{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "6c8e0d86-2211-4d2e-aef1-06e1f9682b8b", "code": "64963-01-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=64963-01-5", "code_system": "CAS", "references": [ "e076b512-9528-d429-91fe-0b4475805e72" ] }, { "uuid": "4204ced2-f1c9-4e4a-b7b3-9e0f3bf25a92", "code": "265-291-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.059.337", "code_system": "ECHA (EC/EINECS)", "references": [ "e2b86d62-ce61-1059-4e33-75bc30a0481f" ] }, { "uuid": "833ae5bf-c70a-4b7a-af1e-2969d01dea5b", "code": "10099522", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10099522", "code_system": "PUBCHEM", "references": [ "c1eb4f7e-09c1-e11a-8b8e-ab60a43070ba" ] }, { "uuid": "f57f3be1-596b-4c84-b59b-e85416b383ec", "code": "PO4D55T1IG", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "d4e1cf23-988a-30f9-76f1-8f5101ed0699", "code": "374895", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=374895", "code_system": "NSC", "references": [ "ae1056f3-2296-e971-eb9b-dd421868162e" ] }, { "uuid": "8456c67e-04a1-3d72-f387-83d05ff90f00", "code": "PO4D55T1IG", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(PO4D55T1IG)", "code_system": "DAILYMED", "references": [ "5127510a-d106-ec82-6c59-7bc6c34bfea7" ] } ], "relationships": [ { "uuid": "fb4d77ac-bf96-4765-876d-766c9155eb3c", "type": "SUBSTANCE->SUB_ALTERNATE", "related_substance": { "uuid": "f03061ee-5e9a-40d2-bfcb-cf9bac8f0cc4", "refuuid": "97cd7836-a793-4dda-b671-014b372e2f5b", "name": "ALTERNATIVE DEFINITION for [PENTAPEPTIDE-18]", "linking_id": "97cd7836-a793-4dda-b671-014b372e2f5b", "ref_pname": "NO NAME" } } ], "substance_class": "chemical", "names": [ { "uuid": "f30ef6a4-e0fc-4c08-a20e-13690d501143", "name": "(D-ALA2)LEUCINE-ENKEPHALIN", "stdName": "(D-ALA2)LEUCINE-ENKEPHALIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e076b512-9528-d429-91fe-0b4475805e72", "3a966455-d0fc-48eb-ba19-889ff942c54f" ], "display_name": false }, { "uuid": "fbe1d8a0-9092-e79f-c34c-487d43b6f457", "name": "1-5-(D-ALA2)-DYNORPHIN", "stdName": "1-5-(D-ALA2)-DYNORPHIN", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e076b512-9528-d429-91fe-0b4475805e72" ], "display_name": false }, { "uuid": "9d779758-5444-235e-1a2c-c1dec86fab72", "name": "L-LEUCINE, L-TYROSYL-D-ALANYLGLYCYL-L-PHENYLALANYL-", "stdName": "L-LEUCINE, L-TYROSYL-D-ALANYLGLYCYL-L-PHENYLALANYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e076b512-9528-d429-91fe-0b4475805e72" ], "display_name": false }, { "uuid": "6d1dd5e6-4ae4-f291-eaac-bcd6c2d4e43c", "name": "LEUPHASYL", "stdName": "LEUPHASYL", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "e076b512-9528-d429-91fe-0b4475805e72" ], "display_name": false }, { "uuid": "652b7119-cdc6-7eed-9e3a-0bb1e48dc44a", "name": "NSC-374895", "stdName": "NSC-374895", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "e076b512-9528-d429-91fe-0b4475805e72" ], "display_name": false }, { "uuid": "2638c1b4-f137-9b4e-3d05-c915d1e5b940", "name": "PENTAPEPTIDE-18", "stdName": "PENTAPEPTIDE-18", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "e076b512-9528-d429-91fe-0b4475805e72" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "6a4e4e78-9588-4a09-ae65-30b0460f6f29", "name_org": "INCI" } ] }, { "uuid": "14c2196f-cf7f-8889-6cca-ea90940673e6", "name": "TYR-D-ALA-GLY-PHE-LEU", "stdName": "TYR-D-ALA-GLY-PHE-LEU", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "e076b512-9528-d429-91fe-0b4475805e72" ], "display_name": false } ], "references": [ { "uuid": "5127510a-d106-ec82-6c59-7bc6c34bfea7", "citation": "DAILYMED", "doc_type": "DAILYMED", "public_domain": true }, { "uuid": "3a966455-d0fc-48eb-ba19-889ff942c54f", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "8f8692a1-d941-41ee-b2f6-8055aebbd53d", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4e3ce404-fbb3-49aa-a868-0295d9e56fd8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394137000, "tags": [ "NOMEN" ] }, { "uuid": "e076b512-9528-d429-91fe-0b4475805e72", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "e2b86d62-ce61-1059-4e33-75bc30a0481f", "citation": "265-291-0", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.059.337", "doc_type": "ECHA (EC/EINECS)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c1eb4f7e-09c1-e11a-8b8e-ab60a43070ba", "citation": "PUBCHEM", "doc_type": "NLM", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ae1056f3-2296-e971-eb9b-dd421868162e", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "98c405c3-8be1-faf8-2f57-e54df7cd03fa", "id": "98c405c3-8be1-faf8-2f57-e54df7cd03fa", "molfile": "\n Marvin 01132107562D \n\n 41 42 0 0 1 0 999 V2000\n 12.4054 -4.0702 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 12.4054 -4.8952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6909 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9765 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9765 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2620 -5.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5475 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8330 -5.3078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5475 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2620 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1199 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1199 -2.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.8344 -4.0702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5488 -3.6577 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 14.5488 -2.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2633 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2633 -4.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9779 -3.6577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6923 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4068 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4068 -2.