{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "18330fe5-dc9c-40e0-881a-13a08c411103",
          "code": "495-32-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=495-32-9",
          "code_system": "CAS",
          "references": [
            "51d22453-7c6c-4a10-bd20-33240534fcf5",
            "c8b01e62-177f-4c10-8b57-eb78c6598c1f"
          ]
        },
        {
          "uuid": "b34a01c0-0220-49e2-897a-fbcabdb1a536",
          "code": "26305",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/26305",
          "code_system": "PUBCHEM",
          "references": [
            "51d22453-7c6c-4a10-bd20-33240534fcf5"
          ]
        },
        {
          "uuid": "fdb5182d-824c-6afb-34e6-b5a9bc80013e",
          "code": "DTXSID00964239",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00964239",
          "code_system": "EPA CompTox",
          "references": [
            "64e63481-d5a5-bafb-79a7-73ecc5169683"
          ]
        },
        {
          "uuid": "e0a87369-2df1-49cf-82fc-d73f051d0b0a",
          "code": "PKL4EW8LPQ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "54de7711-888f-46d8-8763-24b0b5591e5b",
          "name": "(R)-(-)-NODAKENETIN",
          "stdName": "(R)-(-)-NODAKENETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "06930c7e-09a4-4b54-908b-81e333c2f44b"
          ],
          "display_name": false
        },
        {
          "uuid": "5572b840-5ea6-4e79-8f63-e469ca5a2d29",
          "name": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 2,3-DIHYDRO-2-(1-HYDROXY-1-METHYLETHYL)-, (-)-",
          "stdName": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 2,3-DIHYDRO-2-(1-HYDROXY-1-METHYLETHYL)-, (-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "06930c7e-09a4-4b54-908b-81e333c2f44b"
          ],
          "display_name": false
        },
        {
          "uuid": "ce970b00-c859-4caa-a6e4-69e621df13ad",
          "name": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 2,3-DIHYDRO-2-(1-HYDROXY-1-METHYLETHYL)-, (2R)-",
          "stdName": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 2,3-DIHYDRO-2-(1-HYDROXY-1-METHYLETHYL)-, (2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "06930c7e-09a4-4b54-908b-81e333c2f44b"
          ],
          "display_name": false
        },
        {
          "uuid": "f34a7126-73f9-4356-a48d-ade134e3782a",
          "name": "NANI",
          "stdName": "NANI",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "06930c7e-09a4-4b54-908b-81e333c2f44b"
          ],
          "display_name": false
        },
        {
          "uuid": "246bd68c-4dbf-482b-a2df-bfee9cda2d2e",
          "name": "NODAKATIN",
          "stdName": "NODAKATIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "06930c7e-09a4-4b54-908b-81e333c2f44b"
          ],
          "display_name": false
        },
        {
          "uuid": "6bdfb375-d599-4974-9fec-671286051b7b",
          "name": "NODAKENETIN",
          "stdName": "NODAKENETIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "62cc7841-661a-4a17-9a53-0de037a7ce45"
          ],
          "display_name": true
        },
        {
          "uuid": "c7d7e815-2e49-409a-9794-973fbabf5f01",
          "name": "NODAKENITIN",
          "stdName": "NODAKENITIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "06930c7e-09a4-4b54-908b-81e333c2f44b"
          ],
          "display_name": false
        },
        {
          "uuid": "ded56a64-103d-4f63-898a-170df356aad7",
          "name": "PRANGEFEROL",
          "stdName": "PRANGEFEROL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6a32562f-3ee9-448f-a61e-752a880a78fc",
            "06930c7e-09a4-4b54-908b-81e333c2f44b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "62cc7841-661a-4a17-9a53-0de037a7ce45",
          "citation": "Herbal Medicines 4th ED 2103",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6a32562f-3ee9-448f-a61e-752a880a78fc",
          "citation": "HERBAL MEDICINES",
          "doc_type": "HERBAL MEDICINES",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06930c7e-09a4-4b54-908b-81e333c2f44b",
          "citation": "SCIFINDER",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "51d22453-7c6c-4a10-bd20-33240534fcf5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391550000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8be637a1-f98e-aef8-3285-b0f5ef964666",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c8b01e62-177f-4c10-8b57-eb78c6598c1f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "64e63481-d5a5-bafb-79a7-73ecc5169683",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1703267b-257a-5060-13f9-e2ec5a4d2633",
          "id": "1703267b-257a-5060-13f9-e2ec5a4d2633",
          "molfile": "\n  Marvin  01132101232D          \n\n 18 20  0  0  1  0            999 V2000\n   13.6112   -4.0700    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   14.0962   -3.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8808   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5952   -3.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3098   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0242   -3.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7387   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7387   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4532   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0242   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3098   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5952   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8808   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0962   -4.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7863   -4.0701    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.3738   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0718   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7863   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 14  1  0  0  0  0\n  1 15  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3 13  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 15 18  1  0  0  0  0\nM  END",
          "smiles": "CC(C)([C@H]1Cc2cc3ccc(=O)oc3cc2O1)O",
          "formula": "C14H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "dfa3e9c2-215b-4f6d-88f6-7b43a78a0825"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "246.2591",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b14f6cba-6d77-4a7b-98e5-6cfc93083706",
      "version": "9",
      "structure": {
        "id": "49a2c629-3135-4e77-8696-6e9341cd68c5",
        "molfile": "7H-Furo[3,2-g][1]benzopyran-7-one, 2,3-dihydro-2-(1-hydroxy-1-methylethyl)-, ...\n  Marvin  01132103512D          \n\n 18 20  0  0  1  0            999 V2000\n   12.7863   -4.0701    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   12.3738   -4.7845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0718   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7863   -3.2450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.6112   -4.0700    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   14.0962   -3.4026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8808   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.8808   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0962   -4.7375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5952   -4.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3098   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.3098   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5952   -3.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0242   -3.2450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7387   -3.6576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.7387   -4.4826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.0242   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.4532   -4.8950    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  5  1  1  1  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  5  9  1  0  0  0  0\n  8 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n  7 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 11 17  1  0  0  0  0\n 16 18  2  0  0  0  0\nM  END",
        "smiles": "CC(C)([C@H]1Cc2cc3ccc(=O)oc3cc2O1)O",
        "formula": "C14H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "246.2591",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "8be637a1-f98e-aef8-3285-b0f5ef964666",
          "62cc7841-661a-4a17-9a53-0de037a7ce45"
        ],
        "stereo_centers": 1
      },
      "unii": "PKL4EW8LPQ"
    }
  ]
}