{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a0e6b468-f007-4de5-8ff1-2a06c1c12df9",
          "code": "M04AB01",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIGOUT PREPARATIONS|ANTIGOUT PREPARATIONS|Preparations increasing uric acid excretion|probenecid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M04AB01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "d73d89cf-0a55-41c4-b8a0-9bb919eaec64",
          "code": "QM04AB01",
          "comments": "VATC|ANTIGOUT PREPARATIONS|ANTIGOUT PREPARATIONS|Preparations increasing uric acid excretion|probenecid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM04AB01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "59f263c9-9e19-4000-84e0-19bd710bd5f8",
          "code": "57-66-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=57-66-9",
          "code_system": "CAS",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6",
            "78c21a7a-4f2a-4df5-823f-beff89bd09e2"
          ]
        },
        {
          "uuid": "d2ed3d03-8186-43b6-b326-3aaf0f20d582",
          "code": "C772",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C772",
          "code_system": "NCI_THESAURUS",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "669bd783-45a6-48a7-b095-bf9567765326",
          "code": "D011339",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68011339",
          "code_system": "MESH",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "80b58b37-e582-4937-92dd-811526e723aa",
          "code": "NBK548599",
          "comments": "LiverTox|Rheumatologic|Gout|Uricosuric",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548599/",
          "code_system": "LIVERTOX",
          "references": [
            "d96c314d-8049-3c88-54f9-e279f8f3cdcf"
          ]
        },
        {
          "uuid": "adaffb01-7074-49f6-974d-b1338827ede3",
          "code": "563",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=563",
          "code_system": "INN",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "0bbfb1f3-22cf-47b4-be00-7444d0feafa1",
          "code": "4357",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=4357",
          "code_system": "IUPHAR",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "8f90d4ec-4d52-488c-87bc-aab2c6ea9cd8",
          "code": "PROBENECID",
          "comments": "Description: A white or almost white, crystalline powder; odourless. Solubility: Practically insoluble in water; soluble in 25 parts of ethanol (~750 g/l) TS and in 12 parts of acetone R; soluble in dilutesolutions of alkali hydroxides. Category: Antigout drug. Storage: Probenecid should be kept in a well-closed container. Definition: Probenecid contains not less than 98.0% and not more than 101.0% of C13H19NO4S, calculated with reference to thedried substance.",
          "type": "PRIMARY",
          "url": "http://apps.who.int/phint/pdf/b/Jb.6.1.337.pdf",
          "code_system": "WHO INTERNATIONAL PHARMACOPEIA",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "7e2e5250-73c0-4284-9448-fc3605d46e7b",
          "code": "8698",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/8698/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "2925f616-29f1-4c13-9af1-4ba653fa2b91",
          "code": "m9142",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9142?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "b4422c9d-13e5-4f3d-bed6-33a08946b99d",
          "code": "DB01032",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01032",
          "code_system": "DRUG BANK",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "32508d74-811c-4d60-88ab-a6434ecdeb08",
          "code": "SUB10053MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "38082f42-63b1-478f-8fe7-d3b8abff0f5b",
          "code": "CHEMBL897",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL897",
          "code_system": "ChEMBL",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "e02fef31-5daf-4984-b510-58af556846ea",
          "code": "200-344-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.313",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "fd6e17e6-8afd-4f72-b5b7-052f54de9b03",
          "code": "4911",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4911",
          "code_system": "PUBCHEM",
          "references": [
            "b6868341-cf14-425f-9293-e8053d7211f6"
          ]
        },
        {
