{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9b7b18f9-6273-42d2-b3ac-b268b5805a04", "code": "13595-25-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=13595-25-0", "code_system": "CAS", "references": [ "eda76c13-7fc2-43e0-9a1a-af156d7d2df4", "c2088bfb-e9bf-4b18-8dbe-094efb16b380" ] }, { "uuid": "07c44519-8c41-4ef0-bad0-9a5662aca347", "code": "3292100", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3292100", "code_system": "PUBCHEM", "references": [ "eda76c13-7fc2-43e0-9a1a-af156d7d2df4" ] }, { "uuid": "9752562d-efba-358a-d066-1c4cf0cd5bf9", "code": "DTXSID7065548", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7065548", "code_system": "EPA CompTox", "references": [ "d3aa116d-1f54-8ef4-a1fe-c4c6d3baaa28" ] }, { "uuid": "35238358-8bf1-4667-86ab-fa19cb3b53ab", "code": "P9VL9VLK8V", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "c2088bfb-e9bf-4b18-8dbe-094efb16b380" ] } ], "substance_class": "chemical", "names": [ { "uuid": "8c00f3b0-8760-4fd0-929a-c9fed3415ef3", "name": "1,3-Bis(4-hydroxycumyl)benzene", "stdName": "1,3-BIS(4-HYDROXYCUMYL)BENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c2088bfb-e9bf-4b18-8dbe-094efb16b380" ], "display_name": false }, { "uuid": "0b52d903-885e-4256-aacd-5ac0c0e5f8e4", "name": "1,3-Bis[2-(4-hydroxyphenyl)-2-propyl]benzene", "stdName": "1,3-BIS(2-(4-HYDROXYPHENYL)-2-PROPYL)BENZENE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c2088bfb-e9bf-4b18-8dbe-094efb16b380" ], "display_name": true }, { "uuid": "228162e7-56db-4657-9e50-ab263cc19815", "name": "4,4′-[1,3-Phenylenebis(1-methylethylidene)]bis[phenol]", "stdName": "4,4'-(1,3-PHENYLENEBIS(1-METHYLETHYLIDENE))BIS(PHENOL)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c2088bfb-e9bf-4b18-8dbe-094efb16b380" ], "display_name": false }, { "uuid": "0e5933ed-e5e9-4e8d-89b4-960c0c555c6e", "name": "Phenol, 4,4′-[1,3-phenylenebis(1-methylethylidene)]bis-", "stdName": "PHENOL, 4,4'-(1,3-PHENYLENEBIS(1-METHYLETHYLIDENE))BIS-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "fb887aa7-aa6f-48b3-b6ff-56426fb679d2", "247da27e-77ab-442b-aba1-f53c1d2324fd" ], "display_name": false } ], "references": [ { "uuid": "fb887aa7-aa6f-48b3-b6ff-56426fb679d2", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "247da27e-77ab-442b-aba1-f53c1d2324fd", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "eda76c13-7fc2-43e0-9a1a-af156d7d2df4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393012000, "tags": [ "NOMEN" ] }, { "uuid": "259ffdac-f4e2-4929-9f29-905f62385980", "citation": "CHEMID RECORD 13595-25-0", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d3aa116d-1f54-8ef4-a1fe-c4c6d3baaa28", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=13595-25-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c2088bfb-e9bf-4b18-8dbe-094efb16b380", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5c25dcbd-139a-4dfd-aab3-e0e8c2fd6864", "id": "5c25dcbd-139a-4dfd-aab3-e0e8c2fd6864", "molfile": "\n CDK 12012301042D\n\n 26 28 0 0 0 0 0 0 0 0999 V2000\n 19.0840 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7330 -4.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7330 -3.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4350 -4.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4350 -3.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0840 -2.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3820 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0310 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1620 -6.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6020 -4.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7860 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1370 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5660 -4.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0060 -6.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0310 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6800 -8.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6800 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3290 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3290 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4880 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8390 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1370 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4880 -8.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8390 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9780 -8.6840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1900 -8.6840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 3 2 0 0 0 0\n 2 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 4 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 8 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 8 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 16 2 0 0 0 0\n 12 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 12 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 21 2 0 0 0 0\n 19 25 1 0 0 0 0\n 24 26 1 0 0 0 0\nM END", "smiles": "CC(C)(c1ccc(cc1)O)c2cccc(c2)C(C)(C)c3ccc(cc3)O", "formula": "C24H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "5accbb6e-3b42-47c7-8245-15338db6bf7b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.4629", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "51f4bdae-a3cb-4ac4-b8b7-467aea9a23cd", "version": "7", "structure": { "id": "fb6e6f01-d98c-4694-9d7c-d5373d299d18", "molfile": "\n JSDraw212012301042D\n\n 26 28 0 0 0 0 0 V2000\n 19.0840 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7330 -4.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.7330 -3.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4350 -4.7840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 20.4350 -3.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19.0840 -2.4440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.3820 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0310 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.1620 -6.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.6020 -4.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.7860 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1370 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 22.5660 -4.2130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 21.0060 -6.9150 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0310 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6800 -8.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6800 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3290 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3290 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4880 -5.5640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8390 -6.3440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 23.1370 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 24.4880 -8.6840 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 25.8390 -7.9040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.9780 -8.6840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 27.1900 -8.6840 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 1 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 3 2 0 0 0 0\n 2 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 7 9 1 0 0 0 0\n 7 10 1 0 0 0 0\n 4 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 8 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 8 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 16 2 0 0 0 0\n 12 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 12 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 21 2 0 0 0 0\n 19 25 1 0 0 0 0\n 24 26 1 0 0 0 0\nM END", "smiles": "CC(C)(c1ccc(cc1)O)c2cccc(c2)C(C)(C)c3ccc(cc3)O", "formula": "C24H26O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "346.4629", "optical_activity": "NONE", "references": [ "259ffdac-f4e2-4929-9f29-905f62385980" ], "stereo_centers": 0 }, "unii": "P9VL9VLK8V" } ] }