{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "376d3143-22f1-4210-8ef9-d1ba968a2f68",
          "code": "300-76-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=300-76-5",
          "code_system": "CAS",
          "references": [
            "ff21e1b7-ea8c-47b9-a999-26cefd64d5f0",
            "338a6381-027c-4c66-8d2c-35d5a40951c9"
          ]
        },
        {
          "uuid": "83884ee8-31b3-4751-8223-8a57b59f2345",
          "code": "D009267",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68009267",
          "code_system": "MESH",
          "references": [
            "ff21e1b7-ea8c-47b9-a999-26cefd64d5f0"
          ]
        },
        {
          "uuid": "ecc67279-2eac-41ac-8364-0fe112e22b3f",
          "code": "34401",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3013",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ff21e1b7-ea8c-47b9-a999-26cefd64d5f0"
          ]
        },
        {
          "uuid": "001f3dd1-06fe-4732-b5c4-6648781ffb9c",
          "code": "m7712",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7712?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "ff21e1b7-ea8c-47b9-a999-26cefd64d5f0"
          ]
        },
        {
          "uuid": "300ccd21-ed56-4dea-8ffb-0ab99de4f141",
          "code": "206-098-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.545",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ff21e1b7-ea8c-47b9-a999-26cefd64d5f0"
          ]
        },
        {
          "uuid": "b963da1a-f9b4-47ce-a0c2-9ebb2923b53f",
          "code": "4420",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4420",
          "code_system": "PUBCHEM",
          "references": [
            "ff21e1b7-ea8c-47b9-a999-26cefd64d5f0"
          ]
        },
        {
          "uuid": "31d2684c-d5fa-791e-8784-4c2e76d6b53c",
          "code": "1148",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1148",
          "code_system": "HSDB",
          "references": [
            "46951c34-05d1-6947-c579-d2ea5a156837"
          ]
        },
        {
          "uuid": "ebeb199d-7187-b02e-4a28-646e0cff10e4",
          "code": "DTXSID1024209",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1024209",
          "code_system": "EPA CompTox",
          "references": [
            "dd13bb52-aa48-1a74-5ee7-704f70e9128b"
          ]
        },
        {
          "uuid": "1a09cf25-7b9c-4cce-bed8-77db00cef38b",
          "code": "PAM1AI9KU1",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e4af61c1-ea3b-bb28-af13-6f4a3b10551f",
          "code": "38729",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:38729",
          "code_system": "CHEBI",
          "references": [
            "ee5cecc5-a742-268e-4c96-13be82a3d643"
          ]
        },
        {
          "uuid": "196a7e1a-1d41-56f8-ed29-d87ba227c291",
          "code": "Naled",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Naled",
          "code_system": "WIKIPEDIA",
          "references": [
            "b857ab69-d225-1275-be17-7eaae4689a24"
          ]
        },
        {
          "uuid": "89687d3b-78c3-3792-992c-6a982db46367",
          "code": "naled",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/naled.html",
          "code_system": "ALANWOOD",
          "references": [
            "e17edf86-c647-a0b7-5d82-ff2c9ee533b9"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "0ab24de7-6f60-4201-82c7-0c6ebc21041d",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "6e44f491-f233-4f61-9a03-c363996eb8bc",
            "refuuid": "bb6a85b7-8a77-4720-919a-c34839fc995f",
            "name": "NALED",
            "unii": "PAM1AI9KU1",
            "linking_id": "PAM1AI9KU1",
            "ref_pname": "NALED",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "610f5d0c-d062-49e2-8c45-f72b6e8b9bd0",
          "name": "(RS)-1,2-DIBROMO-2,2-DICHLOROETHYL DIMETHYL PHOSPHATE",
          "stdName": "(RS)-1,2-DIBROMO-2,2-DICHLOROETHYL DIMETHYL PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6861e091-499b-490c-bf3c-fedc2743a3f4",
            "cb23b780-1dd2-4698-ad0a-e115f79dbc4a"
          ],
          "display_name": false
        },
        {
          "uuid": "161c03cf-ef73-478b-95f4-d8b1c22adeea",
          "name": "(±)-NALED",
          "stdName": "(+/-)-NALED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c737a13-a802-4d66-9821-d2c966ad969a",
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd"
          ],
          "display_name": false
        },
        {
          "uuid": "059c9d99-e889-44ec-b8b0-95958b01dcbc",
          "name": "1,2-DIBROMO-2,2-DICHLOROETHYL DIMETHYL PHOSPHATE",
