{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "07ca9dab-bdf8-4a4d-99d2-bcce1b8e3371",
          "code": "QV08CX01",
          "comments": "VATC|CONTRAST MEDIA|MAGNETIC RESONANCE IMAGING CONTRAST MEDIA|Other magnetic resonance imaging contrast media|perflubron",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QV08CX01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "e593b782-86b5-40c5-b18b-60a983429a45",
          "code": "423-55-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=423-55-2",
          "code_system": "CAS",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e",
            "5d3eedd3-98df-44e9-abb5-770a2f43bb29"
          ]
        },
        {
          "uuid": "5faa6725-4db9-40cc-b857-277c900daf46",
          "code": "C1422",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1422",
          "code_system": "NCI_THESAURUS",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "c032ab29-0810-48b4-9ae3-1ffc06368c97",
          "code": "C003072",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67003072",
          "code_system": "MESH",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "78ecea14-6c9d-4a9c-b927-4161af06c7e6",
          "code": "PERFLUBRON",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Perflubron",
          "code_system": "WIKIPEDIA",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "b0ee4ff5-81dc-485a-ba53-4e8cb7484025",
          "code": "V08CX01",
          "comments": "ATC|VARIOUS|CONTRAST MEDIA|MAGNETIC RESONANCE IMAGING CONTRAST MEDIA|Other magnetic resonance imaging contrast media|perflubron",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=V08CX01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "d54e6696-34b9-402d-a1c1-b847509ab96c",
          "code": "6903",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6903",
          "code_system": "INN",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "cd93038f-3566-41b1-8acf-bc6f78374237",
          "code": "m8540",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8540?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "1939c67c-eb08-4099-bc99-dd33b60ac245",
          "code": "SUB09721MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "325322e3-71e0-4ac5-b46b-603f8d045152",
          "code": "CHEMBL1200866",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1200866",
          "code_system": "ChEMBL",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "65dc0471-be40-4b8e-856d-cfcd2a52e1bd",
          "code": "207-028-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.391",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "95923b73-0e2b-4e7c-b8e6-806ab2e52d36",
          "code": "9873",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/9873",
          "code_system": "PUBCHEM",
          "references": [
            "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e"
          ]
        },
        {
          "uuid": "5256f56a-a80d-117d-8db0-aede399d8948",
          "code": "DTXSID5046560",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5046560",
          "code_system": "EPA CompTox",
          "references": [
            "38d45ff9-ec40-031d-9d2b-d06647723391"
          ]
        },
        {
          "uuid": "d61775c0-f5c5-d37e-443c-9db1d5f2049a",
          "code": "141100",
          "comments": "ORPHAN DRUG|Designated|Treatment of acute respiratory distress disease (ARDS) in adults",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=141100",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "b82fe213-637b-5144-1746-c8dbb1cbd871",
          "code": "C798",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Radiosensitizing Agent",
          "codeText": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Radiosensitizing Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C798",
          "code_system": "NCI_THESAURUS",
          "references": [
            "256d740e-0557-3ce7-ee75-36f85596f7c3"
          ]
        },
        {
          "uuid": "33883400-8b07-77dc-ade4-e7f049f8516c",
          "code": "631018",
          "comments": "ORPHAN DRUG|Designated|Treatment of respiratory distress syndrome (RDS)",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=631018",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "9dc0e0b5-cb11-f496-a52f-8afb86a9e2fe",
          "code": "C390",
          "comments": "Industrial Aid[C45678]|Reagent[C802]|Imaging Agent[C1966]|Contrast Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C390",
          "code_system": "NCI_THESAURUS",
          "references": [
            "256d740e-0557-3ce7-ee75-36f85596f7c3"
          ]
        },
        {
          "uuid": "3af40af1-86a4-4ff6-81f1-4e6e7898d3db",
          "code": "Q1D0Q7R4D9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1f232e53-22c6-61b1-bee9-f07b010abd2f",
          "code": "630718",
