{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d361b2f5-8063-4c63-b33a-44f0edcf634b",
          "code": "3458-28-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3458-28-4",
          "code_system": "CAS",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015",
            "8df43f92-fa02-4be1-b1b3-3ad6628701cf"
          ]
        },
        {
          "uuid": "b76f387e-fc50-4d24-8294-09551bfba61b",
          "code": "C83903",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83903",
          "code_system": "NCI_THESAURUS",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "74d4a7de-636f-441b-9bcb-31fd15493500",
          "code": "D008358",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008358",
          "code_system": "MESH",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "437c07a4-a198-48b1-911a-e7c5f647aaa0",
          "code": "MANNOSE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mannose",
          "code_system": "WIKIPEDIA",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "39788275-c2d3-456b-b0e5-b89299f8f300",
          "code": "222-392-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.358",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "11f78f2a-d6a4-4efc-b60a-3a7ba6b50024",
          "code": "6633",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6633/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "4fab03d3-d2dd-4a52-939e-66714b05c903",
          "code": "m7082",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7082?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "43465543-f13a-44ae-aa2d-ae8dae34a1d2",
          "code": "SUB33129",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "27cbda27-80fe-45f1-8347-c7341b1fa05b",
          "code": "161658",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/161658",
          "code_system": "PUBCHEM",
          "references": [
            "8657a0f3-f6ee-4cd8-8a47-08a8622db015"
          ]
        },
        {
          "uuid": "762a8810-9d61-05f5-2fb1-85f296a92c7e",
          "code": "DTXSID5040463",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5040463",
          "code_system": "EPA CompTox",
          "references": [
            "901dc5d9-02d1-9017-1f6b-90336a368819"
          ]
        },
        {
          "uuid": "b668bf71-3727-4342-8fc4-c07d58c19459",
          "code": "530-26-7",
          "type": "ALTERNATIVE",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=530-26-7",
          "code_system": "CAS",
          "references": [
            "690d8c6b-b214-aa0b-f435-bcdcfc9ba375"
          ]
        },
        {
          "uuid": "96acd115-7345-24a2-cde3-9835feb5e59d",
          "code": "666918",
          "comments": "ORPHAN DRUG|Designated|Treatment of Mannose Phosphate Isomerase Deficiency",
          "type": "PRIMARY",
          "url": "https://www.accessdata.fda.gov/scripts/opdlisting/oopd/detailedIndex.cfm?cfgridkey=666918",
          "code_system": "FDA ORPHAN DRUG",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "f11e9ed5-69b4-7f0d-3bb0-da7ec8d1fdd5",
          "code": "C1505",
          "comments": "Dietary Supplement",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C1505",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "bcc933fb-eb33-beed-b98f-a46a672cd2c1",
          "code": "C68479",
          "comments": "Food or Food Product[C1949]|Food Component[C1930]|Bioactive Food Component[C54060]|Dietary Carbohydrate[C68470]|Monosaccharide[C68471]|Hexose",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C68479",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "30aa1abb-3f58-4a2b-59a8-3a2bdafb5bd5",
          "code": "74893-9",
          "comments": "LOINC|ACTIVE|CHEM|Urine|Mannose/Creatinine [Molar ratio] in Urine",
          "type": "PRIMARY",
          "url": "https://loinc.org/74893-9/",
          "code_system": "LOINC",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "ecba28af-4858-2de2-4e56-60efa2b25008",
          "code": "208-474-2",
          "type": "ALTERNATIVE",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.007.705",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "31d41801-b1ce-dfbe-a349-b549347d0694"
          ]
        },
        {
          "uuid": "590601b4-dddb-b73b-9050-de06b4268594",
          "code": "1365 (Number of products:1)",
          "comments": "Dietary Supplement Label Database|Carbohydrate|D-Mannose",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1365&item=D-Mannose",