          "uuid": "58fb4821-1aa2-b229-da8d-6957908e18e0",
          "code": "Probenecid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Probenecid",
          "code_system": "WIKIPEDIA",
          "references": [
            "97c86066-2d2b-317a-e7b3-6ba815023524"
          ]
        },
        {
          "uuid": "24958d7a-d0ba-1397-0c3d-a686016720cb",
          "code": "3387",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3387",
          "code_system": "HSDB",
          "references": [
            "3adbbc75-1c5a-4727-7804-82936ca2fe3f"
          ]
        },
        {
          "uuid": "5383b72e-0597-443b-0454-a7ac10dca2d6",
          "code": "DTXSID9021188",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9021188",
          "code_system": "EPA CompTox",
          "references": [
            "6822f914-9648-8b0e-e434-cbf71918da23"
          ]
        },
        {
          "uuid": "1abbbb37-7169-53c6-ab8f-3eb66f78bf8c",
          "code": "Probenecid",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM507/",
          "code_system": "LACTMED",
          "references": [
            "d96c314d-8049-3c88-54f9-e279f8f3cdcf"
          ]
        },
        {
          "uuid": "218256ef-e140-8ac8-ddf2-ac33832eb103",
          "code": "C921",
          "comments": "Pharmacologic Substance[C1909]|Protective Agent[C26170]|Uricosuric Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C921",
          "code_system": "NCI_THESAURUS",
          "references": [
            "d96c314d-8049-3c88-54f9-e279f8f3cdcf"
          ]
        },
        {
          "uuid": "905430b4-7d2c-4eb8-8d76-148c94147c72",
          "code": "PO572Z7917",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "64520cfd-b431-d745-f9f6-07d270ef0605",
          "code": "2268",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2268",
          "code_system": "DRUG CENTRAL",
          "references": [
            "d96c314d-8049-3c88-54f9-e279f8f3cdcf"
          ]
        },
        {
          "uuid": "9bd7a489-9d4d-270b-00d0-37ff8d66f468",
          "code": "8426",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8426",
          "code_system": "CHEBI",
          "references": [
            "d96c314d-8049-3c88-54f9-e279f8f3cdcf"
          ]
        },
        {
          "uuid": "5c867a8e-273d-b5fe-21d7-cd1392b18f4e",
          "code": "1563003",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1563003",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "d96c314d-8049-3c88-54f9-e279f8f3cdcf"
          ]
        },
        {
          "uuid": "0811ef23-9a92-e964-e03b-d1b3b9e0aba9",
          "code": "PO572Z7917",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=PO572Z7917",
          "code_system": "DAILYMED",
          "references": [
            "c49013de-fe17-20d6-ff88-bd8362d29f00"
          ]
        },
        {
          "uuid": "8b36e87a-53e7-2aed-6168-abf06fe8237f",
          "code": "100000081091",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "98a020b4-630b-b535-3cbe-af44d6aef1a3"
          ]
        },
        {
          "uuid": "6ee4ead0-ac87-00e8-5ddc-e7c64df1f80e",
          "code": "18786",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=18786",
          "code_system": "NSC",
          "references": [
            "0e1be03f-7468-436b-3a00-8e5c99bb4235"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "2811d509-90fe-4aec-b4f9-d50e5e4f1477",
          "amount": {
            "uuid": "28b2fc36-77b4-4158-83d0-94ab6f3d2ea7"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "05e266db-e280-42a5-ab47-acb196c6e662",
            "refuuid": "6a04a256-1bbf-4808-9b17-72ebc023ae31",
            "name": "PROBENECID",
            "unii": "PO572Z7917",
            "linking_id": "PO572Z7917",
            "ref_pname": "PROBENECID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9f7b8d5d-a533-47fb-a4ae-ff24a0aea6fe",
          "amount": {
            "uuid": "18945610-371b-4122-b4ef-84bf52431210"
          },
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "5d4dc959-9d32-4dca-84c3-c89636643fc5",
            "refuuid": "a9bb6e88-2c50-4587-b0a3-e21383e885f8",
            "name": "PIVAMPICILLIN PROBENATE",
            "unii": "M3MYK6R22U",
            "linking_id": "M3MYK6R22U",
            "ref_pname": "PIVAMPICILLIN PROBENATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "52fe26e2-2e07-48c4-813a-0f92883c564e",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "ea4f5d2a-1e09-4532-820c-369a1896678c",