          "comments": "ORPHAN DRUG|Designated|Treatment of congenital pulmonary hypoplasia in infancy",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=630718",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "256d740e-0557-3ce7-ee75-36f85596f7c3"
          ]
        },
        {
          "uuid": "0afbcc4c-9723-0859-e4ef-e68ffd4cfbf6",
          "code": "DB05791",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB05791",
          "code_system": "DRUG BANK",
          "references": [
            "256d740e-0557-3ce7-ee75-36f85596f7c3"
          ]
        },
        {
          "uuid": "39002378-b80c-c691-f700-ec0a989c5433",
          "code": "2102",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2102",
          "code_system": "DRUG CENTRAL",
          "references": [
            "256d740e-0557-3ce7-ee75-36f85596f7c3"
          ]
        },
        {
          "uuid": "56c8306d-e891-9053-fbcb-30c5f9b92f48",
          "code": "1510801",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1510801",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "256d740e-0557-3ce7-ee75-36f85596f7c3"
          ]
        },
        {
          "uuid": "e440cd4e-0398-be76-ba57-8467b54e890d",
          "code": "38803",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38803",
          "code_system": "CHEBI",
          "references": [
            "256d740e-0557-3ce7-ee75-36f85596f7c3"
          ]
        },
        {
          "uuid": "9dd77a6b-540d-cccc-c2ec-52c090810d5c",
          "code": "100000082730",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "052c776d-465d-9af0-a638-aabd75818ef6"
          ]
        },
        {
          "uuid": "26a087bb-7ae9-9509-73f6-53db7b61741a",
          "code": "DD-10",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/DD-10/relevant/1/",
          "code_system": "USAN",
          "references": [
            "37cdd5fb-a14c-639d-acb0-a08ce662bc8f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "9b01311b-3e4c-40bb-8b6b-83f81eb716d2",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c1752ede-e751-4a21-b39f-0ab029430b63",
            "refuuid": "f1105ad5-621a-4bae-bb04-bdc79b1d53c3",
            "name": "PERFLUBRON",
            "unii": "Q1D0Q7R4D9",
            "linking_id": "Q1D0Q7R4D9",
            "ref_pname": "PERFLUBRON",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "7315a7b3-b7d6-47f8-b854-39d1b86ec58e",
          "name": "1-Bromoheptadecafluorooctane",
          "stdName": "1-BROMOHEPTADECAFLUOROOCTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "299f1ed1-74ed-431f-8143-31e69b509533"
          ],
          "display_name": false
        },
        {
          "uuid": "30bd1524-0bfd-43e9-86b9-429f7fde011f",
          "name": "IMAGENT",
          "stdName": "IMAGENT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d21655-68e3-40ce-8a86-af93b70ac35e",
            "74fb84a6-f7e7-46e5-9468-3be212ccd304"
          ],
          "display_name": false
        },
        {
          "uuid": "5110cd9e-17dc-8fce-e9a2-17b85c3483be",
          "name": "LIQUIVENT",
          "stdName": "LIQUIVENT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "38d45ff9-ec40-031d-9d2b-d06647723391"
          ],
          "display_name": false
        },
        {
          "uuid": "02c77afe-de95-4d68-a944-d0e3bf4bf722",
          "name": "N-PERFLUOROOCTYL BROMIDE",
          "stdName": "N-PERFLUOROOCTYL BROMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bbb0a7f-61be-41c3-b934-cecef5350483",
            "10d21655-68e3-40ce-8a86-af93b70ac35e"
          ],
          "display_name": false
        },
        {
          "uuid": "297e97fc-eb84-4b02-b22a-419e3383f4a4",
          "name": "OCTANE, 1-BROMO-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-HEPTADECAFLUORO-",
          "stdName": "OCTANE, 1-BROMO-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-HEPTADECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "299f1ed1-74ed-431f-8143-31e69b509533"
          ],
          "display_name": false
        },
        {
          "uuid": "7b3680d1-2184-4e8d-ba6d-ab65eb8cd0ae",
          "name": "OCTANE, 1-BROMOHEPTADECAFLUORO-",
          "stdName": "OCTANE, 1-BROMOHEPTADECAFLUORO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bbb0a7f-61be-41c3-b934-cecef5350483",
            "10d21655-68e3-40ce-8a86-af93b70ac35e"
          ],
          "display_name": false
        },
        {
          "uuid": "8408042d-aae5-41a2-ac96-b396806d0d79",
          "name": "PERFLUBRON",
          "stdName": "PERFLUBRON",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "398d8447-55bf-4eeb-af27-bef347f4b679",
            "77a1efe3-6192-4d69-ba7e-284c88570764",
            "1b0549fd-d04f-4966-8419-01f75aea2d08",
            "5b7a4423-4f07-4894-a7e1-4f4332de8a36",
            "4ec34364-61a8-415c-bfcf-88f4d1b79610",