          "code_system": "DSLD",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "61c32b90-c379-30c3-2b87-f3304a18ebf7",
          "code": "DB12907",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12907",
          "code_system": "DRUG BANK",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "6dc5c7e2-e256-493f-9413-bdf0c15f7000",
          "code": "PHA4727WTP",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "063f20c3-386c-f1dd-a929-345bde5d4fed",
          "code": "2627 (Number of products:112)",
          "comments": "Dietary Supplement Label Database|carbohydrate|Mannose",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2627&item=Mannose",
          "code_system": "DSLD",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "ddcd5757-f135-559f-2fe6-6ded14708c3e",
          "code": "1375182",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1375182",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "cfd65958-62b6-a3be-2c3d-fc5ff6cb0baf",
          "code": "37675",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:37675",
          "code_system": "CHEBI",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "7ea1a14f-3752-ed83-0729-41f267bf1a1f",
          "code": "37684",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:37684",
          "code_system": "CHEBI",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "4036d64c-9493-ae2e-f7d3-cf007c59a789",
          "code": "16024",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:16024",
          "code_system": "CHEBI",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "1a575f2b-fbfb-8e23-8cfa-1119d370f175",
          "code": "4208",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:4208",
          "code_system": "CHEBI",
          "references": [
            "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1"
          ]
        },
        {
          "uuid": "ff45050a-b92b-8427-0181-a998e8b9caca",
          "code": "PHA4727WTP",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=PHA4727WTP",
          "code_system": "DAILYMED",
          "references": [
            "7df4404a-410a-ece9-43e3-062fe16ae69d"
          ]
        },
        {
          "uuid": "cbfe8c0a-6cc9-43e9-af88-ca93045c0681",
          "code": "100000181429",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "9680ccad-57b3-8cf2-23e4-2195257b7b95"
          ]
        },
        {
          "uuid": "22d0dbe4-8d5e-91a2-9112-0ba20c2a01f8",
          "code": "26247",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=26247",
          "code_system": "NSC",
          "references": [
            "96963d7c-9b75-c847-de08-a7373d7ace52"
          ]
        },
        {
          "uuid": "f5869532-c486-387c-9ad9-db699ae71b39",
          "code": "JK-272",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/JK-272/relevant/1/",
          "code_system": "USAN",
          "references": [
            "20746847-5d68-894a-b1ed-1ad58fe6b447"
          ]
        },
        {
          "uuid": "64c1654a-7956-09b6-3619-709e616e06e3",
          "code": "12612",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=12612",
          "code_system": "INN",
          "references": [
            "20746847-5d68-894a-b1ed-1ad58fe6b447"
          ]
        }
      ],
      "substance_class": "chemical",
      "references": [
        {
          "uuid": "04b787a0-5312-4fa3-bc34-8f03dac062af",
          "citation": "Merck Index 14.3",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "522780e1-194a-4c54-a9b1-aad8519238ea",
          "citation": "STN 2007",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cdb98d40-507e-4533-b7a2-e0234895358d",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e227874a-8f76-444a-b4c9-06556a821e2a",
          "citation": "rx-norm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "434209e0-281e-4fe1-8296-3e150e24595e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6f191852-997a-4bd7-bdbe-03917f1f3191",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fbf5646c-126d-4878-b427-2f107d92d5d1",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88b63cee-4fc7-42bf-9e64-c6e5b9f58ce9",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04f386dc-9dfe-41da-89ff-49e1ca13e42e",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86bedb9a-d437-46e3-842d-bf35d8fd8418",
