{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "402cc027-b7f9-4610-acc9-22f5edb85759",
          "code": "65-29-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=65-29-2",
          "code_system": "CAS",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d",
            "d1a17b04-85f2-46de-9474-f165a12bd249"
          ]
        },
        {
          "uuid": "aac5006d-9d9e-4c65-bc95-d0c19e23336c",
          "code": "C65798",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65798",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "04a3064f-c17a-4396-a6c7-0491016fb316",
          "code": "D005703",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68005703",
          "code_system": "MESH",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "bb9b266b-6077-403a-86df-fd2935b534a2",
          "code": "GALLAMINE TRIETHIODIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Gallamine_triethiodide",
          "code_system": "WIKIPEDIA",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "1e27cf96-99bc-4429-bdde-faffee29392e",
          "code": "1928",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1928",
          "code_system": "INN",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "997e91d6-5881-4d01-af3f-c881a45f4ab9",
          "code": "200-605-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.550",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "e6e1ebc7-e69b-454c-ab78-d1f99c597b7a",
          "code": "GALLAMINE TRIETHIODIDE",
          "comments": "Description: A white or almost white powder; odourless. Solubility: Very soluble in water; sparingly soluble in ethanol (~750 g/l) TS; practically insoluble in ether R. Category: Muscle relaxant. Storage: Gallamine triethiodide should be kept in a tightly closed container, protected from light. Additional information: Gallamine triethiodide is hygroscopic. Definition: Gallamine triethiodide contains not less than 98.0% and not more than 101.0% of C30H60I3N3O3, calculated withreference to the dried substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.189.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "279fc836-1df9-4921-95d8-9db5f20a5292",
          "code": "4639",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/4639/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "92427709-3d46-43f3-9fc0-bbb79f0f3a10",
          "code": "m5643",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5643?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "aefffeef-6b98-4e85-ab2a-f18219855f7c",
          "code": "DB00483",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00483",
          "code_system": "DRUG BANK",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "8f55bab8-5bbf-4080-b81a-ebf91856ca59",
          "code": "SUB07872MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "a9b4df8c-c4ab-4cd8-993b-d7eb9afc5af9",
          "code": "CHEMBL360055",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL360055",
          "code_system": "ChEMBL",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "7433fee1-6876-4dc9-9d7e-27cad9096930",
          "code": "6172",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6172",
          "code_system": "PUBCHEM",
          "references": [
            "3de3b2e6-2f1a-411a-b050-344e21a6b79d"
          ]
        },
        {
          "uuid": "2c5632b9-b149-d492-6447-3c8c4ea90725",
          "code": "3229",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3229",
          "code_system": "HSDB",
          "references": [
            "dff5c69f-4943-caa2-bea6-b4b4ccf43d8d"
          ]
        },
        {
          "uuid": "fbecfb00-ab49-389d-c229-4740af915f44",
          "code": "DTXSID5023089",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023089",
          "code_system": "EPA CompTox",
          "references": [
            "98463884-c7e9-2a60-66dc-8d8e3de19fa5"
          ]
        },
        {
          "uuid": "6fdf7c5d-5fdf-d525-7c42-215b929da147",
          "code": "C29696",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Musculoskeletal System[C78281]|Muscle Relaxant",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29696",
          "code_system": "NCI_THESAURUS",
          "references": [
            "67bdf53e-35c0-b99e-36cf-3ae1954525ab"
          ]
        },
        {
          "uuid": "faf63450-2b36-2d65-69d4-9508ae2e22ab",
          "code": "C66886",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Anticholinergic Agent[C66880]|Nicotinic Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C66886",
          "code_system": "NCI_THESAURUS",
          "references": [
            "67bdf53e-35c0-b99e-36cf-3ae1954525ab"
          ]
        },
        {
          "uuid": "d2beeb5f-cb67-48d4-affe-ef2e2c4b5ef7",
          "code": "Q3254X40X2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e10bdcc2-16e7-e0b8-78a4-cce4958bf442",
          "code": "102690",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=102690",
          "code_system": "NSC",
