{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1ba6f4c9-b2ce-4691-ba6f-40d381b88ff9",
          "code": "4685-14-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4685-14-7",
          "code_system": "CAS",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea",
            "1878429b-dfb9-41da-8395-ad4e0635c6f4"
          ]
        },
        {
          "uuid": "c3793fb2-36d4-4a87-ad38-82c8086cb2db",
          "code": "D010269",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68010269",
          "code_system": "MESH",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea"
          ]
        },
        {
          "uuid": "d8eed73a-ee6b-4cc2-b8a4-0abc55d80c10",
          "code": "PARAQUAT",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Paraquat",
          "code_system": "WIKIPEDIA",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea"
          ]
        },
        {
          "uuid": "8a6b666e-1182-48c5-9f8f-3a5549c9c673",
          "code": "61603",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3220",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea"
          ]
        },
        {
          "uuid": "064e1a82-75c9-4af0-937f-05fef8d826f9",
          "code": "m8405",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8405?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea"
          ]
        },
        {
          "uuid": "57c3e118-61cb-4501-a1f6-051021cc5f23",
          "code": "SUB33054",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea"
          ]
        },
        {
          "uuid": "3aae066f-fa47-4308-a357-9ee4f6eee6b3",
          "code": "225-141-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.022.855",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea"
          ]
        },
        {
          "uuid": "d82c637a-7433-4f8d-81e8-f3379d31abc1",
          "code": "15939",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15939",
          "code_system": "PUBCHEM",
          "references": [
            "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea"
          ]
        },
        {
          "uuid": "7200954f-eb2b-b547-8329-9a052b6e2414",
          "code": "1668",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1668",
          "code_system": "HSDB",
          "references": [
            "b99f877e-f0f7-d975-b397-8cd381ec2a9e"
          ]
        },
        {
          "uuid": "e6cd98aa-dc2d-8386-9a12-7eb08f078cf2",
          "code": "DTXSID3034799",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3034799",
          "code_system": "EPA CompTox",
          "references": [
            "32385001-ceb4-2726-e6bc-ed8ddbcd2c8a"
          ]
        },
        {
          "uuid": "85a2f2db-15a9-4822-906b-50f879d0cb4a",
          "code": "PLG39H7695",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "80624528-fc39-028b-2c00-ccbfb656b8a5",
          "code": "34905",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:34905",
          "code_system": "CHEBI",
          "references": [
            "0a507bf7-f481-6053-4b5c-3cc8a095e694"
          ]
        },
        {
          "uuid": "a4a7bf54-b4d9-2ff3-8350-281c3aad0b48",
          "code": "100000126155",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "29a3d596-2930-7273-7055-fa19bbc55caf"
          ]
        },
        {
          "uuid": "02165115-82ee-320a-3a0e-6a89c4114d17",
          "code": "paraquat",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/paraquat.html",
          "code_system": "ALANWOOD",
          "references": [
            "c0d3d270-5229-9e20-0e10-148830b528c2"
          ]
        },
        {
          "uuid": "45d89087-57ab-560e-fd8c-5aaddfe0573a",
          "code": "PLG39H7695",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=(PLG39H7695)",
          "code_system": "DAILYMED",
          "references": [
            "4bc4001b-f18b-1eb8-1024-f0df23522a7e"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "fcc88377-6e28-444c-b44a-1ec206f80ac5",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "8b88d3e4-aa14-4f87-9eb6-4a9fb239bb8e",
            "refuuid": "de5ea231-19e1-4a12-acc7-79b630a75dad",
            "name": "PARAQUAT",
            "unii": "PLG39H7695",
            "linking_id": "PLG39H7695",
            "ref_pname": "PARAQUAT",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2389709c-7ce5-4ac3-b0b7-551dbc7e4344",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "43b81535-a44f-4eec-b52d-a83f5351d2db",
            "refuuid": "a73179bf-3a8d-42f6-887c-5b9bb9419159",
            "name": "PARAQUAT DICHLORIDE",
            "unii": "2KZ83GSS73",
            "linking_id": "2KZ83GSS73",
            "ref_pname": "PARAQUAT DICHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "328d2a63-d113-49ff-af30-159ebb2473e8",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "936f0649-7e53-4f28-9df9-28b9631cf7d2",
            "refuuid": "a8697b69-5bf8-4e27-8ae3-2dba098e620b",
            "name": "PARAQUAT DIMETILSULFATE",
            "unii": "8ZLR3D655F",
            "linking_id": "8ZLR3D655F",
            "ref_pname": "PARAQUAT DIMETILSULFATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ea6829a0-159b-46b2-a703-edf679c2f698",
          "name": "1,1'-DIMETHYL-4,4'-BIPYRIDINIUM",
          "stdName": "1,1'-DIMETHYL-4,4'-BIPYRIDINIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7124ecb3-8b1f-4d6d-acdb-b85152b87449",
