{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c47aa787-a7e4-4a36-9314-de35e2635a25",
          "code": "51-28-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=51-28-5",
          "code_system": "CAS",
          "references": [
            "8ca6440c-f7c3-4d46-bc8a-213095d886be",
            "b7cffa4c-1e5d-41d6-8802-1a42207d85bc"
          ]
        },
        {
          "uuid": "b04dfd15-6672-42d9-8469-837970e71f92",
          "code": "2,4-DINITROPHENOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/2,4-Dinitrophenol",
          "code_system": "WIKIPEDIA",
          "references": [
            "8ca6440c-f7c3-4d46-bc8a-213095d886be"
          ]
        },
        {
          "uuid": "60879da0-9be3-4ea9-a49e-8fa376fb4119",
          "code": "37509",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:426",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "8ca6440c-f7c3-4d46-bc8a-213095d886be"
          ]
        },
        {
          "uuid": "86b9d41b-5179-4ebc-a587-7c9b599d4710",
          "code": "m4578",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m4578?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8ca6440c-f7c3-4d46-bc8a-213095d886be"
          ]
        },
        {
          "uuid": "b083caae-bbb1-4aa4-8104-6cde974c0522",
          "code": "SUB33423",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8ca6440c-f7c3-4d46-bc8a-213095d886be"
          ]
        },
        {
          "uuid": "ff6c92fa-6045-46e5-b5e1-4c3f6657b300",
          "code": "200-087-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.080",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8ca6440c-f7c3-4d46-bc8a-213095d886be"
          ]
        },
        {
          "uuid": "7c241d80-6c4f-4e0d-91b6-f8116a2991f4",
          "code": "1493",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1493",
          "code_system": "PUBCHEM",
          "references": [
            "8ca6440c-f7c3-4d46-bc8a-213095d886be"
          ]
        },
        {
          "uuid": "9945c36b-b4ec-dfd6-0fee-65085f545f15",
          "code": "529",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/529",
          "code_system": "HSDB",
          "references": [
            "d746cbbe-3de0-abf5-626d-aed1da631311"
          ]
        },
        {
          "uuid": "f5460df2-e923-b3b5-82dd-011f177e6e18",
          "code": "DTXSID0020523",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0020523",
          "code_system": "EPA CompTox",
          "references": [
            "1c518784-135a-7131-7d60-fb8708410ebb"
          ]
        },
        {
          "uuid": "6252379c-a132-37f0-511c-713c0f63bbf3",
          "code": "672818",
          "comments": "ORPHAN DRUG|Designated|Treatment of Huntington disease",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=672818",
          "code_system": "FDA ORPHAN DRUG"
        },
        {
          "uuid": "39e03d54-3060-343f-5990-f239468aa250",
          "code": "764820",
          "comments": "ORPHAN DRUG|Designated|Treatment of Amyotrophic Lateral Sclerosis",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=764820",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "ab57bb7b-64a3-288a-5d97-78e91efee32a"
          ]
        },
        {
          "uuid": "97d0f4f1-d2dd-b8e9-2ebf-01db942c7554",
          "code": "DB04528",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB04528",
          "code_system": "DRUG BANK",
          "references": [
            "ab57bb7b-64a3-288a-5d97-78e91efee32a"
          ]
        },
        {
          "uuid": "80e8a0b2-a4d2-4f0d-89e7-a9cb9e0ae708",
          "code": "Q13SKS21MN",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "44adff52-bce9-a041-57b9-21b9583479e8",
          "code": "84561",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:84561",
          "code_system": "CHEBI",
          "references": [
            "ab57bb7b-64a3-288a-5d97-78e91efee32a"
          ]
        },
        {
          "uuid": "692e303a-f173-d4df-698c-05c019fa0d9c",
          "code": "42017",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:42017",
          "code_system": "CHEBI",
          "references": [
            "ab57bb7b-64a3-288a-5d97-78e91efee32a"
          ]
        },
        {
          "uuid": "69cedd30-d025-efac-2b9f-a841c962e6ff",
          "code": "39352",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:39352",
          "code_system": "CHEBI",
          "references": [
            "ab57bb7b-64a3-288a-5d97-78e91efee32a"
          ]
        },
        {
          "uuid": "e8b23654-182a-d774-de0e-392c00249cb8",
          "code": "100000126132",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "8bcf1adb-59dc-92fe-baaa-4854dd481b61"
          ]
        },
        {
          "uuid": "80d28e36-c548-7768-54d0-e0597b849169",
          "code": "1532",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=1532",
          "code_system": "NSC",