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1213 -4.0702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -3.6577 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 19.5502 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5502 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2647 -5.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2647 -6.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5502 -6.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -6.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -5.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -2.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1213 -2.4202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5502 -2.4202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2647 -2.8327 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 20.2647 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6937 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -2.4202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6937 -2.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -1.5952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 1 3 1 0 0 0 0\n 11 1 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 4 10 2 0 0 0 0\n 5 6 2 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 7 2 0 0 0 0\n 10 9 1 0 0 0 0\n 11 12 2 0 0 0 0\n 13 11 1 0 0 0 0\n 14 13 1 0 0 0 0\n 14 15 1 6 0 0 0\n 14 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 18 16 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 20 21 2 0 0 0 0\n 22 20 1 0 0 0 0\n 23 22 1 6 0 0 0\n 23 24 1 0 0 0 0\n 23 31 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 25 30 2 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 29 28 2 0 0 0 0\n 30 29 1 0 0 0 0\n 31 32 2 0 0 0 0\n 31 33 1 0 0 0 0\n 34 33 1 6 0 0 0\n 34 35 1 0 0 0 0\n 34 39 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 1 0 0 0 0\n 39 40 1 0 0 0 0\n 39 41 2 0 0 0 0\nM END", "smiles": "CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@H](Cc2ccc(cc2)O)N", "formula": "C29H39N5O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c55bf4ea-0dd2-4f15-89b2-85911ff1b2a7" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "569.6504", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "28186eed-10a9-4874-9cff-2ccf14b8f737", "version": "13", "structure": { "id": "56ada156-221b-4377-bc8f-275a9be19093", "molfile": "L-Leucine, L-tyrosyl-D-alanylglycyl-L-phenylalanyl-\n Marvin 01132104302D \n\n 41 42 0 0 1 0 999 V2000\n 18.8357 -3.6577 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 19.5502 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5502 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2647 -5.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2647 -6.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5502 -6.5453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -6.1327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -5.3077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 18.8357 -2.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.5502 -2.4202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 20.2647 -2.8327 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 20.2647 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6937 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -2.4202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.6937 -2.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 20.9792 -1.5952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1213 -2.4202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 18.1213 -4.0702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4068 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.6923 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.9779 -3.6577 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2633 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5488 -3.6577 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 13.8344 -4.0702 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1199 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4054 -4.0702 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.6909 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9765 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9765 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2620 -5.3078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5475 -4.8952 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5475 -4.0702 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.2620 -3.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8330 -5.3078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.4054 -4.8952 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.1199 -2.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.5488 -2.8327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2633 -4.8952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4068 -2.8327 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 2 0 0 0 0\n 3 8 1 0 0 0 0\n 1 9 1 6 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\n 11 16 1 6 0 0 0\n 16 17 1 0 0 0 0\n 16 18 2 0 0 0 0\n 9 19 2 0 0 0 0\n 1 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 30 35 1 0 0 0 0\n 33 36 1 0 0 0 0\n 28 37 1 1 0 0 0\n 27 38 2 0 0 0 0\n 25 39 1 6 0 0 0\n 24 40 2 0 0 0 0\n 21 41 2 0 0 0 0\nM END", "smiles": "CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1ccccc1)NC(=O)CNC(=O)[C@@H](C)NC(=O)[C@H](Cc2ccc(cc2)O)N", "formula": "C29H39N5O7", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "569.6504", "optical_activity": "UNSPECIFIED", "references": [ "e076b512-9528-d429-91fe-0b4475805e72", "3a966455-d0fc-48eb-ba19-889ff942c54f" ], "stereo_centers": 4 }, "unii": "PO4D55T1IG" } ] }