{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "d6d70a79-72b7-4673-a5ba-d54bb6fadf99", "code": "28290-79-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28290-79-1", "code_system": "CAS", "references": [ "c99d07a2-38cb-438f-bcd6-aaf3b9178084", "042b9c61-2d37-444c-9977-59141438f386" ] }, { "uuid": "fc70a9e2-475a-467d-9728-2dbe1b010568", "code": "5282822", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5282822", "code_system": "PUBCHEM", "references": [ "c99d07a2-38cb-438f-bcd6-aaf3b9178084" ] }, { "uuid": "5055ccb1-ce8d-47f4-8fa8-2bbcbf9c2919", "code": "PO45E3L8YU", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "41de050c-6868-b4cd-74a4-96022572c0bf", "code": "DTXSID401315640", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401315640", "code_system": "EPA CompTox", "references": [ "a4decc4c-e79b-6e7c-9611-12be96446d10" ] } ], "substance_class": "chemical", "names": [ { "uuid": "46c05fe5-6cd8-445a-a78b-09ca1aa81275", "name": "(9E,12E,15E)-9,12,15-OCTADECATRIENOIC ACID", "stdName": "(9E,12E,15E)-9,12,15-OCTADECATRIENOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86243680-e49c-4e03-98e1-d3b97aae2014" ], "display_name": false }, { "uuid": "56054ea8-4fa7-41ad-8623-da5af1e2e5c6", "name": "(ALL TRANS)-9,12,15-OCTADECATRIENOIC ACID", "stdName": "(ALL TRANS)-9,12,15-OCTADECATRIENOIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86243680-e49c-4e03-98e1-d3b97aae2014" ], "display_name": false }, { "uuid": "f9b8628a-88f9-4940-b614-f77a6d8122af", "name": "9,12,15-OCTADECATRIENOIC ACID, (9E,12E,15E)-", "stdName": "9,12,15-OCTADECATRIENOIC ACID, (9E,12E,15E)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "86243680-e49c-4e03-98e1-d3b97aae2014" ], "display_name": false }, { "uuid": "5d04d349-c0ec-495f-9490-612a7790c0b3", "name": "ELAIDOLINOLENIC ACID", "stdName": "ELAIDOLINOLENIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "86243680-e49c-4e03-98e1-d3b97aae2014" ], "display_name": true }, { "uuid": "264d3516-4828-47aa-b483-ab10989db4a2", "name": "LINOLENELAIDIC ACID", "stdName": "LINOLENELAIDIC ACID", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "86243680-e49c-4e03-98e1-d3b97aae2014" ], "display_name": false } ], "references": [ { "uuid": "86243680-e49c-4e03-98e1-d3b97aae2014", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c99d07a2-38cb-438f-bcd6-aaf3b9178084", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393222000, "tags": [ "NOMEN" ] }, { "uuid": "7131a14a-ddb7-44ca-a201-125c92c37c7a", "citation": "SRS import [PO45E3L8YU]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PO45E3L8YU", "doc_type": "SRS", "public_domain": true, "document_date": 1493393222000, "tags": [ "NOMEN" ] }, { "uuid": "042b9c61-2d37-444c-9977-59141438f386", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "a4decc4c-e79b-6e7c-9611-12be96446d10", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f8913f8c-1d03-47c0-aab2-c873268e13c0", "id": "f8913f8c-1d03-47c0-aab2-c873268e13c0", "molfile": "\n Marvin 01132112532D \n\n 20 19 0 0 0 0 999 V2000\n 15.7018 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9874 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2729 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5585 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8440 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1295 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4150 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7006 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9861 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2716 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5571 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8427 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1282 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4137 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6992 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9848 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2703 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5558 -4.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5559 -5.8247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8414 -4.5872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\nM END", "smiles": "CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O", "formula": "C18H30O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "19976786-c138-4c97-b855-78807e67b991" }, "defined_stereo": 0, "ez_centers": 3, "molecular_weight": "278.4303", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "7f3d9166-3717-4d65-9522-d586806607de", "version": "4", "structure": { "id": "9544ead5-8757-46a2-b753-dab69ccf2477", "molfile": "\n Marvin 01132107452D \n\n 20 19 0 0 0 0 999 V2000\n 7.1282 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4137 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.6992 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9848 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2703 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5558 -4.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5559 -5.8247 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8414 -4.5872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8427 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5571 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2716 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.9861 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7006 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4150 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1295 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.8440 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.5585 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.2729 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.9874 -4.9996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7018 -4.5872 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 6 8 1 0 0 0 0\n 1 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\nM END", "smiles": "CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)O", "formula": "C18H30O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 3, "molecular_weight": "278.4303", "optical_activity": "NONE", "references": [ "7131a14a-ddb7-44ca-a201-125c92c37c7a", "86243680-e49c-4e03-98e1-d3b97aae2014" ], "stereo_centers": 0 }, "unii": "PO45E3L8YU" } ] }