          "references": [
            "827d2308-a86a-08b4-ebca-4f839a960d5f"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "43febf18-6ae3-4ab3-b7fa-24e444e4ad32",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c4928a7f-fd62-4e35-b31d-799206ae52de",
            "refuuid": "c37a2e35-b253-4a59-911a-62bf9b99c93e",
            "name": "2,4-DINITROPHENOL",
            "unii": "Q13SKS21MN",
            "linking_id": "Q13SKS21MN",
            "ref_pname": "2,4-DINITROPHENOL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "e711c641-c6b9-4d20-a70b-17a8ad41a445",
          "type": "SALT/SOLVATE->PARENT",
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61"
          ],
          "related_substance": {
            "uuid": "e813da08-9d5a-4b52-aca1-3e9272d4c486",
            "refuuid": "2d604676-868b-48df-89c7-732532b3948f",
            "name": "SODIUM 2,4-DINITROPHENOLATE",
            "unii": "85D4S1GYRS",
            "linking_id": "85D4S1GYRS",
            "ref_pname": "SODIUM 2,4-DINITROPHENOLATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0b25970a-9736-4312-8ae1-c16dbcebefd9",
          "amount": {
            "uuid": "883ad787-9f1e-4fc7-a3c0-77d94e4cc1b3",
            "high": 300,
            "low": 100,
            "units": "MICROMOLAR"
          },
          "comments": "DNP decreases the formation of high-energy phosphate bonds in mitochondria and at the same time stimulates systemic oxygen consumption. This dissociative effect is known as uncoupling of oxidative phosphorylation.  Weak uncoupler.",
          "type": "TARGET->INHIBITOR OF EXPRESSION",
          "references": [
            "674fea66-9dfe-4e0b-efa6-964bb8f25b96"
          ],
          "related_substance": {
            "uuid": "d527ed29-281f-4f99-b387-8b5bd10debac",
            "refuuid": "e7ee1ff7-abc3-4b65-b63a-c1ed9fffb2dd",
            "name": "ADENOSINE TRIPHOSPHATE",
            "unii": "8L70Q75FXE",
            "linking_id": "8L70Q75FXE",
            "ref_pname": "ADENOSINE TRIPHOSPHATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "2c66f2f1-2262-42b7-9018-d8861d1abe67",
          "name": ".ALPHA.-DINITROPHENOL",
          "stdName": ".ALPHA.-DINITROPHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350",
            "81eaf37f-01ef-4d31-8203-fbd0aba936b7"
          ],
          "display_name": false
        },
        {
          "uuid": "9c8f7756-e82a-47c2-9bfc-c511c6ad3771",
          "name": "1,3-DINITRO-4-HYDROXYBENZENE",
          "stdName": "1,3-DINITRO-4-HYDROXYBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        },
        {
          "uuid": "d58e767d-0387-43ec-9ff3-c4ef46e22159",
          "name": "1-HYDROXY-2,4-DINITROBENZENE",
          "stdName": "1-HYDROXY-2,4-DINITROBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        },
        {
          "uuid": "82555f64-210b-4674-a220-c57a267fc9cd",
          "name": "2,4-DINITROPHENOL",
          "stdName": "2,4-DINITROPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350",
            "fe88c9c8-d4d0-4f02-8a83-b981c5946c18",
            "7928d703-d48c-445d-978f-c9af18a45cda",
            "4d29fca3-4aef-42b9-bd23-fda858985aec",
            "ab8887d1-2954-4855-a26a-fa9569389838",
            "e8fcfe75-f4a9-90c7-1f89-abdf1175c0be"
          ],
          "display_name": true
        },
        {
          "uuid": "8b1ae6b6-fc62-4d79-8afa-bbafa528f970",
          "name": "2,4-DINITROPHENOL [HSDB]",
          "stdName": "2,4-DINITROPHENOL [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350",
            "7928d703-d48c-445d-978f-c9af18a45cda"
          ],
          "display_name": false
        },
        {
          "uuid": "d009cdc1-ff2e-4dbd-978d-67529eebd0a5",
          "name": "2,4-DINITROPHENOL [MI]",
          "stdName": "2,4-DINITROPHENOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350",
            "ab8887d1-2954-4855-a26a-fa9569389838"
          ],
          "display_name": false
        },
        {
          "uuid": "40e04500-013c-440a-8a01-bd51c1e5773f",
          "name": "ALDIFEN",
          "stdName": "ALDIFEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350",
            "81eaf37f-01ef-4d31-8203-fbd0aba936b7"
          ],
          "display_name": false
        },
        {
          "uuid": "cf789bd1-0eae-ad31-6185-9ba40ac55fdc",
          "name": "CHEMOX",
          "stdName": "CHEMOX",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2c01951-bd6c-ff45-12b1-ac98e3cb168a"
          ],
          "display_name": false
        },
        {
          "uuid": "79481ef8-e2da-4f7a-af68-8389c3f3ec10",
          "name": "DINITROPHENOL",
          "stdName": "DINITROPHENOL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "01f93fa6-1d64-4d87-bf02-dbd75f79e9f3",
            "b9d3acf5-7b51-4b21-8dcf-3e5716cf791c",
            "00a10677-2c40-41cb-b292-04c62f7857e1",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350",
