{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "591823b0-493d-4384-a3c3-b7829b76808c", "code": "10213-95-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=10213-95-3", "code_system": "CAS", "references": [ "73a976be-bd41-4ea1-ae23-54e80b76f3c8", "fb02e269-fe0a-4529-b04a-6f6699eb268e" ] }, { "uuid": "62d051f1-3e31-d00f-76b1-9abf692d5ef8", "code": "DTXSID7045073", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7045073", "code_system": "EPA CompTox", "references": [ "f916c73e-5ed1-a50c-5464-0108917a1ee7" ] }, { "uuid": "6378427e-d3d6-a283-5f80-b3246d814787", "code": "135565878", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/135565878", "code_system": "PUBCHEM", "references": [ "91cf44d2-6cb1-fe82-9690-461cdab5c9c7" ] }, { "uuid": "631f8475-efb5-4e3d-a8a4-991d54f9e6ea", "code": "PE11M2TL5C", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "d002a196-c01b-4430-87eb-8438580442c9", "name": "9-(2-CARBOXYLATOPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)XANTHYLIUM", "stdName": "9-(2-CARBOXYLATOPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)XANTHYLIUM", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "efa254df-8da7-4102-b02b-68a8118f9e82" ], "display_name": false }, { "uuid": "7d0f5251-f4e0-4a7b-b055-f64099c5aef2", "name": "ACID VIOLET 9 PARENT", "stdName": "ACID VIOLET 9 PARENT", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "6d36f392-2d02-4b02-9054-a4d7fbf466c7" ], "display_name": true }, { "uuid": "fc66923f-9d8c-4d31-8c62-4888e1660c60", "name": "BENZOIC ACID, 2-(6-((2-METHYLPHENYL)AMINO)-3-((2-METHYL-4-SULFOPHENYL)IMINO)-3H-XANTHEN-9-YL)-", "stdName": "BENZOIC ACID, 2-(6-((2-METHYLPHENYL)AMINO)-3-((2-METHYL-4-SULFOPHENYL)IMINO)-3H-XANTHEN-9-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea029fe7-5d5b-4f85-97f2-628f2f2476fc" ], "display_name": false }, { "uuid": "b43c1efb-edbf-45d8-93cb-e7daae85ab44", "name": "BENZOIC ACID, O-(3-((4-SULFO-O-TOLYL)IMINO)-6-O-TOLUIDINO-3H-XANTHEN-9-YL)-", "stdName": "BENZOIC ACID, O-(3-((4-SULFO-O-TOLYL)IMINO)-6-O-TOLUIDINO-3H-XANTHEN-9-YL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea029fe7-5d5b-4f85-97f2-628f2f2476fc" ], "display_name": false }, { "uuid": "55c4b1a6-1aed-44fe-9e6d-d997ba580f07", "name": "FAST ACID VIOLET GRF BASE", "stdName": "FAST ACID VIOLET GRF BASE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ea029fe7-5d5b-4f85-97f2-628f2f2476fc" ], "display_name": false }, { "uuid": "fc592fb5-1f29-45bc-bf81-1c052a35c8fc", "name": "J3.044.222I", "stdName": "J3.044.222I", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "efa254df-8da7-4102-b02b-68a8118f9e82" ], "display_name": false }, { "uuid": "de09c160-cce7-4b6e-b1f2-6341afe03b27", "name": "SPIRIT FAST RED 3B", "stdName": "SPIRIT FAST RED 3B", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "ea029fe7-5d5b-4f85-97f2-628f2f2476fc" ], "display_name": false }, { "uuid": "ac4fcbe3-fa19-49ca-bc80-3e47ac7a5d6c", "name": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)-, INNER SALT", "stdName": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3-((2-METHYLPHENYL)AMINO)-6-((2-METHYL-4-SULFOPHENYL)AMINO)-, INNER SALT", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "ea029fe7-5d5b-4f85-97f2-628f2f2476fc" ], "display_name": false } ], "references": [ { "uuid": "6d36f392-2d02-4b02-9054-a4d7fbf466c7", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "ea029fe7-5d5b-4f85-97f2-628f2f2476fc", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "efa254df-8da7-4102-b02b-68a8118f9e82", "citation": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=201207070445205226&q=J3.044.222I&t=7", "url": "http://jglobal.jst.go.jp/en/detail?JGLOBAL_ID=201207070445205226&q=J3.044.222I&t=7", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "73a976be-bd41-4ea1-ae23-54e80b76f3c8", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392320000, "tags": [ "NOMEN" ] }, { "uuid": "702c1a3c-15dd-4212-8017-3dadf4a2279b", "citation": "SRS import [PE11M2TL5C]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PE11M2TL5C", "doc_type": "SRS", "public_domain": true, "document_date": 1493392320000, "tags": [ "NOMEN" ] }, { "uuid": "f916c73e-5ed1-a50c-5464-0108917a1ee7", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10213-95-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "91cf44d2-6cb1-fe82-9690-461cdab5c9c7", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "fb02e269-fe0a-4529-b04a-6f6699eb268e", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6d00d778-1f99-4469-8276-0b54b866b813", "id": "6d00d778-1f99-4469-8276-0b54b866b813", "molfile": "\n Marvin 01132105402D \n\n 43 48 0 0 0 0 999 V2000\n 2.1502 -2.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4182 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7091 -2.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7091 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4182 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1273 -4.4263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8365 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8365 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5570 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2775 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9981 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9981 -1.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -1.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9981 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2775 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2775 -1.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5570 -1.