{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "37245db2-7d32-4cff-b6c3-02f64b4af623", "code": "22260-42-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=22260-42-0", "code_system": "CAS", "references": [ "0f75b8a2-2ed7-4d38-95b9-ad307624c0f5", "676b5492-6212-44a9-b1ee-8b070d273752" ] }, { "uuid": "ace4827a-5424-4acd-914a-6e419f46b5aa", "code": "C045237", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67045237", "code_system": "MESH", "references": [ "0f75b8a2-2ed7-4d38-95b9-ad307624c0f5" ] }, { "uuid": "5b57f4e3-b92c-4446-9b7b-67eca0686e3a", "code": "244-880-6", "type": "PRIMARY", "code_system": "ECHA (EC/EINECS)", "references": [ "0f75b8a2-2ed7-4d38-95b9-ad307624c0f5" ] }, { "uuid": "1b1e60cc-79a2-44f7-9eee-b50623e8a14c", "code": "198004", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/198004", "code_system": "PUBCHEM", "references": [ "0f75b8a2-2ed7-4d38-95b9-ad307624c0f5" ] }, { "uuid": "3b9c6fe9-a63f-409a-b771-6e8a44c0bb4f", "code": "Q06KJ82A9S", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "ff582884-3705-4750-8c55-85df67b834ca", "name": "(+)-2,2'-DIMETHYLBEBEERINE", "stdName": "(+)-2,2'-DIMETHYLBEBEERINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8792fad4-a029-4e97-9b94-ae79bda61d41", "6c66394c-cb0e-4ac7-bb4d-8a34a1f7c245" ], "display_name": false }, { "uuid": "8afbe7ce-67aa-4706-aca0-063a1405d9b7", "name": "(+)-CURARINE", "stdName": "(+)-CURARINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8792fad4-a029-4e97-9b94-ae79bda61d41", "6c66394c-cb0e-4ac7-bb4d-8a34a1f7c245" ], "display_name": false }, { "uuid": "7e181876-e35f-4cd4-b8ca-1e88579510e5", "name": "13H-4,6:21,24-DIETHENO-8,12-METHENO-1H-PYRIDO(3',2':14,15)(1,11)DIOXACYCLOEICOSINO(2,3,4-IJ)ISOQUINOLINIUM, 2,3,13A,14,15,16,25,25A-OCTAHYDRO-9,19-DIHYDROXY-18,29-DIMETHOXY-1,1,14,14-TETRAMETHYL-, (13AS,25AS)-", "stdName": "13H-4,6:21,24-DIETHENO-8,12-METHENO-1H-PYRIDO(3',2':14,15)(1,11)DIOXACYCLOEICOSINO(2,3,4-IJ)ISOQUINOLINIUM, 2,3,13A,14,15,16,25,25A-OCTAHYDRO-9,19-DIHYDROXY-18,29-DIMETHOXY-1,1,14,14-TETRAMETHYL-, (13AS,25AS)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8792fad4-a029-4e97-9b94-ae79bda61d41", "6c66394c-cb0e-4ac7-bb4d-8a34a1f7c245" ], "display_name": false }, { "uuid": "d7141036-5c96-40af-952b-2ff60600b1b9", "name": "BEBEERINE, 2,2'-DIMETHYL-, (+)-", "stdName": "BEBEERINE, 2,2'-DIMETHYL-, (+)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8792fad4-a029-4e97-9b94-ae79bda61d41", "6c66394c-cb0e-4ac7-bb4d-8a34a1f7c245" ], "display_name": false }, { "uuid": "b5173f3a-6dd5-452d-a03e-870290b10fa4", "name": "BEBEERINIUM, 2,2'-DIMETHYL-", "stdName": "BEBEERINIUM, 2,2'-DIMETHYL-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8792fad4-a029-4e97-9b94-ae79bda61d41", "6c66394c-cb0e-4ac7-bb4d-8a34a1f7c245" ], "display_name": false }, { "uuid": "b583afae-64a7-4293-b355-19530c9aec56", "name": "CURARINE", "stdName": "CURARINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ed7196bc-2e05-4cb2-b017-1eabac4afb0a", "916d14dc-f660-435b-84e6-49241549ae11" ], "display_name": true }, { "uuid": "20dfb7cc-6051-471d-9f4f-c92899ac1c9c", "name": "D-CURARINE", "stdName": "D-CURARINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8792fad4-a029-4e97-9b94-ae79bda61d41", "9f5c7ac6-1dd3-455c-912b-34f063f2581c" ], "display_name": false }, { "uuid": "30ed1768-b099-47e4-ae3a-e75daee61c2b", "name": "TUBOCURARANIUM, 7',12'-DIHYDROXY-6,6'-DIMETHOXY-2,2,2',2'-TETRAMETHYL-, (1'.ALPHA.)-", "stdName": "TUBOCURARANIUM, 7',12'-DIHYDROXY-6,6'-DIMETHOXY-2,2,2',2'-TETRAMETHYL-, (1'.ALPHA.)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "8792fad4-a029-4e97-9b94-ae79bda61d41", "6c66394c-cb0e-4ac7-bb4d-8a34a1f7c245" ], "display_name": false } ], "references": [ { "uuid": "916d14dc-f660-435b-84e6-49241549ae11", "citation": "CHEMID 2011 Drugportal", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ed7196bc-2e05-4cb2-b017-1eabac4afb0a", "citation": "DRUGPORTAL 2011", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6c66394c-cb0e-4ac7-bb4d-8a34a1f7c245", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8792fad4-a029-4e97-9b94-ae79bda61d41", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9f5c7ac6-1dd3-455c-912b-34f063f2581c", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "0f75b8a2-2ed7-4d38-95b9-ad307624c0f5", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391215000, "tags": [ "NOMEN" ] }, { "uuid": "5c3d9c25-ed42-4cd0-9192-a8df0fd26e41", "citation": "SRS import [Q06KJ82A9S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=Q06KJ82A9S", "doc_type": "SRS", "public_domain": true, "document_date": 1493391215000, "tags": [ "NOMEN" ] }, { "uuid": "7d40aa4e-83b7-4d5e-a41a-75b102cab99c", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "676b5492-6212-44a9-b1ee-8b070d273752", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "da5225ac-a147-4045-96e6-56f3ca913c78", "id": "da5225ac-a147-4045-96e6-56f3ca913c78", "molfile": "\n Marvin 01132111192D \n\n 46 52 0 0 1 0 999 V2000\n 8.2663 -2.3977 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.9685 -2.