            "7a913b99-be8f-4ad1-a824-029127fded52"
          ],
          "display_name": false
        },
        {
          "uuid": "58cfc3bf-d423-4348-8bc2-c787786038f7",
          "name": "DINITROPHENOL [MART.]",
          "stdName": "DINITROPHENOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9d3acf5-7b51-4b21-8dcf-3e5716cf791c"
          ],
          "display_name": false
        },
        {
          "uuid": "ff107f96-6056-426b-a008-3648ccbfe48b",
          "name": "DINOFAN",
          "stdName": "DINOFAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        },
        {
          "uuid": "c58c4dc3-a4f6-4efb-ddbd-b5bbb514c2ba",
          "name": "Dinitrophenol [WHO-DD]",
          "stdName": "DINITROPHENOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f8b7c3bc-206d-6dbf-a438-ad76a0a6aa6b"
          ],
          "display_name": false
        },
        {
          "uuid": "cac1c006-d912-41c6-acd2-0bed00c40242",
          "name": "FENOXYL CARBON N",
          "stdName": "FENOXYL CARBON N",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        },
        {
          "uuid": "b4bee3f9-8727-cca2-2bb0-abfffc72e23a",
          "name": "MITCAL",
          "stdName": "MITCAL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a7110d16-1e0d-2357-db39-cefe088ecef1"
          ],
          "display_name": false
        },
        {
          "uuid": "7767a6f2-b098-2e0b-6cde-ad332182a877",
          "name": "MP-101",
          "stdName": "MP-101",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "438b0cf0-2482-82c1-36f5-05281e8be4e0"
          ],
          "display_name": false
        },
        {
          "uuid": "abcd368f-7094-490f-9da7-5ba40a6a2781",
          "name": "NITROPHEN",
          "stdName": "NITROPHEN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        },
        {
          "uuid": "6bd1280a-736a-491f-942a-64b8c31ab604",
          "name": "NITROPHENE",
          "stdName": "NITROPHENE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        },
        {
          "uuid": "69c83a91-e895-4e10-948d-c043a63d0b97",
          "name": "NSC-1532",
          "stdName": "NSC-1532",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        },
        {
          "uuid": "43845139-537a-41ca-9f8c-d8a92c6d650d",
          "name": "PHENOL, 2,4-DINITRO-",
          "stdName": "PHENOL, 2,4-DINITRO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b566a556-494a-4cd9-a700-b8eaf06d1a61",
            "c871cf25-5d35-48c7-a4eb-d09e56fc0350"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b566a556-494a-4cd9-a700-b8eaf06d1a61",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c871cf25-5d35-48c7-a4eb-d09e56fc0350",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81eaf37f-01ef-4d31-8203-fbd0aba936b7",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b9d3acf5-7b51-4b21-8dcf-3e5716cf791c",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ab8887d1-2954-4855-a26a-fa9569389838",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7928d703-d48c-445d-978f-c9af18a45cda",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7a913b99-be8f-4ad1-a824-029127fded52",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ca6440c-f7c3-4d46-bc8a-213095d886be",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0f14bff7-c8ae-43fd-a881-571b06561c16",
          "citation": "SRS import [Q13SKS21MN]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q13SKS21MN",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389689000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00a10677-2c40-41cb-b292-04c62f7857e1",
          "citation": "DINITROPHENOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fe88c9c8-d4d0-4f02-8a83-b981c5946c18",
          "citation": "2,4-DINITROPHENOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d29fca3-4aef-42b9-bd23-fda858985aec",
          "citation": "2,4-DINITROPHENOL [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01f93fa6-1d64-4d87-bf02-dbd75f79e9f3",
          "citation": "DINITROPHENOL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d746cbbe-3de0-abf5-626d-aed1da631311",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+51-28-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1c518784-135a-7131-7d60-fb8708410ebb",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51-28-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "438b0cf0-2482-82c1-36f5-05281e8be4e0",
          "citation": "https://www.mitochonpharma.com/news/mitochon-pharmaceuticals-awarded-orphan-drug-designation/",
          "url": "https://www.mitochonpharma.com/news/mitochon-pharmaceuticals-awarded-orphan-drug-designation/",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "e8fcfe75-f4a9-90c7-1f89-abdf1175c0be",
          "citation": "orphan drug",
          "doc_type": "ORPHAN DRUG",
          "public_domain": true
        },
        {
