{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "85e5cfb5-cdea-491f-bd01-92f8bfab37ad",
          "code": "187393-00-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=187393-00-6",
          "code_system": "CAS",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b",
            "430c9c59-dcf0-4b55-9dd2-775c29ffb3e3"
          ]
        },
        {
          "uuid": "075fd60b-c90c-4ab7-916b-81b7be3386a5",
          "code": "C74398",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74398",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b"
          ]
        },
        {
          "uuid": "4db1dfec-3cc6-49f4-a959-fcd845374d73",
          "code": "BEMOTRIZINOL",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Bemotrizinol",
          "code_system": "WIKIPEDIA",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b"
          ]
        },
        {
          "uuid": "ebb49ed8-dd07-4c7c-bd36-5226bbea83ec",
          "code": "8585",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=8585",
          "code_system": "INN",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b"
          ]
        },
        {
          "uuid": "c7ae55fc-cadd-4a70-a8d3-c59f7a213443",
          "code": "1306115",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1306115/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b"
          ]
        },
        {
          "uuid": "2f319f05-30ed-435b-9d91-1264c73a08d4",
          "code": "m2300",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2300?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b"
          ]
        },
        {
          "uuid": "3e46cdfd-6aa0-41a0-a76d-78846e441040",
          "code": "SUB32134",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b"
          ]
        },
        {
          "uuid": "3431ada6-b676-44c0-9dc4-dec19af9234c",
          "code": "CHEMBL2104956",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL2104956",
          "code_system": "ChEMBL",
          "references": [
            "ce26fc15-cffa-4baf-8544-4fed43bd9d8b"
          ]
        },
        {
          "uuid": "d28db4c8-7df6-940f-41be-bb76f24625b3",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "33b780ed-48f7-c572-5d2f-88ee72aa2483"
          ]
        },
        {
          "uuid": "79704047-c1d4-8437-ca74-531ec5df8269",
          "code": "135487856",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135487856",
          "code_system": "PUBCHEM",
          "references": [
            "3018db92-fde5-7b2e-849f-cad6c48ce7e0"
          ]
        },
        {
          "uuid": "45192c57-1cbf-4085-9fb0-1fff540b682d",
          "code": "PWZ1720CBH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "6e267a30-26c3-a1a8-3490-c4aa505a862b",
          "code": "3014",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3014",
          "code_system": "DRUG CENTRAL",
          "references": [
            "33b780ed-48f7-c572-5d2f-88ee72aa2483"
          ]
        },
        {
          "uuid": "f6704632-4ac6-f78a-e2b2-6a5d9410bfec",
          "code": "DB11206",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11206",
          "code_system": "DRUG BANK",
          "references": [
            "33b780ed-48f7-c572-5d2f-88ee72aa2483"
          ]
        },
        {
          "uuid": "5ae1f4c0-6d0b-e7b8-8a67-47711dc05440",
          "code": "QQ-43",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/QQ-43/relevant/1/",
          "code_system": "USAN",
          "references": [
            "37ab7e74-c169-32c2-ce0c-69d488f5a7f1"
          ]
        },
        {
          "uuid": "52a17761-80ef-7f26-4dbc-b55b193bd088",
          "code": "1048572",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1048572",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "33b780ed-48f7-c572-5d2f-88ee72aa2483"
          ]
        },
        {
          "uuid": "1321020f-e822-9fb8-733d-9f348e85b18b",
          "code": "DTXSID40896984",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40896984",
          "code_system": "EPA CompTox",
          "references": [
            "33b780ed-48f7-c572-5d2f-88ee72aa2483"
          ]
        },
        {
          "uuid": "fe57c437-dda9-7a4a-9ae5-77c31bbc10f8",
          "code": "100000124344",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "141450d6-2266-2a63-c320-6612d3f658ce"
          ]
        },
        {
          "uuid": "b080b3b4-3604-aff2-2a3f-dff2237ef9e7",
          "code": "PWZ1720CBH",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=PWZ1720CBH",
          "code_system": "DAILYMED",
          "references": [
            "f79e1f24-9cb3-4de7-caaf-ba0be24f187b"
          ]
        },
        {
          "uuid": "d5a5bc45-3ef1-8d21-54e7-9c07d2df078b",
          "code": "759870",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=759870",
          "code_system": "NSC",
          "references": [
            "af739c25-7553-c2ab-9965-d94d61c525ef"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5032e1d2-69bb-4fa2-9b01-633f78373bf8",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "974f7f3b-b14d-4353-8acf-b278296736d4",
            "refuuid": "651c844b-c870-46fe-b7fa-2bec89eb9d3b",
            "name": "BEMOTRIZINOL",
            "unii": "PWZ1720CBH",
            "linking_id": "PWZ1720CBH",
            "ref_pname": "BEMOTRIZINOL",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5ef336a4-2389-4ba3-97c0-05781b0fdf07",
          "name": "2,2'-(6-(4-METHOXYPHENYL)-1,3,5-TRIAZINE-2,4-DIYL)BIS(5-((2-ETHYLHEXYL)OXY)PHENOL)",
          "stdName": "2,2'-(6-(4-METHOXYPHENYL)-1,3,5-TRIAZINE-2,4-DIYL)BIS(5-((2-ETHYLHEXYL)OXY)PHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3c631ac-6bfc-4165-8c20-9cc7576856b7"
          ],
          "display_name": false
        },
        {
