{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "441a21eb-2dca-45cd-be81-31f47f25e44b",
          "code": "26747-90-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=26747-90-0",
          "code_system": "CAS",
          "references": [
            "a9fe3dcc-3761-4631-ab92-11e918d8926d",
            "3980b8b0-a739-4e72-a82d-3c827cb09b0b"
          ]
        },
        {
          "uuid": "53b64b98-cd2a-4e8f-ab0b-0beb7416cd71",
          "code": "247-953-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.043.579",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a9fe3dcc-3761-4631-ab92-11e918d8926d"
          ]
        },
        {
          "uuid": "712238f2-d576-49af-b08c-6a1503ef7665",
          "code": "93102",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93102",
          "code_system": "PUBCHEM",
          "references": [
            "a9fe3dcc-3761-4631-ab92-11e918d8926d"
          ]
        },
        {
          "uuid": "fdca1610-6362-97c2-ff51-467fefff715f",
          "code": "DTXSID50885369",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID50885369",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "f839c13e-2f9e-4579-93c5-5a0b2807535a",
          "code": "3320-33-0",
          "type": "MAJOR COMPONENT STRUCTURE/SEQUENCE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3320-33-0",
          "code_system": "CAS",
          "references": [
            "ea099436-53b1-ee77-e406-cd0207a07289"
          ]
        },
        {
          "uuid": "91f516d0-39b4-4625-96a3-46c973467dcc",
          "code": "PZP0846SQD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a608f7b7-e4e9-a041-eeb3-8b9833d598b4",
          "name": "2,4-DIOXO-1,3-DIAZETIDINE-1,3-BIS(METHYL-M-PHENYLENE) DIISOCYANATE",
          "stdName": "2,4-DIOXO-1,3-DIAZETIDINE-1,3-BIS(METHYL-M-PHENYLENE) DIISOCYANATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea099436-53b1-ee77-e406-cd0207a07289"
          ],
          "display_name": false
        },
        {
          "uuid": "01923ee9-9cad-9e47-fa41-b10ef1501e7d",
          "name": "2,4-TDI DIMER",
          "stdName": "2,4-TDI DIMER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea099436-53b1-ee77-e406-cd0207a07289"
          ],
          "display_name": false
        },
        {
          "uuid": "1127d736-ce41-4d75-8b84-b3cca5519928",
          "name": "2,4-TOLUENE DIISOCYANATE DIMER",
          "stdName": "2,4-TOLUENE DIISOCYANATE DIMER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "46b99ae7-3b04-472c-9e37-ffeb6c217625"
          ],
          "display_name": true
        },
        {
          "uuid": "7d7f5f44-64c2-a115-9f0f-e4cd9bdc23c9",
          "name": "2,4-TOLUENEDIISOCYANATE DIMER",
          "stdName": "2,4-TOLUENEDIISOCYANATE DIMER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea099436-53b1-ee77-e406-cd0207a07289"
          ],
          "display_name": false
        },
        {
          "uuid": "a77074e6-2f41-51bf-dbdc-bd8d05166191",
          "name": "ISOCYANIC ACID, (2,4-DIOXO-1,3-URETIDINEDIYL)BIS(METHYL-M-PHENYLENE) ESTER",
          "stdName": "ISOCYANIC ACID, (2,4-DIOXO-1,3-URETIDINEDIYL)BIS(METHYL-M-PHENYLENE) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ea099436-53b1-ee77-e406-cd0207a07289"
          ],
          "display_name": false
        },
        {
          "uuid": "e6c07534-201f-4d22-5207-1fa5e5201ce1",
          "name": "THANECURE T9 SUPERFINE",
          "stdName": "THANECURE T9 SUPERFINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0666b532-05db-d279-add0-e3500beeacb5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "46b99ae7-3b04-472c-9e37-ffeb6c217625",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9fe3dcc-3761-4631-ab92-11e918d8926d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392735000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0666b532-05db-d279-add0-e3500beeacb5",
          "citation": "Thanecure T9 Superfine",
          "url": "https://www.tse-industries.com/sites/default/files/data-msds-brochures/Thanecure-T9SF.pdf",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ea099436-53b1-ee77-e406-cd0207a07289",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3980b8b0-a739-4e72-a82d-3c827cb09b0b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1951fe35-f719-44eb-a8a6-20e2ff0429cc",
          "id": "1951fe35-f719-44eb-a8a6-20e2ff0429cc",
          "molfile": "\n  Marvin  01132101302D          \n\n 26 28  0  0  0  0            999 V2000\n    1.5197    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2263   -0.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9328    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6492   -0.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6492   -1.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9328   -1.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2263   -1.2583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5197   -1.6746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7647   -1.6649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.6649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3654   -1.6746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1592   -1.4616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5754   -0.7550    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3624   -2.2553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5687   -2.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1525   -3.1749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0787   -2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0787   -3.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7853   -3.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5016   -3.5136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2081   -3.9298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5016   -2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7853   -2.2553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2081   -2.2553    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9244   -2.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6794   -2.2650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n 11  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11 12  1  0  0  0  0\n 11 15  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 12  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 17  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 17 23  2  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  2  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  1  0  0  0  0\n 25 24  2  0  0  0  0\n 25 26  2  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1N=C=O)N2C(=O)N(c3ccc(C)c(c3)N=C=O)C2=O",
          "formula": "C18H12N4O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "12b66fde-fa73-4c22-9ba0-ab3c2cd7aabe"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "348.313",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "REPRESENTATIVE",
      "uuid": "032f21f6-d601-4c49-8ace-d59daa520d2c",
      "version": "6",
      "structure": {
        "id": "c2945335-28e7-4a65-9e92-ce02646e5f8a",
        "molfile": "\n  Marvin  01132110032D          \n\n 26 28  0  0  0  0            999 V2000\n   11.1283   -3.7541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3637   -3.7541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8833   -3.7638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7290   -3.7638    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.7260   -4.3446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5227   -3.5509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.9322   -4.5575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0127   -3.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4422   -4.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2964   -3.7638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1488   -4.3446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2879   -4.3543    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8651   -4.7704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5899   -3.3477    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9389   -2.8443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.5160   -5.2641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5717   -4.3446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0127   -2.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4422   -5.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8651   -5.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5899   -2.5055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.0429   -4.3543    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.1488   -6.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2964   -2.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8833   -2.0893    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5717   -6.0191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  2  0  0  0  0\n  1  2  2  0  0  0  0\n  3 14  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5  9  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6 15  2  0  0  0  0\n  7 16  2  0  0  0  0\n  8 10  1  0  0  0  0\n  8 18  2  0  0  0  0\n  9 11  1  0  0  0  0\n  9 19  2  0  0  0  0\n 10 14  2  0  0  0  0\n 11 13  2  0  0  0  0\n 12 17  2  0  0  0  0\n 12 22  2  0  0  0  0\n 13 17  1  0  0  0  0\n 13 20  1  0  0  0  0\n 14 21  1  0  0  0  0\n 18 24  1  0  0  0  0\n 19 23  1  0  0  0  0\n 20 23  2  0  0  0  0\n 20 26  1  0  0  0  0\n 21 24  2  0  0  0  0\n 21 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1N=C=O)N2C(=O)N(c3ccc(C)c(c3)N=C=O)C2=O",
        "formula": "C18H12N4O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "348.313",
        "optical_activity": "NONE",
        "references": [
          "0666b532-05db-d279-add0-e3500beeacb5"
        ],
        "stereo_centers": 0
      },
      "unii": "PZP0846SQD"
    }
  ]
}