{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "7f45cc37-ad67-4743-92b5-86a2e1b5b100", "code": "2748-74-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2748-74-5", "code_system": "CAS", "references": [ "685b2fe6-0693-4164-b227-899e732dc89f", "0740101f-1f59-470f-b599-6a512af00272" ] }, { "uuid": "1b590681-7683-4bca-a845-c9c799e396d5", "code": "CHEMBL2106214", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2106214", "code_system": "ChEMBL", "references": [ "685b2fe6-0693-4164-b227-899e732dc89f" ] }, { "uuid": "34b2d676-c7e2-4476-a8c4-e9bf2670f840", "code": "20055473", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/20055473", "code_system": "PUBCHEM", "references": [ "685b2fe6-0693-4164-b227-899e732dc89f" ] }, { "uuid": "6fb7045c-e35b-4f35-898f-279404419e59", "code": "Q083G8ZAJH", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d8b04a54-2635-26d7-fe43-0d5ca2b29d4a", "code": "Diacetylnalorphine", "type": "PRIMARY", "url": "https://en.wikipedia.org/wiki/Diacetylnalorphine", "code_system": "WIKIPEDIA", "references": [ "2b3497c5-0da0-08c9-7f04-bd64a9b33446" ] }, { "uuid": "155f9a89-5414-9699-9465-04d7bd5f5b9a", "code": "DTXSID401043407", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401043407", "code_system": "EPA CompTox" } ], "relationships": [ { "uuid": "2a860d90-9ff4-438c-a1f2-2dcf7dd79ae6", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "2abfa77b-b856-4715-87a2-170550b8bf36", "refuuid": "151a0882-71c4-4b25-97c8-9a1b6a272d65", "name": "DIACETYLNALORPHINE", "unii": "Q083G8ZAJH", "linking_id": "Q083G8ZAJH", "ref_pname": "DIACETYLNALORPHINE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "bc9b58db-9694-431b-8ec2-57d9f076904e", "name": "(-)-(5R,6S)-9A-ALLYL-4,5-EPOXYMORPHIN-7-EN-3,6-DIYLDIACETATE", "stdName": "(-)-(5R,6S)-9A-ALLYL-4,5-EPOXYMORPHIN-7-EN-3,6-DIYLDIACETATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fe539265-47c6-4939-942b-f2501c826e3e" ], "display_name": false }, { "uuid": "71a64de1-b417-4101-85cf-4819ad21ab1a", "name": "DIACETYLNALORPHINE", "stdName": "DIACETYLNALORPHINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "fe539265-47c6-4939-942b-f2501c826e3e" ], "display_name": true } ], "references": [ { "uuid": "fe539265-47c6-4939-942b-f2501c826e3e", "citation": "USP DICTIONARY 2009", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "685b2fe6-0693-4164-b227-899e732dc89f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390700000, "tags": [ "NOMEN" ] }, { "uuid": "356c1dfe-b983-4d85-8d52-69c515ba1bc5", "citation": "SRS import [Q083G8ZAJH]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q083G8ZAJH", "doc_type": "SRS", "public_domain": true, "document_date": 1493390700000, "tags": [ "NOMEN" ] }, { "uuid": "2b3497c5-0da0-08c9-7f04-bd64a9b33446", "citation": "WIKI", "doc_type": "WIKI", "public_domain": true }, { "uuid": "0740101f-1f59-470f-b599-6a512af00272", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "04e5b350-c334-405f-9ada-e5436eaf7049", "id": "04e5b350-c334-405f-9ada-e5436eaf7049", "molfile": "\n Marvin 01132100332D \n\n 29 33 0 0 1 0 999 V2000\n 8.1160 -5.9815 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 7.3128 -6.7083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4497 -5.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8644 -5.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4775 -4.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8930 -3.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.7032 -3.8590 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.2620 -3.1599 0.0000 N 0 0 1 0 0 0 0 0 0 0 0 0\n 8.9416 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8145 -1.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4942 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2849 -3.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2730 -4.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6991 -5.2847 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.1223 -4.5883 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 8.9460 -4.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3708 -5.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9182 -5.9976 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 9.3198 -6.7664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1866 -6.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.6515 -6.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5883 -7.5717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6456 -4.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2224 -5.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6396 -5.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2041 -6.6824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3367 -6.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9046 -5.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9014 -7.4308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 14 1 0 0 0 0\n 1 18 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 3 25 2 0 0 0 0\n 5 4 2 0 0 0 0\n 14 4 1 6 0 0 0\n 6 5 1 0 0 0 0\n 5 23 1 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 1 0 0 0\n 15 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 12 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 6 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 6 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 20 22 2 0 0 0 0\n 24 23 2 0 0 0 0\n 25 24 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\nM END", "smiles": "C=CCN1CC[C@@]23[C@H]4C=C[C@@H]([C@@H]2Oc5c(ccc(C[C@H]41)c53)OC(=O)C)OC(=O)C", "formula": "C23H25NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "437c8849-50ab-489d-91bb-17fbfd3dd863" }, "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "395.4492", "optical_activity": "UNSPECIFIED", "stereo_centers": 5 } ], "definition_level": "COMPLETE", "uuid": "151a0882-71c4-4b25-97c8-9a1b6a272d65", "version": "4", "structure": { "id": "67a0eabe-e4ca-4f77-a617-c7142a431d60", "molfile": "\n Marvin 01132105232D \n\n 31 35 0 0 1 0 999 V2000\n 10.6515 -6.0706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1866 -6.8029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5883 -7.5717 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3198 -6.7664 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9182 -5.9976 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 9.3708 -5.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9460 -4.6048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1223 -4.5883 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.7032 -3.8590 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.8930 -3.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4775 -4.5555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8644 -5.2680 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4497 -5.9482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6396 -5.9320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2041 -6.6824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3367 -6.6805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9046 -5.9283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9014 -7.4308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2224 -5.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6456 -4.5388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.3128 -6.7083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1160 -5.9815 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 7.6991 -5.2847 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 7.2730 -4.6310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2849 -3.6256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2620 -3.1599 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 8.9416 -2.6208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8145 -1.7627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4942 -1.2236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3113 -6.7567 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5375 -3.8873 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 1 6 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 14 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 11 20 1 0 0 0 0\n 13 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 5 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 8 23 1 0 0 0 0\n 12 23 1 0 0 0 0\n 23 24 1 1 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 9 26 1 1 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 22 30 1 1 0 0 0\n 8 31 1 1 0 0 0\nM END", "smiles": "C=CCN1CC[C@@]23[C@@]4([H])C=C[C@@H]([C@]2([H])Oc5c(ccc(C[C@H]41)c53)OC(=O)C)OC(=O)C", "formula": "C23H25NO5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 5, "ez_centers": 0, "molecular_weight": "395.4492", "optical_activity": "UNSPECIFIED", "references": [ "fe539265-47c6-4939-942b-f2501c826e3e", "356c1dfe-b983-4d85-8d52-69c515ba1bc5" ], "stereo_centers": 5 }, "unii": "Q083G8ZAJH" } ] }