{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "f727a6e4-1929-4dbe-915f-216b7dce95d7",
          "code": "335-27-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=335-27-3",
          "code_system": "CAS",
          "references": [
            "8c8aed52-123e-4611-bc42-a036f5ee1582",
            "c95fc16a-2af2-4723-927a-88edb4f9c68d"
          ]
        },
        {
          "uuid": "f48c34b2-63b9-4313-89f3-d0d462d8ac63",
          "code": "206-386-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.807",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8c8aed52-123e-4611-bc42-a036f5ee1582"
          ]
        },
        {
          "uuid": "c8a429f1-a0b7-445e-a22f-daad9ce040a2",
          "code": "78975",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/78975",
          "code_system": "PUBCHEM",
          "references": [
            "8c8aed52-123e-4611-bc42-a036f5ee1582"
          ]
        },
        {
          "uuid": "caba1055-add6-bf18-b38b-e98d36feb8ab",
          "code": "DTXSID0036926",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0036926",
          "code_system": "EPA CompTox",
          "references": [
            "03a786f7-0de9-35b0-77c0-ed2c83420e36"
          ]
        },
        {
          "uuid": "08b056bc-9050-c131-4a81-044a36a6f0f0",
          "code": "1876640",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1876640/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "eea5e9f7-fcee-4461-a5fc-9d829ce29d20",
          "code": "Q1Y54IOL0P",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "cf9a53ad-a65a-c81d-7c33-c27e305f2379",
          "code": "Perfluoro-1,3-dimethylcyclohexane",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Perfluoro-1,3-dimethylcyclohexane",
          "code_system": "WIKIPEDIA",
          "references": [
            "9a1a8bc4-7d74-5a5a-c31d-86065d2bb254"
          ]
        },
        {
          "uuid": "cc1e7c92-f54e-cd62-f61b-216f60da7d68",
          "code": "Q1Y54IOL0P",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q1Y54IOL0P",
          "code_system": "DAILYMED",
          "references": [
            "8cc90e79-e46e-0cc8-d300-37034579fe28"
          ]
        },
        {
          "uuid": "2d023720-7cab-6605-bdc7-da2ae4044e79",
          "code": "4782",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4782",
          "code_system": "NSC",
          "references": [
            "a6e7b9eb-78c9-d47d-95a7-0f942fbea6e8"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "9ab52e61-4681-411f-ae5b-7996ed836947",
          "name": "1,1,2,2,3,3,4,5,5,6-DECAFLUORO-4,6-BIS(TRIFLUOROMETHYL)CYCLOHEXANE",
          "stdName": "1,1,2,2,3,3,4,5,5,6-DECAFLUORO-4,6-BIS(TRIFLUOROMETHYL)CYCLOHEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b456459-116a-48d0-bcb6-015777282cd4",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "25bd3eb2-a2ef-497e-841f-32460b86e463",
          "name": "CYCLOHEXANE, 1,1,2,2,3,3,4,5,5,6-DECAFLUORO-4,6-BIS(TRIFLUOROMETHYL)-",
          "stdName": "CYCLOHEXANE, 1,1,2,2,3,3,4,5,5,6-DECAFLUORO-4,6-BIS(TRIFLUOROMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eb770c3-3d1e-40fe-a009-deb63ddd70d9",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "d497fc44-ba7c-4e26-a146-e5671ca79227",
          "name": "CYCLOHEXANE, DECAFLUORO-1,3-BIS(TRIFLUOROMETHYL)-",
          "stdName": "CYCLOHEXANE, DECAFLUORO-1,3-BIS(TRIFLUOROMETHYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eb770c3-3d1e-40fe-a009-deb63ddd70d9",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "b947a192-0de9-4056-b8fd-e856833e12fd",
          "name": "DECAFLUORO-1,3-BIS(TRIFLUOROMETHYL)CYCLOHEXANE",
          "stdName": "DECAFLUORO-1,3-BIS(TRIFLUOROMETHYL)CYCLOHEXANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eb770c3-3d1e-40fe-a009-deb63ddd70d9",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "c4b3d79c-c686-4ce3-b527-190a08645a26",
          "name": "FIFLOW 100",
          "stdName": "FIFLOW 100",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e447ca18-28c3-4d73-9333-20b4b26ebbfc",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "ee06ff90-fb13-4ec1-b899-969b2b349526",
          "name": "FLUTEC PC-3",
          "stdName": "FLUTEC PC-3",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e447ca18-28c3-4d73-9333-20b4b26ebbfc",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "7cf85658-7885-4afe-b6e6-a4cc3fa23564",
          "name": "FLUTEC PC3",
          "stdName": "FLUTEC PC3",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b456459-116a-48d0-bcb6-015777282cd4",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "e84e2f6b-8f4c-48e9-bef2-b274a4bf0417",
          "name": "NSC-4782",
          "stdName": "NSC-4782",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eb770c3-3d1e-40fe-a009-deb63ddd70d9",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "c872f829-558f-4679-9950-4c6c485af7aa",
          "name": "PERFLUORO(1,3-DIMETHYLCYCLOHEXANE)",
          "stdName": "PERFLUORO(1,3-DIMETHYLCYCLOHEXANE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8eb770c3-3d1e-40fe-a009-deb63ddd70d9",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": false
        },
        {
          "uuid": "af64a5fe-15b7-4462-bc7c-5e707b0c845e",
          "name": "PERFLUORODIMETHYLCYCLOHEXANE",
          "stdName": "PERFLUORODIMETHYLCYCLOHEXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5abdc752-591e-43d8-9962-95791f2297d3",
            "e447ca18-28c3-4d73-9333-20b4b26ebbfc",
            "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f4fc244c-c30a-4b63-896e-ed7e8632f35b",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "e447ca18-28c3-4d73-9333-20b4b26ebbfc",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a53e2c51-70a7-4dff-b7bc-c7b4e1e8df6f",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b456459-116a-48d0-bcb6-015777282cd4",
          "citation": "http://f2chemicals.com/data/cosmetics/pc3.pdf",
