{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "98d07637-a5b8-4d8a-a72f-b9a8ad2ff945",
          "code": "633-96-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=633-96-5",
          "code_system": "CAS",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa",
            "9d16199e-b01a-4b70-b814-5d349a549c58"
          ]
        },
        {
          "uuid": "0ccf75a1-77fa-4416-ae27-eef1eb79fe02",
          "code": "C71653",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71653",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa"
          ]
        },
        {
          "uuid": "7cb516ab-881d-438a-9486-803dba2c5f32",
          "code": "ACID ORANGE 7",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Acid_orange_7",
          "code_system": "WIKIPEDIA",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa"
          ]
        },
        {
          "uuid": "8a0767ee-a516-4430-9ffc-41aefb9b0821",
          "code": "211-199-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.182",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa"
          ]
        },
        {
          "uuid": "badac4f1-fe86-4781-b2e4-58816fc64cac",
          "code": "21 CFR 74.1254",
          "comments": "PART 74 -- LISTING OF COLOR ADDITIVES SUBJECT TO CERTIFICATION|Subpart B--Drugs|Sec. 74.1254 D&C Orange No. 4.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=74.1254",
          "code_system": "CFR",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa"
          ]
        },
        {
          "uuid": "acef8659-d5cc-48f0-a7f7-0279a755c6ff",
          "code": "21 CFR 74.2254",
          "comments": "PART 74 -- LISTING OF COLOR ADDITIVES SUBJECT TO CERTIFICATION|Subpart C--Cosmetics|Sec. 74.2254 D&C Orange No. 4.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=74.2254",
          "code_system": "CFR",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa"
          ]
        },
        {
          "uuid": "78ef75f0-2055-48bc-bf02-d09d9b49b729",
          "code": "1426468",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426468/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa"
          ]
        },
        {
          "uuid": "14b27712-94e4-47d4-b883-75735cb1dd1c",
          "code": "m8223",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8223?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9310fc73-a46d-4c19-84a9-2a6717cf3dfa"
          ]
        },
        {
          "uuid": "13a9090e-cc4c-8ac3-ff2e-ce5024427eaa",
          "code": "DTXSID0038881",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0038881",
          "code_system": "EPA CompTox",
          "references": [
            "7216812d-a87d-302e-89f8-fb1875e35aab"
          ]
        },
        {
          "uuid": "23e9b4b5-e243-8d60-7df7-51a42a168505",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "79187b39-a25c-92f6-1632-bf1fa57b7bb7"
          ]
        },
        {
          "uuid": "0cc2731b-099c-402c-87d6-b37f61c87586",
          "code": "Q1LIY3BO0U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e1f7103d-daf5-02eb-b4a2-e47c01870c99",
          "code": "101008",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=101008",
          "code_system": "NSC",
          "references": [
            "d3be9e11-4c87-bd04-d347-73c277b1b2e2"
          ]
        },
        {
          "uuid": "b49e3d71-208e-a085-8155-6cd4ba1e8694",
          "code": "9853",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=9853",
          "code_system": "NSC",
          "references": [
            "d3be9e11-4c87-bd04-d347-73c277b1b2e2"
          ]
        },
        {
          "uuid": "1f13fd26-d2fe-7ff5-dd0a-23a8015d0436",
          "code": "Q1LIY3BO0U",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q1LIY3BO0U",
          "code_system": "DAILYMED",
          "references": [
            "7aeff608-37c3-b877-bf84-2fdbb5cb37a3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "265b79c2-0e2b-4d36-b535-ff8eee098dfd",
          "name": "ACID ORANGE 7",
          "stdName": "ACID ORANGE 7",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "cd70dc2f-7d9a-4422-9e7e-3e523eec1eb3",
            "e4e71f30-0d85-4acf-8af4-f2d5c5fccff1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6be0143a-2648-4259-8ff6-24cdc44725d2",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "326a1b4b-76c0-4407-a3b5-4b540f521115",
          "name": "C.I. ACID ORANGE 7",
          "stdName": "C.I. ACID ORANGE 7",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "c3003df0-f66a-4b5a-8e3a-74a4aed5ad03"
          ],
          "display_name": false
        },
        {
          "uuid": "349321fc-e289-43b6-8a29-0eb4d25973b2",
          "name": "C.I. NO.15510 (D&C ORANGE NO.4)",
          "stdName": "C.I. NO.15510 (D&C ORANGE NO.4)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "dd24a610-ee0a-4734-8a60-ab81937e3112"
          ],
          "display_name": false
        },
        {
          "uuid": "0d2d130d-7262-4292-94bc-7ba249bb7a04",
          "name": "CI 15510",
          "stdName": "CI 15510",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "9400c624-5425-4dcb-a895-5e77e2cd5d71",
            "e4e71f30-0d85-4acf-8af4-f2d5c5fccff1",