            "refuuid": "83cbbb38-f6f1-4c2f-bdb4-e13faa1c8e80",
            "name": "PROBENECID GLYCINE CONJUGATE",
            "unii": "HXH382L6UT",
            "linking_id": "HXH382L6UT",
            "ref_pname": "PROBENECID GLYCINE CONJUGATE"
          }
        },
        {
          "uuid": "b9c4381c-5bc1-4f32-93c8-57dc017b34e2",
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "b4c5c081-d099-48d0-bf1f-9d9cbef7363c",
            "refuuid": "e82e03b4-e7ee-496d-ae54-a7b8d5f9bce5",
            "name": "BENZOIC ACID, 4-(((3-HYDROXYPROPYL)PROPYLAMINO)SULFONYL)-",
            "unii": "KH6A8BM4VL",
            "linking_id": "KH6A8BM4VL",
            "ref_pname": "BENZOIC ACID, 4-(((3-HYDROXYPROPYL)PROPYLAMINO)SULFONYL)-"
          }
        },
        {
          "uuid": "8aa86283-e657-4bd6-bd91-e8e5dc4f9045",
          "amount": {
            "uuid": "8e5cc0c1-3ca1-4e7e-a59c-cfbf942566f8"
          },
          "type": "METABOLITE->PARENT",
          "related_substance": {
            "uuid": "aa715c29-7e4b-46f3-a5b2-3c3c910a3a16",
            "refuuid": "f32a85ed-db4c-41c1-8f72-c360dd4e3d32",
            "name": "4-((PROPYLAMINO)SULFONYL)BENZOIC ACID",
            "unii": "6TGK2SB58H",
            "linking_id": "6TGK2SB58H",
            "ref_pname": "4-((PROPYLAMINO)SULFONYL)BENZOIC ACID"
          }
        },
        {
          "uuid": "dab8316c-15b4-49bf-be8f-d77b385e25cb",
          "type": "TRANSPORTER->SUBSTRATE",
          "references": [
            "14d27400-2b3d-4864-a2db-21f5f6b6baeb"
          ],
          "related_substance": {
            "uuid": "219637e3-28f9-4683-b096-e276153ce1be",
            "refuuid": "7e429dc7-8255-4143-a00f-0635730dff29",
            "name": "MONOCARBOXYLATE TRANSPORTER 6",
            "unii": "3FJ2FTH4UQ",
            "linking_id": "3FJ2FTH4UQ",
            "ref_pname": "MONOCARBOXYLATE TRANSPORTER 6"
          }
        },
        {
          "uuid": "84f03ee2-e91f-460f-8136-a449dc6b4557",
          "amount": {
            "uuid": "f9e6fa5e-5a42-44b6-8d93-0b368d9adf43"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "5852f748-50c2-4d4e-94fc-0cc65ae3562e"
          ],
          "related_substance": {
            "uuid": "d9ed88f5-4956-41d2-8ae7-f760e13390ce",
            "refuuid": "07f8480e-7bce-4193-b48c-e6d5a190646e",
            "name": "OAT-3",
            "unii": "ZWJ2Y6JZWY",
            "linking_id": "ZWJ2Y6JZWY",
            "ref_pname": "OAT-3",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "7b20af8f-f35d-4992-b39a-62c1418a3221",
          "amount": {
            "uuid": "4d436658-3046-4359-8dd8-7d9252908530"
          },
          "type": "TARGET->INHIBITOR",
          "references": [
            "5852f748-50c2-4d4e-94fc-0cc65ae3562e"
          ],
          "related_substance": {
            "uuid": "87d8669b-8226-4858-906c-f05a61508dda",
            "refuuid": "d72d1f5d-15ef-4ce5-91ef-95de4f5f5619",
            "name": "OAT-1",
            "unii": "I81U7H57XI",
            "linking_id": "I81U7H57XI",
            "ref_pname": "OAT-1",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c0fe64b7-0b99-42a1-95f3-fd509d2607d8",
          "amount": {
            "uuid": "19e91565-9b7f-48f5-8e3e-24984a8f82eb",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "dd29ed89-699a-4f8c-aa89-42cfccc8111e"
          ],
          "related_substance": {
            "uuid": "dea8398a-2cd3-4374-8486-a62725ca6ebf",
            "refuuid": "621b503d-7048-425e-a5a2-e86af42e72be",
            "name": "ETHYL 4-(DIPROPYLSULFAMOYL)BENZOATE",
            "unii": "4P8TV3VB42",
            "linking_id": "4P8TV3VB42",
            "ref_pname": "ETHYL 4-(DIPROPYLSULFAMOYL)BENZOATE"
          }
        },
        {
          "uuid": "705977ac-bd98-44ac-ab80-3e21ebfdb098",
          "amount": {
            "uuid": "dc70aa04-ac71-4e61-abdd-21c63f248ef8",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7f49a29b-7e8c-4b56-94b5-32bcb224df82"
          ],
          "related_substance": {
            "uuid": "8111e452-f9d0-4063-adc1-f0aedbd7a67b",
            "refuuid": "1c7a12cf-5000-4e67-b218-a9dbf60a8051",
            "name": "4-(DIPROPYLSULFAMOYL)-N,N-DIPROPYLBENZAMIDE",
            "unii": "B3BQC7FFA2",
            "linking_id": "B3BQC7FFA2",