          "references": [
            "4027733e-ab38-c9c5-95d6-17d9e1d66cd6"
          ]
        },
        {
          "uuid": "7e4272e9-bd09-e816-014a-c2dec6fce341",
          "code": "100000084492",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "41f05455-dfde-7d8e-6da8-24780a808070"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "885e15e8-1cab-478f-8545-b42b84b4f411",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "693653d5-b06d-4e8d-a79c-76c7bf053cf1",
            "refuuid": "208c2b29-9ede-4920-ae0f-0b96a3acdb7e",
            "name": "TRIETHYLGALLAMINE",
            "unii": "VYJ027LZ05",
            "linking_id": "VYJ027LZ05",
            "ref_pname": "TRIETHYLGALLAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "0a6db6f2-72ef-43aa-b15f-5652a6920923",
          "name": "BENZCURINE IODIDE",
          "stdName": "BENZCURINE IODIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a41b259-ba03-40c1-8d0c-f206e9f16d3d"
          ],
          "display_name": false
        },
        {
          "uuid": "d96a23be-381e-4869-bdb3-002ff07a10b8",
          "name": "ETHANAMINIUM, 2,2',2''-(BENZENE-1,2,3-TRIYLTRIS(OXY))TRIS(N,N,N-TRIETHYL-, TRIIODIDE",
          "stdName": "ETHANAMINIUM, 2,2',2''-(BENZENE-1,2,3-TRIYLTRIS(OXY))TRIS(N,N,N-TRIETHYL-, TRIIODIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d2ebd1b-a6e6-435d-a82c-cad551143167"
          ],
          "display_name": false
        },
        {
          "uuid": "a2684ff2-f8f9-4fd7-ac53-c1122dd69ab8",
          "name": "FLAXEDIL",
          "stdName": "FLAXEDIL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "954c4e39-06f0-45af-a25c-8836c3dda0f1"
          ],
          "display_name": false
        },
        {
          "uuid": "6362aff4-b4b3-4c6e-bfa6-d1a207a538e2",
          "name": "GALLAMINE TRIETHIODIDE",
          "stdName": "GALLAMINE TRIETHIODIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2431b526-3fe5-4369-8037-1d88778c4a98",
            "3f90c713-97f8-4a8d-bb3f-20ba3287f94b",
            "2d2ebd1b-a6e6-435d-a82c-cad551143167",
            "575866d3-899b-4d8c-a669-7c40901142ee",
            "93f84eb5-ad72-47a7-ae4f-88422197a578",
            "98d2b286-c2e2-4080-980e-7ec85599b2c4",
            "caece642-44fc-4135-87d5-c191e3542f2d",
            "3b1fe8ec-8ef4-4d3e-99b1-d3bf278b8ea0",
            "ea475be8-a07d-45b4-9ef3-ed4f02cb484c",
            "025819d5-3931-4c13-957b-e0dd9b63f36d",
            "6dd26002-94e4-4f85-a612-02b562452b53",
            "3e4ebb16-1634-44a8-8d02-7f5e50d75ce5",
            "e8b578c6-5345-499b-9154-6851fcbe9559",
            "283021fc-12d6-4f2d-8048-c2fe4bb9d0f9",
            "15f7d4de-b865-412f-80b0-30099e6e27e0",
            "751fab81-c406-427d-bacb-befc665d0906",
            "6dfc450d-c47c-439a-a023-3da079890359",
            "179c640b-36a9-4dfb-bdef-bc44db3687ad",
            "71aaca1f-c583-43df-a852-a46494d14898",
            "e8fe43b3-c9b5-449c-94cd-f8ca58f5e017",
            "0b087c24-2023-4b13-8924-9b38de2ec9b2"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "13c314ef-d054-4d17-9f71-8cbc743301f7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "5951b0f7-ce27-4ca3-b2a7-23c20c1a7166",
          "name": "GALLAMINE TRIETHIODIDE [HSDB]",
          "stdName": "GALLAMINE TRIETHIODIDE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3b1fe8ec-8ef4-4d3e-99b1-d3bf278b8ea0"
          ],
          "display_name": false
        },
        {
          "uuid": "7b69123f-e325-49b2-bce7-4ac68af0db8b",
          "name": "GALLAMINE TRIETHIODIDE [MART.]",
          "stdName": "GALLAMINE TRIETHIODIDE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2431b526-3fe5-4369-8037-1d88778c4a98"
          ],
          "display_name": false
        },
        {
          "uuid": "47848e9d-6323-43d6-a62e-42e9b6fde429",
          "name": "GALLAMINE TRIETHIODIDE [MI]",
          "stdName": "GALLAMINE TRIETHIODIDE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6dfc450d-c47c-439a-a023-3da079890359"
          ],
          "display_name": false
        },
        {
          "uuid": "54b0ce05-e158-48ba-b54e-19dab8bb5c11",
          "name": "GALLAMINE TRIETHIODIDE [ORANGE BOOK]",
          "stdName": "GALLAMINE TRIETHIODIDE [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea475be8-a07d-45b4-9ef3-ed4f02cb484c"
          ],
          "display_name": false
        },
        {
          "uuid": "7e060e4a-0424-67e5-75e3-7f1472ecd3ca",
          "name": "GALLAMINE TRIETHIODIDE [USP IMPURITY]",
          "stdName": "GALLAMINE TRIETHIODIDE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93f84eb5-ad72-47a7-ae4f-88422197a578"
          ],
          "display_name": false
        },
        {
          "uuid": "9a256466-c2db-4e38-8509-44bf932cab24",
          "name": "GALLAMINE TRIETHIODIDE [VANDF]",
          "stdName": "GALLAMINE TRIETHIODIDE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3e4ebb16-1634-44a8-8d02-7f5e50d75ce5"
          ],
          "display_name": false
        },
        {