            "ccfe2791-cdcb-47c9-a5fa-af3805226182"
          ],
          "display_name": false
        },
        {
          "uuid": "fcb28a59-23d8-4171-a106-668977127ddd",
          "name": "BIPYRIDINIUM, 1,1'-DIMETHYL-4,4'-",
          "stdName": "BIPYRIDINIUM, 1,1'-DIMETHYL-4,4'-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "7cd52873-f439-462d-94b8-6692cade9900"
          ],
          "display_name": false
        },
        {
          "uuid": "7d6aab23-52e6-4e5d-b69a-cfc19abb04f3",
          "name": "GRAMOXONE S",
          "stdName": "GRAMOXONE S",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f"
          ],
          "display_name": false
        },
        {
          "uuid": "e9d26d84-026d-444c-aaf5-699719f62941",
          "name": "METHYL VIOLOGEN (2+)",
          "stdName": "METHYL VIOLOGEN (2+)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f"
          ],
          "display_name": false
        },
        {
          "uuid": "b81dec83-a2a1-49e8-a57c-a3ba846476d6",
          "name": "N,N'-DIMETHYL-4,4'-BIPYRIDINIUM",
          "stdName": "N,N'-DIMETHYL-4,4'-BIPYRIDINIUM",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "7cd52873-f439-462d-94b8-6692cade9900"
          ],
          "display_name": false
        },
        {
          "uuid": "94345b1b-585c-491d-afc2-83ba657f069b",
          "name": "PARAQUAT",
          "stdName": "PARAQUAT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f",
            "e81f9807-a773-442c-8360-cb294a5b1c03",
            "59aab8ed-e31f-4069-84ec-2307b049ac26",
            "82cf3766-4dd5-46e2-957d-bdce02461b64",
            "17e0196d-cee2-45f5-aa65-e548b8c36659",
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "09d0be48-0b3c-4631-9a73-70e8132d3439",
            "9b11d7c7-dd88-4c19-b756-0c4472f505c2",
            "4b781311-35d1-46db-95a1-50942aaac86e",
            "55f6fbc2-0d21-4519-837b-96b06b992d62"
          ],
          "display_name": true
        },
        {
          "uuid": "328ed107-2a57-4746-b6a2-305a2901d7e4",
          "name": "PARAQUAT CATION",
          "stdName": "PARAQUAT CATION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "189624f7-a46a-417a-84f5-2680e8fc8d7b"
          ],
          "display_name": false
        },
        {
          "uuid": "150046f7-0874-41a2-8a74-a17b64170b5a",
          "name": "PARAQUAT DICATION",
          "stdName": "PARAQUAT DICATION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f"
          ],
          "display_name": false
        },
        {
          "uuid": "c5904b95-b00f-4482-8706-284e1ff346df",
          "name": "PARAQUAT ION",
          "stdName": "PARAQUAT ION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f"
          ],
          "display_name": false
        },
        {
          "uuid": "81815c61-82c8-42be-a273-5d6a1f77c569",
          "name": "PARAQUAT [HSDB]",
          "stdName": "PARAQUAT [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "9b11d7c7-dd88-4c19-b756-0c4472f505c2"
          ],
          "display_name": false
        },
        {
          "uuid": "daa558c9-0c1d-41f2-8926-f52aedf17ebf",
          "name": "PARAQUAT [ISO]",
          "stdName": "PARAQUAT [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "59aab8ed-e31f-4069-84ec-2307b049ac26"
          ],
          "display_name": false
        },
        {
          "uuid": "71c83c08-4858-44fd-852b-14b2cf8ed4f1",
          "name": "PARAQUAT [MART.]",
          "stdName": "PARAQUAT [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "17e0196d-cee2-45f5-aa65-e548b8c36659"
          ],
          "display_name": false
        },
        {
          "uuid": "bb66084e-4981-4869-808e-4f53d549b0f5",
          "name": "PARAQUAT [MI]",
          "stdName": "PARAQUAT [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "e81f9807-a773-442c-8360-cb294a5b1c03"
          ],
          "display_name": false
        },
        {
          "uuid": "336493fc-a1e3-408a-bb4e-0d929bf88bf3",
          "name": "PRIGLONE",
          "stdName": "PRIGLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8851700e-8e1a-407d-84d2-dc91aa807fac",
            "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f",
          "citation": "SAX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8851700e-8e1a-407d-84d2-dc91aa807fac",
          "citation": "SAX DANGEROUS PROPERTIES",
          "doc_type": "SAX DANGEROUS PROPERTIES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cd52873-f439-462d-94b8-6692cade9900",
          "citation": "SITTIG",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7124ecb3-8b1f-4d6d-acdb-b85152b87449",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ccfe2791-cdcb-47c9-a5fa-af3805226182",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "17e0196d-cee2-45f5-aa65-e548b8c36659",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e81f9807-a773-442c-8360-cb294a5b1c03",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b11d7c7-dd88-4c19-b756-0c4472f505c2",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59aab8ed-e31f-4069-84ec-2307b049ac26",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "189624f7-a46a-417a-84f5-2680e8fc8d7b",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bfbee490-9ce1-4a8a-9f4a-6ffb72cda8ea",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390844000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5b255ba-644c-42e0-af48-7ff8328aba3d",
