{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "924068d5-0baf-4a50-a3de-dee91503cb72",
          "code": "752-61-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=752-61-4",
          "code_system": "CAS",
          "references": [
            "a4220680-78bf-4f85-8061-e86dc7c1e3dd",
            "7860fdf7-72c2-4f2d-9eb9-93d4fd0a006f"
          ]
        },
        {
          "uuid": "dada5488-463f-46e4-99f9-2e989f1bbdd9",
          "code": "C61723",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61723",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a4220680-78bf-4f85-8061-e86dc7c1e3dd"
          ]
        },
        {
          "uuid": "228b0c63-212f-4452-8a15-91912b7c9daa",
          "code": "C034791",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67034791",
          "code_system": "MESH",
          "references": [
            "a4220680-78bf-4f85-8061-e86dc7c1e3dd"
          ]
        },
        {
          "uuid": "9de94962-5da4-424e-a11a-e41957823165",
          "code": "m4447",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4447?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a4220680-78bf-4f85-8061-e86dc7c1e3dd"
          ]
        },
        {
          "uuid": "e79d9bea-e55e-4d2c-9050-c9b8c870a0c6",
          "code": "SUB13578MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a4220680-78bf-4f85-8061-e86dc7c1e3dd"
          ]
        },
        {
          "uuid": "e8ca6547-b864-4edf-8ebf-f9b90199d683",
          "code": "212-036-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.942",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a4220680-78bf-4f85-8061-e86dc7c1e3dd"
          ]
        },
        {
          "uuid": "795b0429-74e6-464a-8ccb-7b95566af963",
          "code": "441856",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441856",
          "code_system": "PUBCHEM",
          "references": [
            "a4220680-78bf-4f85-8061-e86dc7c1e3dd"
          ]
        },
        {
          "uuid": "5e73803d-b21f-2ccd-c4ea-c4bc4e89e4b3",
          "code": "Digitalin",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Digitalin",
          "code_system": "WIKIPEDIA",
          "references": [
            "755dc639-14a7-6d52-2e86-3d3eba417787"
          ]
        },
        {
          "uuid": "9261d4b4-f8fb-71b5-2151-15d1849b52f2",
          "code": "1923401",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1923401/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "794bc923-377e-ec49-8a07-f54dae0aeec9",
          "code": "C47793",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Cardiovascular System[C78274]|Antiarrhythmic Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47793",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5d58a93c-3cfb-b7d4-edb3-6de2f3ff2e74"
          ]
        },
        {
          "uuid": "56044290-429b-86ad-7a48-7184baf53569",
          "code": "3143",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3143",
          "code_system": "DRUG CENTRAL",
          "references": [
            "5d58a93c-3cfb-b7d4-edb3-6de2f3ff2e74"
          ]
        },
        {
          "uuid": "17f2d1df-acbd-4436-8e05-fdd9bc506567",
          "code": "Q15ECE254B",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d60b3eb2-c5b6-56f5-982a-1ecece1c111d",
          "code": "28143",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28143",
          "code_system": "CHEBI",
          "references": [
            "5d58a93c-3cfb-b7d4-edb3-6de2f3ff2e74"
          ]
        },
        {
          "uuid": "519e6ab7-9dad-25a9-caa5-e476196d9dd8",
          "code": "100000079780",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a4cbc646-9ad0-0ed4-4cae-67fde2c9d701"
          ]
        },
        {
          "uuid": "8caf50b2-292b-4108-3408-7089d37a7c8d",
          "code": "Q15ECE254B",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q15ECE254B",
          "code_system": "DAILYMED",
          "references": [
            "dccd1e6b-7338-36f5-c6ee-f8a288ad338a"
          ]
        },
        {
          "uuid": "b4c5423b-cc7e-1068-f84a-4cd911cdabd5",
          "code": "DTXSID801024550",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID801024550",
          "code_system": "EPA CompTox",
          "references": [
            "c19fd590-aeff-1524-9974-23670507df9c"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ed02d61a-4b42-4bbc-9c6e-6dad5142886c",
          "name": "(3.BETA.,5.BETA.,16.BETA.)-3-((6-DEOXY-4-O-.BETA.-D-GLUCOPYRANOSYL-3-O-METHYL-.BETA.-D-GALACTOPYRANOSYL)OXY)-14,16-DIHYDROXYCARD-20(22)-ENOLIDE",
          "stdName": "(3.BETA.,5.BETA.,16.BETA.)-3-((6-DEOXY-4-O-.BETA.-D-GLUCOPYRANOSYL-3-O-METHYL-.BETA.-D-GALACTOPYRANOSYL)OXY)-14,16-DIHYDROXYCARD-20(22)-ENOLIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7047c9d-4b58-465e-b6ed-2f07b047773f",
            "92a4bfe0-662c-4402-8e3e-002f09939662"
          ],
          "display_name": false
        },
        {
          "uuid": "87268d08-009e-47b5-a8dd-c3de8e4330b9",
          "name": "DIGITALIN",
          "stdName": "DIGITALIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4fe4ad8-1653-4ff5-a094-6aa5f3363bc6",
            "c883354f-7237-4b32-86e1-06dd45f9858e",
            "f6683e70-3a40-499c-895e-c6b3b3920d1e",
            "f2e6a72a-19b8-4857-92dd-ffa0e8bed8e9",
            "92a4bfe0-662c-4402-8e3e-002f09939662",
            "3e257a58-1888-4180-8b49-5d0e89897443",
            "e79765fa-d769-426e-a88d-669315d2cf14",
            "91588c26-7eed-4ddc-83a3-9975600c429f"
          ],
          "display_name": true
        },
        {