          "uuid": "725ba1de-7e94-4d44-8e2e-9caddf365d13",
          "name": "BEMOTRIZINOL",
          "stdName": "BEMOTRIZINOL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaf1792f-ba61-4ef4-bfd2-b95949aa1f85",
            "a45bda99-2a78-4e8e-9a4a-7e879a288913",
            "0b92bc61-ec55-4710-b775-8a23713c984c",
            "77fc59b5-a901-4599-b248-130e03cb5e73",
            "5fa39626-161c-45dd-a508-eda1c5904567",
            "1547d9ed-2710-4c3f-a4f8-86bcfa9f1245",
            "bfb47510-2b7a-408a-8596-66e75d402e47",
            "76749c73-12bb-4a06-bb17-8d705eee2190",
            "1e8a8279-b78f-4ddc-8f90-c728f10cfc34",
            "be2be747-a474-4415-8084-516597fecbd2",
            "c9af8f85-a871-4981-b70f-48570133e7cf",
            "2d7cc515-9d5e-4da0-bee2-afbbc503d148"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "30f079ba-7e77-40ae-9321-d8e089a2e2b2",
              "name_org": "INN"
            },
            {
              "uuid": "e07d5a0a-e6f4-41ad-99d3-489723092669",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "fcd71c20-b5a0-4006-bcea-56374e2a262f",
          "name": "BEMOTRIZINOL [MART.]",
          "stdName": "BEMOTRIZINOL [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5fa39626-161c-45dd-a508-eda1c5904567"
          ],
          "display_name": false
        },
        {
          "uuid": "b6f89e07-930c-485a-a739-c3658c7cd151",
          "name": "BEMOTRIZINOL [MI]",
          "stdName": "BEMOTRIZINOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1547d9ed-2710-4c3f-a4f8-86bcfa9f1245",
            "be2be747-a474-4415-8084-516597fecbd2"
          ],
          "display_name": false
        },
        {
          "uuid": "ae4ffef4-ce08-4b59-bc6f-6ee3a131b549",
          "name": "BEMOTRIZINOL [USAN]",
          "stdName": "BEMOTRIZINOL [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e8a8279-b78f-4ddc-8f90-c728f10cfc34"
          ],
          "display_name": false
        },
        {
          "uuid": "9cef18ca-7333-41c7-9517-7be1ab1ad899",
          "name": "BEMOTRIZINOL [USP-RS]",
          "stdName": "BEMOTRIZINOL [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eaf1792f-ba61-4ef4-bfd2-b95949aa1f85",
            "be2be747-a474-4415-8084-516597fecbd2"
          ],
          "display_name": false
        },
        {
          "uuid": "a059c2bf-cd86-44b0-b9a2-7b2f853172f8",
          "name": "BEMT",
          "stdName": "BEMT",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3c631ac-6bfc-4165-8c20-9cc7576856b7"
          ],
          "display_name": false
        },
        {
          "uuid": "0396589c-a14d-458a-96f5-ff3444a6bea6",
          "name": "BIS-ETHYLHEXYLOXYPHENOL METHOXYPHENYL TRIAZINE",
          "stdName": "BIS-ETHYLHEXYLOXYPHENOL METHOXYPHENYL TRIAZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "b31abac2-5113-4482-b5e9-a225d949d0ed",
            "a3c631ac-6bfc-4165-8c20-9cc7576856b7",
            "4a89f145-0532-4c90-a9e1-d61af7389834",
            "be2be747-a474-4415-8084-516597fecbd2"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "16985129-f1f9-4ee8-a8e3-abce364adf34",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "2dd624e6-d43f-3e90-de66-e3004ea7fab1",
          "name": "Bemotrizinol [WHO-DD]",
          "stdName": "BEMOTRIZINOL [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2726916-609c-08f9-a1f5-3ae868317947"
          ],
          "display_name": false
        },
        {
          "uuid": "aa880407-b4d9-4231-b75a-5d6f63e8b937",
          "name": "FAT 70'884",
          "stdName": "FAT 70'884",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a3c631ac-6bfc-4165-8c20-9cc7576856b7"
          ],
          "display_name": false
        },
        {
          "uuid": "8a2db5a6-886a-4537-afd6-c110149d005c",
          "name": "FAT-70884",
          "stdName": "FAT-70884",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "40e93c01-cfe1-4e9c-bd74-91ed17fbe176",
            "be2be747-a474-4415-8084-516597fecbd2"
          ],
          "display_name": false
        },
        {
          "uuid": "fd5f1bf5-294a-39e9-a120-432fbf5da995",
          "name": "NSC-759870",
          "stdName": "NSC-759870",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "af739c25-7553-c2ab-9965-d94d61c525ef"
          ],
          "display_name": false
        },
        {
          "uuid": "18bcd483-eca6-4703-b7d7-99188ff636b9",
          "name": "TINOSORB S",
          "stdName": "TINOSORB S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "767065b6-3770-47fd-85b9-c5e189b20133",
            "be2be747-a474-4415-8084-516597fecbd2"
          ],
          "display_name": false
        },
        {
          "uuid": "1bc94a9e-cf74-4e33-b8a4-b8989990ec18",
          "name": "bemotrizinol [INN]",
          "stdName": "BEMOTRIZINOL [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "76749c73-12bb-4a06-bb17-8d705eee2190"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "bfb47510-2b7a-408a-8596-66e75d402e47",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a3c631ac-6bfc-4165-8c20-9cc7576856b7",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "be2be747-a474-4415-8084-516597fecbd2",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "767065b6-3770-47fd-85b9-c5e189b20133",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76749c73-12bb-4a06-bb17-8d705eee2190",
          "citation": "INN Proposed List 92",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL92.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1e8a8279-b78f-4ddc-8f90-c728f10cfc34",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5fa39626-161c-45dd-a508-eda1c5904567",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1547d9ed-2710-4c3f-a4f8-86bcfa9f1245",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a89f145-0532-4c90-a9e1-d61af7389834",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eaf1792f-ba61-4ef4-bfd2-b95949aa1f85",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40e93c01-cfe1-4e9c-bd74-91ed17fbe176",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce26fc15-cffa-4baf-8544-4fed43bd9d8b",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "08d140a8-a78e-4cc0-9d82-955c34da1a38",