          "citation": "SRS import [PLG39H7695]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PLG39H7695",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390844000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b781311-35d1-46db-95a1-50942aaac86e",
          "citation": "PARAQUAT [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "55f6fbc2-0d21-4519-837b-96b06b992d62",
          "citation": "PARAQUAT [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82cf3766-4dd5-46e2-957d-bdce02461b64",
          "citation": "PARAQUAT [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09d0be48-0b3c-4631-9a73-70e8132d3439",
          "citation": "PARAQUAT [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4bc4001b-f18b-1eb8-1024-f0df23522a7e",
          "citation": "DAILYMED",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b99f877e-f0f7-d975-b397-8cd381ec2a9e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+4685-14-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "32385001-ceb4-2726-e6bc-ed8ddbcd2c8a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4685-14-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c0d3d270-5229-9e20-0e10-148830b528c2",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "0a507bf7-f481-6053-4b5c-3cc8a095e694",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1878429b-dfb9-41da-8395-ad4e0635c6f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "29a3d596-2930-7273-7055-fa19bbc55caf",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5e6347d0-e8a9-4014-b669-b4b2e969457c",
          "id": "5e6347d0-e8a9-4014-b669-b4b2e969457c",
          "molfile": "\n  Marvin  01132104532D          \n\n 14 15  0  0  0  0            999 V2000\n    9.0010   -3.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1759   -3.8373    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    7.7677   -4.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9425   -4.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5345   -3.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9382   -3.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7633   -3.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7138   -3.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3012   -4.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4761   -4.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0679   -3.8506    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    3.2517   -3.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4716   -3.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2968   -3.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  7  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 14  8  2  0  0  0  0\n 10  9  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  2  0  0  0  0\n 13 14  1  0  0  0  0\nM  CHG  2   2   1  11   1\nM  END",
          "smiles": "C[n+]1ccc(cc1)-c2cc[n+](C)cc2",
          "formula": "C12H14N2",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "feb7e1e9-fa75-4eec-b3d9-5f27e474fe15"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "186.2534",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "de5ea231-19e1-4a12-acc7-79b630a75dad",
      "version": "8",
      "structure": {
        "id": "cf224df4-ba7b-45aa-ba84-b139e4d1e416",
        "molfile": "\n  Marvin  01132110422D          \n\n 14 15  0  0  0  0            999 V2000\n    8.1759   -3.8373    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    4.0679   -3.8506    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    6.5345   -3.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7138   -3.8461    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7633   -3.1230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4761   -4.5560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7677   -4.5427    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4716   -3.1363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3012   -4.5515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9425   -4.5470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2968   -3.1320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9382   -3.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0010   -3.8373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2517   -3.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  8  1  0  0  0  0\n  3 10  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  1  1  0  0  0  0\n  6  9  1  0  0  0  0\n  7  1  2  0  0  0  0\n  8 11  2  0  0  0  0\n  9  4  2  0  0  0  0\n 10  7  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  5  2  0  0  0  0\n 13  1  1  0  0  0  0\n 14  2  1  0  0  0  0\n 12  3  1  0  0  0  0\n  6  2  2  0  0  0  0\nM  CHG  2   1   1   2   1\nM  END",
        "smiles": "C[n+]1ccc(cc1)-c2cc[n+](C)cc2",
        "formula": "C12H14N2",
        "atropisomerism": "No",
        "charge": 2,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "186.2534",
        "optical_activity": "NONE",
        "references": [
          "b5b255ba-644c-42e0-af48-7ff8328aba3d",
          "5d88ddc1-9d72-4971-92e1-b57ff6c7ce6f"
        ],
        "stereo_centers": 0
      },
      "unii": "PLG39H7695"
    }
  ]
}