          "citation": "CHEMDRAW",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7d8e666-e21a-48dd-8fb9-9f0df829ccf6",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8657a0f3-f6ee-4cd8-8a47-08a8622db015",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389665000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4dd21ce-07df-4bbb-b408-e851514957bf",
          "citation": "SRS import [PHA4727WTP]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PHA4727WTP",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389665000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ceb8d11-5528-4ee1-af1a-bf02c74e9ef7",
          "citation": "D-MANNOSE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3ed6aec-d319-4d42-b867-9d71a64e4bde",
          "citation": "MANNOSE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "0538146d-51b0-463e-b266-33522e1925bf",
          "citation": "MANNOSE, D- [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1e5b6775-4e31-4ca8-98e7-5754a9fe1184",
          "citation": "MANNOSE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79a0df85-e612-465b-8a42-c220e09435e9",
          "citation": "D-MANNOSE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9edae085-937a-4806-aa9a-3e3971fb9221",
          "citation": "MANNOSE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8df43f92-fa02-4be1-b1b3-3ad6628701cf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "901dc5d9-02d1-9017-1f6b-90336a368819",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3458-28-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "690d8c6b-b214-aa0b-f435-bcdcfc9ba375",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a4cb0d9e-0b53-e243-51c6-8aad47fa95d1",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "31d41801-b1ce-dfbe-a349-b549347d0694",
          "citation": "EC",
          "doc_type": "ECHA (EC/EINECS)",
          "public_domain": true
        },
        {
          "uuid": "c466b503-1fde-2aaf-cfa9-175577021bf7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "20746847-5d68-894a-b1ed-1ad58fe6b447",
          "citation": "USAN Coun 2023",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "96963d7c-9b75-c847-de08-a7373d7ace52",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7df4404a-410a-ece9-43e3-062fe16ae69d",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d7846a2c-a9bd-5f30-17c4-0489cdd811e6",
          "citation": "USAN COUN 2023",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "9680ccad-57b3-8cf2-23e4-2195257b7b95",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "d1916e3d-0dff-4121-b533-17be5d33b4ed",
          "citation": "INN P129",
          "url": "https://cdn.who.int/media/docs/default-source/international-nonproprietary-names-(inn)/pl129.pdf?sfvrsn=678fceea_3&download=true",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "05b90301-eeef-99e9-4cf7-08ef304c6cac",
          "citation": "INN P129",
          "doc_type": "INN_LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ac0f8512-f388-4917-8efa-e4ce107e98b5",
          "id": "ac0f8512-f388-4917-8efa-e4ce107e98b5",
          "molfile": "\n  Marvin  01132108552D          \n\n 12 11  0  0  1  0            999 V2000\n    3.5026   -1.7899    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.5026   -2.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7881   -1.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0737   -1.7899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2171   -1.3774    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    4.2171   -0.5524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9316   -1.7899    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.9316   -2.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6461   -1.3774    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.6461   -0.5524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3605   -1.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3605   -2.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  5  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  6  1  1  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  1  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  6  0  0  0\n  9 11  1  0  0  0  0\n 11 12  2  0  0  0  0\nM  END",
          "smiles": "C(=O)[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O",
          "formula": "C6H12O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "5f662ed4-7b35-43e7-98be-39cb395effb1"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "180.1561",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "b94398fa-c0c0-45f6-aef5-6ed3f833ecdc",