            "6939b784-a893-4f02-bc19-ff87458390af",
            "23d82089-8e0d-443a-9476-d7775fdf8dcf",
            "e14455c3-15af-4ba5-af05-62cec4778b34",
            "d545d785-2c66-42cf-870c-49574fcea3f9",
            "e4b2a851-999a-403b-bd67-5f823a161677",
            "aa6da563-1632-4fb4-af49-cdddbc6c47fd",
            "b9dc7b10-1e50-492b-afdb-648273cb3e18",
            "299f1ed1-74ed-431f-8143-31e69b509533",
            "d09cc3a3-d19a-4152-89e1-a5ee0a51fc85",
            "c0402649-0825-45c4-954d-54a736ec2eba",
            "e4ff1dd0-071b-4686-9850-d5bed44ea96b",
            "10d21655-68e3-40ce-8a86-af93b70ac35e",
            "b04eb1d5-a898-4f12-8e08-ff42bf3dbce8",
            "4deec07b-3a1a-48ba-8ba0-a0d44f928417",
            "3ea097ca-99b9-4cfc-a0cf-f574ca679ab9"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "b750fac2-6679-4fb1-8671-d11666100481",
              "name_org": "INN"
            },
            {
              "uuid": "3862663f-83a9-4c4d-9527-64bdabae33eb",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "e09d261c-529e-4524-9ab1-1c9315822cce",
          "name": "PERFLUBRON [MART.]",
          "stdName": "PERFLUBRON [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b04eb1d5-a898-4f12-8e08-ff42bf3dbce8"
          ],
          "display_name": false
        },
        {
          "uuid": "5358c4bc-6662-4e08-bb69-819f2a264b33",
          "name": "PERFLUBRON [MI]",
          "stdName": "PERFLUBRON [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d21655-68e3-40ce-8a86-af93b70ac35e",
            "5b7a4423-4f07-4894-a7e1-4f4332de8a36"
          ],
          "display_name": false
        },
        {
          "uuid": "a1057340-636c-456f-b8c7-609c66ca94e4",
          "name": "PERFLUBRON [ORANGE BOOK]",
          "stdName": "PERFLUBRON [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d545d785-2c66-42cf-870c-49574fcea3f9"
          ],
          "display_name": false
        },
        {
          "uuid": "3eb9362b-0cd8-4159-a98a-fc73df6cb612",
          "name": "PERFLUBRON [USAN]",
          "stdName": "PERFLUBRON [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ea097ca-99b9-4cfc-a0cf-f574ca679ab9"
          ],
          "display_name": false
        },
        {
          "uuid": "3935296a-aff1-3be5-2f66-9f27aa8dc433",
          "name": "PERFLUBRON [USP MONOGRAPH]",
          "stdName": "PERFLUBRON [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b1071535-d988-eedb-9a66-98768f83cc14"
          ],
          "display_name": false
        },
        {
          "uuid": "16d953a3-0c3c-4cbf-bd5a-52cbf89d679a",
          "name": "PERFLUBRON [USP-RS]",
          "stdName": "PERFLUBRON [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d21655-68e3-40ce-8a86-af93b70ac35e",
            "23d82089-8e0d-443a-9476-d7775fdf8dcf"
          ],
          "display_name": false
        },
        {
          "uuid": "bfbf59f2-5e85-4135-8b15-e3887eb822d6",
          "name": "PERFLUBRON [VANDF]",
          "stdName": "PERFLUBRON [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10d21655-68e3-40ce-8a86-af93b70ac35e",
            "4deec07b-3a1a-48ba-8ba0-a0d44f928417"
          ],
          "display_name": false
        },
        {
          "uuid": "9beb602d-7d35-46eb-8433-3d9bf9ed33e5",
          "name": "PERFLUOROCAPRYLYL BROMIDE",
          "stdName": "PERFLUOROCAPRYLYL BROMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "10d21655-68e3-40ce-8a86-af93b70ac35e",
            "7678169b-06ce-4f93-849b-cbb75fb711d8",
            "7bd099d0-1028-4f79-b36f-a4cde9547675",
            "1cdd0a36-03f3-47d5-a4a9-891627078a58"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "55f6ca72-fee6-47d6-8f8c-dd059721aaa3",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2c6aad88-830e-427e-b3d1-fc903ada3ca5",
          "name": "PERFLUOROCTYL BROMIDE",
          "stdName": "PERFLUOROCTYL BROMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f58f7bc4-228c-4101-84de-d99d5b827b63",
            "10d21655-68e3-40ce-8a86-af93b70ac35e"
          ],
          "display_name": false
        },
        {
          "uuid": "ebd77e11-c6ca-486e-8e9c-397c72229ee6",
          "name": "PERFLUOROOCTYL BROMIDE",
          "stdName": "PERFLUOROOCTYL BROMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "299f1ed1-74ed-431f-8143-31e69b509533"
          ],
          "display_name": false
        },
        {
          "uuid": "fe46c657-afc3-b396-5857-c65a89b1943f",
          "name": "Perflubron [WHO-DD]",
          "stdName": "PERFLUBRON [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5978aa45-f337-ddf3-4f9e-ab79eb6e27a6"
          ],
          "display_name": false
        },
        {
          "uuid": "f9e848d5-6c8a-4f0f-a446-f928d91b465a",
          "name": "perflubron [INN]",