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9685 -3.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2500 -4.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2500 -4.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9613 -5.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9613 -6.1422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2781 -6.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0099 -6.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7094 -6.4561 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 9.0099 -7.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7313 -8.1028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7313 -8.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3076 -8.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5852 -7.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8761 -8.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1319 -7.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1319 -6.9209 0.0000 N 0 3 1 0 0 0 0 0 0 3 0 0\n 5.5423 -6.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4308 -7.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8463 -6.4944 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 6.1204 -6.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1204 -5.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8403 -4.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8403 -3.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1289 -3.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1289 -2.5487 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 5.4201 -3.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4201 -2.3850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1220 -1.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8393 -2.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5515 -1.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5515 -1.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2690 -0.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9890 -1.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9890 -1.9804 0.0000 N 0 3 2 0 0 0 0 0 0 3 0 0\n 9.5674 -2.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6983 -1.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8372 -0.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1220 -1.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4084 -0.7381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4084 0.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4201 -4.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5852 -6.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6799 -4.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6799 -4.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 32 1 1 0 0 0 0\n 1 36 1 6 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 46 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 45 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 44 2 0 0 0 0\n 9 10 1 0 0 0 0\n 11 9 2 0 0 0 0\n 11 12 1 0 0 0 0\n 14 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 15 14 2 0 0 0 0\n 15 16 1 0 0 0 0\n 15 44 1 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 1 0 0 0 0\n 21 18 1 6 0 0 0\n 21 22 1 0 0 0 0\n 44 21 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 43 23 2 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 26 28 2 0 0 0 0\n 29 28 1 0 0 0 0\n 28 43 1 0 0 0 0\n 30 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 40 30 2 0 0 0 0\n 31 32 2 0 0 0 0\n 33 32 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 39 2 0 0 0 0\n 35 34 1 0 0 0 0\n 36 35 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 45 46 1 0 0 0 0\nM CHG 4 10 -1 18 1 27 -1 36 1\nM END", "smiles": "C[N@+]1(C)CCc2cc(c3cc2[C@@H]1Cc4ccc(cc4)Oc5c6c(CC[N@+](C)(C)[C@H]6Cc7ccc(c(c7)O3)[O-])cc(c5[O-])OC)OC", "formula": "C38H42N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "MIXED", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "7c974e4c-9f6c-40c5-b3b8-a6fa832beb51" }, "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "622.7513", "optical_activity": "UNSPECIFIED", "stereo_centers": 2 } ], "definition_level": "COMPLETE", "uuid": "81bbbdea-a61d-4aa0-9a4d-240334dae80d", "version": "2", "structure": { "id": "de28cd1f-61dd-49b5-b4eb-056aba84f036", "molfile": "\n Marvin 01132111312D \n\n 48 54 0 0 1 0 999 V2000\n 9.0099 -7.7006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0099 -6.