            "ref_pname": "4-(DIPROPYLSULFAMOYL)-N,N-DIPROPYLBENZAMIDE"
          }
        },
        {
          "uuid": "9f7620ca-fa4a-4c6a-8b6f-51308baa7ef0",
          "amount": {
            "uuid": "3c2d865b-5195-45a8-a53f-f77853f656f0",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.15
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "8a0e4405-7bbd-4f30-84a7-63e7ba72681a"
          ],
          "related_substance": {
            "uuid": "e0090c8e-3687-42c8-8f27-795c0ce7bcd6",
            "refuuid": "273fccbc-e459-4be7-8c06-49a03f097fee",
            "name": "4-SULFOBENZOIC ACID",
            "unii": "CTD9Y82JZH",
            "linking_id": "CTD9Y82JZH",
            "ref_pname": "4-SULFOBENZOIC ACID"
          }
        },
        {
          "uuid": "8b67b40d-286b-40bb-ab19-0f1dc6d07664",
          "amount": {
            "uuid": "881bda85-170b-4728-a7ce-b9e7e9b5887a"
          },
          "comments": "Primary target.",
          "type": "TARGET->INHIBITOR",
          "related_substance": {
            "uuid": "23d65591-82ba-48e4-8cb1-131ff41f1eee",
            "refuuid": "3025967b-8cf4-4394-84c8-a88794395a83",
            "name": "OATL-4",
            "unii": "LGG1US7EOD",
            "linking_id": "LGG1US7EOD",
            "ref_pname": "OATL-4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d73374af-490a-47b1-8701-dee91d0c32e7",
          "amount": {
            "uuid": "e1bc8b4a-ef24-4637-92cb-e11766406544",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "5a3279aa-704d-4655-bf33-6f821382de8c"
          ],
          "related_substance": {
            "uuid": "a8b731c5-634e-4fb2-812d-a1d4e0329431",
            "refuuid": "240a24e5-bccb-4cce-bd80-7855694b6a5c",
            "name": "DITOLAMIDE",
            "unii": "AL8499KM94",
            "linking_id": "AL8499KM94",
            "ref_pname": "DITOLAMIDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "762f2d6e-b750-4aa6-8607-3bdee85c0d19",
          "name": "BENEMID",
          "stdName": "BENEMID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d7ebbde-5911-4e4c-853d-48dab8de9f0a",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "3d864cbf-5049-40f6-917e-5873b9e55dce",
          "name": "BENZOIC ACID, 4-((DIPROPYLAMINO)SULFONYL)-",
          "stdName": "BENZOIC ACID, 4-((DIPROPYLAMINO)SULFONYL)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "837208b7-45ec-441c-91cd-25256921dcc2"
          ],
          "display_name": false
        },
        {
          "uuid": "d7429359-51b5-4a4f-878b-5921d316fb49",
          "name": "COL-PROBENECID COMPONENT PROBENECID",
          "stdName": "COL-PROBENECID COMPONENT PROBENECID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ed2487-b849-42cb-8647-5ba7f744baa0",
            "6f1c4932-3178-46cf-a46d-299d862746c5"
          ],
          "display_name": false
        },
        {
          "uuid": "f202fadb-8d50-4794-a63a-47ce87d958ff",
          "name": "COLBENEMID COMPONENT PROBENECID",
          "stdName": "COLBENEMID COMPONENT PROBENECID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ed2487-b849-42cb-8647-5ba7f744baa0",
            "6f1c4932-3178-46cf-a46d-299d862746c5"
          ],
          "display_name": false
        },
        {
          "uuid": "80cd782f-217d-4117-9d2f-c560534b7f95",
          "name": "NSC-18786",
          "stdName": "NSC-18786",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "02f922ac-0f6a-4533-9ad5-b24040bed590",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "f9436b4c-79fe-4cb4-934d-ac3d8d8b8fa0",
          "name": "ORLYNVAH COMPONENT PROBENECID",
          "stdName": "ORLYNVAH COMPONENT PROBENECID",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e1427934-460a-4453-a407-397c559a7aac"
          ],
          "display_name": false
        },
        {
          "uuid": "6392d0b9-a9bd-4b54-9b78-c8a399c086a7",
          "name": "P-(DIPROPYLSULFAMOYL)BENZOIC ACID",
          "stdName": "P-(DIPROPYLSULFAMOYL)BENZOIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "837208b7-45ec-441c-91cd-25256921dcc2"
          ],
          "display_name": false
        },
        {
          "uuid": "fb6f94be-02bb-4b12-8c68-b49421b44ad5",
          "name": "PROBALAN",
          "stdName": "PROBALAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d7ebbde-5911-4e4c-853d-48dab8de9f0a",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "0651a0d2-3ed3-4953-97e6-f1ce9b21237d",