          "uuid": "61258b26-5c90-4165-99dc-c13825d1dbc1",
          "name": "GALLAMINE TRIETHIODIDE [WHO-IP]",
          "stdName": "GALLAMINE TRIETHIODIDE [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "179c640b-36a9-4dfb-bdef-bc44db3687ad"
          ],
          "display_name": false
        },
        {
          "uuid": "91ee2206-3bbf-47c9-825a-18dbc7997539",
          "name": "GALLAMINI TRIETHIODIDUM [WHO-IP LATIN]",
          "stdName": "GALLAMINI TRIETHIODIDUM [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "179c640b-36a9-4dfb-bdef-bc44db3687ad"
          ],
          "display_name": false
        },
        {
          "uuid": "f856e18b-2134-24d6-0895-0757e2ef60da",
          "name": "Gallamine triethiodide [WHO-DD]",
          "stdName": "GALLAMINE TRIETHIODIDE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bffa4b8d-6fbe-6f00-fddc-2e8f17c63cbc"
          ],
          "display_name": false
        },
        {
          "uuid": "8c909476-042c-4bb7-9f93-94bd19500da5",
          "name": "NSC-102690",
          "stdName": "NSC-102690",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f201dc77-deea-475d-b4c7-466b5d3c66f4"
          ],
          "display_name": false
        },
        {
          "uuid": "4c3c200b-3aab-402e-babe-45e786f62dbd",
          "name": "REMYOLAN",
          "stdName": "REMYOLAN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a41b259-ba03-40c1-8d0c-f206e9f16d3d"
          ],
          "display_name": false
        },
        {
          "uuid": "4903fce4-3a85-4dfb-9dea-0d19a41653fc",
          "name": "SYNCURARINE",
          "stdName": "SYNCURARINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a41b259-ba03-40c1-8d0c-f206e9f16d3d"
          ],
          "display_name": false
        },
        {
          "uuid": "fa04a4b2-f00a-41fb-af13-dc831ba933cd",
          "name": "[v-Phenenyltris(oxyethylene)]tris[triethylammonium] triiodide",
          "stdName": "(V-PHENENYLTRIS(OXYETHYLENE))TRIS(TRIETHYLAMMONIUM) TRIIODIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "954c4e39-06f0-45af-a25c-8836c3dda0f1"
          ],
          "display_name": false
        },
        {
          "uuid": "a5c0f6f6-1127-4ff0-bbd1-4ef132983633",
          "name": "gallamine triethiodide [INN]",
          "stdName": "GALLAMINE TRIETHIODIDE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6dd26002-94e4-4f85-a612-02b562452b53"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "db1713bb-9f0f-4a18-a6f4-87618cee4b61",
          "citation": "SRS import [Q3254X40X2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q3254X40X2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389684000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "15f7d4de-b865-412f-80b0-30099e6e27e0",
          "citation": "GALLAMINE TRIETHIODIDE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71aaca1f-c583-43df-a852-a46494d14898",
          "citation": "GALLAMINE TRIETHIODIDE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "98d2b286-c2e2-4080-980e-7ec85599b2c4",
          "citation": "GALLAMINE TRIETHIODIDE [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "caece642-44fc-4135-87d5-c191e3542f2d",
          "citation": "GALLAMINE TRIETHIODIDE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0b087c24-2023-4b13-8924-9b38de2ec9b2",
          "citation": "GALLAMINE TRIETHIODIDE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8fe43b3-c9b5-449c-94cd-f8ca58f5e017",
          "citation": "GALLAMINE TRIETHIODIDE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3f90c713-97f8-4a8d-bb3f-20ba3287f94b",
          "citation": "GALLAMINE TRIETHIODIDE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "025819d5-3931-4c13-957b-e0dd9b63f36d",
          "citation": "GALLAMINE TRIETHIODIDE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "575866d3-899b-4d8c-a669-7c40901142ee",
          "citation": "GALLAMINE TRIETHIODIDE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "751fab81-c406-427d-bacb-befc665d0906",
          "citation": "GALLAMINE TRIETHIODIDE [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c249c653-71bb-4f1e-99c4-941c9fe44271",
          "citation": "ACD 9.0(USAN 2006)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2d2ebd1b-a6e6-435d-a82c-cad551143167",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "954c4e39-06f0-45af-a25c-8836c3dda0f1",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dd26002-94e4-4f85-a612-02b562452b53",
