{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e29ddacb-85c1-46fd-b689-4836aa621e51",
          "code": "36519-25-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=36519-25-2",
          "code_system": "CAS",
          "references": [
            "65bafbca-e7b9-4506-8661-4409a46d409d",
            "f3805707-aa9e-4e0c-9ec3-988090226ca1"
          ]
        },
        {
          "uuid": "8db87bd5-057f-45ff-aafb-a64654c84a78",
          "code": "13818797",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/13818797",
          "code_system": "PUBCHEM",
          "references": [
            "957b9da3-3914-cac9-7fac-aea63fdab7e7"
          ]
        },
        {
          "uuid": "f293341a-c354-47b6-ac31-17d1de47230f",
          "code": "PLZ86LH7A6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ab33ba80-57c8-f72c-2150-e962174f5287",
          "code": "DTXSID40891813",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID40891813",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "9a7ac9ee-95d5-f168-be8c-517d8ec09862",
          "code": "197212",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=197212",
          "code_system": "NSC",
          "references": [
            "40113da2-4acb-3a83-9d80-4e4b773951d3"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "e87abb23-9adc-4265-87bf-5628422db25b",
          "name": "NEOSOLANIOL",
          "stdName": "NEOSOLANIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bc5f1243-f6ee-45be-80c7-134db80e6323"
          ],
          "display_name": true
        },
        {
          "uuid": "5823822e-1546-615c-d4a6-43d54d7e808d",
          "name": "NEOZOLANIOL",
          "stdName": "NEOZOLANIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec544fe7-a180-4453-03f6-47d9bfcfa2e8"
          ],
          "display_name": false
        },
        {
          "uuid": "33d4bc38-99f1-4b9a-b301-e86b31ff33a2",
          "name": "NSC-197212",
          "stdName": "NSC-197212",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e139a8f8-37b9-473b-8679-121e9a7e082d"
          ],
          "display_name": false
        },
        {
          "uuid": "5a812e78-649e-3db5-0a9a-33cc0678170d",
          "name": "SOLANIOL",
          "stdName": "SOLANIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec544fe7-a180-4453-03f6-47d9bfcfa2e8"
          ],
          "display_name": false
        },
        {
          "uuid": "a068bdfe-7e5d-3834-c0de-ba84265a50dc",
          "name": "TRICHOTHEC-9-ENE-3,4,8,15-TETROL, 12,13-EPOXY-, 4,15-DIACETATE, (3.ALPHA.,4.BETA.,8.ALPHA.)-",
          "stdName": "TRICHOTHEC-9-ENE-3,4,8,15-TETROL, 12,13-EPOXY-, 4,15-DIACETATE, (3.ALPHA.,4.BETA.,8.ALPHA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ec544fe7-a180-4453-03f6-47d9bfcfa2e8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f3805707-aa9e-4e0c-9ec3-988090226ca1",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "bc5f1243-f6ee-45be-80c7-134db80e6323",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e139a8f8-37b9-473b-8679-121e9a7e082d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65bafbca-e7b9-4506-8661-4409a46d409d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392254000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec544fe7-a180-4453-03f6-47d9bfcfa2e8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "957b9da3-3914-cac9-7fac-aea63fdab7e7",
          "citation": "PUBCHEM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "40113da2-4acb-3a83-9d80-4e4b773951d3",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e5b5c58b-826f-7217-b387-f0a442179862",
          "id": "e5b5c58b-826f-7217-b387-f0a442179862",
          "molfile": "\n  Marvin  01132111532D          \n\n 27 30  0  0  1  0            999 V2000\n   16.8006   -3.2547    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   17.6206   -3.1632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3741   -3.9609    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   16.4735   -4.7799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2324   -5.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8920   -4.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3318   -5.9222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4902   -3.8830    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   15.2341   -4.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2767   -3.5235    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   17.4768   -3.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0503   -4.4726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2289   -2.6600    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   15.5228   -2.2335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8002   -2.6317    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.0941   -2.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3716   -2.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6655   -2.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3553   -3.4283    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   12.6329   -3.8267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0616   -3.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.7840   -3.4565    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   14.7677   -4.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0417   -4.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8363   -5.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1014   -6.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3608   -6.3331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n 13  1  1  0  0  0  0\n  3  4  1  1  0  0  0\n  8  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  2  0  0  0  0\n  8  9  1  1  0  0  0\n 10  8  1  0  0  0  0\n  8 22  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  6  0  0  0\n 13 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  6  0  0  0\n 15 14  1  1  0  0  0\n 15 16  1  0  0  0  0\n 22 15  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 19 17  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  6  0  0  0\n 23 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 25 26  1  0  0  0  0\n 25 27  2  0  0  0  0\nM  END",
          "smiles": "CC1=C[C@@H]2[C@@](C[C@@H]1O)(COC(=O)C)[C@@]3(C)[C@@H]([C@H]([C@H]([C@]43CO4)O2)O)OC(=O)C",
          "formula": "C19H26O8",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "47eb9f82-20db-42a0-ada4-28fc6c015ffd"
          },
          "defined_stereo": 8,
          "ez_centers": 0,
          "molecular_weight": "382.4057",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 8
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7f76b51c-4110-4a1e-8e91-02e62cbc0ad1",
      "version": "7",
      "structure": {
        "id": "545b5576-bf56-401a-963d-26d2aabfb382",
        "molfile": "\n  Marvin  01132104232D          \n\n 29 32  0  0  1  0            999 V2000\n   15.2341   -4.6673    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.4902   -3.8830    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.2767   -3.5235    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.2289   -2.6600    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.8006   -3.2547    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.3741   -3.9609    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   16.4735   -4.7799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.2324   -5.1032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.8920   -4.6077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3318   -5.9222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6206   -3.1632    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5228   -2.2335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8002   -2.6317    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.7840   -3.4565    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.7677   -4.2814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0417   -4.6816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8363   -5.7005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1014   -6.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3608   -6.3331    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0616   -3.8549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3553   -3.4283    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   13.3716   -2.6035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0941   -2.2052    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6655   -2.1769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6329   -3.8267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8166   -1.8069    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   16.7440   -2.0155    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   17.4768   -3.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0503   -4.4726    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  6  7  1  1  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n  5 11  1  6  0  0  0\n  4 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 19  2  0  0  0  0\n 14 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 13 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 21 25  1  6  0  0  0\n 13 26  1  6  0  0  0\n  4 27  1  1  0  0  0\n  3 28  1  1  0  0  0\n 28 29  1  0  0  0  0\n  3 29  1  0  0  0  0\nM  END",
        "smiles": "CC1=C[C@]2([H])[C@@](C[C@@H]1O)(COC(=O)C)[C@@]3(C)[C@@H]([C@H]([C@]([H])([C@]43CO4)O2)O)OC(=O)C",
        "formula": "C19H26O8",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 8,
        "ez_centers": 0,
        "molecular_weight": "382.4057",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bc5f1243-f6ee-45be-80c7-134db80e6323"
        ],
        "stereo_centers": 8
      },
      "unii": "PLZ86LH7A6"
    }
  ]
}