          "name": "PROBAMPACIN COMPONENT PROBENECID",
          "stdName": "PROBAMPACIN COMPONENT PROBENECID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ed2487-b849-42cb-8647-5ba7f744baa0",
            "6f1c4932-3178-46cf-a46d-299d862746c5"
          ],
          "display_name": false
        },
        {
          "uuid": "be4fcd1e-c5c7-42dc-ac37-0dd8d3e9bb1d",
          "name": "PROBEN-C COMPONENT PROBENECID",
          "stdName": "PROBEN-C COMPONENT PROBENECID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ed2487-b849-42cb-8647-5ba7f744baa0",
            "6f1c4932-3178-46cf-a46d-299d862746c5"
          ],
          "display_name": false
        },
        {
          "uuid": "3c11226f-5f5f-41ea-8a5d-633fd5cad53c",
          "name": "PROBENATE",
          "stdName": "PROBENATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56",
            "10380a02-342a-4483-bfdc-a4a0f242a17a"
          ],
          "display_name": false
        },
        {
          "uuid": "3dfbe0cb-d128-45cc-8281-95ab79c42d5c",
          "name": "PROBENECID",
          "stdName": "PROBENECID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e4619ef3-4d11-42ba-88c4-618fba0f5232",
            "0534e62a-1c7a-4dd0-85c9-0dace36ac94d",
            "182eb915-da1d-4a04-a93a-ba417ccc8e0b",
            "5a5f3429-9226-44ea-8a2f-4b353e9853a6",
            "ff87ea76-89a4-4a15-9879-16bab57eee86",
            "fa6c946d-b488-4fe0-909a-f054ff69003a",
            "f21494b5-2968-4094-803f-213f5194ec2d",
            "35ad0891-6d43-4a78-9909-9e31c5a6e5b5",
            "60e3dea8-6cff-41e9-b13c-fd89ef8de2f3",
            "deb232c9-ec08-479f-8322-145f9448ebd6",
            "cdf4fc38-ba9c-45a0-9278-f4cca818fdce",
            "7eb85529-5507-4819-8f04-e79079e2344f",
            "4b94e3b2-278a-4086-8ef3-f77d385ef714",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56",
            "4b22d6e6-95ed-4486-9a09-830d50b3117b",
            "2cad31eb-4a06-41f2-b611-38aec1fdd7bc",
            "56458526-d053-4c51-832e-88f9f03ef5c7",
            "cc35c4b9-f07e-4c78-bbc6-3a2bb4b0fdb2",
            "1b39da00-e6bb-4fb5-aa12-f432ec3db633",
            "cff43db9-e0e2-4ba1-b075-3a1bd684602b",
            "3af7633b-cd4a-44bd-ae42-36b1b825ca51",
            "837208b7-45ec-441c-91cd-25256921dcc2",
            "918086f3-8557-4760-bf82-efe7228f1e8b",
            "69181ab3-7f84-4226-98dd-8adc62e323ec",
            "4a8a92ab-ab2f-44cf-bce6-57150e4050de",
            "721384d3-5152-42c0-a5a6-60cf3ad063c0"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "9ff77a52-1d69-472b-b610-92f869be911b",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "ab51e0c1-60f3-5913-6023-4ad64d6c623c",
          "name": "PROBENECID [EP IMPURITY]",
          "stdName": "PROBENECID [EP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2cad31eb-4a06-41f2-b611-38aec1fdd7bc"
          ],
          "display_name": false
        },
        {
          "uuid": "2c1c22bf-0248-c88a-529c-6da01f1df6d8",
          "name": "PROBENECID [EP MONOGRAPH]",
          "stdName": "PROBENECID [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "11be0e6e-f1bc-2df9-0dfd-197524be65a4"
          ],
          "display_name": false
        },
        {
          "uuid": "79808624-5b65-4f76-b2aa-27cf96465ae8",
          "name": "PROBENECID [HSDB]",
          "stdName": "PROBENECID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56",
            "182eb915-da1d-4a04-a93a-ba417ccc8e0b"
          ],
          "display_name": false
        },
        {
          "uuid": "3f3cf06e-5a82-43a9-bb1c-825de3d8d3e9",
          "name": "PROBENECID [JAN]",
          "stdName": "PROBENECID [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b94e3b2-278a-4086-8ef3-f77d385ef714",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "1c680ae5-a2ba-457c-ae1e-4e7c30c69710",
          "name": "PROBENECID [MART.]",
          "stdName": "PROBENECID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5a5f3429-9226-44ea-8a2f-4b353e9853a6"
          ],
          "display_name": false
        },
        {
          "uuid": "63b67116-18a4-4938-bebd-ddf9cc77bdef",
          "name": "PROBENECID [MI]",
          "stdName": "PROBENECID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a8a92ab-ab2f-44cf-bce6-57150e4050de",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "10f9d8e6-d87b-46e5-bf22-fce74bcf6620",