          "url": "http://f2chemicals.com/data/cosmetics/pc3.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8eb770c3-3d1e-40fe-a009-deb63ddd70d9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c8aed52-123e-4611-bc42-a036f5ee1582",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23abe200-4478-4d84-9cb8-9872872eb556",
          "citation": "SRS import [Q1Y54IOL0P]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q1Y54IOL0P",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5abdc752-591e-43d8-9962-95791f2297d3",
          "citation": "PERFLUORODIMETHYLCYCLOHEXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "03a786f7-0de9-35b0-77c0-ed2c83420e36",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=335-27-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9a1a8bc4-7d74-5a5a-c31d-86065d2bb254",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "c95fc16a-2af2-4723-927a-88edb4f9c68d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a6e7b9eb-78c9-d47d-95a7-0f942fbea6e8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8cc90e79-e46e-0cc8-d300-37034579fe28",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b9d97a12-d472-429e-9119-7d889ad35202",
          "id": "b9d97a12-d472-429e-9119-7d889ad35202",
          "molfile": "\n  Marvin  01132109372D          \n\n 24 24  0  0  0  0            999 V2000\n    7.7074   -2.0049    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5199   -2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0501   -1.5162    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2377   -1.3730    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9855   -3.4273    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    8.1730   -3.5706    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9855   -4.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7033   -5.0276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1730   -4.1090    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7000   -4.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2303   -5.2968    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1697   -5.2968    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4144   -4.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2269   -4.1090    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6966   -5.0276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4144   -3.4273    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   11.2269   -3.5706    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8800   -2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3497   -1.5162    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1621   -1.3730    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6924   -2.0049    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7000   -3.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2303   -2.3829    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1697   -2.3829    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 22  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\n 16 22  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  1  0  0  0  0\nM  END",
          "smiles": "C1(C(C(C(C(C1(F)F)(F)F)(F)F)(C(F)(F)F)F)(F)F)(C(F)(F)F)F",
          "formula": "C8F16",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "01dce058-5b37-48a7-9472-e8a10dc5f2fd"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "400.0603",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "514f0a91-9d73-42c5-bd89-3637df390cc2",
      "version": "8",
      "structure": {
        "id": "dfe1037f-fe59-4e8f-8a71-cd6fad6f9d39",
        "molfile": "\n  Marvin  01132111362D          \n\n 24 24  0  0  0  0            999 V2000\n   10.2303   -2.3829    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7000   -3.0149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4144   -3.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4144   -4.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7000   -4.6648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9855   -4.2523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9855   -3.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5199   -2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7033   -5.0276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1730   -4.1090    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2303   -5.2968    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1697   -5.2968    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2269   -4.1090    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6966   -5.0276    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8800   -2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2269   -3.5706    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1697   -2.3829    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1730   -3.5706    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7074   -2.0049    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0501   -1.5162    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2377   -1.3730    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3497   -1.5162    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1621   -1.3730    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6924   -2.0049    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  7  1  0  0  0  0\n  6  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  5 11  1  0  0  0  0\n  5 12  1  0  0  0  0\n  4 13  1  0  0  0  0\n  4 14  1  0  0  0  0\n  3 15  1  0  0  0  0\n  3 16  1  0  0  0  0\n  2 17  1  0  0  0  0\n  7 18  1  0  0  0  0\n  8 19  1  0  0  0  0\n  8 20  1  0  0  0  0\n  8 21  1  0  0  0  0\n 15 22  1  0  0  0  0\n 15 23  1  0  0  0  0\n 15 24  1  0  0  0  0\nM  END",
        "smiles": "C1(C(C(C(C(C1(F)F)(F)F)(F)F)(C(F)(F)F)F)(F)F)(C(F)(F)F)F",
        "formula": "C8F16",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "400.0603",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8eb770c3-3d1e-40fe-a009-deb63ddd70d9",
          "23abe200-4478-4d84-9cb8-9872872eb556"
        ],
        "stereo_centers": 2
      },
      "unii": "Q1Y54IOL0P"
    }
  ]
}