{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e5ab77e4-13e4-4a46-be51-215e19e1880b",
          "code": "632-85-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=632-85-9",
          "code_system": "CAS",
          "references": [
            "f85d7051-1f11-4403-be5c-c123fb0279ff",
            "709abb58-cbef-464b-8e01-01b5cbfeb124"
          ]
        },
        {
          "uuid": "2f7b476f-81c6-446c-84c9-0fff761580ab",
          "code": "WOGONIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Wogonin",
          "code_system": "WIKIPEDIA",
          "references": [
            "f85d7051-1f11-4403-be5c-c123fb0279ff"
          ]
        },
        {
          "uuid": "e42ef276-d7d2-40f8-9c55-cf52d5883d5c",
          "code": "5281703",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281703",
          "code_system": "PUBCHEM",
          "references": [
            "f85d7051-1f11-4403-be5c-c123fb0279ff"
          ]
        },
        {
          "uuid": "fa832abf-7a2d-2a12-5738-1f87986e0435",
          "code": "DTXSID70212557",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70212557",
          "code_system": "EPA CompTox",
          "references": [
            "d95d3375-8bc8-91dc-1db1-7250dd1b7933"
          ]
        },
        {
          "uuid": "48f68875-79cb-fe2a-22e9-ee1357fafc49",
          "code": "2001619",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2001619/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "38725926-7a3d-bac6-093b-7a02ce079c27"
          ]
        },
        {
          "uuid": "f267c6a8-5845-4210-b2ec-0d5521c54541",
          "code": "POK93PO28W",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5bae493d-8656-f50d-044b-ded00464d5ee",
          "code": "10043",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:10043",
          "code_system": "CHEBI",
          "references": [
            "7deb738f-4531-8716-73d4-241538c05d4e"
          ]
        },
        {
          "uuid": "50b6c8c8-da67-e111-d031-051cc05e3003",
          "code": "78338",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:78338",
          "code_system": "CHEBI",
          "references": [
            "7deb738f-4531-8716-73d4-241538c05d4e"
          ]
        },
        {
          "uuid": "3a5825ee-e4ca-5357-7908-fcf367bb5407",
          "code": "POK93PO28W",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=POK93PO28W",
          "code_system": "DAILYMED",
          "references": [
            "0ba7cb84-d5f9-464c-ea36-550dbfc90388"
          ]
        },
        {
          "uuid": "f5e28bd2-d1b9-7dee-3f9c-ff66707a9684",
          "code": "300000051274",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f8619dc7-eb86-3ae2-6a8c-cccaa91d7ee5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "13671b05-4449-4cf6-ac41-97d10699cf30",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-8-METHOXY-2-PHENYL-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-8-METHOXY-2-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "764468dc-1859-4d9e-9729-41be1297870b",
            "8d92190a-8bb2-46ef-9082-ad32848f80a9"
          ],
          "display_name": false
        },
        {
          "uuid": "319285c4-652b-4422-89b9-e715e56eb633",
          "name": "5,7-DIHYDROXY-8-METHOXYFLAVONE",
          "stdName": "5,7-DIHYDROXY-8-METHOXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "764468dc-1859-4d9e-9729-41be1297870b",
            "8d92190a-8bb2-46ef-9082-ad32848f80a9"
          ],
          "display_name": false
        },
        {
          "uuid": "493b7fa4-3dd1-46c1-b7d2-69129471927a",
          "name": "FLAVONE, 5,7-DIHYDROXY-8-METHOXY-",
          "stdName": "FLAVONE, 5,7-DIHYDROXY-8-METHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "764468dc-1859-4d9e-9729-41be1297870b",
            "8d92190a-8bb2-46ef-9082-ad32848f80a9"
          ],
          "display_name": false
        },
        {
          "uuid": "52b4b5ef-4b19-44b9-8dd8-95185afa0d11",
          "name": "WOGONIN",
          "stdName": "WOGONIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22866e16-b36e-4adf-8745-ba0573bf95a2",
            "ce3c1dca-f116-4782-a152-9810c1c909ff",
            "44c13b79-ccf4-4abc-92ec-ba653f1b46ec",
            "764468dc-1859-4d9e-9729-41be1297870b"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "37c64f3c-fc9c-4e72-9503-2c63b977e5d2",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "ce3c1dca-f116-4782-a152-9810c1c909ff",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "44c13b79-ccf4-4abc-92ec-ba653f1b46ec",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "764468dc-1859-4d9e-9729-41be1297870b",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8d92190a-8bb2-46ef-9082-ad32848f80a9",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f85d7051-1f11-4403-be5c-c123fb0279ff",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390941000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bef83d73-ed6b-4c53-a372-3133b8a82738",
          "citation": "SRS import [POK93PO28W]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=POK93PO28W",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390941000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87e6d1a3-5ccb-4c2d-874b-ed4953bc48fe",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22866e16-b36e-4adf-8745-ba0573bf95a2",
          "citation": "WOGONIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d95d3375-8bc8-91dc-1db1-7250dd1b7933",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=632-85-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "38725926-7a3d-bac6-093b-7a02ce079c27",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "709abb58-cbef-464b-8e01-01b5cbfeb124",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7deb738f-4531-8716-73d4-241538c05d4e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "0ba7cb84-d5f9-464c-ea36-550dbfc90388",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f8619dc7-eb86-3ae2-6a8c-cccaa91d7ee5",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e9f5a6ec-d7b3-4b56-99e8-d970b54b1436",
          "id": "e9f5a6ec-d7b3-4b56-99e8-d970b54b1436",
          "molfile": "\n  Marvin  01132112062D          \n\n 21 23  0  0  0  0            999 V2000\n    5.0793   -3.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -3.4322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0793   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3588   -4.2716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0793   -5.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -5.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -6.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5105   -5.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5105   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2200   -4.2544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9333   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9333   -5.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2200   -5.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2200   -6.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6477   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3590   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0742   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0742   -3.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3590   -3.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6477   -3.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n 10  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  7  2  0  0  0  0\n  9 10  1  0  0  0  0\n  9 14  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 12 16  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 16 17  1  0  0  0  0\n 16 21  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\nM  END",
          "smiles": "COc1c(cc(c2c(=O)cc(-c3ccccc3)oc21)O)O",
          "formula": "C16H12O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bce833e3-7e24-42d9-8da9-6175f85a4c18"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "284.2641",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "39249956-6b3a-40a5-a781-053e63e265b6",
      "version": "10",
      "structure": {
        "id": "e3ebbb66-f0a1-4991-85cb-8624df25dfe0",
        "molfile": "\n  Marvin  01132111482D          \n\n 21 23  0  0  0  0            999 V2000\n    6.5105   -5.4998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5105   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0793   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3588   -4.2716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0793   -5.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -5.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -6.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7908   -3.4322    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0793   -3.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2200   -4.2544    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9333   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6477   -4.2716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3590   -4.6756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0742   -4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0742   -3.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3590   -3.0262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6477   -3.4466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9333   -5.4827    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2200   -5.9038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2200   -6.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  3  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  2 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 13 18  2  0  0  0  0\n 19 12  2  0  0  0  0\n 20 19  1  0  0  0  0\n  1 20  1  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
        "smiles": "COc1c(cc(c2c(=O)cc(-c3ccccc3)oc21)O)O",
        "formula": "C16H12O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "284.2641",
        "optical_activity": "NONE",
        "references": [
          "87e6d1a3-5ccb-4c2d-874b-ed4953bc48fe",
          "bef83d73-ed6b-4c53-a372-3133b8a82738"
        ],
        "stereo_centers": 0
      },
      "unii": "POK93PO28W"
    }
  ]
}