{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a3fd12b7-2026-44d9-a7b3-824febce2797",
          "code": "D11AX09",
          "comments": "ATC|DERMATOLOGICALS|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Other dermatologicals|oxaceprol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D11AX09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "88899a54-422d-443c-a7ed-f03341e4ded3",
          "code": "M01AX24",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Other antiinflammatory and antirheumatic agents, non-steroids|oxaceprol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M01AX24&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "00a7321c-ae69-492c-b497-3b322658c73e",
          "code": "QM01AX24",
          "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Other antiinflammatory and antirheumatic agents, non-steroids|oxaceprol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AX24&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "033db046-9bda-4f46-9bef-58d383c87e8c",
          "code": "33996-33-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33996-33-7",
          "code_system": "CAS",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711",
            "fd79c98f-acd8-4fac-8c43-ad91087c7950"
          ]
        },
        {
          "uuid": "0ae081f3-06c2-40d5-b8f9-46c1a9799a15",
          "code": "C90905",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C90905",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "39839ca7-53e4-4f58-a525-5c6b5bc6ab4d",
          "code": "OXACEPROL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Oxaceprol",
          "code_system": "WIKIPEDIA",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "37506a2f-91ba-44c2-a066-5f29ce98a645",
          "code": "QD11AX09",
          "comments": "VATC|OTHER DERMATOLOGICAL PREPARATIONS|OTHER DERMATOLOGICAL PREPARATIONS|Other dermatologicals|oxaceprol",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD11AX09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "436bbff4-6a1c-4513-9f7b-cd8b8ca774b7",
          "code": "3891",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=3891",
          "code_system": "INN",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "c3c8a21b-7181-4fbf-9d76-9d24eeb4c748",
          "code": "28068",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/28068/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "ed9a1712-da91-4eeb-9a47-d79f77c801a8",
          "code": "m8272",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8272?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "0dd2c316-e9b1-4234-ae80-b6fb5e625fe2",
          "code": "SUB09483MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "f020c3da-635c-405f-b97b-8c2a117b51bb",
          "code": "CHEMBL2105621",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2105621",
          "code_system": "ChEMBL",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "4140f699-152b-499f-94f0-41d91ccda38e",
          "code": "251-780-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.047.058",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "25668cb4-e38a-42ba-9b7b-b01ea7d60125",
          "code": "65784",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65784",
          "code_system": "PUBCHEM",
          "references": [
            "8b78d30b-4a0b-4d19-9d13-20bdbdf66711"
          ]
        },
        {
          "uuid": "62a7616e-0379-7d40-2d44-844264e62399",
          "code": "DTXSID2046410",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2046410",
          "code_system": "EPA CompTox",
          "references": [
            "4a5058ba-a21e-133e-e3bb-e39d21917528"
          ]
        },
        {
          "uuid": "51b5830b-b040-a34c-d198-36f1c9cd303e",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d1dd1bde-2991-229b-5fb4-52b23d4b8172"
          ]
        },
        {
          "uuid": "5fbe7dc5-102a-4224-be05-a33dea0dae3b",
          "code": "Q0XV76B96L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c09c9bb8-1efe-458a-58da-fa25efd33829",
          "code": "2005",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2005",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d1dd1bde-2991-229b-5fb4-52b23d4b8172"
          ]
        },
        {
          "uuid": "5f77e1fe-c33e-acce-726a-bffc456c056a",
          "code": "DB13363",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB13363",
          "code_system": "DRUG BANK",
          "references": [
            "d1dd1bde-2991-229b-5fb4-52b23d4b8172"
          ]
        },
        {
          "uuid": "dcc0980d-0cbc-61a1-e5e7-f8de1cb4d644",
          "code": "Q0XV76B96L",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=Q0XV76B96L",
          "code_system": "DAILYMED",
          "references": [
            "8257378c-cef9-8b6d-10c2-904c5312c938"
          ]
        },
        {
          "uuid": "6473295f-f3a7-cba6-a332-9df7f15fb025",