      "version": "46",
      "structure": {
        "id": "9baa13b1-f27a-4d3e-bc4f-fb511ef43907",
        "molfile": "\n  Marvin  01132108052D          \n\n 12 11  0  0  1  0            999 V2000\n    2.0737   -1.7899    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7881   -1.3774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5026   -1.7899    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.2171   -1.3774    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.9316   -1.7899    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.6461   -1.3774    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.3605   -1.7899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3605   -2.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6461   -0.5524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9316   -2.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2171   -0.5524    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5026   -2.6149    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  6  9  1  6  0  0  0\n  5 10  1  1  0  0  0\n  4 11  1  1  0  0  0\n  3 12  1  6  0  0  0\nM  END",
        "smiles": "C(=O)[C@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O",
        "formula": "C6H12O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "180.1561",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "04b787a0-5312-4fa3-bc34-8f03dac062af",
          "d1916e3d-0dff-4121-b533-17be5d33b4ed"
        ],
        "stereo_centers": 4
      },
      "unii": "PHA4727WTP",
      "relationships": [
        {
          "uuid": "fe64798d-b1f4-4ef5-9d0a-d344b3cb3c52",
          "amount": {
            "uuid": "f8e6ca7a-9a8f-4b2f-b156-2ad7fcf39a13"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "46eb13e3-5459-46a3-996f-8dc730494f4a",
            "refuuid": "cab85019-c79c-4ee8-a55c-6c9d4058edbb",
            "name": "ALTERNATIVE DEFINITION for [Demannose]",
            "linking_id": "cab85019-c79c-4ee8-a55c-6c9d4058edbb",
            "ref_pname": "NO NAME"
          }
        },
        {
          "uuid": "c70c5340-64ae-4a12-bb2b-570bf6350ad7",
          "amount": {
            "uuid": "df6adfaf-b763-4b6a-90e4-785a81e9202f"
          },
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "0979cbfc-9863-4b1a-9ee4-8b343122f8d3",
            "refuuid": "42302cdd-bfa8-4d7b-aa48-1bfae49b216e",
            "name": "ALTERNATIVE DEFINITION for [Demannose]",
            "linking_id": "42302cdd-bfa8-4d7b-aa48-1bfae49b216e",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "names": [
        {
          "uuid": "a7f9d961-f1eb-42c9-95bd-7c64bc0e9c35",
          "name": "(2S,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanal",
          "stdName": "(2S,3S,4R,5R)-2,3,4,5,6-PENTAHYDROXYHEXANAL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86bedb9a-d437-46e3-842d-bf35d8fd8418",
            "cdb98d40-507e-4533-b7a2-e0234895358d",
            "d7846a2c-a9bd-5f30-17c4-0489cdd811e6"
          ],
          "display_name": false
        },
        {
          "uuid": "6679e65f-4f1c-4227-a4b8-e53ffa2842d7",
          "name": "CARUBINOSE",
          "stdName": "CARUBINOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04b787a0-5312-4fa3-bc34-8f03dac062af",
            "cdb98d40-507e-4533-b7a2-e0234895358d"
          ],
          "display_name": false
        },
        {
          "uuid": "fa67f942-9d73-407e-9907-f90808feaaef",
          "name": "CERC-802",
          "stdName": "CERC-802",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7846a2c-a9bd-5f30-17c4-0489cdd811e6"
          ],
          "display_name": false
        },
        {
          "uuid": "afb5c8d3-f0ca-45da-8d47-4310ad1244b6",
          "name": "D-MANNOSE",
          "stdName": "D-MANNOSE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "434209e0-281e-4fe1-8296-3e150e24595e",
            "79a0df85-e612-465b-8a42-c220e09435e9",
            "04b787a0-5312-4fa3-bc34-8f03dac062af",
            "88b63cee-4fc7-42bf-9e64-c6e5b9f58ce9",
            "cdb98d40-507e-4533-b7a2-e0234895358d",
            "2ceb8d11-5528-4ee1-af1a-bf02c74e9ef7",
            "522780e1-194a-4c54-a9b1-aad8519238ea"
          ],
          "display_name": false
        },
        {
          "uuid": "6e0d6b87-86c8-4766-bed1-19a61d39986c",
          "name": "D-MANNOSE [MI]",