          "name": "PROBENECID [ORANGE BOOK]",
          "stdName": "PROBENECID [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fa6c946d-b488-4fe0-909a-f054ff69003a"
          ],
          "display_name": false
        },
        {
          "uuid": "1d633f31-344e-42c5-cdb0-65afa5823da3",
          "name": "PROBENECID [USP IMPURITY]",
          "stdName": "PROBENECID [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ff87ea76-89a4-4a15-9879-16bab57eee86"
          ],
          "display_name": false
        },
        {
          "uuid": "349862cc-08f6-3bad-80de-30d0d6458375",
          "name": "PROBENECID [USP MONOGRAPH]",
          "stdName": "PROBENECID [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ed481b18-6868-3210-ea9f-f000860413eb"
          ],
          "display_name": false
        },
        {
          "uuid": "03656f85-06a9-451f-949e-4f1888a42c29",
          "name": "PROBENECID [USP-RS]",
          "stdName": "PROBENECID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b39da00-e6bb-4fb5-aa12-f432ec3db633",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "85b64659-8d6b-4eec-858b-72f8d83bf24b",
          "name": "PROBENECID [WHO-IP]",
          "stdName": "PROBENECID [WHO-IP]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc35c4b9-f07e-4c78-bbc6-3a2bb4b0fdb2",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "98ebd04c-85e3-4d43-bf52-283cddcbaac3",
          "name": "PROBENECIDUM [WHO-IP LATIN]",
          "stdName": "PROBENECIDUM [WHO-IP LATIN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc35c4b9-f07e-4c78-bbc6-3a2bb4b0fdb2",
            "5a6c136a-9ef9-475b-b3c0-778cbe109c56"
          ],
          "display_name": false
        },
        {
          "uuid": "8c65da1b-a27f-7254-c785-f4cce67a566d",
          "name": "Probenecid [WHO-DD]",
          "stdName": "PROBENECID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cd545d51-c85c-8866-438d-1b940b405b70"
          ],
          "display_name": false
        },
        {
          "uuid": "5b405ae0-3d4f-44bd-a43a-c3d1aac7f636",
          "name": "probenecid [INN]",
          "stdName": "PROBENECID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "918086f3-8557-4760-bf82-efe7228f1e8b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "837208b7-45ec-441c-91cd-25256921dcc2",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2d7ebbde-5911-4e4c-853d-48dab8de9f0a",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a6c136a-9ef9-475b-b3c0-778cbe109c56",
          "citation": "ORANGE BOOK",
          "doc_type": "ORANGE BOOK",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "918086f3-8557-4760-bf82-efe7228f1e8b",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ff87ea76-89a4-4a15-9879-16bab57eee86",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2cad31eb-4a06-41f2-b611-38aec1fdd7bc",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a1ed2487-b849-42cb-8647-5ba7f744baa0",
          "citation": "Drugs@FDA 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f1c4932-3178-46cf-a46d-299d862746c5",
          "citation": "Drugs@FDA 2012",
          "doc_type": "DRUGS@FDA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa6c946d-b488-4fe0-909a-f054ff69003a",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5a5f3429-9226-44ea-8a2f-4b353e9853a6",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a8a92ab-ab2f-44cf-bce6-57150e4050de",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10380a02-342a-4483-bfdc-a4a0f242a17a",
          "citation": "WHO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b94e3b2-278a-4086-8ef3-f77d385ef714",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "182eb915-da1d-4a04-a93a-ba417ccc8e0b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b39da00-e6bb-4fb5-aa12-f432ec3db633",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69181ab3-7f84-4226-98dd-8adc62e323ec",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "deb232c9-ec08-479f-8322-145f9448ebd6",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc35c4b9-f07e-4c78-bbc6-3a2bb4b0fdb2",
          "citation": "WHO-IP",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02f922ac-0f6a-4533-9ad5-b24040bed590",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6868341-cf14-425f-9293-e8053d7211f6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8a6750ea-d36a-481f-af70-8f1c55b852d9",
