{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bf4fddc0-87cf-45ba-86d2-6c04853d614e",
          "code": "114612-27-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=114612-27-0",
          "code_system": "CAS",
          "references": [
            "1ccdb18a-c5f1-4f83-acf6-29b1574f41ae",
            "b7cbfbea-ee8b-4b38-a952-35c72f906fd3"
          ]
        },
        {
          "uuid": "cfe1124f-47ec-470f-9196-a61bee0ee206",
          "code": "13909091",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13909091",
          "code_system": "PUBCHEM",
          "references": [
            "1ccdb18a-c5f1-4f83-acf6-29b1574f41ae"
          ]
        },
        {
          "uuid": "e2ec57b9-c8fc-4768-b0be-089f8ffbbc07",
          "code": "PVK7G754HO",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "9d129e80-06aa-4777-803c-cb3c4b9b54ac",
          "amount": {
            "uuid": "bb04ffb6-0f2f-49b3-a981-5cfb402ea69a"
          },
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "3354b5b7-e790-4105-b659-eeb8b9f3379b",
            "refuuid": "e49b438a-0533-4360-a79f-eeafa19c9df7",
            "name": "MDE",
            "unii": "ML1I4KK67B",
            "linking_id": "ML1I4KK67B",
            "ref_pname": "MDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "586ff3a7-6f56-4ff7-aa72-b4b299f672bf",
          "amount": {
            "uuid": "16f3a962-4157-4319-a65a-c0a6e8179c83"
          },
          "type": "ENANTIOMER->ENANTIOMER",
          "related_substance": {
            "uuid": "5f19aa40-216f-4128-8707-8ea8ed227486",
            "refuuid": "213ee3c7-864b-42b6-b3b5-b205713ecb74",
            "name": "MDE, (S)-",
            "unii": "23Y2GY4AJG",
            "linking_id": "23Y2GY4AJG",
            "ref_pname": "MDE, (S)-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "a3c6ed7d-4c93-4126-bd18-8e32491ee4c5",
          "amount": {
            "uuid": "657dd272-07fe-4869-af40-203be66469f4"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "f1db2705-5b51-41e0-a2d2-d4870ab97179",
            "refuuid": "3a86833a-d7d5-44ea-96e9-b5979ebc6f6a",
            "name": "MDE HYDROCHLORIDE, (R)-",
            "unii": "4J99G5E8NZ",
            "linking_id": "4J99G5E8NZ",
            "ref_pname": "MDE HYDROCHLORIDE, (R)-",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c55d362c-c330-4d04-84f5-fb9219060915",
          "name": "(-)-3,4-METHYLENEDIOXY-N-ETHYLAMPHETAMINE",
          "stdName": "(-)-3,4-METHYLENEDIOXY-N-ETHYLAMPHETAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcfb29e5-e42e-43a9-8612-54238f905ae5",
            "0ecf416a-8b10-4fde-8c0b-9e166059ebfa"
          ],
          "display_name": false
        },
        {
          "uuid": "b856d0f5-abee-4f70-88cf-879e850405bd",
          "name": "(R)-3,4-METHYLENEDIOXYETHYLAMPHETAMINE",
          "stdName": "(R)-3,4-METHYLENEDIOXYETHYLAMPHETAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcfb29e5-e42e-43a9-8612-54238f905ae5",
            "0ecf416a-8b10-4fde-8c0b-9e166059ebfa"
          ],
          "display_name": false
        },
        {
          "uuid": "7d5ff9fe-6a7e-4b40-9a1f-50f045700e5b",
          "name": "(R)-METHYLENEDIOXYETHYLAMPHETAMINE",
          "stdName": "(R)-METHYLENEDIOXYETHYLAMPHETAMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcfb29e5-e42e-43a9-8612-54238f905ae5",
            "0ecf416a-8b10-4fde-8c0b-9e166059ebfa"
          ],
          "display_name": false
        },
        {
          "uuid": "88783d36-b57b-436d-aec0-29821cd7ab63",
          "name": "1,3-BENZODIOXOLE-5-ETHANAMINE, N-ETHYL-.ALPHA.-METHYL-, (.ALPHA.R)-",
          "stdName": "1,3-BENZODIOXOLE-5-ETHANAMINE, N-ETHYL-.ALPHA.-METHYL-, (.ALPHA.R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcfb29e5-e42e-43a9-8612-54238f905ae5",
            "0ecf416a-8b10-4fde-8c0b-9e166059ebfa"
          ],
          "display_name": false
        },
        {
          "uuid": "68fe4b24-c71b-4bb9-a865-e6c42c6cfffc",
          "name": "3,4-Methylenedioxy-N-ethylamphetamine, (R)-",
          "stdName": "3,4-METHYLENEDIOXY-N-ETHYLAMPHETAMINE, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bb325a7-790a-41fe-86b5-8061181f3290"
          ],
          "display_name": false
        },
        {
          "uuid": "7da339bb-eebc-4f4c-affb-46557a200647",
          "name": "EVE, (R)-",
          "stdName": "EVE, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bb325a7-790a-41fe-86b5-8061181f3290"
          ],
          "display_name": false
        },
        {
          "uuid": "8b4742b9-be8d-42c9-b1b4-56d32bfae8fa",
          "name": "L-3,4-METHYLENEDIOXYETHYLAMPHETAMINE",
          "stdName": "L-3,4-METHYLENEDIOXYETHYLAMPHETAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcfb29e5-e42e-43a9-8612-54238f905ae5",
            "0ecf416a-8b10-4fde-8c0b-9e166059ebfa"
          ],
          "display_name": false
        },
        {
          "uuid": "5a387b16-bd96-4f31-ba2b-1a92c4a9081e",
          "name": "MDE, (-)-",
