{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "de656b5b-f760-44cd-8e8c-e1bf5ee853c7",
          "code": "L02BG02",
          "comments": "ATC|ANTINEOPLASTIC AND IMMUNOMODULATING AGENTS|ENDOCRINE THERAPY|HORMONE ANTAGONISTS AND RELATED AGENTS|Enzyme inhibitors|formestane",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=L02BG02&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "709c4993-4766-40d4-b1e5-a392d2f2aebb",
          "code": "QL02BG02",
          "comments": "VATC|ENDOCRINE THERAPY|HORMONE ANTAGONISTS AND RELATED AGENTS|Aromatase inhibitors|formestane",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QL02BG02&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "4056cfc4-f980-4956-a76c-c35fc62fe4b8",
          "code": "566-48-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=566-48-3",
          "code_system": "CAS",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc",
            "7a1953e4-a9eb-4b16-87d3-b4c0df916395"
          ]
        },
        {
          "uuid": "9d87997e-d832-48cb-8a73-a84af5a26329",
          "code": "C974",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C974",
          "code_system": "NCI_THESAURUS",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "c184e0cf-bac0-40a6-a7f3-ad5fa7c80528",
          "code": "C014594",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67014594",
          "code_system": "MESH",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "8280d634-b6c5-4e12-9919-689f9b24a714",
          "code": "6877",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=6877",
          "code_system": "INN",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "af181feb-9e08-4b65-85a3-5cc40d3fac34",
          "code": "15070",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/15070/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "c2e2f7a7-eb66-477e-b07b-4d208205f728",
          "code": "m5538",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5538?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "b3b2994f-f1f7-4adb-a1bb-ca5aaf93bebb",
          "code": "DB08905",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB08905",
          "code_system": "DRUG BANK",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "56672ec5-f573-4030-8f20-aed6093622fe",
          "code": "SUB07784MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "4d51d4a2-2203-4884-afb2-3f1ecc25a667",
          "code": "CHEMBL132530",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL132530",
          "code_system": "ChEMBL",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "fc71b876-2b40-43d4-aa07-ceb5eeba462b",
          "code": "11273",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11273",
          "code_system": "PUBCHEM",
          "references": [
            "804da276-2d46-44de-813b-a7857f2154dc"
          ]
        },
        {
          "uuid": "1c8c5ad5-19ed-c4e1-64ce-f26782e970c5",
          "code": "Formestane",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Formestane",
          "code_system": "WIKIPEDIA",
          "references": [
            "11547381-49a8-c60e-a000-c513aaf234d0"
          ]
        },
        {
          "uuid": "88c0d45d-f4e8-fb6b-3300-e8c29350fcc2",
          "code": "DTXSID3034113",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3034113",
          "code_system": "EPA CompTox",
          "references": [
            "4a8208ce-8953-2246-2b92-1ca35bc27dee"
          ]
        },
        {
          "uuid": "f91f3c24-83ca-29f7-cbb3-6227d5bf2827",
          "code": "C2017",
          "comments": "Pharmacologic Substance[C1909]|Antineoplastic Agent[C274]|Antineoplastic Protein Inhibitor[C129824]|Antineoplastic Enzyme Inhibitor[C129825]|Aromatase Inhibitor[C1740]|Steroidal Aromatase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2017",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3e2af7dd-6079-ebd8-0ee1-f5f9923d56df"
          ]
        },
        {
          "uuid": "86f6efcb-6090-cc85-2420-1fc35070a922",
          "code": "EU/3/16/1646",
          "comments": "EU ORPHAN DRUG|Positive|Treatment of multiple symmetric lipomatosis",
          "type": "PRIMARY",
          "url": "https://www.ema.europa.eu/en/medicines/human/orphan-designations/eu3161646",
          "code_system": "EU-Orphan Drug",
          "references": [
            "3e2af7dd-6079-ebd8-0ee1-f5f9923d56df"
          ]
        },
        {
          "uuid": "8ffe5946-6aae-4b4e-acd8-7ce5082e61da",
          "code": "PUB9T8T355",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8eb2f777-7fa0-ac94-099a-7cd3cecb0ee3",
          "code": "1238",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1238",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3e2af7dd-6079-ebd8-0ee1-f5f9923d56df"
          ]
        },
        {
          "uuid": "5f62dda8-46d1-3cf7-97cc-8a1ee69275af",
          "code": "75172",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75172",
          "code_system": "CHEBI",
          "references": [
            "3e2af7dd-6079-ebd8-0ee1-f5f9923d56df"
          ]
        },
        {