          "uuid": "fc5a992e-5ff7-44e5-b5be-1f655ea09686",
          "name": "DIGITALIN [MART.]",
          "stdName": "DIGITALIN [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c883354f-7237-4b32-86e1-06dd45f9858e"
          ],
          "display_name": false
        },
        {
          "uuid": "f354f65a-ca84-41cc-ba30-09993d2bd78d",
          "name": "DIGITALIN [MI]",
          "stdName": "DIGITALIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b4fe4ad8-1653-4ff5-a094-6aa5f3363bc6",
            "92a4bfe0-662c-4402-8e3e-002f09939662"
          ],
          "display_name": false
        },
        {
          "uuid": "29b69a97-cc4c-47bb-94cd-043d25d64c9b",
          "name": "DIGITALINUM",
          "stdName": "DIGITALINUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d86a497-76ef-4fda-87d5-6709f1bead51",
            "b22ae9b2-a36d-436e-b988-735e6cc881e4",
            "92a4bfe0-662c-4402-8e3e-002f09939662",
            "7c96b142-5726-42b3-8c20-9676c002547b"
          ],
          "display_name": false
        },
        {
          "uuid": "2bb9ad5d-d557-47ac-bfa6-c6f532576461",
          "name": "DIGITALINUM TRUE",
          "stdName": "DIGITALINUM TRUE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7047c9d-4b58-465e-b6ed-2f07b047773f",
            "92a4bfe0-662c-4402-8e3e-002f09939662"
          ],
          "display_name": false
        },
        {
          "uuid": "a8d25727-6b97-429a-9628-ba34196c2eac",
          "name": "DIGITALINUM VERUM",
          "stdName": "DIGITALINUM VERUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7047c9d-4b58-465e-b6ed-2f07b047773f",
            "92a4bfe0-662c-4402-8e3e-002f09939662"
          ],
          "display_name": false
        },
        {
          "uuid": "9a64b403-4783-4468-9cb0-c28468cc202b",
          "name": "DIGITALINUM [HPUS]",
          "stdName": "DIGITALINUM [HPUS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9d86a497-76ef-4fda-87d5-6709f1bead51",
            "b22ae9b2-a36d-436e-b988-735e6cc881e4"
          ],
          "display_name": false
        },
        {
          "uuid": "53aa493f-01b8-0bff-85ac-08c3350051fd",
          "name": "Digitalin [WHO-DD]",
          "stdName": "DIGITALIN [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4007dc3-6abf-f981-8041-77d52fabf4eb"
          ],
          "display_name": false
        },
        {
          "uuid": "f53dd1c7-4736-429c-b620-589f5e8cd900",
          "name": "SCHMIEDEBERG'S DIGITALIN",
          "stdName": "SCHMIEDEBERG'S DIGITALIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b7047c9d-4b58-465e-b6ed-2f07b047773f",
            "92a4bfe0-662c-4402-8e3e-002f09939662"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e79765fa-d769-426e-a88d-669315d2cf14",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "92a4bfe0-662c-4402-8e3e-002f09939662",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e1ccd2b7-caa4-45e6-bdd9-7920f4cbf930",
          "citation": "STN-2006",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7047c9d-4b58-465e-b6ed-2f07b047773f",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d86a497-76ef-4fda-87d5-6709f1bead51",
          "citation": "HPUS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b22ae9b2-a36d-436e-b988-735e6cc881e4",
          "citation": "HPUS 2011",
          "doc_type": "HOMEOPATHIC PHARMACOPOEIA US",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c883354f-7237-4b32-86e1-06dd45f9858e",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4fe4ad8-1653-4ff5-a094-6aa5f3363bc6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6683e70-3a40-499c-895e-c6b3b3920d1e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a4220680-78bf-4f85-8061-e86dc7c1e3dd",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389679000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e03380fc-2c09-4e55-ad90-59a250fc3b59",
          "citation": "SRS import [Q15ECE254B]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q15ECE254B",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389679000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c96b142-5726-42b3-8c20-9676c002547b",
          "citation": "DIGITALINUM [HPUS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f2e6a72a-19b8-4857-92dd-ffa0e8bed8e9",
          "citation": "DIGITALIN [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "91588c26-7eed-4ddc-83a3-9975600c429f",
          "citation": "DIGITALIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3e257a58-1888-4180-8b49-5d0e89897443",
          "citation": "DIGITALIN [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "755dc639-14a7-6d52-2e86-3d3eba417787",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Digitalin",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d58a93c-3cfb-b7d4-edb3-6de2f3ff2e74",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c19fd590-aeff-1524-9974-23670507df9c",
          "citation": "CompTox",
          "doc_type": "EPA",
          "public_domain": true
        },
        {
          "uuid": "7860fdf7-72c2-4f2d-9eb9-93d4fd0a006f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dccd1e6b-7338-36f5-c6ee-f8a288ad338a",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c4007dc3-6abf-f981-8041-77d52fabf4eb",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a4cbc646-9ad0-0ed4-4cae-67fde2c9d701",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7985ac1b-a1b3-4388-b2aa-76102835e62a",
          "id": "7985ac1b-a1b3-4388-b2aa-76102835e62a",