            "b65a58f4-b0f1-4bd4-badb-7a0d33e0179c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "5c9085d8-b5bb-4852-9b06-02b359193c8c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e7a0e58f-7f39-4c8f-8be1-6f13986572a8",
          "name": "D&C ORANGE NO. 4",
          "stdName": "D&C ORANGE NO. 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1569da18-dc71-4c54-bd54-116e83bc1fd3"
          ],
          "display_name": true
        },
        {
          "uuid": "273bc873-32e4-4264-82b9-8e040d6fe2ef",
          "name": "DAIDAI205",
          "stdName": "DAIDAI205",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "69ceb356-2d7a-450b-aaf3-bb3d917b1e1c",
            "548d3e20-af2e-4447-8b2a-362cf660c25f"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f63f65c7-96f2-4390-89e0-cfa05feb1f3c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f3d8c1a1-8970-46c4-98f3-c000118fa497",
          "name": "DC ORANGE NO. 4",
          "stdName": "DC ORANGE NO. 4",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "d0fe2a53-af13-4842-83b5-ba731dcec081"
          ],
          "display_name": false
        },
        {
          "uuid": "c9a0677d-7b50-4d3a-8aa5-dca23a1244f0",
          "name": "NSC-101008",
          "stdName": "NSC-101008",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "e29e95d8-9e91-4721-a7d5-9323c488f627"
          ],
          "display_name": false
        },
        {
          "uuid": "801eb336-2ee9-4030-9e4e-34a8b0ba5a9a",
          "name": "NSC-9853",
          "stdName": "NSC-9853",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "e29e95d8-9e91-4721-a7d5-9323c488f627"
          ],
          "display_name": false
        },
        {
          "uuid": "d10a0611-b420-4058-85dc-a204fca1190a",
          "name": "ORANGE 4",
          "stdName": "ORANGE 4",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "61f84706-be8a-49d1-92f8-1d0dc05adf4d",
            "9400c624-5425-4dcb-a895-5e77e2cd5d71",
            "e4e71f30-0d85-4acf-8af4-f2d5c5fccff1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "62ad5a92-d727-443d-9c8f-2a067cd810ed",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "eac0738d-fb78-47aa-90f9-365d93aefd72",
          "name": "ORANGE II [MI]",
          "stdName": "ORANGE II [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
            "7b024ad5-72af-49b8-b299-af734a6777fb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1569da18-dc71-4c54-bd54-116e83bc1fd3",
          "citation": "21CFR74.1254",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "81edda2e-14f9-4824-9da8-06aa5656fe2c",
          "citation": "ACD 8.0(21CFR74.1254",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee861b37-0adb-4bbe-8e82-f3497c48f396",
          "citation": "CTFA 2004",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9400c624-5425-4dcb-a895-5e77e2cd5d71",
          "citation": "CTFA 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7476d3f-8d0c-4e25-9429-3f14792a26a1",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b024ad5-72af-49b8-b299-af734a6777fb",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4e71f30-0d85-4acf-8af4-f2d5c5fccff1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0fe2a53-af13-4842-83b5-ba731dcec081",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69ceb356-2d7a-450b-aaf3-bb3d917b1e1c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dd24a610-ee0a-4734-8a60-ab81937e3112",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e29e95d8-9e91-4721-a7d5-9323c488f627",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c3003df0-f66a-4b5a-8e3a-74a4aed5ad03",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9310fc73-a46d-4c19-84a9-2a6717cf3dfa",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4cb8082b-0511-4e00-89ba-093b02c1a567",
          "citation": "SRS import [Q1LIY3BO0U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q1LIY3BO0U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389938000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "002a6df8-e5ce-4d10-b38e-6dedcde6fbf2",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61f84706-be8a-49d1-92f8-1d0dc05adf4d",
          "citation": "ORANGE 4 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b65a58f4-b0f1-4bd4-badb-7a0d33e0179c",
          "citation": "CI 15510 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cd70dc2f-7d9a-4422-9e7e-3e523eec1eb3",
          "citation": "ACID ORANGE 7 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "548d3e20-af2e-4447-8b2a-362cf660c25f",
          "citation": "DAIDAI205 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7216812d-a87d-302e-89f8-fb1875e35aab",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=633-96-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "79187b39-a25c-92f6-1632-bf1fa57b7bb7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9d16199e-b01a-4b70-b814-5d349a549c58",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7aeff608-37c3-b877-bf84-2fdbb5cb37a3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d3be9e11-4c87-bd04-d347-73c277b1b2e2",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a63c78be-aa33-449b-887d-569398ed4baf",
          "id": "a63c78be-aa33-449b-887d-569398ed4baf",