          "uuid": "aa8b14a1-f5ef-0227-4213-5784c3df10ad",
          "code": "100000092642",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c48789f2-f353-84fa-9f7b-07e17b468cec"
          ]
        },
        {
          "uuid": "4e3ca55e-c7dc-3c94-6e70-077898a92f03",
          "code": "282175",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=282175",
          "code_system": "NSC",
          "references": [
            "5d14e59a-0f93-56b1-9009-586da0d2bae8"
          ]
        },
        {
          "uuid": "cfd5cfb2-8cd9-416b-8320-9c4aef239532",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "GENERIC (FAMILY)",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "code_system": "DEA NO.",
          "references": [
            "562a644c-f435-44cd-9cea-f20846ccbd12"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a2700821-65a5-497b-84ad-fad8c4ba7a4e",
          "amount": {
            "uuid": "75010396-d672-4579-9b74-eecf8d0275b6"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "56eec252-10da-4d2d-98f8-36f886a81eb5",
            "refuuid": "b8752ba1-84b2-4887-8a6b-e85374bb51f8",
            "name": "FORMESTANE",
            "unii": "PUB9T8T355",
            "linking_id": "PUB9T8T355",
            "ref_pname": "FORMESTANE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c3363c4e-be02-4af3-bb12-d76fdf22de19",
          "amount": {
            "uuid": "afd88e79-e3c5-46e2-910b-afecbe1fbbbf"
          },
          "qualification": "URINE",
          "type": "PARENT->METABOLITE",
          "references": [
            "e79c4763-576c-9258-3c2a-8dba845c1140"
          ],
          "related_substance": {
            "uuid": "b46a31a3-596a-4844-b825-98a06a2587b1",
            "refuuid": "04ef1e00-880c-43d0-a341-2850ca076754",
            "name": "Androstenedione",
            "unii": "409J2J96VR",
            "linking_id": "409J2J96VR",
            "ref_pname": "Androstenedione",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "02f3c5ad-8a51-4029-bea3-faeb7ca074d0",
          "name": "4-HYDROXYANDROST-4-ENE-3,17-DIONE",
          "stdName": "4-HYDROXYANDROST-4-ENE-3,17-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb2fde1c-2a18-46fa-adab-64e68b0c7d50"
          ],
          "display_name": false
        },
        {
          "uuid": "73ec2aab-7034-48ab-800a-785c5769f918",
          "name": "4-OH-ANDROSTENE-3,17-DIONE",
          "stdName": "4-OH-ANDROSTENE-3,17-DIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "623da344-6e40-4a15-857c-04d75081af58",
            "c7221625-d351-4081-980e-6ab866299f5a"
          ],
          "display_name": false
        },
        {
          "uuid": "ac020938-eb8c-410b-8fdc-a0cdd531a03a",
          "name": "4-hydroxy-androst-4-ene-3,17-dione",
          "stdName": "4-HYDROXY-ANDROST-4-ENE-3,17-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "562a644c-f435-44cd-9cea-f20846ccbd12"
          ],
          "display_name": false
        },
        {
          "uuid": "e86e9148-ffac-45d0-accb-73819916fe65",
          "name": "CGP 32349",
          "stdName": "CGP 32349",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb2fde1c-2a18-46fa-adab-64e68b0c7d50"
          ],
          "display_name": false
        },
        {
          "uuid": "b529f349-eab4-41a2-90bf-8b07a209df48",
          "name": "CGP-32349",
          "stdName": "CGP-32349",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "051908ec-3884-436b-b90d-12701a2bc0a3"
          ],
          "display_name": false
        },
        {
          "uuid": "bd155ca5-e4d0-468d-a46b-c5603c96301f",
          "name": "FORMESTANE",
          "stdName": "FORMESTANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa4c14ff-59d3-4d8f-9a64-f0f663abf43d",
            "140e79de-170d-405c-b748-64f0d75e03fb",
            "1c7596e7-eb5a-4053-912f-dadb1df82d9c",
            "9a168989-8546-439e-b4f1-abbd31ab7c2a",
            "9d7ffeb5-4adf-457b-9ea4-6b0bd4be30f6",
            "3f497472-abf3-4501-8573-a8964d8f5ff9",
            "b75cb85e-59d7-47d9-b363-ea71a3f362c6",
            "18b24a80-b3e6-4e49-b1c0-8ca4ea82aa28",
            "bad1b9c7-b9b4-44c2-a2a9-fba2995109c7",
            "623da344-6e40-4a15-857c-04d75081af58"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "0437a8a9-fc08-430a-82e9-b544abbb9812",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "7d1e9333-3b9a-47bd-a5d6-6146240ed9d2",
          "name": "FORMESTANE [MART.]",
          "stdName": "FORMESTANE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3f497472-abf3-4501-8573-a8964d8f5ff9"
          ],
          "display_name": false
        },
        {
          "uuid": "a0dba7c5-5838-41d7-b07d-473415c62b3d",
          "name": "FORMESTANE [MI]",
          "stdName": "FORMESTANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b75cb85e-59d7-47d9-b363-ea71a3f362c6",
            "623da344-6e40-4a15-857c-04d75081af58"
          ],
          "display_name": false
        },
        {
          "uuid": "0bb96e49-0dcd-e381-30a7-b71870d5702c",
          "name": "Formestane [WHO-DD]",