          "code": "100000083577",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "07c32d52-55d1-4808-1150-a339da8a6729"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6d086f5b-da44-41e7-a8bc-2c0fbd4d8030",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5d69c7bd-ed06-400e-a5e0-ebb54e1e9beb",
            "refuuid": "52fb681b-0b2b-47d7-a047-f0e5b7620e89",
            "name": "OXACEPROL",
            "unii": "Q0XV76B96L",
            "linking_id": "Q0XV76B96L",
            "ref_pname": "OXACEPROL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fb5c3b83-c3a9-44f9-9f37-e0e73aabe94a",
          "name": "(-)-1-ACETYL-4-HYDROXY-L-PROLINE",
          "stdName": "(-)-1-ACETYL-4-HYDROXY-L-PROLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "13244676-db03-4120-9ab0-144539b9ae32"
          ],
          "display_name": false
        },
        {
          "uuid": "5c63f4cc-b072-4922-bfbf-96777b72e3a6",
          "name": "ACETYL HYDROXYPROLINE",
          "stdName": "ACETYL HYDROXYPROLINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "127e407a-e3d3-4927-ad19-09dcc245bc99",
            "38d64ea5-f492-4eb8-9458-4d3b5c1c3e51",
            "f2dc7472-4c7a-4937-ac48-331b2e136d03"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "813ef224-51db-438f-9590-177e53323a14",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "738bf459-4215-4993-94f4-f93cd72a7203",
          "name": "JONCTUM",
          "stdName": "JONCTUM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3b6395c-b264-42d1-97e4-cb4dad7cf6df",
            "05ccf66b-7a07-44e1-a5aa-a55f73ce7d06"
          ],
          "display_name": false
        },
        {
          "uuid": "65114a0a-c166-42a7-87bb-ca0276a4b6d4",
          "name": "N-ACETYL-L-HYDROXYPROLINE",
          "stdName": "N-ACETYL-L-HYDROXYPROLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b36e4a-1d41-450e-a064-3faab73b3701"
          ],
          "display_name": false
        },
        {
          "uuid": "25de5e7a-1930-4c08-a781-2e5dcbd8be24",
          "name": "N-ACETYLHYDROXYPROLINE",
          "stdName": "N-ACETYLHYDROXYPROLINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c88b7929-c695-4a6d-bfe9-bf61c382db29"
          ],
          "display_name": false
        },
        {
          "uuid": "3df04672-e3c4-460b-a65d-c7cc5a15f3e0",
          "name": "OXACEPROL",
          "stdName": "OXACEPROL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d66aa10a-8230-49b0-885f-5364fbdd68cd",
            "3ea06582-9b99-445f-a5a3-e27e96305a24",
            "13244676-db03-4120-9ab0-144539b9ae32",
            "ce8445de-fadd-40d5-bf59-45a145873796",
            "4e1fc004-55b9-43f1-be5b-e4557f89d276",
            "dbb29346-1e9c-4e6c-8f93-722294df5df6",
            "1bfa6638-719c-49ec-bbf2-175d3af03818",
            "c3cc3ab7-7ce5-421f-9f0c-31f8b08ce784",
            "144f0217-affc-4c35-9cc7-15faef4c2b4d"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "d84883ea-2d15-421b-a38f-d648919a9f84",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ebc7b7d1-66f1-47d6-a9a1-3b2838da40d7",
          "name": "OXACEPROL [MART.]",
          "stdName": "OXACEPROL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c3cc3ab7-7ce5-421f-9f0c-31f8b08ce784"
          ],
          "display_name": false
        },
        {
          "uuid": "f51530b2-3936-49c8-8087-963aeb0a93fb",
          "name": "OXACEPROL [MI]",
          "stdName": "OXACEPROL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1bfa6638-719c-49ec-bbf2-175d3af03818"
          ],
          "display_name": false
        },
        {
          "uuid": "abb3751e-a850-7dd5-5ae2-a5c7ce1b15be",
          "name": "Oxaceprol [WHO-DD]",
          "stdName": "OXACEPROL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8018f5f2-b71d-b81f-e898-c869a449a077"
          ],
          "display_name": false
        },
        {
          "uuid": "ac81f9b9-14ac-4171-8c2f-1ebc8383515c",
          "name": "oxaceprol [INN]",
          "stdName": "OXACEPROL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dbb29346-1e9c-4e6c-8f93-722294df5df6"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c88b7929-c695-4a6d-bfe9-bf61c382db29",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8b78d30b-4a0b-4d19-9d13-20bdbdf66711",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390631000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe067b19-47aa-40b3-96eb-cbf447a55f72",
          "citation": "SRS import [Q0XV76B96L]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q0XV76B96L",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390631000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e1fc004-55b9-43f1-be5b-e4557f89d276",
          "citation": "OXACEPROL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3ea06582-9b99-445f-a5a3-e27e96305a24",
          "citation": "OXACEPROL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d66aa10a-8230-49b0-885f-5364fbdd68cd",
          "citation": "OXACEPROL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "38d64ea5-f492-4eb8-9458-4d3b5c1c3e51",
          "citation": "ACETYL HYDROXYPROLINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ce8445de-fadd-40d5-bf59-45a145873796",
