{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ee0df71f-478b-402d-88a0-daa62ceb5ec7", "code": "PPD399X5ES", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "366b4bdd-9351-416b-9709-255a0b331801", "code": "82982", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82982", "code_system": "PUBCHEM", "references": [ "6ee3decb-946e-4b3a-895e-46700c2ba565" ] }, { "uuid": "4483d242-393e-4371-a0b3-716e3f2d7ae4", "code": "12225-06-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=12225-06-8", "code_system": "CAS", "references": [ "2aa5f9f1-6ddd-443f-be30-f43e4ca45e49", "4813e1cc-f2b8-4921-9325-9d055fc2cbb7" ] }, { "uuid": "28ae87c1-82d7-433c-9b6a-1db5abdb3fd0", "code": "235-425-2", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.032.193", "code_system": "ECHA (EC/EINECS)", "references": [ "2aa5f9f1-6ddd-443f-be30-f43e4ca45e49" ] }, { "uuid": "92966d02-4337-d779-a09c-b42c61d72c06", "code": "DTXSID5065277", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5065277", "code_system": "EPA CompTox", "references": [ "13f26a36-1b41-f5de-406f-a37d75255d22" ] } ], "substance_class": "chemical", "names": [ { "uuid": "28b6a083-bc13-4c51-b43c-2a0e30c1ee16", "name": "2-Naphthalenecarboxamide, N-(2,3-dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-4-[2-[2-methoxy-5-[(phenylamino)carbonyl]phenyl]diazenyl]-", "stdName": "2-NAPHTHALENECARBOXAMIDE, N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-4-(2-(2-METHOXY-5-((PHENYLAMINO)CARBONYL)PHENYL)DIAZENYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "aa0fb86e-d391-4ebf-a143-aa6576cdb0f0" ], "display_name": false }, { "uuid": "9c8548f8-0eb5-410b-8695-9a9e39eb6031", "name": "C.I. Pigment Red 176", "stdName": "C.I. PIGMENT RED 176", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4813e1cc-f2b8-4921-9325-9d055fc2cbb7" ], "display_name": false }, { "uuid": "b4b9874c-17e1-47b9-8058-75db84092922", "name": "N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-4-((2-methoxy-5-((phenylamino)carbonyl)phenyl)azo)naphthalene-2-carboxamide", "stdName": "N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-4-((2-METHOXY-5-((PHENYLAMINO)CARBONYL)PHENYL)AZO)NAPHTHALENE-2-CARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "6ee3decb-946e-4b3a-895e-46700c2ba565" ], "display_name": true }, { "uuid": "f9fe7f0e-674e-4e97-970a-04048777ebad", "name": "N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-3-hydroxy-4-[2-[2-methoxy-5-[(phenylamino)carbonyl]phenyl]diazenyl]-2-naphthalenecarboxamide", "stdName": "N-(2,3-DIHYDRO-2-OXO-1H-BENZIMIDAZOL-5-YL)-3-HYDROXY-4-(2-(2-METHOXY-5-((PHENYLAMINO)CARBONYL)PHENYL)DIAZENYL)-2-NAPHTHALENECARBOXAMIDE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4813e1cc-f2b8-4921-9325-9d055fc2cbb7" ], "display_name": false } ], "references": [ { "uuid": "aa0fb86e-d391-4ebf-a143-aa6576cdb0f0", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "2aa5f9f1-6ddd-443f-be30-f43e4ca45e49", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392364000, "tags": [ "NOMEN" ] }, { "uuid": "13f26a36-1b41-f5de-406f-a37d75255d22", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=12225-06-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "4813e1cc-f2b8-4921-9325-9d055fc2cbb7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "6ee3decb-946e-4b3a-895e-46700c2ba565", "citation": "pubchem", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82982", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "4c6599cf-b272-46d0-a6f9-eaf851f6ef1b", "id": "4c6599cf-b272-46d0-a6f9-eaf851f6ef1b", "molfile": "\n Marvin 01132103592D \n\n 43 48 0 0 0 0 999 V2000\n 4.9807 -4.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -5.3663 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4159 -4.9593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1229 -5.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8405 -4.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8405 -4.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1229 -3.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4159 -4.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -3.7168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -2.8920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9807 -2.4743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2630 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2737 -3.7168 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5454 -2.4743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5454 -1.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2630 -1.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2737 -0.4070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9914 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -0.4177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6983 -1.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9807 -1.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8385 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1101 -2.4743 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8385 -3.7168 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1208 -4.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4031 -3.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6855 -4.1237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.6855 -4.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0750 -5.5162 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4070 -6.2660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -6.9836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2425 -6.1696 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4031 -5.3663 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1208 -4.9485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5582 -3.7168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2758 -4.1345 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5582 -2.8920 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2758 -2.