          "stdName": "FORMESTANE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b384a42e-24c5-3cdb-b97e-f43fc19b3c68"
          ],
          "display_name": false
        },
        {
          "uuid": "d6144e44-2bfd-43ad-846b-6b2920c07725",
          "name": "LENTARON",
          "stdName": "LENTARON",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "20bead8d-3374-409f-b2cb-b289ca13ebf9",
            "ebc64cab-ade0-4361-aefe-cdbae669240b"
          ],
          "display_name": false
        },
        {
          "uuid": "171c234f-23dd-4c87-bffc-cc95acdbb742",
          "name": "NSC-282175",
          "stdName": "NSC-282175",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "676abba9-ca2c-44c4-a7dc-d8ef45e35ff4",
            "623da344-6e40-4a15-857c-04d75081af58"
          ],
          "display_name": false
        },
        {
          "uuid": "83f177cb-85fb-4bf1-930a-0331a2812159",
          "name": "formestane [INN]",
          "stdName": "FORMESTANE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9a168989-8546-439e-b4f1-abbd31ab7c2a",
            "1f5e7ab1-de18-4ab7-ae5f-04792cfb6205"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "18b24a80-b3e6-4e49-b1c0-8ca4ea82aa28",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "623da344-6e40-4a15-857c-04d75081af58",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "051908ec-3884-436b-b90d-12701a2bc0a3",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb2fde1c-2a18-46fa-adab-64e68b0c7d50",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a168989-8546-439e-b4f1-abbd31ab7c2a",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3f497472-abf3-4501-8573-a8964d8f5ff9",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b75cb85e-59d7-47d9-b363-ea71a3f362c6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20bead8d-3374-409f-b2cb-b289ca13ebf9",
          "citation": "KEGG 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebc64cab-ade0-4361-aefe-cdbae669240b",
          "citation": "D07260",
          "doc_type": "KEGG",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bad1b9c7-b9b4-44c2-a2a9-fba2995109c7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7221625-d351-4081-980e-6ab866299f5a",
          "citation": "http://www.analytical.com/fullaccess/novedad31file1.pdf",
          "url": "http://www.analytical.com/fullaccess/novedad31file1.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "676abba9-ca2c-44c4-a7dc-d8ef45e35ff4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "804da276-2d46-44de-813b-a7857f2154dc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390841000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "277961e6-f031-452e-ad8f-bec68abcd17e",
          "citation": "SRS import [PUB9T8T355]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PUB9T8T355",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390841000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa4c14ff-59d3-4d8f-9a64-f0f663abf43d",
          "citation": "FORMESTANE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "140e79de-170d-405c-b748-64f0d75e03fb",
          "citation": "FORMESTANE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1c7596e7-eb5a-4053-912f-dadb1df82d9c",
          "citation": "FORMESTANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d7ffeb5-4adf-457b-9ea4-6b0bd4be30f6",
          "citation": "FORMESTANE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "11547381-49a8-c60e-a000-c513aaf234d0",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/4-Hydroxyandrostenedione",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "4a8208ce-8953-2246-2b92-1ca35bc27dee",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=566-48-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3e2af7dd-6079-ebd8-0ee1-f5f9923d56df",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7a1953e4-a9eb-4b16-87d3-b4c0df916395",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1f5e7ab1-de18-4ab7-ae5f-04792cfb6205",
          "citation": "INN Proposed List 66",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL66.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e79c4763-576c-9258-3c2a-8dba845c1140",
          "citation": "The uPA (+/+)-SCID mouse with humanized liver as a model for in vivo metabolism of 4-androstene-3, 17-dione",
          "url": "https://dmd.aspetjournals.org/content/dmd/37/12/2367.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5d14e59a-0f93-56b1-9009-586da0d2bae8",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b384a42e-24c5-3cdb-b97e-f43fc19b3c68",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c48789f2-f353-84fa-9f7b-07e17b468cec",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "562a644c-f435-44cd-9cea-f20846ccbd12",
          "citation": "CFR",
          "url": "https://www.ecfr.gov/current/title-21/chapter-II/part-1308",
          "doc_type": "CFR",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "93ecdf95-008e-4cd7-94e4-c32b2f5a4955",
          "id": "93ecdf95-008e-4cd7-94e4-c32b2f5a4955",