          "molfile": "\n  Marvin  01132106192D          \n\n 50 56  0  0  1  0            999 V2000\n    7.1184   -0.8256    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.9477   -0.8256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6304   -1.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8489   -1.2366    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8452   -2.1245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1407   -1.6549    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    5.1407   -2.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4214   -2.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7023   -2.4768    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    2.9794   -2.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2749   -2.4768    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.2749   -1.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9794   -1.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7023   -1.6549    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    3.5335   -0.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4214   -1.2366    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.4214   -0.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1407   -0.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8489   -0.4293    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    5.8452    0.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6304   -0.1651    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.8762    0.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6725    0.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6725    1.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3329    2.1796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8762    1.9374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992    1.2769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5668   -2.8951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8476   -2.4768    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.8476   -1.6549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1284   -1.2366    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    0.1284   -0.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5797   -1.6549    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -1.2989   -1.2366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0034   -0.8366    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -2.0144   -0.0037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7299    0.4000    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -2.7336    1.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0254    1.6402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4381   -0.0257    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -4.1573    0.3816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4381   -0.8513    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -4.1389   -1.2659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7226   -1.2586    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -2.7042   -2.0768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5797   -2.4768    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -1.2989   -2.8951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0181   -2.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1284   -2.8951    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    0.1284   -3.7243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 21  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  4 19  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 16  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  6  0  0  0\n 14  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 28  1  1  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  1  0  0  0\n 16 14  1  0  0  0  0\n 16 17  1  1  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  1  0  0  0\n 23 22  2  0  0  0  0\n 27 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 29 28  1  1  0  0  0\n 29 30  1  0  0  0  0\n 49 29  1  0  0  0  0\n 31 30  1  0  0  0  0\n 31 32  1  1  0  0  0\n 33 31  1  0  0  0  0\n 33 34  1  1  0  0  0\n 46 33  1  0  0  0  0\n 35 34  1  1  0  0  0\n 35 36  1  0  0  0  0\n 44 35  1  0  0  0  0\n 37 36  1  0  0  0  0\n 37 38  1  1  0  0  0\n 40 37  1  0  0  0  0\n 39 38  1  0  0  0  0\n 40 41  1  6  0  0  0\n 40 42  1  0  0  0  0\n 42 43  1  1  0  0  0\n 42 44  1  0  0  0  0\n 44 45  1  6  0  0  0\n 46 47  1  1  0  0  0\n 49 46  1  0  0  0  0\n 48 47  1  0  0  0  0\n 49 50  1  6  0  0  0\nM  END",
          "smiles": "C[C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@H]2CC[C@@]3(C)[C@H](CC[C@@H]4[C@@H]3CC[C@]5(C)[C@@H](C6=CC(=O)OC6)[C@H](C[C@]45O)O)C2)O)OC)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O",
          "formula": "C36H56O14",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "42cd53f4-b6bf-4860-bb04-c9c9b1413be2"
          },
          "defined_stereo": 19,
          "ez_centers": 0,
          "molecular_weight": "712.8228",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 19
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c180c1ff-7b95-4b31-b18c-0eac12e0f4f0",
      "version": "16",
      "structure": {
        "id": "cc2a2446-97bf-43d3-b17f-297f1724bc93",
