{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d5ffd6b8-26a3-47cb-bef7-db15af4910a9",
          "code": "69777-61-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=69777-61-3",
          "code_system": "CAS",
          "references": [
            "98ed1ec6-7415-4d1a-9a36-ce4b022f707e",
            "9d72ae9f-203a-4d62-a851-3e9e504723b0"
          ]
        },
        {
          "uuid": "18a3533b-29de-474f-b68c-d959ffe511d6",
          "code": "274-113-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.067.354",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "98ed1ec6-7415-4d1a-9a36-ce4b022f707e"
          ]
        },
        {
          "uuid": "a46558f1-3b9d-478e-929b-d515754167a5",
          "code": "21118872",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/21118872",
          "code_system": "PUBCHEM",
          "references": [
            "98ed1ec6-7415-4d1a-9a36-ce4b022f707e"
          ]
        },
        {
          "uuid": "5845bd3a-ae2e-4a02-b59b-60563b34e5f8",
          "code": "PM117M1KUL",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4a665536-76d0-81c1-438c-3ba75399ba19",
          "code": "DTXSID30887669",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30887669",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "55865756-b520-4334-ad50-4ae5ddb8ba72",
          "name": "BENZOIC ACID, 4-(OCTYLOXY)-, 4-((2S)-2-METHYLBUTYL)PHENYL ESTER",
          "stdName": "BENZOIC ACID, 4-(OCTYLOXY)-, 4-((2S)-2-METHYLBUTYL)PHENYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30757f83-55aa-4ad9-9421-c80174221eb5",
            "f838aab6-3231-40d5-8ed8-274dbcf02023"
          ],
          "display_name": false
        },
        {
          "uuid": "73fd0e5f-15a1-4e8a-b2e5-67f08ff7698e",
          "name": "BENZOIC ACID, 4-(OCTYLOXY)-, 4-(2-METHYLBUTYL)PHENYL ESTER, (S)-",
          "stdName": "BENZOIC ACID, 4-(OCTYLOXY)-, 4-(2-METHYLBUTYL)PHENYL ESTER, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f838aab6-3231-40d5-8ed8-274dbcf02023",
            "48b87d46-2832-458d-acaa-6484c496abfa"
          ],
          "display_name": false
        },
        {
          "uuid": "df291138-1d31-4f25-b81f-7fd0f86eb320",
          "name": "METHYLBUTYLPHENYL OCTYLOXYBENZOATE",
          "stdName": "METHYLBUTYLPHENYL OCTYLOXYBENZOATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "30757f83-55aa-4ad9-9421-c80174221eb5",
            "f838aab6-3231-40d5-8ed8-274dbcf02023",
            "dea8edc4-d900-4550-98ae-b453e029d8bc"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e4e144aa-a0dd-40da-9094-abcf31185480",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "073db097-5e1a-4e92-82ea-230d48dbeb4d",
          "name": "METHYLBUTYLPHENYL OCTYLOXYBENZOATE, (2S)-",
          "stdName": "METHYLBUTYLPHENYL OCTYLOXYBENZOATE, (2S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f838aab6-3231-40d5-8ed8-274dbcf02023",
            "588f1dc8-269f-490a-9f4d-cf2dba6db40d"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "30757f83-55aa-4ad9-9421-c80174221eb5",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "f838aab6-3231-40d5-8ed8-274dbcf02023",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48b87d46-2832-458d-acaa-6484c496abfa",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "588f1dc8-269f-490a-9f4d-cf2dba6db40d",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "98ed1ec6-7415-4d1a-9a36-ce4b022f707e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391526000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6b97eb2-6ace-4af0-950e-6675814ce907",
          "citation": "SRS import [PM117M1KUL]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PM117M1KUL",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391526000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dea8edc4-d900-4550-98ae-b453e029d8bc",
          "citation": "METHYLBUTYLPHENYL OCTYLOXYBENZOATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9d72ae9f-203a-4d62-a851-3e9e504723b0",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "dbfb289f-4074-479f-9ac7-06047feee71e",
          "id": "dbfb289f-4074-479f-9ac7-06047feee71e",
          "molfile": "\n  Marvin  01132111242D          \n\n 29 30  0  0  1  0            999 V2000\n   10.8391   -6.8872    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   10.1246   -6.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -7.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1246   -8.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5536   -6.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5536   -5.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2681   -5.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2681   -4.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5536   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5536   -3.1747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -2.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -1.9372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1246   -3.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4102   -2.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6957   -3.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6957   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9812   -4.4122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9812   -5.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2668   -5.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2668   -6.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5523   -6.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5523   -7.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8378   -8.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8378   -8.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1234   -9.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4102   -4.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1246   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -4.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -5.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  6 29  2  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 28  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 27  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 26 16  2  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 27 26  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(cc2)C[C@@H](C)CC",
          "formula": "C26H36O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "63554ac4-2528-45c0-a648-7d484652e293"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "396.5632",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5c44660f-8d74-4b75-88f2-ea552a2bce18",
      "version": "4",
      "structure": {
        "id": "5601113a-0008-43e0-ba0c-bdc30100e55d",
        "molfile": "\n  Marvin  01132104282D          \n\n 29 30  0  0  1  0            999 V2000\n    6.5523   -6.8872    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5523   -7.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8378   -8.1247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2668   -6.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2668   -5.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9812   -5.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6957   -3.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4102   -2.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2681   -4.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2681   -5.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1246   -6.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1246   -8.1246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -7.7122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -6.8872    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   11.5536   -6.4747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5536   -5.6497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -5.2372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -4.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5536   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5536   -3.1747    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -1.9372    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8391   -2.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1246   -3.1747    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1246   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4102   -4.4122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6957   -3.9997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9812   -4.4122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8378   -8.9498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1234   -9.3623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n 26  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n 23  8  1  0  0  0  0\n 19  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 16  2  0  0  0  0\n 14 11  1  6  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 27 26  1  0  0  0  0\n  6 27  1  0  0  0  0\n  3 28  1  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
        "smiles": "CCCCCCCCOc1ccc(cc1)C(=O)Oc2ccc(cc2)C[C@@H](C)CC",
        "formula": "C26H36O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "396.5632",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "48b87d46-2832-458d-acaa-6484c496abfa",
          "a6b97eb2-6ace-4af0-950e-6675814ce907"
        ],
        "stereo_centers": 1
      },
      "unii": "PM117M1KUL"
    }
  ]
}