          "citation": "INN Proposed List 1",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL01.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93f84eb5-ad72-47a7-ae4f-88422197a578",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea475be8-a07d-45b4-9ef3-ed4f02cb484c",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2431b526-3fe5-4369-8037-1d88778c4a98",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dfc450d-c47c-439a-a023-3da079890359",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b1fe8ec-8ef4-4d3e-99b1-d3bf278b8ea0",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "283021fc-12d6-4f2d-8048-c2fe4bb9d0f9",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e8b578c6-5345-499b-9154-6851fcbe9559",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e4ebb16-1634-44a8-8d02-7f5e50d75ce5",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "179c640b-36a9-4dfb-bdef-bc44db3687ad",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a41b259-ba03-40c1-8d0c-f206e9f16d3d",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f201dc77-deea-475d-b4c7-466b5d3c66f4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3de3b2e6-2f1a-411a-b050-344e21a6b79d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389684000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dff5c69f-4943-caa2-bea6-b4b4ccf43d8d",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+65-29-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "98463884-c7e9-2a60-66dc-8d8e3de19fa5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=65-29-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "67bdf53e-35c0-b99e-36cf-3ae1954525ab",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "d1a17b04-85f2-46de-9474-f165a12bd249",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4027733e-ab38-c9c5-95d6-17d9e1d66cd6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "bffa4b8d-6fbe-6f00-fddc-2e8f17c63cbc",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "41f05455-dfde-7d8e-6da8-24780a808070",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4f670888-33b2-460d-9427-8d16d40d0590",
          "id": "4f670888-33b2-460d-9427-8d16d40d0590",
          "molfile": "\n  Marvin  01132104082D          \n\n  1  0  0  0  0  0            999 V2000\n    6.7281   -2.1211    0.0000 I   0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "I",
          "formula": "HI",
          "atropisomerism": "No",
          "charge": 0,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "b574049e-661a-4c07-9b05-256fc49c0e5b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "127.9124",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "1b5f19ea-419f-4793-b4c2-d1db69ff1914",
          "id": "1b5f19ea-419f-4793-b4c2-d1db69ff1914",
          "molfile": "\n  Marvin  01132101362D          \n\n 36 36  0  0  0  0            999 V2000\n    4.4659   -3.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2270   -3.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6715   -4.6389    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    6.1266   -5.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0315   -5.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4273   -4.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4273   -3.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9290   -5.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2157   -4.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4838   -4.9902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7865   -4.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0786   -4.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3467   -4.5883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3467   -3.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0706   -3.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0626   -2.5204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3467   -2.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3307   -1.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6148   -0.8357    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    0.8197   -0.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4478   -0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0612   -0.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0612   -0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2422   -1.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3620   -1.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7865   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4838   -3.3135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4918   -2.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2077   -2.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1944   -1.2482    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n    4.9503   -1.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4027   -1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2077   -0.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7666   -0.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4013   -1.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1086   -0.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  6  3  1  0  0  0  0\n  3  8  1  0  0  0  0\n  5  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 26  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 15  1  0  0  0  0\n 15 26  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 22 19  1  0  0  0  0\n 24 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\n 30 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 33 30  1  0  0  0  0\n 30 35  1  0  0  0  0\n 32 31  1  0  0  0  0\n 34 33  1  0  0  0  0\n 35 36  1  0  0  0  0\nM  CHG  3   3   1  19   1  30   1\nM  END",
