{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "6249af6a-2a0f-43d2-8ef2-bc3e92c3285a",
          "code": "PKZ8989NC5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "4b25269f-863b-4c10-9589-c194131adc33",
          "code": "6528-34-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6528-34-3",
          "code_system": "CAS",
          "references": [
            "c72e21b3-3021-4e6b-a400-e7ad1cdb7f8f",
            "92e9a57e-bbae-46d0-adac-d7a5559fce7b"
          ]
        },
        {
          "uuid": "5b187b73-02c1-4d9b-813e-8ab0ebd51c0a",
          "code": "229-419-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.746",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c72e21b3-3021-4e6b-a400-e7ad1cdb7f8f"
          ]
        },
        {
          "uuid": "e02dd446-ec1f-176d-32dd-3187ee7f9506",
          "code": "DTXSID0052336",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0052336",
          "code_system": "EPA CompTox",
          "references": [
            "a13e7be8-decc-91aa-ec30-7f1c3ed8683a"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "bdb7c2a6-1539-481c-b118-bc15e64d776b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "629b321a-357b-4419-abbf-d010e609220d",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c72e21b3-3021-4e6b-a400-e7ad1cdb7f8f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392815000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f32460d6-b5d1-45ce-9dec-3a81a9b6b45a",
          "citation": "CHEMID RECORD 6528-34-3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a13e7be8-decc-91aa-ec30-7f1c3ed8683a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6528-34-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "92e9a57e-bbae-46d0-adac-d7a5559fce7b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "64ef75d3-cbac-42ea-8c42-26f21b585494",
          "citation": "http://www.dyestuffintermediates.com/pigment-dye/pigment-yellow-65.html",
          "url": "http://www.dyestuffintermediates.com/pigment-dye/pigment-yellow-65.html",
          "doc_type": "MANUFACTURER PRODUCT DESCRIPTION",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "7f91dfc3-4b46-4fc6-9ecb-57d8524d46ae",
          "id": "7f91dfc3-4b46-4fc6-9ecb-57d8524d46ae",
          "molfile": "Pigment Yellow 65\n  CDK     01082519492D\n\n 28 29  0  0  0  0  0  0  0  0999 V2000\n   26.3380   -9.0469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5580   -7.6960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2180   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2180   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -6.3450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980   -4.9940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980  -10.3980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980  -11.7491    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   26.3380  -11.7491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6780  -13.1000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   32.5780   -9.0469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   33.3580   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5380   -6.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9780   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6780  -10.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6780   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.2380  -10.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.2380   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.0180   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8780   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3180   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -3.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5380   -3.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8780   -2.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3180   -2.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1 17  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  6 23  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 10 18  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 22  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 24  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 26 28  2  0  0  0  0\n 27 28  1  0  0  0  0\nM  CHG  1  10   1\nM  CHG  1  12  -1\nM  END",
          "smiles": "CC(=O)C(C(=O)Nc1ccccc1OC)/N=N/c2ccc(cc2[N+](=O)[O-])OC",
          "formula": "C18H18N4O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "59af82eb-70eb-497c-9a0a-63f08b69fa64"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "386.3594",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "1d10cf44-308d-4018-b916-76bc10783d4e",
      "version": "7",
      "structure": {
        "id": "9c8d185f-2462-4fb3-94ac-61bb0b6fe02a",