          "citation": "SRS import [PO572Z7917]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PO572Z7917",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389714000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56458526-d053-4c51-832e-88f9f03ef5c7",
          "citation": "PROBENECID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "35ad0891-6d43-4a78-9909-9e31c5a6e5b5",
          "citation": "PROBENECID [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0534e62a-1c7a-4dd0-85c9-0dace36ac94d",
          "citation": "PROBENECID [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e4619ef3-4d11-42ba-88c4-618fba0f5232",
          "citation": "PROBENECID [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cff43db9-e0e2-4ba1-b075-3a1bd684602b",
          "citation": "PROBENECID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b22d6e6-95ed-4486-9a09-830d50b3117b",
          "citation": "PROBENECID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "721384d3-5152-42c0-a5a6-60cf3ad063c0",
          "citation": "PROBENECID [JAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cdf4fc38-ba9c-45a0-9278-f4cca818fdce",
          "citation": "PROBENECID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f21494b5-2968-4094-803f-213f5194ec2d",
          "citation": "PROBENECID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "60e3dea8-6cff-41e9-b13c-fd89ef8de2f3",
          "citation": "PROBENECID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3af7633b-cd4a-44bd-ae42-36b1b825ca51",
          "citation": "PROBENECID [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7eb85529-5507-4819-8f04-e79079e2344f",
          "citation": "PROBENECID [WHO-IP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "97c86066-2d2b-317a-e7b3-6ba815023524",
          "citation": "Probenecid",
          "url": "https://en.wikipedia.org/wiki/Probenecid",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3adbbc75-1c5a-4727-7804-82936ca2fe3f",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+57-66-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6822f914-9648-8b0e-e434-cbf71918da23",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=57-66-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1d10d802-d235-1292-26b8-f551d1f58e8a",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+57-66-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d96c314d-8049-3c88-54f9-e279f8f3cdcf",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "78c21a7a-4f2a-4df5-823f-beff89bd09e2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "14d27400-2b3d-4864-a2db-21f5f6b6baeb",
          "citation": "Pérez-Escuredo, Jhudit, et al. \"Monocarboxylate transporters in the brain and in cancer.\" Biochimica et Biophysica Acta (BBA)-Molecular Cell Research 1863.10 (2016): 2481-2497.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0167488916300660",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "ed481b18-6868-3210-ea9f-f000860413eb",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "8a0e4405-7bbd-4f30-84a7-63e7ba72681a",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "11be0e6e-f1bc-2df9-0dfd-197524be65a4",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "5a3279aa-704d-4655-bf33-6f821382de8c",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5852f748-50c2-4d4e-94fc-0cc65ae3562e",
          "citation": "Hagos, Fanuel T., et al. \"Probenecid, an organic anion transporter 1 and 3 inhibitor, increases plasma and brain exposure of N-acetylcysteine.\" Xenobiotica 47.4 (2017): 346-353.",
          "url": "https://www.tandfonline.com/doi/pdf/10.1080/00498254.2016.1187777?needAccess=true",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "dd29ed89-699a-4f8c-aa89-42cfccc8111e",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7f49a29b-7e8c-4b56-94b5-32bcb224df82",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0e1be03f-7468-436b-3a00-8e5c99bb4235",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c49013de-fe17-20d6-ff88-bd8362d29f00",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "cd545d51-c85c-8866-438d-1b940b405b70",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "98a020b4-630b-b535-3cbe-af44d6aef1a3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e1427934-460a-4453-a407-397c559a7aac",
          "citation": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2024/213972s000lbl.pdf",