          "stdName": "PERFLUBRON [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "398d8447-55bf-4eeb-af27-bef347f4b679"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "299f1ed1-74ed-431f-8143-31e69b509533",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "74fb84a6-f7e7-46e5-9468-3be212ccd304",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10d21655-68e3-40ce-8a86-af93b70ac35e",
          "citation": "ORANGE BOOK",
          "doc_type": "ORANGE BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "398d8447-55bf-4eeb-af27-bef347f4b679",
          "citation": "INN Proposed List 66",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL66.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3ea097ca-99b9-4cfc-a0cf-f574ca679ab9",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b0549fd-d04f-4966-8419-01f75aea2d08",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d545d785-2c66-42cf-870c-49574fcea3f9",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b04eb1d5-a898-4f12-8e08-ff42bf3dbce8",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5b7a4423-4f07-4894-a7e1-4f4332de8a36",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7bd099d0-1028-4f79-b36f-a4cde9547675",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bbb0a7f-61be-41c3-b934-cecef5350483",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23d82089-8e0d-443a-9476-d7775fdf8dcf",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9dc7b10-1e50-492b-afdb-648273cb3e18",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4deec07b-3a1a-48ba-8ba0-a0d44f928417",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1cdd0a36-03f3-47d5-a4a9-891627078a58",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f58f7bc4-228c-4101-84de-d99d5b827b63",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "34efb3a5-cf1b-405f-aae6-9c3713e6aa3e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389741000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c50675c-1b70-4883-bbc5-136d453a6d3a",
          "citation": "SRS import [Q1D0Q7R4D9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q1D0Q7R4D9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389741000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e14455c3-15af-4ba5-af05-62cec4778b34",
          "citation": "PERFLUBRON [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "aa6da563-1632-4fb4-af49-cdddbc6c47fd",
          "citation": "PERFLUBRON [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e4ff1dd0-071b-4686-9850-d5bed44ea96b",
          "citation": "PERFLUBRON [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e4b2a851-999a-403b-bd67-5f823a161677",
          "citation": "PERFLUBRON [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c0402649-0825-45c4-954d-54a736ec2eba",
          "citation": "PERFLUBRON [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d09cc3a3-d19a-4152-89e1-a5ee0a51fc85",
          "citation": "PERFLUBRON [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7678169b-06ce-4f93-849b-cbb75fb711d8",
          "citation": "PERFLUOROCAPRYLYL BROMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "77a1efe3-6192-4d69-ba7e-284c88570764",
          "citation": "PERFLUBRON [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6939b784-a893-4f02-bc19-ff87458390af",
          "citation": "PERFLUBRON [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4ec34364-61a8-415c-bfcf-88f4d1b79610",
          "citation": "PERFLUBRON [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38d45ff9-ec40-031d-9d2b-d06647723391",
          "citation": "https://www.researchgate.net/publication/12712868_Liquid_Ventilation_Current_Status/figures?lo=1",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=423-55-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "256d740e-0557-3ce7-ee75-36f85596f7c3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "5d3eedd3-98df-44e9-abb5-770a2f43bb29",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "37cdd5fb-a14c-639d-acb0-a08ce662bc8f",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "b1071535-d988-eedb-9a66-98768f83cc14",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "5978aa45-f337-ddf3-4f9e-ab79eb6e27a6",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "052c776d-465d-9af0-a638-aabd75818ef6",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "44f0a80c-84e4-4242-b12e-e56f2d6a60c1",
          "id": "44f0a80c-84e4-4242-b12e-e56f2d6a60c1",