        "molfile": "Pigment Yellow 65\n   JSDraw201082519492D\n\n 28 29  0  0  0  0              0 V2000\n   26.3380   -9.0469    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5580   -7.6960    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2180   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2180   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -6.3450    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980   -4.9940    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980  -10.3980    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980  -11.7491    0.0000 N   0  3  0  0  0  0  5  0  0  0  0  0\n   26.3380  -11.7491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6780  -13.1000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   32.5780   -9.0469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   33.3580   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5380   -6.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9780   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6780  -10.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6780   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.2380  -10.3980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.2380   -7.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.0180   -9.0469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8780   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3180   -4.9940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -3.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5380   -3.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8780   -2.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3180   -2.2920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1 17  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  5  9  2  0  0  0  0\n  6 23  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 10 18  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 22  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 24  1  0  0  0  0\n 17 18  2  0  0  0  0\n 17 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  2  0  0  0  0\n 20 22  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  2  0  0  0  0\n 23 25  1  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  2  0  0  0  0\n 26 28  2  0  0  0  0\n 27 28  1  0  0  0  0\nM  CHG  2  10   1  12  -1\nM  END",
        "smiles": "CC(=O)C(C(=O)Nc1ccccc1OC)/N=N/c2ccc(cc2[N+](=O)[O-])OC",
        "formula": "C18H18N4O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "386.3594",
        "optical_activity": "( + / - )",
        "references": [
          "f32460d6-b5d1-45ce-9dec-3a81a9b6b45a",
          "92e9a57e-bbae-46d0-adac-d7a5559fce7b",
          "64ef75d3-cbac-42ea-8c42-26f21b585494"
        ],
        "stereo_centers": 1
      },
      "unii": "PKZ8989NC5",
      "relationships": [
        {
          "uuid": "ff227a5d-b6e2-4433-a5be-5869b0a90528",
          "amount": {
            "uuid": "277590e5-b9ba-45b5-9a8b-55461081fc6a"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "dd178f4c-7287-4322-b41e-4f138e6e2e07",
            "refuuid": "567eb273-536a-4c3e-ad46-73dcf83bdedc",
            "name": "ALTERNATIVE DEFINITION for [Pigment Yellow 65]",
            "linking_id": "567eb273-536a-4c3e-ad46-73dcf83bdedc",
            "ref_pname": "NO NAME",
            "substance_class": "reference"
          }
        }
      ],
      "names": [
        {
          "uuid": "0d68d09b-023f-40d2-9ff7-0ba0ce2b4f32",
          "name": "2-[2-(4-Methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxobutanamide",
          "stdName": "2-(2-(4-METHOXY-2-NITROPHENYL)DIAZENYL)-N-(2-METHOXYPHENYL)-3-OXOBUTANAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92e9a57e-bbae-46d0-adac-d7a5559fce7b"
          ],
          "display_name": false
        },
        {
          "uuid": "6a5a3ad8-6c9f-477a-bd80-c5fdefbab1e9",
          "name": "Butanamide, 2-[2-(4-methoxy-2-nitrophenyl)diazenyl]-N-(2-methoxyphenyl)-3-oxo-",
          "stdName": "BUTANAMIDE, 2-(2-(4-METHOXY-2-NITROPHENYL)DIAZENYL)-N-(2-METHOXYPHENYL)-3-OXO-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92e9a57e-bbae-46d0-adac-d7a5559fce7b"
          ],
          "display_name": false
        },
        {
          "uuid": "b0b393db-0636-43b5-a20a-8ca405e1a172",
          "name": "C.I. 11740",
          "stdName": "C.I. 11740",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92e9a57e-bbae-46d0-adac-d7a5559fce7b"
          ],
          "display_name": false
        },
        {
          "uuid": "d8406313-c33e-47f5-b9cf-d0514ee45344",
          "name": "CI 11740",
          "stdName": "CI 11740",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "92e9a57e-bbae-46d0-adac-d7a5559fce7b"
          ],
          "display_name": false
        },
        {
          "uuid": "06136cc7-5081-4d92-8fbd-712fb9d15830",
          "name": "Pigment Yellow 65",
          "stdName": "PIGMENT YELLOW 65",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64ef75d3-cbac-42ea-8c42-26f21b585494"
          ],
          "display_name": true
        }
      ],
      "modifications": {
        "uuid": "658531b6-2333-43d0-9759-d2d4fea0a0f9"
      }
    }
  ]
}