          "url": "https://www.accessdata.fda.gov/drugsatfda_docs/label/2024/213972s000lbl.pdf",
          "doc_type": "DRUGS@FDA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "91b2efb1-528c-4f36-88c4-2021c1938c62",
          "id": "91b2efb1-528c-4f36-88c4-2021c1938c62",
          "molfile": "\n  Marvin  01132107332D          \n\n 19 19  0  0  0  0            999 V2000\n    6.3631   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5729   -1.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9737   -2.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1551   -2.1641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9460   -1.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5347   -0.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3178    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5792   -2.7529    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1325   -3.4346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2249   -3.2952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8691   -2.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1718   -2.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4513   -2.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4513   -1.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1718   -1.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8768   -1.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -1.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7127   -0.3176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  8  2  0  0  0  0\n 11  8  1  0  0  0  0\n 12 11  1  0  0  0  0\n 16 11  2  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 17 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 17  2  0  0  0  0\nM  END",
          "smiles": "CCCN(CCC)S(=O)(=O)c1ccc(cc1)C(=O)O",
          "formula": "C13H19NO4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4f6281da-b90a-4bbf-b4ca-60718d808a4e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "285.3608",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6a04a256-1bbf-4808-9b17-72ebc023ae31",
      "version": "64",
      "structure": {
        "id": "9bfe752c-0c3d-47d7-9895-5e93af583b6b",
        "molfile": "\n  Marvin  01132108062D          \n\n 19 19  0  0  0  0            999 V2000\n    3.5792   -2.7529    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8691   -2.3629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1551   -2.1641    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7154   -1.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1325   -3.4346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2249   -3.2952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4513   -1.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7127   -0.3176    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1718   -2.7761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8768   -1.5366    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4513   -2.3552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1718   -1.1388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5443    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9737   -2.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9460   -1.3868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5729   -1.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5347   -0.8006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3631   -2.0014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3178    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  7  1  0  0  0  0\n  5  1  2  0  0  0  0\n  6  1  2  0  0  0  0\n  7 12  1  0  0  0  0\n  8  4  2  0  0  0  0\n  9  2  2  0  0  0  0\n 10  2  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13  4  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  3  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 15  1  0  0  0  0\n 18 16  1  0  0  0  0\n 19 17  1  0  0  0  0\n 11  7  2  0  0  0  0\nM  END",
        "smiles": "CCCN(CCC)S(=O)(=O)c1ccc(cc1)C(=O)O",
        "formula": "C13H19NO4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "285.3608",
        "optical_activity": "NONE",
        "references": [
          "8a6750ea-d36a-481f-af70-8f1c55b852d9",
          "837208b7-45ec-441c-91cd-25256921dcc2",
          "918086f3-8557-4760-bf82-efe7228f1e8b"
        ],
        "stereo_centers": 0
      },
      "unii": "PO572Z7917"
    }
  ]
}