          "molfile": "\n  Marvin  01132103382D          \n\n 26 25  0  0  0  0            999 V2000\n    3.4864    0.1754    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4864   -0.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7724   -0.2380    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7724   -1.0647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2004   -1.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7870   -1.7745    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6137   -1.7745    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9144   -0.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3277    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5010    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6283   -1.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0417   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2150   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3423   -0.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7557    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9290    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0563   -1.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6429   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4696   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7703   -0.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1836    0.0794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3569    0.0794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4842   -1.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1982   -1.4613    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4842   -1.8747    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1982   -0.6346    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n  8 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 17  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 23 20  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 23  1  0  0  0  0\n 26 23  1  0  0  0  0\nM  END",
          "smiles": "C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(Br)(F)F)(F)F)(F)F)(F)F",
          "formula": "C8BrF17",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3c5e52cb-dc6c-4f03-aad0-8d339b093fe7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "498.9623",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f1105ad5-621a-4bae-bb04-bdc79b1d53c3",
      "version": "31",
      "structure": {
        "id": "061c3017-63d2-4d1d-a353-52a68e9d768f",
        "molfile": "\n  Marvin  01132100362D          \n\n 26 25  0  0  0  0            999 V2000\n    5.6283   -1.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3423   -0.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0563   -1.0522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9144   -0.6471    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2004   -1.0605    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7703   -0.6388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4864   -0.6513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4842   -1.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0417   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7557    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9290    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2150   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6429   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4696   -1.7662    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3277    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5010    0.0752    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7870   -1.7745    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6137   -1.7745    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1836    0.0794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3569    0.0794    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4864    0.1754    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7724   -0.2380    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7724   -1.0647    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1982   -0.6346    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    9.1982   -1.4613    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4842   -1.8747    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  5  1  0  0  0  0\n  8  6  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13  3  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  4  1  0  0  0  0\n 16  4  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18  5  1  0  0  0  0\n 19  6  1  0  0  0  0\n 20  6  1  0  0  0  0\n 21  7  1  0  0  0  0\n 22  7  1  0  0  0  0\n 23  7  1  0  0  0  0\n 24  8  1  0  0  0  0\n 25  8  1  0  0  0  0\n 26  8  1  0  0  0  0\nM  END",
        "smiles": "C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(C(C(C(Br)(F)F)(F)F)(F)F)(F)F",
        "formula": "C8BrF17",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "498.9623",
        "optical_activity": "NONE",
        "references": [
          "299f1ed1-74ed-431f-8143-31e69b509533",
          "1c50675c-1b70-4883-bbc5-136d453a6d3a",
          "398d8447-55bf-4eeb-af27-bef347f4b679"
        ],
        "stereo_centers": 0
      },
      "unii": "Q1D0Q7R4D9"
    }
  ]
}