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9934 -2.8920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7111 -2.4850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7111 -1.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0042 -1.2425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2865 -1.6602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 8 3 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 35 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 11 21 2 0 0 0 0\n 12 13 1 0 0 0 0\n 14 12 2 0 0 0 0\n 14 15 1 0 0 0 0\n 22 14 1 0 0 0 0\n 16 15 2 0 0 0 0\n 16 17 1 0 0 0 0\n 21 16 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 21 20 1 0 0 0 0\n 23 22 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 34 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 28 33 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 30 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 35 36 2 0 0 0 0\n 35 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 38 43 2 0 0 0 0\n 39 40 2 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 2 0 0 0 0\n 42 43 1 0 0 0 0\nM END", "smiles": "COc1ccc(cc1/N=N/c2c3ccccc3cc(c2O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5)C(=O)Nc6ccccc6", "formula": "C32H24N6O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "236dce40-3a89-4998-b8b0-eb2fe279d677" }, "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "572.5714", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a4ebcf86-49fb-4179-8837-84db017af30e", "version": "5", "structure": { "id": "8fb8acb6-4994-4116-be9e-270e9b6c3189", "molfile": "\n JSDraw201242512272D\n\n 43 48 0 0 0 0 0 V2000\n 30.7392 -8.5513 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3984 -9.3487 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 28.0373 -8.5862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9869 -7.0139 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6311 -6.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2896 -7.0225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2833 -8.6104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6392 -9.3820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6392 -10.9420 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9901 -11.7220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9901 -13.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6381 -14.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2861 -13.2820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9341 -14.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9341 -15.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.2861 -16.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 26.6381 -15.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 27.9901 -16.4020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3421 -15.6220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 29.3421 -14.0620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6930 -13.2818 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6930 -16.4023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.6928 -17.9623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 32.0442 -15.6225 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3950 -16.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.3950 -17.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7470 -18.7427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.0990 -17.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.0990 -16.4027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.7470 -15.6227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5862 -15.9243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 38.5014 -17.1827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.0614 -17.1827 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5862 -18.4411 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9389 -6.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5876 -7.0214 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 23.9395 -4.6819 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5888 -3.9014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5899 -2.3405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2393 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8874 -2.3403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.8863 -3.9012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.2370 -4.6818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 3 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 12 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 2 0 0 0 0\n 11 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 19 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 2 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 2 0 0 0 0\n 25 30 1 0 0 0 0\n 29 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 32 34 1 0 0 0 0\n 28 34 1 0 0 0 0\n 6 35 1 0 0 0 0\n 35 36 2 0 0 0 0\n 35 37 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 2 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 2 0 0 0 0\n 38 43 1 0 0 0 0\nM END", "smiles": "COc1ccc(cc1/N=N/c2c3ccccc3cc(c2O)C(=O)Nc4ccc5c(c4)[nH]c(=O)[nH]5)C(=O)Nc6ccccc6", "formula": "C32H24N6O5", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 1, "molecular_weight": "572.5714", "optical_activity": "NONE", "references": [ "aa0fb86e-d391-4ebf-a143-aa6576cdb0f0", "4813e1cc-f2b8-4921-9325-9d055fc2cbb7" ], "stereo_centers": 0 }, "unii": "PPD399X5ES" } ] }