{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "44051b7a-0852-4e9f-a0f7-1fbf20151440",
          "code": "P9AUQ66PZS",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2e9b0fdb-ef3a-4773-9f22-0c12bd353cbb",
          "code": "1889-67-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1889-67-4",
          "code_system": "CAS",
          "references": [
            "ef4981b4-6363-4522-ac73-5f263561b59c",
            "f6649671-9d13-4b76-833d-d8012a6123b8"
          ]
        },
        {
          "uuid": "0fec432d-a444-469c-a960-a2a25763d173",
          "code": "217-568-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.015.972",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ef4981b4-6363-4522-ac73-5f263561b59c"
          ]
        },
        {
          "uuid": "d3f1387f-86ad-4524-82b0-aec81b6a6c07",
          "code": "74681",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/74681",
          "code_system": "PUBCHEM",
          "references": [
            "ef4981b4-6363-4522-ac73-5f263561b59c"
          ]
        },
        {
          "uuid": "5317c2e0-7993-1583-b9b8-9e45ea804f1e",
          "code": "DTXSID1062043",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1062043",
          "code_system": "EPA CompTox",
          "references": [
            "cb3d463f-b8db-934d-b490-4a660fed71b6"
          ]
        },
        {
          "uuid": "ec18d84f-507e-0ca4-5dad-41a9f153e9ca",
          "code": "34859",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=34859",
          "code_system": "NSC",
          "references": [
            "7222d57d-5099-7ada-de35-abad30331c66"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "de5285d5-3d2c-415a-a945-4cf74b303eb4",
          "name": "1,1′-(1,1,2,2-Tetramethyl-1,2-ethanediyl)bis[benzene]",
          "stdName": "1,1'-(1,1,2,2-TETRAMETHYL-1,2-ETHANEDIYL)BIS(BENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6649671-9d13-4b76-833d-d8012a6123b8"
          ],
          "display_name": false
        },
        {
          "uuid": "58c1f7f7-445b-42d1-8bfa-6fe2a6455fd4",
          "name": "2,3-Dimethyl-2,3-diphenylbutane",
          "stdName": "2,3-DIMETHYL-2,3-DIPHENYLBUTANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f4637ec-e7c9-4ccf-982e-0a06fadd8020",
            "d18a4587-682a-4f4c-9c58-c0cf2e6fb5e5"
          ],
          "display_name": false
        },
        {
          "uuid": "10312937-c26b-419a-91a7-409104319a6a",
          "name": "Benzene, 1,1′-(1,1,2,2-tetramethyl-1,2-ethanediyl)bis-",
          "stdName": "BENZENE, 1,1'-(1,1,2,2-TETRAMETHYL-1,2-ETHANEDIYL)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6649671-9d13-4b76-833d-d8012a6123b8"
          ],
          "display_name": false
        },
        {
          "uuid": "5e6f3a9e-14e5-4279-b556-b7fb3a77b6e8",
          "name": "Dicumene",
          "stdName": "DICUMENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6649671-9d13-4b76-833d-d8012a6123b8"
          ],
          "display_name": true
        },
        {
          "uuid": "75a14f8b-0247-4bc9-bfe5-fe87c6147609",
          "name": "NSC-34859",
          "stdName": "NSC-34859",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f4637ec-e7c9-4ccf-982e-0a06fadd8020",
            "d18a4587-682a-4f4c-9c58-c0cf2e6fb5e5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d18a4587-682a-4f4c-9c58-c0cf2e6fb5e5",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f4637ec-e7c9-4ccf-982e-0a06fadd8020",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef4981b4-6363-4522-ac73-5f263561b59c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393955000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb3d463f-b8db-934d-b490-4a660fed71b6",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=1889-67-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f6649671-9d13-4b76-833d-d8012a6123b8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "7222d57d-5099-7ada-de35-abad30331c66",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f65b59ff-f3ac-48f0-bc1e-b583de7e2ab6",
          "id": "f65b59ff-f3ac-48f0-bc1e-b583de7e2ab6",
          "molfile": "\n  Marvin  01132112462D          \n\n 18 19  0  0  0  0            999 V2000\n    3.4818   -0.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9493    0.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6661    0.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6633    0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3811    0.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0906    0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0906    1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3811    1.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6633    1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413   -0.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6087    0.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4245   -0.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273   -0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095   -0.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095   -1.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273   -1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 10  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  9  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 10  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(c1ccccc1)C(C)(C)c2ccccc2",
          "formula": "C18H22",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1ab1ab5-72d3-4247-94da-064e836d6bc1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "238.3679",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "a7612bad-1ad2-4013-9746-d21aa24fcabe",
      "version": "7",
      "structure": {
        "id": "1e0c8c2f-3848-4c02-8d22-d3f9595f458b",
        "molfile": "\n  Marvin  01132101432D          \n\n 18 19  0  0  0  0            999 V2000\n    1.4273   -0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095   -0.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7095   -1.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4273   -1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1413   -0.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9493    0.0719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6633    0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3811    0.0727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0906    0.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0906    1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3811    1.7227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6633    1.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4818   -0.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6661    0.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6087    0.5619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4245   -0.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  2  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  9  2  0  0  0  0\n  8 15  1  0  0  0  0\n  8 16  1  0  0  0  0\n  7 17  1  0  0  0  0\n  7 18  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(c1ccccc1)C(C)(C)c2ccccc2",
        "formula": "C18H22",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "238.3679",
        "optical_activity": "NONE",
        "references": [
          "d18a4587-682a-4f4c-9c58-c0cf2e6fb5e5"
        ],
        "stereo_centers": 0
      },
      "unii": "P9AUQ66PZS"
    }
  ]
}