{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7750e7e3-028b-44fe-b799-0077b383a1cb",
          "code": "53109-32-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=53109-32-3",
          "code_system": "CAS",
          "references": [
            "c24073f8-221e-4649-9f6d-10d9e61cccda",
            "17aa616c-4d65-4d2e-9148-d5ddd880a954"
          ]
        },
        {
          "uuid": "416eb71f-4fdc-44ca-a015-24ec29925e93",
          "code": "C015924",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67015924",
          "code_system": "MESH",
          "references": [
            "c24073f8-221e-4649-9f6d-10d9e61cccda"
          ]
        },
        {
          "uuid": "4d53e05b-198a-443f-bf50-88bccd8797c8",
          "code": "449094",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/449094",
          "code_system": "PUBCHEM",
          "references": [
            "c24073f8-221e-4649-9f6d-10d9e61cccda"
          ]
        },
        {
          "uuid": "3eeee3c9-7626-6797-6e3a-4bf5a719f68c",
          "code": "DB02414",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB02414",
          "code_system": "DRUG BANK",
          "references": [
            "67e70950-e670-5df5-0657-e873dcd7da39"
          ]
        },
        {
          "uuid": "9d217d4e-a9f0-4245-a1b0-0f39e56a4964",
          "code": "Q10817UXVT",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8a7c85e5-5cf6-a77c-cfb4-8d014150eee9",
          "code": "90039",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:90039",
          "code_system": "CHEBI",
          "references": [
            "67e70950-e670-5df5-0657-e873dcd7da39"
          ]
        },
        {
          "uuid": "a719e0cc-f3e1-0966-3a73-185141857fae",
          "code": "DTXSID90962567",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90962567",
          "code_system": "EPA CompTox",
          "references": [
            "67e70950-e670-5df5-0657-e873dcd7da39"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "611b9ee7-2291-426b-bed9-4f3e9fe55b71",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0cf38f91-0557-4a0a-9dc4-22a776eb9fea",
            "refuuid": "c552a699-3bc6-4682-a65c-96e5c55ca21a",
            "name": "CYCLO(HIS-PRO)",
            "unii": "Q10817UXVT",
            "linking_id": "Q10817UXVT",
            "ref_pname": "CYCLO(HIS-PRO)",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5454b44d-c165-41d7-aa2e-107a26cd9539",
          "name": "(3S,8AS)-3-(1H-IMIDAZOL-5-YLMETHYL)-2,3,6,7,8,8A-HEXAHYDROPYRROLO(1,2-A)PYRAZINE-1,4-DIONE",
          "stdName": "(3S,8AS)-3-(1H-IMIDAZOL-5-YLMETHYL)-2,3,6,7,8,8A-HEXAHYDROPYRROLO(1,2-A)PYRAZINE-1,4-DIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70512a05-cd06-431d-8fee-40055e4d5690",
            "5cc80a53-d444-4e6f-a240-373cc09a6fc6"
          ],
          "display_name": false
        },
        {
          "uuid": "dcd8324a-7b75-4b8b-acaf-4710df9b8115",
          "name": "CYCLO(HIS-PRO)",
          "stdName": "CYCLO(HIS-PRO)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70916921-3a63-47b4-95a9-9e49e87699b8"
          ],
          "display_name": true
        },
        {
          "uuid": "b3152237-fd5f-4a61-9b42-e7c03ae918a5",
          "name": "CYCLO(L-HIS-L-PRO)",
          "stdName": "CYCLO(L-HIS-L-PRO)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "70512a05-cd06-431d-8fee-40055e4d5690",
            "5cc80a53-d444-4e6f-a240-373cc09a6fc6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "70916921-3a63-47b4-95a9-9e49e87699b8",
          "citation": "sigma",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5cc80a53-d444-4e6f-a240-373cc09a6fc6",
          "citation": "http://www.chembase.com/cbid_449094.htm",
          "url": "http://www.chembase.com/cbid_449094.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "70512a05-cd06-431d-8fee-40055e4d5690",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c24073f8-221e-4649-9f6d-10d9e61cccda",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54705154-067e-4651-9b13-15d6becdd662",
          "citation": "SRS import [Q10817UXVT]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q10817UXVT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390467000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67e70950-e670-5df5-0657-e873dcd7da39",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "17aa616c-4d65-4d2e-9148-d5ddd880a954",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "45c6c036-d1a6-498b-ac05-fd50c0833e59",
          "id": "45c6c036-d1a6-498b-ac05-fd50c0833e59",
          "molfile": "\n  Marvin  01132103402D          \n\n 17 19  0  0  1  0            999 V2000\n    6.2918   -3.6453    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.9592   -4.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7042   -4.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8792   -4.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6243   -4.1302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8706   -3.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2032   -4.2795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7844   -2.9741    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.0307   -2.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3633   -3.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5787   -2.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0937   -3.5360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5787   -4.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3633   -3.9485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4518   -2.4892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2055   -2.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8729   -2.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  5  1  0  0  0  0\n  1 16  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  6  1  0  0  0  0\n  8  9  1  6  0  0  0\n  8 15  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  2  0  0  0  0\n 14 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
          "smiles": "C1C[C@H]2C(=O)N[C@@H](Cc3c[nH]cn3)C(=O)N2C1",
          "formula": "C11H14N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e84bbb28-cd15-4d94-b256-d8038f606dba"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "234.2549",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c552a699-3bc6-4682-a65c-96e5c55ca21a",
      "version": "6",
      "structure": {
        "id": "7340a500-7406-47fb-8117-2262b782a409",
        "molfile": "\n  Marvin  01132105582D          \n\n 18 20  0  0  1  0            999 V2000\n    5.6243   -4.1302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8706   -3.7946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7844   -2.9741    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0307   -2.6386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3633   -3.1235    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3633   -3.9485    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5787   -4.2035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0937   -3.5360    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5787   -2.8686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4518   -2.4892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2055   -2.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2918   -3.6453    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.9592   -4.1302    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7042   -4.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8792   -4.9148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0062   -3.2328    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8729   -2.3399    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2032   -4.2795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  6  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9  5  2  0  0  0  0\n 10  3  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12  1  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15  1  1  0  0  0  0\n 12 16  1  1  0  0  0\n 17 11  2  0  0  0  0\n 18  2  2  0  0  0  0\nM  END",
        "smiles": "C1C[C@@]2([H])C(=O)N[C@@H](Cc3cnc[nH]3)C(=O)N2C1",
        "formula": "C11H14N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "234.2549",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "70916921-3a63-47b4-95a9-9e49e87699b8",
          "54705154-067e-4651-9b13-15d6becdd662"
        ],
        "stereo_centers": 2
      },
      "unii": "Q10817UXVT"
    }
  ]
}