          "molfile": "\n  CDK     01242414322D\n\n 25 28  0  0  1  0  0  0  0  0999 V2000\n   23.9669   -6.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9669   -7.8966    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   22.6156   -7.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2644   -7.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2644   -9.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9143  -10.2355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6156  -10.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9669   -9.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3181  -10.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6694   -9.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6694   -7.8966    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   26.6701   -6.3375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0206   -7.1170    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   28.1856   -8.6674    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5070   -7.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4217   -6.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5070   -5.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9907   -3.5976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0206   -5.5579    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   28.1856   -4.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6694   -4.7783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3181   -5.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3181   -7.1170    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   25.3174   -8.6762    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6156  -11.7944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 13 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 11 23  1  0  0  0  0\n  2 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n  7 25  1  0  0  0  0\nM  END",
          "smiles": "C[C@@]12CCC(=O)C(=C2CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@@]31[H])O",
          "formula": "C19H26O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "20a275d4-ca62-43e2-8d45-114696545383"
          },
          "defined_stereo": 5,
          "ez_centers": 0,
          "molecular_weight": "302.4087",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 5
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b8752ba1-84b2-4887-8a6b-e85374bb51f8",
      "version": "20",
      "structure": {
        "id": "9e748705-1e3f-4b43-bdaa-0702f2af1c1a",
        "molfile": "\n   JSDraw201242414322D\n\n 25 28  0  0  1  0              0 V2000\n   23.9669   -6.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9669   -7.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6156   -7.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2644   -7.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.2644   -9.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.9143  -10.2355    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6156  -10.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9669   -9.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3181  -10.2353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6694   -9.4557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6694   -7.8966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6701   -6.3375    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0206   -7.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.1856   -8.6674    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5070   -7.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.4217   -6.3375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.5070   -5.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   29.9907   -3.5976    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.0206   -5.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.1856   -4.0075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.6694   -4.7783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3181   -5.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3181   -7.1170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.3174   -8.6762    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   22.6156  -11.7944    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  2  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  1  0  0  0\n 11 13  1  0  0  0  0\n 13 14  1  6  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 13 19  1  0  0  0  0\n 19 20  1  1  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 11 23  1  0  0  0  0\n  2 23  1  0  0  0  0\n 23 24  1  6  0  0  0\n  7 25  1  0  0  0  0\nM  END",
        "smiles": "C[C@@]12CCC(=O)C(=C2CC[C@@]3([H])[C@]4([H])CCC(=O)[C@@]4(C)CC[C@@]31[H])O",
        "formula": "C19H26O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 5,
        "ez_centers": 0,
        "molecular_weight": "302.4087",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "277961e6-f031-452e-ad8f-bec68abcd17e",
          "18b24a80-b3e6-4e49-b1c0-8ca4ea82aa28",
          "1f5e7ab1-de18-4ab7-ae5f-04792cfb6205"
        ],
        "stereo_centers": 5
      },
      "unii": "PUB9T8T355"
    }
  ]
}