          "stdName": "D-MANNOSE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "434209e0-281e-4fe1-8296-3e150e24595e",
            "cdb98d40-507e-4533-b7a2-e0234895358d"
          ],
          "display_name": false
        },
        {
          "uuid": "5bb2d77b-c5a8-bc16-676e-2dc5d92fdd0b",
          "name": "D-mannose [WHO-DD]",
          "stdName": "D-MANNOSE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c466b503-1fde-2aaf-cfa9-175577021bf7",
            "20746847-5d68-894a-b1ed-1ad58fe6b447"
          ],
          "display_name": false
        },
        {
          "uuid": "42256b1b-f1b2-597b-0715-1bb9d266bdca",
          "name": "DEMANNOSE [USAN]",
          "stdName": "DEMANNOSE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7846a2c-a9bd-5f30-17c4-0489cdd811e6"
          ],
          "display_name": false
        },
        {
          "uuid": "949c6537-78d8-4b1b-947f-5788a3562373",
          "name": "Demannose",
          "stdName": "DEMANNOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7846a2c-a9bd-5f30-17c4-0489cdd811e6",
            "d1916e3d-0dff-4121-b533-17be5d33b4ed"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "c5bde894-e4f6-4ce6-8aca-f2b3216da75e",
              "name_org": "USAN"
            },
            {
              "uuid": "fcc13543-d145-41b7-9598-49bde0ecb485",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "75b753d9-b145-4495-83ce-c950f4276011",
          "name": "MANNOSE",
          "stdName": "MANNOSE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "e227874a-8f76-444a-b4c9-06556a821e2a",
            "a3ed6aec-d319-4d42-b867-9d71a64e4bde",
            "cdb98d40-507e-4533-b7a2-e0234895358d",
            "fbf5646c-126d-4878-b427-2f107d92d5d1",
            "6f191852-997a-4bd7-bdbe-03917f1f3191",
            "04f386dc-9dfe-41da-89ff-49e1ca13e42e",
            "1e5b6775-4e31-4ca8-98e7-5754a9fe1184",
            "9edae085-937a-4806-aa9a-3e3971fb9221"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "decd79e6-aaa0-42bf-ad2c-bcb9edb2294d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "dac0a885-6d5a-4ee8-82ee-8485fd17e1e6",
          "name": "MANNOSE [USP-RS]",
          "stdName": "MANNOSE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdb98d40-507e-4533-b7a2-e0234895358d",
            "fbf5646c-126d-4878-b427-2f107d92d5d1"
          ],
          "display_name": false
        },
        {
          "uuid": "907cbc89-1fa4-4386-8021-d54120a58cca",
          "name": "MANNOSE [VANDF]",
          "stdName": "MANNOSE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cdb98d40-507e-4533-b7a2-e0234895358d",
            "04f386dc-9dfe-41da-89ff-49e1ca13e42e"
          ],
          "display_name": false
        },
        {
          "uuid": "d648e6a9-c5cd-404b-a9a5-e198a82d58a9",
          "name": "MANNOSE, D-",
          "stdName": "MANNOSE, D-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "04b787a0-5312-4fa3-bc34-8f03dac062af",
            "0538146d-51b0-463e-b266-33522e1925bf",
            "522780e1-194a-4c54-a9b1-aad8519238ea"
          ],
          "display_name": false
        },
        {
          "uuid": "ee045afe-ca4e-4ba9-abef-ed0ff010a1b6",
          "name": "MANNOSE, D- [II]",
          "stdName": "MANNOSE, D- [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04b787a0-5312-4fa3-bc34-8f03dac062af",
            "522780e1-194a-4c54-a9b1-aad8519238ea"
          ],
          "display_name": false
        },
        {
          "uuid": "167b59dc-004e-487a-b2b8-c9a35a5bd4f0",
          "name": "NSC-26247",
          "stdName": "NSC-26247",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7d8e666-e21a-48dd-8fb9-9f0df829ccf6",
            "cdb98d40-507e-4533-b7a2-e0234895358d"
          ],
          "display_name": false
        },
        {
          "uuid": "5d7e2004-cb78-4d54-951f-bd74ff3dbb8d",
          "name": "SEMINOSE",
          "stdName": "SEMINOSE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04b787a0-5312-4fa3-bc34-8f03dac062af",
            "cdb98d40-507e-4533-b7a2-e0234895358d"
          ],
          "display_name": false
        },
        {
          "uuid": "3eb2ecb8-1331-a02e-a081-1a626fab26f9",
          "name": "demannose [INN]",
          "stdName": "DEMANNOSE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "05b90301-eeef-99e9-4cf7-08ef304c6cac"
          ],
          "display_name": false
        }
      ],
      "modifications": {
        "uuid": "dc890dd5-7ef0-4df9-96ca-71c0b24b88b6"
      }
    }
  ]
}