          "citation": "SRS import [PWZ1720CBH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PWZ1720CBH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390744000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0b92bc61-ec55-4710-b775-8a23713c984c",
          "citation": "BEMOTRIZINOL [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "77fc59b5-a901-4599-b248-130e03cb5e73",
          "citation": "BEMOTRIZINOL [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2d7cc515-9d5e-4da0-bee2-afbbc503d148",
          "citation": "BEMOTRIZINOL [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c9af8f85-a871-4981-b70f-48570133e7cf",
          "citation": "BEMOTRIZINOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b31abac2-5113-4482-b5e9-a225d949d0ed",
          "citation": "BIS-ETHYLHEXYLOXYPHENOL METHOXYPHENYL TRIAZINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a45bda99-2a78-4e8e-9a4a-7e879a288913",
          "citation": "BEMOTRIZINOL [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "33b780ed-48f7-c572-5d2f-88ee72aa2483",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a8326a10-1562-b009-f29a-8a90ad426d25",
          "citation": "USAN COUN 2004",
          "doc_type": "USANCOUN",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "430c9c59-dcf0-4b55-9dd2-775c29ffb3e3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "37ab7e74-c169-32c2-ce0c-69d488f5a7f1",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "9951ea07-8ff2-788a-1d3c-cceabeb4910c",
          "citation": "WHO DRUG DICTIONARY 2019",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3018db92-fde5-7b2e-849f-cad6c48ce7e0",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "af739c25-7553-c2ab-9965-d94d61c525ef",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "f79e1f24-9cb3-4de7-caaf-ba0be24f187b",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c2726916-609c-08f9-a1f5-3ae868317947",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "141450d6-2266-2a63-c320-6612d3f658ce",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e6459e52-f35b-47c2-9617-2fe253859fc7",
          "id": "e6459e52-f35b-47c2-9617-2fe253859fc7",
          "molfile": "\n  Marvin  01132111552D          \n\n 46 49  0  0  0  0            999 V2000\n   -2.9519   -3.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2379   -3.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5240   -3.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8100   -3.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0960   -3.4321    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   -0.0960   -4.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8100   -4.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6180   -3.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3320   -3.4279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0468   -3.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7675   -3.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4803   -3.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4771   -2.1904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7636   -1.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7653   -0.9491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0479   -2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1934   -1.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1939   -0.9517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9097   -0.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6251   -0.9498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6281   -1.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9098   -2.1920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3454   -2.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3464   -3.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0628   -3.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7784   -3.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4884   -3.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2023   -3.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9163   -3.4113    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    9.9163   -4.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6303   -4.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6303   -2.9979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3443   -3.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0582   -2.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7722   -3.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7731   -2.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0560   -1.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0502   -0.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9099    0.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1936    0.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1948    1.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9081    1.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9056    2.7685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6203    3.1840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6249    1.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6278    0.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 16 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 17 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 22  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 39 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 37 23  2  0  0  0  0\n 24 25  2  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 26 36  2  0  0  0  0\n 27 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 29 30  1  0  0  0  0\n 29 32  1  0  0  0  0\n 30 31  1  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  1  0  0  0  0\n 34 35  1  0  0  0  0\n 36 37  1  0  0  0  0\n 37 38  1  0  0  0  0\n 40 39  1  0  0  0  0\n 39 46  2  0  0  0  0\n 41 40  2  0  0  0  0\n 42 41  1  0  0  0  0\n 42 43  1  0  0  0  0\n 45 42  2  0  0  0  0\n 43 44  1  0  0  0  0\n 46 45  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COc1ccc(c(c1)O)-c2nc(-c3ccc(cc3)OC)nc(-c4ccc(cc4O)OCC(CC)CCCC)n2",