        "molfile": "\n  Marvin  01132110322D          \n\n 55 61  0  0  1  0            999 V2000\n    5.8489   -1.2366    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8489   -0.4293    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.0034   -0.8366    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.8476   -2.4768    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.5797   -1.6549    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -2.7226   -1.2586    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.1284   -2.8951    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.7023   -1.6549    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8762    0.6201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1407   -1.6549    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.5797   -2.4768    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6304   -0.1651    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -3.4381   -0.8513    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.6304   -1.5008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4214   -1.2366    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.0144   -0.0037    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2989   -1.2366    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8476   -1.6549    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.4381   -0.0257    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.1184   -0.8256    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -2.7299    0.4000    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.6725    0.8659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1284   -1.2366    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.7023   -2.4768    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.1407   -0.0110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6725    1.6952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4214   -0.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5668   -2.8951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8762    1.9374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9794   -1.2366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1407   -2.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3992    1.2769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9794   -2.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4214   -2.8951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8452   -2.1245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2749   -2.4768    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.3329    2.1796    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1284   -3.7243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7042   -2.0768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1389   -1.2659    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2989   -2.8951    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.1573    0.3816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8452    0.5321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9477   -0.8256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2749   -1.6549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5335   -0.5907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.7336    1.2182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0254    1.6402    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1284   -0.4293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0181   -2.4768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1370   -0.8329    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4178   -2.0658    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6986   -3.3060    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8439   -3.3060    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5834   -0.8329    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3 17  1  1  0  0  0\n  4 28  1  0  0  0  0\n  5 23  1  0  0  0  0\n  6  3  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8 15  1  0  0  0  0\n 12  9  1  1  0  0  0\n 10  1  1  0  0  0  0\n 11  7  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14  1  1  0  0  0  0\n 15 10  1  0  0  0  0\n 16  3  1  0  0  0  0\n 17  5  1  0  0  0  0\n 18  4  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 14  1  0  0  0  0\n 21 16  1  0  0  0  0\n 22  9  2  0  0  0  0\n 23 18  1  0  0  0  0\n 24 34  1  0  0  0  0\n 25  2  1  0  0  0  0\n 26 22  1  0  0  0  0\n 27 25  1  0  0  0  0\n 36 28  1  1  0  0  0\n 29 32  1  0  0  0  0\n 30  8  1  0  0  0  0\n 31 10  1  0  0  0  0\n 32  9  1  0  0  0  0\n 33 24  1  0  0  0  0\n 34 31  1  0  0  0  0\n  1 35  1  1  0  0  0\n 36 33  1  0  0  0  0\n 37 26  2  0  0  0  0\n  7 38  1  6  0  0  0\n  6 39  1  6  0  0  0\n 13 40  1  1  0  0  0\n 11 41  1  1  0  0  0\n 19 42  1  6  0  0  0\n  2 43  1  1  0  0  0\n 20 44  1  1  0  0  0\n 45 30  1  0  0  0  0\n  8 46  1  1  0  0  0\n 21 47  1  1  0  0  0\n 48 47  1  0  0  0  0\n 23 49  1  1  0  0  0\n 50 41  1  0  0  0  0\n 10 51  1  1  0  0  0\n 15 52  1  6  0  0  0\n 24 53  1  1  0  0  0\n  4 54  1  6  0  0  0\n  5 55  1  6  0  0  0\n 12 20  1  0  0  0  0\n 15 27  1  0  0  0  0\n  8 24  1  0  0  0  0\n 26 29  1  0  0  0  0\n 36 45  1  0  0  0  0\n 11  5  1  0  0  0  0\n 13 19  1  0  0  0  0\nM  END",
        "smiles": "C[C@@H]1[C@@]([H])([C@@H]([C@H]([C@@]([H])(O1)O[C@H]2CC[C@@]3(C)[C@]([H])(CC[C@]4([H])[C@]3([H])CC[C@]5(C)[C@@H](C6=CC(=O)OC6)[C@H](C[C@]45O)O)C2)O)OC)O[C@H]7[C@@H]([C@H]([C@@H]([C@@H](CO)O7)O)O)O",
        "formula": "C36H56O14",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 19,
        "ez_centers": 0,
        "molecular_weight": "712.8228",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "e03380fc-2c09-4e55-ad90-59a250fc3b59",
          "e79765fa-d769-426e-a88d-669315d2cf14"
        ],
        "stereo_centers": 19
      },
      "modifications": {
        "uuid": "8f2f1d29-5c35-4069-9265-63da566826d5"
      },
      "unii": "Q15ECE254B"
    }
  ]
}