          "stdName": "1,2-DIBROMO-2,2-DICHLOROETHYL DIMETHYL PHOSPHATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cb23b780-1dd2-4698-ad0a-e115f79dbc4a",
            "d4635da1-008e-4fbf-a7c5-9c6ce6bde6e1"
          ],
          "display_name": false
        },
        {
          "uuid": "c5c1e1f4-ddf2-4550-a6d2-61e6ae782252",
          "name": "BROMCHLOPHOS",
          "stdName": "BROMCHLOPHOS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd",
            "8a7a84ec-1167-4c5f-8592-e85a939b0bf7"
          ],
          "display_name": false
        },
        {
          "uuid": "a6c5b6fe-eb2e-4c4c-a3e7-c57599880834",
          "name": "BRP",
          "stdName": "BRP",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd",
            "8a7a84ec-1167-4c5f-8592-e85a939b0bf7"
          ],
          "display_name": false
        },
        {
          "uuid": "56bbcdc3-1945-4cbf-9ed0-0da887c945b8",
          "name": "DIBROM",
          "stdName": "DIBROM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd",
            "8a7a84ec-1167-4c5f-8592-e85a939b0bf7"
          ],
          "display_name": false
        },
        {
          "uuid": "8303aa85-a8d3-4a3c-bc44-b4232f710ae4",
          "name": "NALED",
          "stdName": "NALED",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6723681-7795-45ff-8249-2ea62784f0cb",
            "431c19f6-c6e1-4798-8ed8-d5c1ccb78c11",
            "bb6c09fd-3556-4ec2-b39a-384ac48b46ba",
            "e8c28c89-b255-4d82-ba7c-fa866fffd2f3",
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd",
            "177f3ee3-0e7a-429d-9ccb-bd037cdcc4e8",
            "755c55b6-c6a6-4708-ba20-b128cf12caa1",
            "660511c8-f935-48ce-9265-abfdfe077c5f",
            "2e4f3bbc-a973-4a76-9eb8-8b6013e68d6b",
            "8a7a84ec-1167-4c5f-8592-e85a939b0bf7"
          ],
          "display_name": true
        },
        {
          "uuid": "6d77bc99-aba7-49ce-aa54-0e956b65bd8d",
          "name": "NALED [HSDB]",
          "stdName": "NALED [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2e4f3bbc-a973-4a76-9eb8-8b6013e68d6b",
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd"
          ],
          "display_name": false
        },
        {
          "uuid": "62ab1322-3959-4426-8e88-bf119e31eac8",
          "name": "NALED [ISO]",
          "stdName": "NALED [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6723681-7795-45ff-8249-2ea62784f0cb",
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd"
          ],
          "display_name": false
        },
        {
          "uuid": "49237493-005d-45a7-838c-e20bc1e585a2",
          "name": "NALED [MART.]",
          "stdName": "NALED [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb6c09fd-3556-4ec2-b39a-384ac48b46ba"
          ],
          "display_name": false
        },
        {
          "uuid": "5ca08686-0852-4ccc-bf28-6c58cedac8fc",
          "name": "NALED [MI]",
          "stdName": "NALED [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd",
            "755c55b6-c6a6-4708-ba20-b128cf12caa1"
          ],
          "display_name": false
        },
        {
          "uuid": "321a38b1-92d1-4914-bf6a-7732a60795b5",
          "name": "PHOSPHORIC ACID, 1,2-DIBROMO-2,2-DICHLOROETHYL DIMETHYL ESTER",
          "stdName": "PHOSPHORIC ACID, 1,2-DIBROMO-2,2-DICHLOROETHYL DIMETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5c737a13-a802-4d66-9821-d2c966ad969a",
            "c25682ad-1a2f-425b-85e8-1dd9775bc7dd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8a7a84ec-1167-4c5f-8592-e85a939b0bf7",
          "citation": "http://www.alanwood.net/pesticides/naled.html",
          "url": "http://www.alanwood.net/pesticides/naled.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c25682ad-1a2f-425b-85e8-1dd9775bc7dd",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb23b780-1dd2-4698-ad0a-e115f79dbc4a",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6861e091-499b-490c-bf3c-fedc2743a3f4",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d4635da1-008e-4fbf-a7c5-9c6ce6bde6e1",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb6c09fd-3556-4ec2-b39a-384ac48b46ba",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "755c55b6-c6a6-4708-ba20-b128cf12caa1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2e4f3bbc-a973-4a76-9eb8-8b6013e68d6b",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5c737a13-a802-4d66-9821-d2c966ad969a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6723681-7795-45ff-8249-2ea62784f0cb",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff21e1b7-ea8c-47b9-a999-26cefd64d5f0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391928000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b950a894-be8b-4ea8-bc9d-6f4527085973",