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2781 -6.4763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5852 -6.8998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8463 -6.4944 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 6.1204 -6.0998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1204 -5.0237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4201 -4.6054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4201 -3.7839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1289 -3.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1289 -2.5487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8403 -3.7880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8403 -4.6129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4201 -2.3850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1220 -1.9806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1220 -1.1497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8372 -0.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5515 -1.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5515 -1.9781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8393 -2.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2663 -2.3977 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.9890 -1.9804 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 8.9890 -1.1479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2690 -0.7326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5674 -2.5627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6983 -1.5661 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9685 -2.8060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9685 -3.6296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2500 -4.0351 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2500 -4.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9613 -5.2745 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6799 -4.8620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.6799 -4.0407 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.9613 -6.1422 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2663 -3.2178 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4084 -0.7381 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4084 0.0856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8463 -5.6742 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1319 -6.9209 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 5.5423 -6.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4308 -7.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1319 -7.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8761 -8.1593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5852 -7.7323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3076 -8.1263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7094 -6.4561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7313 -8.1028 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7313 -8.9262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 10 2 0 0 0 0\n 13 12 1 0 0 0 0\n 7 13 2 0 0 0 0\n 14 9 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 17 16 1 0 0 0 0\n 18 17 2 0 0 0 0\n 18 19 1 0 0 0 0\n 20 19 2 0 0 0 0\n 15 20 1 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 18 24 1 0 0 0 0\n 22 25 1 0 0 0 0\n 22 26 1 0 0 0 0\n 21 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 33 28 1 0 0 0 0\n 31 34 1 0 0 0 0\n 3 34 1 0 0 0 0\n 21 35 1 6 0 0 0\n 16 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 5 38 1 6 0 0 0\n 5 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 41 1 0 0 0 0\n 39 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 44 43 1 0 0 0 0\n 44 45 2 0 0 0 0\n 45 1 1 0 0 0 0\n 44 4 1 0 0 0 0\n 2 46 1 0 0 0 0\n 1 47 1 0 0 0 0\n 47 48 1 0 0 0 0\nM CHG 2 22 1 39 1\nM END", "smiles": "C[N+]1(C)CCc2cc(c3cc2[C@]1([H])Cc4ccc(cc4)Oc5c6c(CC[N+](C)(C)[C@@]6([H])Cc7ccc(c(c7)O3)O)cc(c5O)OC)OC", "formula": "C38H44N2O6", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 2, "ez_centers": 0, "molecular_weight": "624.7672", "optical_activity": "UNSPECIFIED", "references": [ "7d40aa4e-83b7-4d5e-a41a-75b102cab99c", "5c3d9c25-ed42-4cd0-9192-a8df0fd26e41" ], "stereo_centers": 2 }, "unii": "Q06KJ82A9S" } ] }