{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "846fbc57-5131-42de-bb78-b594ed778fef", "code": "41723-98-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=41723-98-2", "code_system": "CAS", "references": [ "e5d73127-1e6d-46d0-97c3-3020fa3dae5a", "9573309d-42df-4c38-8f53-1ed93db4a274" ] }, { "uuid": "ef66c286-7425-41b1-abed-c3d1016dcdc7", "code": "255-515-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.050.450", "code_system": "ECHA (EC/EINECS)", "references": [ "e5d73127-1e6d-46d0-97c3-3020fa3dae5a" ] }, { "uuid": "4424c1b3-0e87-4330-9ec1-c34b422cf0d3", "code": "121494081", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/121494081", "code_system": "PUBCHEM", "references": [ "e5d73127-1e6d-46d0-97c3-3020fa3dae5a" ] }, { "uuid": "a5d42dc8-c909-db17-cd27-7113c7e014ea", "code": "DTXSID6052087", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6052087", "code_system": "EPA CompTox", "references": [ "7a729412-121b-8fe3-ffc5-237e84e6b5b6" ] }, { "uuid": "7f1cca30-80b7-4a67-ad43-ae5f465c9595", "code": "Q08MFL8271", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "2c6575a6-dd2d-4fe1-ae48-97d537919c4a", "name": "9-(9,12-EPOXYETHYL)-4-METHYLTRICYCLO(6.2.1.02,7)UNDEC-4-ENE", "stdName": "9-(9,12-EPOXYETHYL)-4-METHYLTRICYCLO(6.2.1.02,7)UNDEC-4-ENE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6d7349d3-6a87-4956-94e2-05fc6cd7fb82", "e3525bab-b511-4c06-9348-7a926d6a77ab" ], "display_name": true }, { "uuid": "413fa70d-63d6-42bd-a0ec-946d21fe9441", "name": "SPIRO(1,4-METHANONAPHTHALENE-2(1H),2'-OXIRANE), 3,4,4A,5,8,8A-HEXAHYDRO-3',6-DIMETHYL-", "stdName": "SPIRO(1,4-METHANONAPHTHALENE-2(1H),2'-OXIRANE), 3,4,4A,5,8,8A-HEXAHYDRO-3',6-DIMETHYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "12a4ebbd-657c-4ee2-b156-97e52ac8d375", "e3525bab-b511-4c06-9348-7a926d6a77ab" ], "display_name": false } ], "references": [ { "uuid": "6d7349d3-6a87-4956-94e2-05fc6cd7fb82", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "e3525bab-b511-4c06-9348-7a926d6a77ab", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "12a4ebbd-657c-4ee2-b156-97e52ac8d375", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e5d73127-1e6d-46d0-97c3-3020fa3dae5a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392253000, "tags": [ "NOMEN" ] }, { "uuid": "73957338-4afc-4fe9-8805-4de320e5d315", "citation": "SRS import [Q08MFL8271]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q08MFL8271", "doc_type": "SRS", "public_domain": true, "document_date": 1493392253000, "tags": [ "NOMEN" ] }, { "uuid": "7a729412-121b-8fe3-ffc5-237e84e6b5b6", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=41723-98-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9573309d-42df-4c38-8f53-1ed93db4a274", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "7d86654c-fe89-4220-9d2d-0332c1065098", "id": "7d86654c-fe89-4220-9d2d-0332c1065098", "molfile": "\n Marvin 01132106312D \n\n 15 18 0 0 0 0 999 V2000\n 9.5842 -6.4292 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 10.0606 -5.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5844 -4.7792 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 8.8698 -5.1916 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 8.1554 -4.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4409 -5.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4409 -6.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7264 -6.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1553 -6.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8698 -6.0166 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.6137 -5.0100 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 10.2987 -6.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4387 -5.0101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0262 -4.2955 0.0000 C 0 0 0 0 0 0 0 0 0 3 0 0\n 11.0263 -3.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 10 1 0 0 0 0\n 1 12 1 0 0 0 0\n 3 2 1 1 0 0 0\n 3 4 1 0 0 0 0\n 11 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 10 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 14 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\nM END", "smiles": "CC1=CCC2C(C1)[C@@H]3C[C@H]2C4(C3)C(C)O4", "formula": "C14H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4966be03-5aec-44a1-a902-e88b67e67945" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "204.3085", "optical_activity": "UNSPECIFIED", "stereo_centers": 6 } ], "definition_level": "COMPLETE", "uuid": "603e560a-01ba-47d1-a4d2-ed53717e0b89", "version": "3", "structure": { "id": "5ac50dab-d39c-428e-b811-5fb50fa924d1", "molfile": "\n Marvin 01132104422D \n\n 15 18 0 0 1 0 999 V2000\n 11.0263 -3.4705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0262 -4.2955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6137 -5.0100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5844 -4.7792 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.8698 -5.1916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8698 -6.0166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5842 -6.4292 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 10.0606 -5.6042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2987 -6.0167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1553 -6.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4409 -6.0164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7264 -6.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4409 -5.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1554 -4.7791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4387 -5.0101 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 4 8 1 1 0 0 0\n 7 8 1 1 0 0 0\n 3 9 1 0 0 0 0\n 9 7 1 0 0 0 0\n 6 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 13 11 2 0 0 0 0\n 14 13 1 0 0 0 0\n 5 14 1 0 0 0 0\n 3 15 1 0 0 0 0\n 2 15 1 0 0 0 0\nM END", "smiles": "CC1=CCC2C(C1)[C@@H]3C[C@H]2C4(C3)C(C)O4", "formula": "C14H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "204.3085", "optical_activity": "UNSPECIFIED", "references": [ "73957338-4afc-4fe9-8805-4de320e5d315", "12a4ebbd-657c-4ee2-b156-97e52ac8d375" ], "stereo_centers": 6 }, "unii": "Q08MFL8271" } ] }