          "citation": "SRS import [PAM1AI9KU1]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=PAM1AI9KU1",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391928000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "660511c8-f935-48ce-9265-abfdfe077c5f",
          "citation": "NALED [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "177f3ee3-0e7a-429d-9ccb-bd037cdcc4e8",
          "citation": "NALED [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e8c28c89-b255-4d82-ba7c-fa866fffd2f3",
          "citation": "NALED [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "431c19f6-c6e1-4798-8ed8-d5c1ccb78c11",
          "citation": "NALED [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "46951c34-05d1-6947-c579-d2ea5a156837",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+300-76-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dd13bb52-aa48-1a74-5ee7-704f70e9128b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=300-76-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b857ab69-d225-1275-be17-7eaae4689a24",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "e17edf86-c647-a0b7-5d82-ff2c9ee533b9",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "338a6381-027c-4c66-8d2c-35d5a40951c9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ee5cecc5-a742-268e-4c96-13be82a3d643",
          "doc_type": "SYSTEM",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "6cc8635b-f23f-4431-b61c-a5fe59c0184a",
          "id": "6cc8635b-f23f-4431-b61c-a5fe59c0184a",
          "molfile": "\n  Marvin  01132105392D          \n\n 13 12  0  0  0  0            999 V2000\n    7.7454   -3.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0311   -4.1485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -3.7349    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7219   -3.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8948   -3.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1078   -2.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6023   -4.1485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8879   -3.7349    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.8796   -2.9077    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.1735   -4.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -4.8628    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7516   -4.8628    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4591   -3.7306    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  3  1  0  0  0  0\n  3  7  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13 10  1  0  0  0  0\nM  END",
          "smiles": "COP(=O)(OC)OC(C(Br)(Cl)Cl)Br",
          "formula": "C4H7Br2Cl2O4P",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9d2697e1-eb03-4599-9a97-333898417e47"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "380.7828",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bb6a85b7-8a77-4720-919a-c34839fc995f",
      "version": "7",
      "structure": {
        "id": "bfc6de61-389d-4f22-8902-4a0ed3282308",
        "molfile": "\n  Marvin  01132109552D          \n\n 13 12  0  0  0  0            999 V2000\n    4.8879   -3.7349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -3.7349    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6023   -4.1485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1735   -4.1442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7219   -3.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8796   -2.9077    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.5788   -4.8628    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.4591   -3.7306    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    3.7516   -4.8628    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8948   -3.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0311   -4.1485    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7454   -3.7432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1078   -2.2267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  1  6  1  0  0  0  0\n  7  4  1  0  0  0  0\n  8  4  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  2  1  0  0  0  0\n 11  2  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 10  1  0  0  0  0\nM  END",
        "smiles": "COP(=O)(OC)OC(C(Br)(Cl)Cl)Br",
        "formula": "C4H7Br2Cl2O4P",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "380.7828",
        "optical_activity": "( + / - )",
        "references": [
          "8a7a84ec-1167-4c5f-8592-e85a939b0bf7",
          "b950a894-be8b-4ea8-bc9d-6f4527085973"
        ],
        "stereo_centers": 1
      },
      "unii": "PAM1AI9KU1"
    }
  ]
}