          "molfile": "\n  Marvin  01132108382D          \n\n  1  0  0  0  0  0            999 V2000\n    6.1323   -5.0155    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ce689b3e-6d97-4e9e-9b25-a8246bdbeee6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "c01209b8-2a11-483d-b41d-92a595360f80",
          "id": "c01209b8-2a11-483d-b41d-92a595360f80",
          "molfile": "\n  Marvin  01132109562D          \n\n 23 25  0  0  0  0            999 V2000\n    4.9112   -1.2933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0853   -1.2918    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0737   -0.4691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2561   -1.2935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0903   -2.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8070   -2.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8096   -3.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0940   -3.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3808   -3.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3748   -2.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0969   -4.5927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5137   -5.1788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5183   -6.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2325   -6.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9455   -5.9982    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.2364   -7.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5222   -7.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8086   -7.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0935   -7.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3804   -7.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3811   -6.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0922   -6.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8087   -6.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 11  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 13 23  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 14  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 23 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\nM  CHG  1  15  -1\nM  END",
          "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc(cc3)S(=O)(=O)O)[O-]",
          "formula": "C16H11N2O4S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "07be1177-5883-431e-9c92-8f466210a877"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "327.3362",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "308ab010-6e99-4368-bc6e-573c5259edcc",
      "version": "11",
      "structure": {
        "id": "7765e4d4-0c5f-4eb8-b148-2659d235186b",
        "molfile": "\n  Marvin  01132106122D          \n\n 24 25  0  0  0  0            999 V2000\n    1.3811   -6.4210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3804   -7.2479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0935   -7.6622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0922   -6.0096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8087   -6.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8086   -7.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5222   -7.6548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2364   -7.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2325   -6.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5183   -6.0057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5137   -5.1788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9455   -5.9982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0969   -4.5927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0940   -3.7674    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8096   -3.3542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8070   -2.5297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0903   -2.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3748   -2.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3808   -3.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0853   -1.2918    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9112   -1.2933    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.0737   -0.4691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2561   -1.2935    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1323   -5.0155    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  4  1  1  0  0  0  0\n 10 11  1  0  0  0  0\n  1  2  2  0  0  0  0\n  9 12  1  0  0  0  0\n 11 13  2  0  0  0  0\n  5  6  1  0  0  0  0\n 13 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n 14 15  2  0  0  0  0\n  6  7  1  0  0  0  0\n 15 16  1  0  0  0  0\n  3  6  2  0  0  0  0\n 16 17  2  0  0  0  0\n  7  8  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 14  1  0  0  0  0\n  8  9  1  0  0  0  0\n 17 20  1  0  0  0  0\n  5  4  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10  5  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 20 23  2  0  0  0  0\nM  CHG  2  21  -1  24   1\nM  END",
        "smiles": "c1ccc2c(c1)ccc(c2/N=N/c3ccc(cc3)S(=O)(=O)[O-])O.[Na+]",
        "formula": "C16H11N2O4S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "350.326",
        "optical_activity": "NONE",
        "references": [
          "002a6df8-e5ce-4d10-b38e-6dedcde6fbf2",
          "4cb8082b-0511-4e00-89ba-093b02c1a567"
        ],
        "stereo_centers": 0
      },
      "unii": "Q1LIY3BO0U"
    }
  ]
}