{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5e95cb75-8474-48ab-93f1-0235083c1587",
          "code": "92934-64-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=92934-64-0",
          "code_system": "CAS",
          "references": [
            "707e8463-b1dd-403b-b91e-fc93b50a3fab",
            "3d8570bf-6c20-4f43-bfb9-7c1e79cc7cd2"
          ]
        },
        {
          "uuid": "9173a33a-80af-4f9e-acf2-3bba31fdde60",
          "code": "688596",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/688596",
          "code_system": "PUBCHEM",
          "references": [
            "707e8463-b1dd-403b-b91e-fc93b50a3fab"
          ]
        },
        {
          "uuid": "20bc956c-0a74-27e0-c89f-c0fadc2b9ad4",
          "code": "DTXSID60276365",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60276365",
          "code_system": "EPA CompTox",
          "references": [
            "ae82da58-ba5a-8fda-5d64-7e102837de5d"
          ]
        },
        {
          "uuid": "bb6dca51-ff17-42af-aa63-c3710001d49a",
          "code": "PGI7V914AD",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "4dcfafe4-4c74-4d3e-a06d-689250a3b7c5",
          "type": "RACEMATE->ENANTIOMER",
          "related_substance": {
            "uuid": "fd4cde0e-6542-487f-b066-62d24b98e53c",
            "refuuid": "e2c7af9f-2b6e-4b5d-b3dc-1a238ba48fc5",
            "name": "TROPICAMIDE",
            "unii": "N0A3Z5XTC6",
            "linking_id": "N0A3Z5XTC6",
            "ref_pname": "TROPICAMIDE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "fcd21006-22be-42ad-ac43-8a344ab41bdb",
          "name": "(-)-TROPICAMIDE",
          "stdName": "(-)-TROPICAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "941ec922-b2a6-4d56-9d2e-a8d976770281",
            "2473f384-fcb9-4707-aad6-10986c50d7d9"
          ],
          "display_name": false
        },
        {
          "uuid": "264f7ffd-959f-4d99-bae6-dff17a94d180",
          "name": "BENZENEACETAMIDE, N-ETHYL-.ALPHA.-(HYDROXYMETHYL)-N-(4-PYRIDINYLMETHYL)-, (.ALPHA.S)-",
          "stdName": "BENZENEACETAMIDE, N-ETHYL-.ALPHA.-(HYDROXYMETHYL)-N-(4-PYRIDINYLMETHYL)-, (.ALPHA.S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "941ec922-b2a6-4d56-9d2e-a8d976770281",
            "2473f384-fcb9-4707-aad6-10986c50d7d9"
          ],
          "display_name": false
        },
        {
          "uuid": "46c785ad-41e1-4733-92aa-8103c24d8353",
          "name": "BENZENEACETAMIDE, N-ETHYL-.ALPHA.-(HYDROXYMETHYL)-N-(4-PYRIDINYLMETHYL)-, (S)-",
          "stdName": "BENZENEACETAMIDE, N-ETHYL-.ALPHA.-(HYDROXYMETHYL)-N-(4-PYRIDINYLMETHYL)-, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "941ec922-b2a6-4d56-9d2e-a8d976770281",
            "2473f384-fcb9-4707-aad6-10986c50d7d9"
          ],
          "display_name": false
        },
        {
          "uuid": "1d6fc127-dade-4e07-9ca5-d7cb5a0621cc",
          "name": "TROPICAMIDE, (-)-",
          "stdName": "TROPICAMIDE, (-)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8d15115d-5cdb-4b58-a783-8e2a2f9f0ebc",
            "941ec922-b2a6-4d56-9d2e-a8d976770281"
          ],
          "display_name": false
        },
        {
          "uuid": "b24cc703-1b56-4825-bee3-2a9b9de93913",
          "name": "TROPICAMIDE, (S)-",
          "stdName": "TROPICAMIDE, (S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "941ec922-b2a6-4d56-9d2e-a8d976770281",
            "2473f384-fcb9-4707-aad6-10986c50d7d9"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "8d15115d-5cdb-4b58-a783-8e2a2f9f0ebc",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "941ec922-b2a6-4d56-9d2e-a8d976770281",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2473f384-fcb9-4707-aad6-10986c50d7d9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "707e8463-b1dd-403b-b91e-fc93b50a3fab",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393371000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f99e9ded-40bf-4a8a-96bf-4bc908dca581",
          "citation": "SRS import [PGI7V914AD]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PGI7V914AD",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393371000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae82da58-ba5a-8fda-5d64-7e102837de5d",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=92934-64-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3d8570bf-6c20-4f43-bfb9-7c1e79cc7cd2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b73be77c-fbb1-4a0d-81e7-0378d6acf061",
          "id": "b73be77c-fbb1-4a0d-81e7-0378d6acf061",
          "molfile": "\n  Marvin  01132109292D          \n\n 21 22  0  0  1  0            999 V2000\n    7.1730   -3.8496    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.1730   -3.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8932   -2.6217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4668   -4.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4668   -5.0866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7513   -3.8403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7513   -3.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0312   -2.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0312   -4.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3250   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6003   -4.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8894   -3.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8894   -3.0325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6003   -2.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3250   -3.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8932   -4.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8932   -5.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6086   -5.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3287   -5.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3287   -4.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6086   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  6  0  0  0\n  1 16  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  9  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 15 10  2  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 21 16  2  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\nM  END",
          "smiles": "CCN(Cc1ccncc1)C(=O)[C@H](CO)c2ccccc2",
          "formula": "C17H20N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "46a32b69-8972-4dc1-bc9b-d6858f6d4d31"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "284.3535",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "64ff6d38-46d4-4abe-b72a-7c1ba7615a77",
      "version": "3",
      "structure": {
        "id": "60d47e59-cbf2-4fff-a89b-ba3520b2bf6f",
        "molfile": "\n  Marvin  01132105012D          \n\n 21 22  0  0  1  0            999 V2000\n    6.4668   -4.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1730   -3.8496    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8932   -4.2650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8932   -5.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6086   -5.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3287   -5.0866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3287   -4.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6086   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1730   -3.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8932   -2.6217    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7513   -3.8403    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0312   -4.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3250   -3.8542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6003   -4.2557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8894   -3.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8894   -3.0325    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6003   -2.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3250   -3.0095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7513   -3.0371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0312   -2.6217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4668   -5.0866    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  3  1  0  0  0  0\n  2  9  1  6  0  0  0\n 10  9  1  0  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 13  1  0  0  0  0\n 19 11  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21  1  2  0  0  0  0\nM  END",
        "smiles": "CCN(Cc1ccncc1)C(=O)[C@H](CO)c2ccccc2",
        "formula": "C17H20N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "284.3535",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "f99e9ded-40bf-4a8a-96bf-4bc908dca581",
          "2473f384-fcb9-4707-aad6-10986c50d7d9"
        ],
        "stereo_centers": 1
      },
      "unii": "PGI7V914AD"
    }
  ]
}