          "smiles": "CC[N+](CC)(CC)CCOc1cccc(c1OCC[N+](CC)(CC)CC)OCC[N+](CC)(CC)CC",
          "formula": "C30H60N3O3",
          "atropisomerism": "No",
          "charge": 3,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d5ce3e39-4794-4ed9-8fee-521a44d40e9b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "510.8168",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b7a79a33-161a-4c3c-ac61-05656dc53859",
      "version": "13",
      "structure": {
        "id": "39dd7d5a-e323-4b68-a329-2f0a101aa725",
        "molfile": "\n  Marvin  01132103042D          \n\n 39 36  0  0  0  0            999 V2000\n    6.7281   -2.1211    0.0000 I   0  5  0  0  0  0  0  0  0  0  0  0\n    4.9503   -1.2508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4027   -1.8550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1944   -1.2482    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.7865   -3.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6148   -0.8357    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    5.6715   -4.6389    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    2.7865   -4.5643    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0706   -3.3135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4838   -3.3135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4838   -4.9902    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0626   -2.5204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4918   -2.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2157   -4.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3467   -2.1052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9290   -5.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3307   -1.2455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2077   -2.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2077   -0.4285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2270   -3.9522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4273   -4.0827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1266   -5.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8197   -0.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0612   -0.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2422   -1.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3467   -4.5883    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0786   -4.9982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3467   -3.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4659   -3.9336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4478   -0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0612   -0.0107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0315   -5.2909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3620   -1.5197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4273   -3.3294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7666   -0.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4013   -1.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1086   -0.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7281   -2.1211    0.0000 I   0  5  0  0  0  0  0  0  0  0  0  0\n    6.7281   -2.1211    0.0000 I   0  5  0  0  0  0  0  0  0  0  0  0\n  4 18  1  0  0  0  0\n  6 17  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  5  2  0  0  0  0\n  9  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  8  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13 10  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 12  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 13  1  0  0  0  0\n 19  4  1  0  0  0  0\n 20  7  1  0  0  0  0\n 21  7  1  0  0  0  0\n 22  7  1  0  0  0  0\n 23  6  1  0  0  0  0\n 24  6  1  0  0  0  0\n 25  6  1  0  0  0  0\n 26 28  1  0  0  0  0\n 27  8  1  0  0  0  0\n 28  9  2  0  0  0  0\n 29 20  1  0  0  0  0\n 30 23  1  0  0  0  0\n 31 24  1  0  0  0  0\n 32 22  1  0  0  0  0\n 33 25  1  0  0  0  0\n 34 21  1  0  0  0  0\n 35 19  1  0  0  0  0\n 27 26  2  0  0  0  0\n  4 36  1  0  0  0  0\n  3  2  1  0  0  0  0\n 36 37  1  0  0  0  0\n  2  4  1  0  0  0  0\nM  CHG  6   1  -1   4   1   6   1   7   1  38  -1  39  -1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  3   1  38  39\nM  SPA   1  1   1\nM  SDI   1  4    6.3081   -2.5411    6.3081   -1.7011\nM  SDI   1  4    7.1481   -1.7011    7.1481   -2.5411\nM  SMT   1 3\nM  END",
        "smiles": "CC[N+](CC)(CC)CCOc1cccc(c1OCC[N+](CC)(CC)CC)OCC[N+](CC)(CC)CC.[I-].[I-].[I-]",
        "formula": "C30H60N3O3.3I",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "891.5303",
        "optical_activity": "NONE",
        "references": [
          "db1713bb-9f0f-4a18-a6f4-87618cee4b61",
          "2d2ebd1b-a6e6-435d-a82c-cad551143167",
          "6dd26002-94e4-4f85-a612-02b562452b53"
        ],
        "stereo_centers": 0
      },
      "unii": "Q3254X40X2"
    }
  ]
}