{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ce4c3f64-1432-4bf6-a2fc-02e0f35876bb",
          "code": "114369-43-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=114369-43-6",
          "code_system": "CAS",
          "references": [
            "3e07b32c-3133-4b2e-a399-b8fc308fb1f0",
            "a37b1925-7871-470e-aa50-c8748027d0df"
          ]
        },
        {
          "uuid": "6b91e1cb-5176-4467-9ce0-d9b7495fe005",
          "code": "m5265",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5265?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3e07b32c-3133-4b2e-a399-b8fc308fb1f0"
          ]
        },
        {
          "uuid": "72d617fb-8f83-42c9-91e5-d74e2c9811ee",
          "code": "86138",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86138",
          "code_system": "PUBCHEM",
          "references": [
            "3e07b32c-3133-4b2e-a399-b8fc308fb1f0"
          ]
        },
        {
          "uuid": "9bc94366-e06e-bf2b-6e27-6ec8e6ba1bb8",
          "code": "DTXSID8032548",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8032548",
          "code_system": "EPA CompTox",
          "references": [
            "f1584cde-581f-ead4-cf11-8cca815fe9bf"
          ]
        },
        {
          "uuid": "4bfc88de-a1cc-4e1c-9282-82efcf8189ae",
          "code": "P9P3C2AL0Z",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "67601e93-6989-024e-d266-86078f273560",
          "code": "fenbuconazole",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/fenbuconazole.html",
          "code_system": "ALANWOOD",
          "references": [
            "819a046f-179b-ce4d-a005-40dc98585f0a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c85c029d-7a35-45ed-b841-b8dbd08a5008",
          "name": "1H-1,2,4-TRIAZOLE-1-PROPANENITRILE, .ALPHA.-(2-(4-CHLOROPHENYL)ETHYL)-.ALPHA.-PHENYL-",
          "stdName": "1H-1,2,4-TRIAZOLE-1-PROPANENITRILE, .ALPHA.-(2-(4-CHLOROPHENYL)ETHYL)-.ALPHA.-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0235e82b-cca6-4b1b-b1db-78d384d4be56",
            "b810aefb-1160-470e-8cfe-0334a97bc56c"
          ],
          "display_name": false
        },
        {
          "uuid": "2491c928-4ba2-496d-871c-ee4cd20a62d2",
          "name": "FENBUCONAZOLE",
          "stdName": "FENBUCONAZOLE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b0b3634d-0102-43da-8e50-e825407a174d",
            "74d3319a-2ae4-4ff1-b4e6-2ed910dfba82",
            "4da426ec-cb2a-4e8d-93ed-c543e0f81f83",
            "068039c5-1521-4795-b900-67e38d1c3681",
            "0235e82b-cca6-4b1b-b1db-78d384d4be56",
            "b810aefb-1160-470e-8cfe-0334a97bc56c"
          ],
          "display_name": true
        },
        {
          "uuid": "e84ca401-958b-4514-800d-2f3202346972",
          "name": "FENBUCONAZOLE [ISO]",
          "stdName": "FENBUCONAZOLE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "74d3319a-2ae4-4ff1-b4e6-2ed910dfba82",
            "0235e82b-cca6-4b1b-b1db-78d384d4be56"
          ],
          "display_name": false
        },
        {
          "uuid": "7f250b66-d522-4c84-a8ea-7eade864d744",
          "name": "FENBUCONAZOLE [MI]",
          "stdName": "FENBUCONAZOLE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "068039c5-1521-4795-b900-67e38d1c3681",
            "0235e82b-cca6-4b1b-b1db-78d384d4be56"
          ],
          "display_name": false
        },
        {
          "uuid": "5d92810b-60bf-4913-b090-a3148d1a9ac3",
          "name": "RH-7592",
          "stdName": "RH-7592",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0235e82b-cca6-4b1b-b1db-78d384d4be56",
            "b810aefb-1160-470e-8cfe-0334a97bc56c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b810aefb-1160-470e-8cfe-0334a97bc56c",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0235e82b-cca6-4b1b-b1db-78d384d4be56",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "74d3319a-2ae4-4ff1-b4e6-2ed910dfba82",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "068039c5-1521-4795-b900-67e38d1c3681",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e07b32c-3133-4b2e-a399-b8fc308fb1f0",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6af4e4fe-7e5f-4a38-a461-00fd094243ed",
          "citation": "SRS import [P9P3C2AL0Z]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P9P3C2AL0Z",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392017000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dec691b9-e941-4656-9063-0898b970369e",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4da426ec-cb2a-4e8d-93ed-c543e0f81f83",
          "citation": "FENBUCONAZOLE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b0b3634d-0102-43da-8e50-e825407a174d",
          "citation": "FENBUCONAZOLE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "f1584cde-581f-ead4-cf11-8cca815fe9bf",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=114369-43-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "819a046f-179b-ce4d-a005-40dc98585f0a",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "a37b1925-7871-470e-aa50-c8748027d0df",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f919fe38-8bb0-408c-8896-3454ba6637b0",
          "id": "f919fe38-8bb0-408c-8896-3454ba6637b0",
          "molfile": "\n  Marvin  01132112552D          \n\n 24 26  0  0  0  0            999 V2000\n    4.2660   -5.2216    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.8587   -4.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2660   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8587   -3.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0337   -3.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6160   -2.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7910   -2.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3837   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    0.6683   -2.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6683   -2.8823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3315   -3.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0756   -4.1564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2506   -4.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.3732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9660   -0.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5587   -0.2193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0991   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8040   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5193   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5193   -0.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8040    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0991   -0.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6160   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0337   -4.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 24  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 23  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 15  1  0  0  0  0\n  8 17  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 14  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 16  3  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 24  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(CCc2ccc(cc2)Cl)(C#N)Cn3cncn3",
          "formula": "C19H17ClN4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8a56c12f-9941-48d4-8874-291a562121e4"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "336.8187",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "71c2d9ae-4e90-432f-aaec-dc5066d760c5",
      "version": "4",
      "structure": {
        "id": "9930dc00-5bba-4727-b1bc-96077144d902",
        "molfile": "\n  Marvin  01132107572D          \n\n 24 26  0  0  0  0            999 V2000\n    4.2660   -5.2216    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.8587   -4.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2660   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8587   -3.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0337   -3.0755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6160   -3.7909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0337   -4.5062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6160   -2.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7910   -2.3549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3837   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0991   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8040   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5193   -1.2323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5193   -0.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8040    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0991   -0.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9660   -0.9347    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5587   -0.2193    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6683   -2.0573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6683   -2.8823    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -3.3732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2506   -4.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0756   -4.1564    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3315   -3.3732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  7  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 17  1  0  0  0  0\n 10 19  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 16  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 17 18  3  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 24  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(CCc2ccc(cc2)Cl)(C#N)Cn3cncn3",
        "formula": "C19H17ClN4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "336.8187",
        "optical_activity": "( + / - )",
        "references": [
          "dec691b9-e941-4656-9063-0898b970369e",
          "6af4e4fe-7e5f-4a38-a461-00fd094243ed"
        ],
        "stereo_centers": 1
      },
      "unii": "P9P3C2AL0Z"
    }
  ]
}