{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "4d7b374e-fb1b-44bb-90eb-df13705d41e6",
          "code": "45293-08-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=45293-08-1",
          "code_system": "CAS",
          "references": [
            "810704c8-a189-4236-9a0b-a4f570fb2bdb"
          ]
        },
        {
          "uuid": "4005780b-508f-4ffd-b8f6-75abbb67cd9b",
          "code": "Q1I8G0B3LW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c32973bb-63f5-4a48-3523-8fcaf439adbe",
          "code": "154926046",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/154926046",
          "code_system": "PUBCHEM",
          "references": [
            "b912757e-0c13-c6b0-ab34-04bd345b09c6"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "810704c8-a189-4236-9a0b-a4f570fb2bdb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43e021dd-87a3-484c-b4cb-39c75e52ee40",
          "citation": "PCPC-DB",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd5804a3-1f2c-4883-996f-54645d832c8b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b912757e-0c13-c6b0-ab34-04bd345b09c6",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "68352189-50ec-40ef-83e1-a1c00b5b3792",
          "id": "68352189-50ec-40ef-83e1-a1c00b5b3792",
          "molfile": "\n  Marvin  01132105252D          \n\n 26 25  0  0  0  0            999 V2000\n   12.5956   -5.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3101   -4.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0246   -5.1569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7390   -4.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4535   -5.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1679   -4.7442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8824   -5.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5968   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5967   -3.9190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3114   -5.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0258   -4.7440    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4383   -5.4583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6132   -4.0296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7402   -4.3314    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.1678   -3.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8823   -3.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8822   -2.6817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3100   -3.9195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8811   -4.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1667   -5.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4522   -4.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7378   -5.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0233   -4.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3088   -5.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5943   -4.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8799   -5.1575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 19  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 18  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 15  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  CHG  1  14  -1\nM  END",
          "smiles": "CCCCCCCCCC(=O)NCCN(CCO)CC(CS(=O)(=O)[O-])O",
          "formula": "C17H35N2O6S",
          "atropisomerism": "No",
          "charge": -1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c98cc9fd-fc71-43fa-9f17-dfc5258d882d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "395.5364",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        },
        {
          "uuid": "c97bdfc7-5b2d-4037-afc8-f75b8920a869",
          "id": "c97bdfc7-5b2d-4037-afc8-f75b8920a869",
          "molfile": "\n  Marvin  01132110242D          \n\n  1  0  0  0  0  0            999 V2000\n   21.2301   -4.9088    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "caa483dd-9f38-48d6-a90d-958b8befb4a0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f0f4e232-2a62-4b50-9af4-65df5a7f67d2",
      "version": "7",
      "structure": {
        "id": "103e4a18-84c1-4593-b8f6-392095c7805d",
        "molfile": "\n  Marvin  01132101042D          \n\n 27 25  0  0  0  0            999 V2000\n   12.5956   -5.1570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3101   -4.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0246   -5.1569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7390   -4.7443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4535   -5.1567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.1679   -4.7442    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8824   -5.1566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5968   -4.7440    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5967   -3.9190    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3114   -5.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0258   -4.7440    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4383   -5.4583    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.6132   -4.0296    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.7402   -4.3314    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.1678   -3.9192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8823   -3.5066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8822   -2.6817    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3100   -3.9195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8811   -4.7445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1667   -5.1571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4522   -4.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7378   -5.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0233   -4.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3088   -5.1573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5943   -4.7449    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8799   -5.1575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2301   -4.9088    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n  6 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  2 18  2  0  0  0  0\n  1 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  CHG  2  14  -1  27   1\nM  END",
        "smiles": "CCCCCCCCCC(=O)NCCN(CCO)CC(CS(=O)(=O)[O-])O.[Na+]",
        "formula": "C17H35N2O6S.Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "418.5261",
        "optical_activity": "( + / - )",
        "references": [
          "810704c8-a189-4236-9a0b-a4f570fb2bdb"
        ],
        "stereo_centers": 1
      },
      "unii": "Q1I8G0B3LW",
      "relationships": [
        {
          "uuid": "a0cbc6c0-7c5c-474a-95ef-3101f3a5acc2",
          "amount": {
            "uuid": "00d53ec5-8502-467a-9594-d2ea4b0a42b9"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "dd5804a3-1f2c-4883-996f-54645d832c8b"
          ],
          "related_substance": {
            "uuid": "a0a1052a-06a5-45cd-a458-dce775c34ee1",
            "refuuid": "ea566bf2-f0d3-4ebd-90df-b28a80af3fae",
            "name": "CAPROAMPHOHYDROXYPROPYLSULFONIC ACID",
            "unii": "FS2NLH8NXQ",
            "linking_id": "FS2NLH8NXQ",
            "ref_pname": "CAPROAMPHOHYDROXYPROPYLSULFONIC ACID"
          }
        }
      ],
      "names": [
        {
          "uuid": "74c85224-60b5-4ab7-9bc5-04934dc6c603",
          "name": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-((2-HYDROXYETHYL)(2-((1-OXODECYL)AMINO)ETHYL)AMINO)-, SODIUM SALT (1:1)",
          "stdName": "1-PROPANESULFONIC ACID, 2-HYDROXY-3-((2-HYDROXYETHYL)(2-((1-OXODECYL)AMINO)ETHYL)AMINO)-, SODIUM SALT (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "810704c8-a189-4236-9a0b-a4f570fb2bdb"
          ],
          "display_name": false
        },
        {
          "uuid": "9bd2fd64-2e40-400a-bbfa-e144473e0125",
          "name": "SODIUM CAPROAMPHOHYDROXYPROPYLSULFONATE",
          "stdName": "SODIUM CAPROAMPHOHYDROXYPROPYLSULFONATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43e021dd-87a3-484c-b4cb-39c75e52ee40"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "da87e5fc-5698-4938-847d-c58592bc6b20",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "modifications": {
        "uuid": "54f24649-e170-424c-80a1-502971ad247b"
      }
    }
  ]
}