          "uuid": "b7cffa4c-1e5d-41d6-8802-1a42207d85bc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d2c01951-bd6c-ff45-12b1-ac98e3cb168a",
          "citation": "Grundlingh, Johann, et al. \"2, 4-dinitrophenol (DNP): a weight loss agent with significant acute toxicity and risk of death.\" Journal of medical toxicology 7.3 (2011): 205.",
          "url": "https://link.springer.com/article/10.1007/s13181-011-0162-6",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "a7110d16-1e0d-2357-db39-cefe088ecef1",
          "citation": "Wallace, Kendall B., and A. A. Starkov. \"Mitochondrial targets of drug toxicity.\" Annual review of pharmacology and toxicology 40.1 (2000): 353-388.",
          "url": "https://www.annualreviews.org/doi/abs/10.1146/annurev.pharmtox.40.1.353",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "674fea66-9dfe-4e0b-efa6-964bb8f25b96",
          "citation": "Grundlingh, Johann, et al. \"2, 4-dinitrophenol (DNP): a weight loss agent with significant acute toxicity and risk of death.\" Journal of medical toxicology 7.3 (2011): 205.",
          "url": "https://link.springer.com/article/10.1007/s13181-011-0162-6",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "ab57bb7b-64a3-288a-5d97-78e91efee32a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "827d2308-a86a-08b4-ebca-4f839a960d5f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f8b7c3bc-206d-6dbf-a438-ad76a0a6aa6b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8bcf1adb-59dc-92fe-baaa-4854dd481b61",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1214f716-f6e0-4115-8dbf-9669727eb646",
          "id": "1214f716-f6e0-4115-8dbf-9669727eb646",
          "molfile": "\n  Marvin  01132101092D          \n\n 13 13  0  0  0  0            999 V2000\n    0.6893   -2.4691    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4069   -2.0602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0987   -2.4742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8266   -2.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8266   -1.2577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1399   -0.8333    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4069   -1.2371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7176   -0.8282    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.1986    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.7356    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5571   -0.8668    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.2515   -1.2912    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    3.5571   -0.0335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\nM  CHG  4   8   1   9  -1  11   1  12  -1\nM  END",
          "smiles": "c1cc(c(cc1[N+](=O)[O-])[N+](=O)[O-])O",
          "formula": "C6H4N2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "200101ba-203e-4da2-a9d5-e599d8d1d955"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "184.1066",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c37a2e35-b253-4a59-911a-62bf9b99c93e",
      "version": "22",
      "structure": {
        "id": "37f6f0cb-a7ff-4635-aa88-2c5de49c30fc",
        "molfile": "\n  Marvin  01132102582D          \n\n 13 13  0  0  0  0            999 V2000\n   14.5605   -4.0745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8713   -3.6656    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   16.7107   -3.7042    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   15.2935   -3.6707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9802   -4.0951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5605   -4.8976    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1537   -4.0360    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   17.4051   -4.1286    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.8893   -2.8374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7107   -2.8709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9802   -4.9233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.2523   -5.3116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8429   -5.3065    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  1  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  1  1  0  0  0  0\n  7  2  1  0  0  0  0\n  8  3  1  0  0  0  0\n  9  2  2  0  0  0  0\n 10  3  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12  6  2  0  0  0  0\n 13  6  1  0  0  0  0\n  5 11  2  0  0  0  0\nM  CHG  4   2   1   3   1   7  -1   8  -1\nM  END",
        "smiles": "c1cc(c(cc1[N+](=O)[O-])[N+](=O)[O-])O",
        "formula": "C6H4N2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "184.1066",
        "optical_activity": "NONE",
        "references": [
          "b566a556-494a-4cd9-a700-b8eaf06d1a61",
          "0f14bff7-c8ae-43fd-a881-571b06561c16",
          "e8fcfe75-f4a9-90c7-1f89-abdf1175c0be"
        ],
        "stereo_centers": 0
      },
      "unii": "Q13SKS21MN"
    }
  ]
}