          "stdName": "MDE, (-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fcfb29e5-e42e-43a9-8612-54238f905ae5",
            "6bb325a7-790a-41fe-86b5-8061181f3290"
          ],
          "display_name": false
        },
        {
          "uuid": "c5f2d2ac-74c4-453c-abd2-eaf2e34f3aa6",
          "name": "MDE, (R)-",
          "stdName": "MDE, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bb325a7-790a-41fe-86b5-8061181f3290"
          ],
          "display_name": true
        },
        {
          "uuid": "1db16465-e143-48dc-9653-fe865c7e6a97",
          "name": "MDEA, (R)-",
          "stdName": "MDEA, (R)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6bb325a7-790a-41fe-86b5-8061181f3290"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "6bb325a7-790a-41fe-86b5-8061181f3290",
          "citation": "SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fcfb29e5-e42e-43a9-8612-54238f905ae5",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ecf416a-8b10-4fde-8c0b-9e166059ebfa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ccdb18a-c5f1-4f83-acf6-29b1574f41ae",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392801000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e4cda5a8-5513-4f41-ad97-85f92275d9e1",
          "citation": "SRS import [PVK7G754HO]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PVK7G754HO",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392801000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b7cbfbea-ee8b-4b38-a952-35c72f906fd3",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5f9e9b44-653b-45a4-882b-70c89d86dcf6",
          "id": "5f9e9b44-653b-45a4-882b-70c89d86dcf6",
          "molfile": "\n  Marvin  01132104572D          \n\n 15 16  0  0  1  0            999 V2000\n    7.6056   -3.4018    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6056   -4.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3184   -2.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0335   -3.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0335   -4.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7491   -4.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4647   -4.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2544   -4.4847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7425   -3.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2544   -3.1413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4647   -3.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7491   -2.9790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8904   -2.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1777   -3.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4625   -2.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  1 13  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n 12  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 11  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\nM  END",
          "smiles": "CCN[C@H](C)Cc1ccc2c(c1)OCO2",
          "formula": "C12H17NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "145e7e93-54a8-48e5-8c34-c8738247d729"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "207.2693",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3cc70265-361e-4436-a4e5-ffefc4e19241",
      "version": "4",
      "structure": {
        "id": "4bd03f65-26f6-48ec-9dde-7c8e7bed2e5e",
        "molfile": "\n  Marvin  01132103582D          \n\n 15 16  0  0  1  0            999 V2000\n    6.1777   -3.4059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4625   -2.9959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8904   -2.9917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6056   -3.4018    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.3184   -2.9876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0335   -3.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7491   -2.9790    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4647   -3.3977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2544   -3.1413    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7425   -3.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2544   -4.4847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4647   -4.2280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7491   -4.6375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0335   -4.2270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6056   -4.2263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n  8 12  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n  6 14  1  0  0  0  0\n 14 13  2  0  0  0  0\n  4 15  1  1  0  0  0\nM  END",
        "smiles": "CCN[C@H](C)Cc1ccc2c(c1)OCO2",
        "formula": "C12H17NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "207.2693",
        "optical_activity": "( - )",
        "references": [
          "0ecf416a-8b10-4fde-8c0b-9e166059ebfa",
          "e4cda5a8-5513-4f41-ad97-85f92275d9e1"
        ],
        "stereo_centers": 1
      },
      "unii": "PVK7G754HO"
    }
  ]
}