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8365 -1.2352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5570 -2.4933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4163 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1483 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1483 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4163 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9981 -4.4263 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2775 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5570 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8574 -4.4263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5779 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2871 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0076 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0076 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2871 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5779 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8574 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7167 -2.7793 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3164 -2.0587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4373 -2.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1399 -3.4883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 2 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 31 9 2 0 0 0 0\n 11 10 2 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 30 12 2 0 0 0 0\n 13 14 1 0 0 0 0\n 13 23 2 0 0 0 0\n 14 15 1 0 0 0 0\n 14 19 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 18 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 20 22 2 0 0 0 0\n 23 24 1 0 0 0 0\n 28 23 1 0 0 0 0\n 24 25 2 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 32 26 2 3 0 0 0\n 28 27 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 33 38 2 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 36 37 2 0 0 0 0\n 40 36 1 0 0 0 0\n 37 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 2 0 0 0 0\n 40 43 2 0 0 0 0\nM END", "smiles": "Cc1ccccc1Nc2ccc3c(c2)oc-4cc(=Nc5ccc(cc5C)S(=O)(=O)O)ccc4c3-c6ccccc6C(=O)O", "formula": "C34H26N2O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "bf66d3b2-6413-45e2-9051-5bd65edd278e" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "590.6474", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "6d0a4b40-129d-45a4-9477-cf4070220c2b", "version": "6", "structure": { "id": "b01d05d6-37df-4bf2-9521-5f3bf892539b", "molfile": "\n Marvin 01132109082D \n\n 43 48 0 0 0 0 999 V2000\n 4.9981 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7167 -2.7793 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9981 -1.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9981 -4.4263 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0\n 4.2775 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8574 -4.4263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2775 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4163 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4163 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2775 -1.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1483 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0076 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5570 -1.6470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5779 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5570 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1483 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1273 -4.4263 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.3164 -2.0587 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2871 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5779 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4373 -2.3560 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1399 -3.4883 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5570 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4182 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8365 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8365 -1.2352 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 3.5570 -2.4933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0076 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.2871 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4182 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8365 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -1.2352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2775 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8574 -2.7793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7091 -4.4263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1502 -2.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7091 -2.7678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7072 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9981 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -4.0145 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -3.1796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 4 1 0 0 0 0\n 1 5 1 0 0 0 0\n 1 9 2 0 0 0 0\n 2 14 1 0 0 0 0\n 2 20 1 0 0 0 0\n 2 23 2 0 0 0 0\n 2 24 2 0 0 0 0\n 3 4 2 0 0 0 0\n 3 10 1 0 0 0 0\n 3 6 1 0 0 0 0\n 4 11 1 0 0 0 0\n 5 12 1 0 0 0 0\n 5 34 2 0 0 0 0\n 6 7 2 0 0 0 0\n 7 9 1 0 0 0 0\n 7 17 1 0 0 0 0\n 8 13 1 0 0 0 0\n 8 16 1 0 0 0 0\n 9 25 1 0 0 0 0\n 10 13 2 0 0 0 0\n 11 18 2 0 0 0 0\n 12 15 1 0 0 0 0\n 12 35 2 0 0 0 0\n 13 18 1 0 0 0 0\n 14 30 1 0 0 0 0\n 14 21 2 0 0 0 0\n 15 28 1 0 0 0 0\n 15 29 2 0 0 0 0\n 16 22 2 0 0 0 0\n 16 31 1 0 0 0 0\n 17 27 2 0 0 0 0\n 19 27 1 0 0 0 0\n 19 26 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 36 1 0 0 0 0\n 25 33 2 0 0 0 0\n 26 32 1 0 0 0 0\n 26 37 2 0 0 0 0\n 27 33 1 0 0 0 0\n 30 31 2 0 0 0 0\n 32 38 1 0 0 0 0\n 32 39 2 0 0 0 0\n 34 40 1 0 0 0 0\n 35 41 1 0 0 0 0\n 37 42 1 0 0 0 0\n 39 43 1 0 0 0 0\n 40 41 2 0 0 0 0\n 42 43 2 0 0 0 0\nM CHG 2 6 1 28 -1\nM END", "smiles": "Cc1ccccc1Nc2ccc3c(c2)[o+]c4cc(ccc4c3-c5ccccc5C(=O)[O-])Nc6ccc(cc6C)S(=O)(=O)O", "formula": "C34H26N2O6S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "590.6474", "optical_activity": "NONE", "references": [ "702c1a3c-15dd-4212-8017-3dadf4a2279b", "6d36f392-2d02-4b02-9054-a4d7fbf466c7" ], "stereo_centers": 0 }, "unii": "PE11M2TL5C" } ] }