          "citation": "OXACEPROL [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "13244676-db03-4120-9ab0-144539b9ae32",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "dbb29346-1e9c-4e6c-8f93-722294df5df6",
          "citation": "INN Proposed List 34",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL34.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c3cc3ab7-7ce5-421f-9f0c-31f8b08ce784",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1bfa6638-719c-49ec-bbf2-175d3af03818",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "127e407a-e3d3-4927-ad19-09dcc245bc99",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7b36e4a-1d41-450e-a064-3faab73b3701",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05ccf66b-7a07-44e1-a5aa-a55f73ce7d06",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a3b6395c-b264-42d1-97e4-cb4dad7cf6df",
          "citation": "D07215",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2dc7472-4c7a-4937-ac48-331b2e136d03",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "144f0217-affc-4c35-9cc7-15faef4c2b4d",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a5058ba-a21e-133e-e3bb-e39d21917528",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=33996-33-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d1dd1bde-2991-229b-5fb4-52b23d4b8172",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fd79c98f-acd8-4fac-8c43-ad91087c7950",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8257378c-cef9-8b6d-10c2-904c5312c938",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8018f5f2-b71d-b81f-e898-c869a449a077",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "07c32d52-55d1-4808-1150-a339da8a6729",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f38c23ff-16df-458c-b12a-3fe92d7d0a63",
          "id": "f38c23ff-16df-458c-b12a-3fe92d7d0a63",
          "molfile": "\n  Marvin  01132112382D          \n\n 12 12  0  0  1  0            999 V2000\n    3.2167   -0.9299    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    2.7951   -1.6390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9608   -0.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6243    0.3378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6160    1.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3281    1.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9012    1.5720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2935   -0.1447    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    4.0376   -0.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9786   -0.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2332    0.6048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4120   -0.5831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  3  1  1  0  0  0  0\n  1  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  8  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  1  6  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "CC(=O)N1C[C@@H](C[C@H]1C(=O)O)O",
          "formula": "C7H11NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "7a7419de-f8f4-4ff6-8b94-8b33d1ebc8e3"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "173.1668",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "52fb681b-0b2b-47d7-a047-f0e5b7620e89",
      "version": "13",
      "structure": {
        "id": "86dce78b-b960-4c25-978c-9a010e2e8ab6",
        "molfile": "\n  Marvin  01132107002D          \n\n 12 12  0  0  1  0            999 V2000\n    3.2167   -0.9299    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.0376   -0.9299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2935   -0.1447    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.6243    0.3378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9608   -0.1447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7951   -1.6390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6160    1.1587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9012    1.5720    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3281    1.5777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9786   -0.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2332    0.6048    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4120   -0.5831    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  4  7  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  8  2  0  0  0  0\n  3  4  1  0  0  0  0\n  7  9  1  0  0  0  0\n  4  5  1  0  0  0  0\n  3 10  1  6  0  0  0\n  5  1  1  0  0  0  0\n  1  2  1  0  0  0  0\n 10 11  2  0  0  0  0\n  1  6  1  1  0  0  0\n 10 12  1  0  0  0  0\nM  END",
        "smiles": "CC(=O)N1C[C@@H](C[C@H]1C(=O)O)O",
        "formula": "C7H11NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "173.1668",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "fe067b19-47aa-40b3-96eb-cbf447a55f72",
          "13244676-db03-4120-9ab0-144539b9ae32",
          "dbb29346-1e9c-4e6c-8f93-722294df5df6"
        ],
        "stereo_centers": 2
      },
      "unii": "Q0XV76B96L"
    }
  ]
}