{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "3a153bf0-0863-42ff-bf6c-bb865e117430", "code": "202197-26-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=202197-26-0", "code_system": "CAS" }, { "uuid": "94e4e43f-47e8-44b8-8ef5-07f16f6de684", "code": "Q2X82DMR4T", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d541976e-f22a-f6c5-71f1-dadf7bde27eb", "code": "7059263", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7059263", "code_system": "PUBCHEM", "references": [ "71d1fb88-306e-2173-89ef-48fddeb97d5d" ] }, { "uuid": "32a3dd97-8f96-cdf9-6a04-237e467e30b0", "code": "DTXSID10427603", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10427603", "code_system": "EPA CompTox", "references": [ "62c62bd6-1e2b-6d17-c5f1-dac03e2261d0" ] } ], "substance_class": "chemical", "names": [ { "uuid": "00d10ed3-2e22-42aa-8746-8184fac81588", "name": "3-Chloro-4-[(3-fluorophenyl)methoxy]benzenamine", "stdName": "3-CHLORO-4-((3-FLUOROPHENYL)METHOXY)BENZENAMINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e7079879-9b69-4857-ad28-32dd1c3abf4b" ], "display_name": true }, { "uuid": "7e1ca247-b4f5-4bbc-ae0d-86724c81e5a5", "name": "Benzenamine, 3-chloro-4-[(3-fluorophenyl)methoxy]-", "stdName": "BENZENAMINE, 3-CHLORO-4-((3-FLUOROPHENYL)METHOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e7079879-9b69-4857-ad28-32dd1c3abf4b" ], "display_name": false } ], "references": [ { "uuid": "71d1fb88-306e-2173-89ef-48fddeb97d5d", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "e7079879-9b69-4857-ad28-32dd1c3abf4b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "62c62bd6-1e2b-6d17-c5f1-dac03e2261d0", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "9177bf0e-da08-4679-9289-c8c671d6d7a3", "id": "9177bf0e-da08-4679-9289-c8c671d6d7a3", "molfile": "\n Marvin 01202313552D \n\n 17 18 0 0 0 0 999 V2000\n 11.5238 -3.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8094 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8094 -5.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5238 -5.5138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2383 -5.1012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2383 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0949 -5.5138 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9528 -3.8638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6672 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9528 -5.5138 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -3.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0962 -4.2762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8106 -3.8638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.8106 -3.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0962 -2.6262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3817 -3.0388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.5251 -4.2762 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 6 1 2 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 3 7 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 5 10 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 16 11 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 17 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\nM END", "smiles": "c1cc(cc(c1)F)COc2ccc(cc2Cl)N", "formula": "C13H11ClFNO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "6cefbc3f-0677-43c8-8fad-2c01dd72e0dc" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "251.6844", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "bfa83f89-e0f3-43ca-8f3b-b8cd0e8337e5", "version": "7", "structure": { "id": "7a38cf57-a80c-463d-9eb4-9505c3ae6a41", "molfile": "\n JSDraw201202313552D\n\n 17 18 0 0 0 0 0 V2000\n 21.7904 -7.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4395 -9.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7904 -10.4261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1415 -9.6459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1415 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0885 -10.4261 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4926 -7.3061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8434 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4926 -10.4261 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1945 -7.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5456 -8.0859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8965 -7.3061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.8965 -5.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 28.5456 -4.9659 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1945 -5.7461 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.2475 -8.0859 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 1 2 0 0 0 0\n 3 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 5 10 1 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 11 2 0 0 0 0\n 13 17 1 0 0 0 0\nM END", "smiles": "c1cc(cc(c1)F)COc2ccc(cc2Cl)N", "formula": "C13H11ClFNO", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "251.6844", "optical_activity": "NONE", "references": [ "e7079879-9b69-4857-ad28-32dd1c3abf4b" ], "stereo_centers": 0 }, "unii": "Q2X82DMR4T" } ] }