{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "940eb9c8-3530-4b19-97f0-4d524bd894df",
          "code": "74183-60-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=74183-60-1",
          "code_system": "CAS",
          "references": [
            "bb98bf19-4206-412b-8abd-3f0bce1fff66",
            "8f2e9666-8fdb-46a6-be47-35db32022ee3"
          ]
        },
        {
          "uuid": "7cc2e47b-01bf-437d-a3ee-452c5b1e64da",
          "code": "101282733",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/101282733",
          "code_system": "PUBCHEM",
          "references": [
            "bb98bf19-4206-412b-8abd-3f0bce1fff66"
          ]
        },
        {
          "uuid": "e883ee29-152e-4e04-9e64-051ce74bb3ce",
          "code": "PYA35NRY4L",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a6ae8533-8428-0744-e937-f8b2787da5e6",
          "code": "DTXSID301019730",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID301019730",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "cea8a839-d636-454b-ac32-df05b53f35af",
          "name": "(-)-MARMELOLACTONE B",
          "stdName": "(-)-MARMELOLACTONE B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fe7498d-72b6-479e-bdcc-d591741b36c7"
          ],
          "display_name": false
        },
        {
          "uuid": "c28f9036-d239-4c37-b242-b0d9c8b222bf",
          "name": "(3R,5R)-DIHYDRO-3-METHYL-5-((1E)-3-METHYL-1,3-BUTADIEN-1-YL)-2(3H)-FURANONE",
          "stdName": "(3R,5R)-DIHYDRO-3-METHYL-5-((1E)-3-METHYL-1,3-BUTADIEN-1-YL)-2(3H)-FURANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4fe7498d-72b6-479e-bdcc-d591741b36c7"
          ],
          "display_name": false
        },
        {
          "uuid": "bdc3f494-3f80-4014-ad0b-08c197aeaa67",
          "name": "2(3H)-FURANONE, DIHYDRO-3-METHYL-5-((1E)-3-METHYL-1,3-BUTADIEN-1-YL)-, (3R,5R)-",
          "stdName": "2(3H)-FURANONE, DIHYDRO-3-METHYL-5-((1E)-3-METHYL-1,3-BUTADIEN-1-YL)-, (3R,5R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f672bef-e8bd-4695-9a1c-696a82b2bf46",
            "4fe7498d-72b6-479e-bdcc-d591741b36c7"
          ],
          "display_name": false
        },
        {
          "uuid": "c4fb8c9d-3f6d-4dc5-8d13-d2164e49b4c7",
          "name": "MARMELOLACTONE B",
          "stdName": "MARMELOLACTONE B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f672bef-e8bd-4695-9a1c-696a82b2bf46",
            "4fe7498d-72b6-479e-bdcc-d591741b36c7"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "4fe7498d-72b6-479e-bdcc-d591741b36c7",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c43522b-d41e-4dd2-a028-71ec04d6353c",
          "citation": "EC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb98bf19-4206-412b-8abd-3f0bce1fff66",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392023000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f672bef-e8bd-4695-9a1c-696a82b2bf46",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f2e9666-8fdb-46a6-be47-35db32022ee3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "26be3838-ed7e-4d6b-bdc3-930ddc097609",
          "id": "26be3838-ed7e-4d6b-bdc3-930ddc097609",
          "molfile": "\n  Marvin  01132102082D          \n\n 12 12  0  0  0  0            999 V2000\n   -1.6718   -0.4338    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -2.3863   -0.8463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8872   -0.6888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4023   -0.0213    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -0.8872    0.6461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6718    0.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2552    0.9745    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4227   -0.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0061   -0.6047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8030   -0.3912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3863   -0.9745    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2155    0.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  6  1  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  8  1  1  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  2  0  0  0  0\nM  END",
          "smiles": "C=C(C)/C=C/[C@H]1C[C@@H](C)C(=O)O1",
          "formula": "C10H14O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b687a8ec-5a4a-4014-aff0-0b7929509843"
          },
          "defined_stereo": 2,
          "ez_centers": 1,
          "molecular_weight": "166.2173",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "47e0448e-28bc-4b68-b4d8-1101b0e981e8",
      "version": "6",
      "structure": {
        "id": "bbd28c00-c186-4db6-b2d6-d334e010b763",
        "molfile": "2(3H)-Furanone, dihydro-3-methyl-5-[(1E)-3-methyl-1,3-butadien-1-yl]-, (3R,5R)-\n   JSDraw206032108472D\n\n 12 12  0  0  1  0              0 V2000\n   25.7279   -6.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.8944   -7.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.5731   -7.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0492   -6.5295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.1415   -9.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.5116   -6.3195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.2157   -7.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0492   -4.6515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.7884   -9.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.4034   -7.4627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.9952  -10.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1203   -6.8795    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  3  1  1  1  0  0  0\n  3  5  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  7  1  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6 10  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  1  0  0  0\n 10 12  2  0  0  0  0\nM  END",
        "smiles": "C=C(C)/C=C/[C@H]1C[C@@H](C)C(=O)O1",
        "formula": "C10H14O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 1,
        "molecular_weight": "166.2173",
        "optical_activity": "( - )",
        "references": [
          "2f672bef-e8bd-4695-9a1c-696a82b2bf46",
          "4fe7498d-72b6-479e-bdcc-d591741b36c7"
        ],
        "stereo_centers": 2
      },
      "unii": "PYA35NRY4L"
    }
  ]
}