{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "49f377a9-663b-ca7b-5f16-ba710e9399bf", "code": "151006", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/151006", "code_system": "PUBCHEM", "references": [ "df28178b-4943-f674-1872-93073858ee7b" ] }, { "uuid": "2d7bce5f-f7c3-09c4-c3af-c67ef3feda7e", "code": "2426-46-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2426-46-2", "code_system": "CAS", "references": [ "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8" ] }, { "uuid": "2e17945d-ad5e-45bb-9e37-c93b20c845b1", "code": "PQ2MC48DHL", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8" ] }, { "uuid": "d30a9091-b897-c52c-2d9f-225fc19f062d", "code": "DTXSID60178956", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60178956", "code_system": "EPA CompTox", "references": [ "3c5dba9f-be63-9aab-f858-b974b7a3b285" ] } ], "substance_class": "chemical", "names": [ { "uuid": "cfe8313c-4cfe-4766-9924-c639fc8b15c5", "name": "(3R,4S,5S,6R)-3,4,5,6-Tetrahydroxyoxepan-2-one", "stdName": "(3R,4S,5S,6R)-3,4,5,6-TETRAHYDROXYOXEPAN-2-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8" ], "display_name": false }, { "uuid": "4459ba23-ae43-4e4a-8bff-78e9750b91f5", "name": "D-Galactonic acid, ε-lactone", "stdName": "D-GALACTONIC ACID, .EPSILON.-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8" ], "display_name": false }, { "uuid": "7685e86b-1516-4a27-8c77-13da070b7c8a", "name": "D-Galactono-7-lactone", "stdName": "D-GALACTONO-7-LACTONE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8" ], "display_name": true }, { "uuid": "1213a49e-2282-4bb3-b38d-cc9bf36d161d", "name": "Galactonic acid, ξ-lactone, D-", "stdName": "GALACTONIC ACID, .XI.-LACTONE, D-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8" ], "display_name": false } ], "references": [ { "uuid": "df28178b-4943-f674-1872-93073858ee7b", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "6b4e49b7-4c30-262c-113b-f4475a9418c6", "citation": "ZINC", "url": "http://zinc.docking.org/substances/subsets/in-vivo/", "doc_type": "WEBSITE", "public_domain": true }, { "uuid": "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3c5dba9f-be63-9aab-f858-b974b7a3b285", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "77e1569d-d246-4f8e-99b5-9f09430b655b", "id": "77e1569d-d246-4f8e-99b5-9f09430b655b", "molfile": "\n Marvin 01132106132D \n\n 12 12 0 0 0 0 999 V2000\n 1.7757 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9507 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5927 0.7433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2115 0.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8566 0.4125 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.5998 0.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8566 -0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.5998 -0.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2115 -0.9269 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.3951 -1.7312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5927 -0.7433 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.1071 -1.3883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 11 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 6 0 0 0\nM END", "smiles": "C1[C@H]([C@@H]([C@@H]([C@H](C(=O)O1)O)O)O)O", "formula": "C6H10O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "fef2fe9a-0275-4286-a621-699efbddc31b" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "178.1403", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "dbf61d8e-d49a-423d-9508-c360bebcdeff", "version": "8", "structure": { "id": "04d84c6a-562c-45a1-85b5-0c0159def615", "molfile": "ZINC000005157263\n Marvin 01132100332D \n\n 12 12 0 0 1 0 999 V2000\n 1.7757 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.9507 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5927 0.7433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2115 0.9269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8566 0.4125 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n -1.5998 0.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8566 -0.4125 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -1.5998 -0.7704 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2115 -0.9269 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n -0.3951 -1.7312 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.5927 -0.7433 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 1.1071 -1.3883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 6 0 0 0\n 5 7 1 0 0 0 0\n 7 8 1 1 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 1 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 6 0 0 0\n 11 2 1 0 0 0 0\nM END", "smiles": "C1[C@H]([C@@H]([C@@H]([C@H](C(=O)O1)O)O)O)O", "formula": "C6H10O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "178.1403", "optical_activity": "UNSPECIFIED", "references": [ "6b4e49b7-4c30-262c-113b-f4475a9418c6", "c2fa3cbe-25c9-4bea-8138-e81cf2f655d8" ], "stereo_centers": 4 }, "unii": "PQ2MC48DHL" } ] }