          "formula": "C38H49N3O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31bf0a17-0333-48e6-af6e-cfd6e98b475a"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "627.8142",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "651c844b-c870-46fe-b7fa-2bec89eb9d3b",
      "version": "27",
      "structure": {
        "id": "5c580a71-2b51-40a0-949d-f60fa490a135",
        "molfile": "\n  Marvin  01132104472D          \n\n 46 49  0  0  0  0            999 V2000\n    4.1948    1.5282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1936    0.6991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9099    0.2854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6278    0.6995    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6249    1.5319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9081    1.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9056    2.7685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9097   -0.5413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6203    3.1840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1939   -0.9517    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1934   -1.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9098   -2.1920    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6281   -1.7744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6251   -0.9498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4771   -2.1904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3454   -2.1854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7636   -1.7758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0479   -2.1879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0468   -3.0155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7675   -3.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4803   -3.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3464   -3.0114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0628   -3.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7784   -3.0066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7731   -2.1757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0560   -1.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7653   -0.9491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0502   -0.9417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3320   -3.4279    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6180   -3.0187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0960   -3.4321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8100   -3.0230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5240   -3.4363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2379   -3.0271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9519   -3.4404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4884   -3.4154    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2023   -3.0020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9163   -3.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6303   -2.9979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3443   -3.4070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0582   -2.9937    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7722   -3.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0960   -4.2546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8100   -4.6638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9163   -4.2338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6303   -4.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n 16 22  2  0  0  0  0\n 10 11  1  0  0  0  0\n 22 23  1  0  0  0  0\n  5  6  2  0  0  0  0\n 23 24  2  0  0  0  0\n 11 12  2  0  0  0  0\n 24 25  1  0  0  0  0\n  6  1  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 16  1  0  0  0  0\n 12 13  1  0  0  0  0\n 17 27  1  0  0  0  0\n  1  2  2  0  0  0  0\n 26 28  1  0  0  0  0\n 13 14  2  0  0  0  0\n 19 29  1  0  0  0  0\n 14  8  1  0  0  0  0\n 29 30  1  0  0  0  0\n  6  7  1  0  0  0  0\n 30 31  1  0  0  0  0\n 11 15  1  0  0  0  0\n 31 32  1  0  0  0  0\n  3  4  2  0  0  0  0\n 32 33  1  0  0  0  0\n 13 16  1  0  0  0  0\n 33 34  1  0  0  0  0\n  3  8  1  0  0  0  0\n 34 35  1  0  0  0  0\n 15 17  2  0  0  0  0\n 24 36  1  0  0  0  0\n 36 37  1  0  0  0  0\n 17 18  1  0  0  0  0\n 37 38  1  0  0  0  0\n  7  9  1  0  0  0  0\n 38 39  1  0  0  0  0\n 18 19  2  0  0  0  0\n 39 40  1  0  0  0  0\n  4  5  1  0  0  0  0\n 40 41  1  0  0  0  0\n 19 20  1  0  0  0  0\n 41 42  1  0  0  0  0\n  8 10  2  0  0  0  0\n 31 43  1  0  0  0  0\n 20 21  2  0  0  0  0\n 43 44  1  0  0  0  0\n 21 15  1  0  0  0  0\n 38 45  1  0  0  0  0\n  2  3  1  0  0  0  0\n 45 46  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COc1ccc(c(c1)O)-c2nc(-c3ccc(cc3)OC)nc(-c4ccc(cc4O)OCC(CC)CCCC)n2",
        "formula": "C38H49N3O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "627.8142",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bfb47510-2b7a-408a-8596-66e75d402e47",
          "08d140a8-a78e-4cc0-9d82-955c34da1a38",
          "76749c73-12bb-4a06-bb17-8d705eee2190"
        ],
        "stereo_centers": 2
      },
      "unii": "PWZ1720CBH"
    }
  ]
}