{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "a34187cb-9cec-4fe5-9ae8-25326eeb554b", "code": "4028-98-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=4028-98-2", "code_system": "CAS", "references": [ "133e32b7-f591-4858-842d-67f39843856f", "eb3d69ab-49b5-42c1-80dc-1da23455c58b" ] }, { "uuid": "6e701b62-0090-41ad-baf7-30d4bd19b5aa", "code": "C83662", "type": "PRIMARY", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83662", "code_system": "NCI_THESAURUS", "references": [ "133e32b7-f591-4858-842d-67f39843856f" ] }, { "uuid": "19a30ead-d236-420f-8a62-f352f50ee63f", "code": "SUB01591MIG", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "133e32b7-f591-4858-842d-67f39843856f" ] }, { "uuid": "4b1a21a7-a6fb-46eb-9d73-e6cc8ac2b417", "code": "223-712-5", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.557", "code_system": "ECHA (EC/EINECS)", "references": [ "133e32b7-f591-4858-842d-67f39843856f" ] }, { "uuid": "d1b29e4c-2761-4ed3-948d-c0aa019a1d68", "code": "19939", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19939", "code_system": "PUBCHEM", "references": [ "133e32b7-f591-4858-842d-67f39843856f" ] }, { "uuid": "94bb598e-80f2-c82a-2d72-c54633f1d070", "code": "DTXSID80193267", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80193267", "code_system": "EPA CompTox", "references": [ "797d357c-73c4-69e2-83f1-220d74ba5a0d" ] }, { "uuid": "249c76fd-5f63-f0af-6590-ef4527023a15", "code": "C795", "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic[C258]|Quinolone Antibiotic", "type": "CONCEPT", "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C795", "code_system": "NCI_THESAURUS", "references": [ "3d000c23-9f65-674a-cb64-b283404bda60" ] }, { "uuid": "5af5ac25-d58b-e08c-8d5e-620f8204a4e1", "code": "DBSALT002402", "type": "PRIMARY", "url": "https://go.drugbank.com/drugs/DBSALT002402", "code_system": "DRUG BANK", "references": [ "3d000c23-9f65-674a-cb64-b283404bda60" ] }, { "uuid": "24926555-8d6c-4f96-8551-4c75fef13a5f", "code": "P8W4UX112S", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "e83cca20-f73c-b5ae-863b-84100e916072", "code": "100000087751", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "c2548305-3595-e01d-a492-6d2aa603d9e1" ] } ], "relationships": [ { "uuid": "97a33b5f-50a9-494b-af96-5fc10c7e0a05", "type": "ACTIVE MOIETY", "related_substance": { "uuid": "ab2fcfe2-2fcf-405b-9f1c-d54397faf816", "refuuid": "2ca7d4ec-63b6-4e65-add4-d7f0e78b72da", "name": "DEQUALINIUM", "unii": "E7QC7V26B8", "linking_id": "E7QC7V26B8", "ref_pname": "DEQUALINIUM", "substance_class": "reference" } }, { "uuid": "95f57673-d9b0-4067-9799-8cafd0004e64", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "24bdbaea-5bb4-41a3-b9f8-da584d7b2485", "refuuid": "2ca7d4ec-63b6-4e65-add4-d7f0e78b72da", "name": "DEQUALINIUM", "unii": "E7QC7V26B8", "linking_id": "E7QC7V26B8", "ref_pname": "DEQUALINIUM", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "72e35067-e073-4573-9aac-b8f458655a84", "name": "1,1'-(DECANE-1,10-DIYL)BIS(4-AMINO-2-METHYLQUINOLINIUM) DIACETATE", "stdName": "1,1'-(DECANE-1,10-DIYL)BIS(4-AMINO-2-METHYLQUINOLINIUM) DIACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4291e76e-31f6-42b7-aebc-9e42922da970", "116f993b-60f7-47a3-8a7c-4dc99e337799" ], "display_name": false }, { "uuid": "9a559932-db62-4d2a-87e6-4069154c93e4", "name": "DEQUALINIUM ACETATE", "stdName": "DEQUALINIUM ACETATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "4291e76e-31f6-42b7-aebc-9e42922da970", "f5993f7f-86df-47b8-af43-59857868a541", "116f993b-60f7-47a3-8a7c-4dc99e337799", "6b8deb82-5806-4c41-876a-867af23a99a5", "ed3a52c1-2bcf-4611-b48b-d20ded504fdb", "83291a3a-9582-4159-98e8-04bb226396e3" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "26cf5ab3-35fd-4ed1-b841-ce869b83ba34", "name_org": "INCI" } ] }, { "uuid": "8467090e-0918-9a03-6d1d-20df22f3b307", "name": "Dequalinium acetate [WHO-DD]", "stdName": "DEQUALINIUM ACETATE [WHO-DD]", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "e998113c-c5d5-18ea-760b-5714179ff37c" ], "display_name": false }, { "uuid": "4166cea7-fcc6-4abd-9a69-4c390a4c1f37", "name": "QUINOLINIUM, 1,1'-(1,10-DECANEDIYL)BIS(4-AMINO-2-METHYL-, DIACETATE", "stdName": "QUINOLINIUM, 1,1'-(1,10-DECANEDIYL)BIS(4-AMINO-2-METHYL-, DIACETATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4291e76e-31f6-42b7-aebc-9e42922da970", "116f993b-60f7-47a3-8a7c-4dc99e337799" ], "display_name": false } ], "references": [ { "uuid": "4291e76e-31f6-42b7-aebc-9e42922da970", "citation": "ChemID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "116f993b-60f7-47a3-8a7c-4dc99e337799", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6b8deb82-5806-4c41-876a-867af23a99a5", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "ed3a52c1-2bcf-4611-b48b-d20ded504fdb", "citation": "WHO-DD", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "133e32b7-f591-4858-842d-67f39843856f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493389701000, "tags": [ "NOMEN" ] }, { "uuid": "a1384197-32c4-4fa5-9c77-b181e4afd459", "citation": "SRS import [P8W4UX112S]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P8W4UX112S", "doc_type": "SRS", "public_domain": true, "document_date": 1493389701000, "tags": [ "NOMEN" ] }, { "uuid": "f5993f7f-86df-47b8-af43-59857868a541", "citation": "DEQUALINIUM ACETATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "83291a3a-9582-4159-98e8-04bb226396e3", "citation": "DEQUALINIUM ACETATE [WHO-DD]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "797d357c-73c4-69e2-83f1-220d74ba5a0d", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=4028-98-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "3d000c23-9f65-674a-cb64-b283404bda60", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "eb3d69ab-49b5-42c1-80dc-1da23455c58b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e998113c-c5d5-18ea-760b-5714179ff37c", "citation": "WHO-DD", "doc_type": "WHO DRUG DICTIONARY", "public_domain": true }, { "uuid": "c2548305-3595-e01d-a492-6d2aa603d9e1", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "39179f77-6dbd-4889-acf8-13427f3566c6", "id": "39179f77-6dbd-4889-acf8-13427f3566c6", "molfile": "\n Marvin 01132103022D \n\n 4 3 0 0 0 0 999 V2000\n 10.0594 -20.0895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7716 -19.6731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4839 -20.0854 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7674 -18.8483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\nM END", "smiles": "CC(=O)O", "formula": "C2H4O2", "atropisomerism": "No", "charge": 0, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "4e0ef2e0-c6f9-40d9-bb37-e43a8731f930" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "60.052", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "ca20a82d-bf29-432a-be2a-4fd179cb81a2", "id": "ca20a82d-bf29-432a-be2a-4fd179cb81a2", "molfile": "\n Marvin 01132110262D \n\n 34 37 0 0 0 0 999 V2000\n -2.0377 -21.1670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7488 -20.7557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4594 -21.1707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1794 -20.7592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8982 -21.1670 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1800 -19.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8902 -19.5247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8932 -18.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1784 -18.2886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4656 -18.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4660 -19.5226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7518 -19.9352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0377 -19.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3237 -19.9310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6097 -19.5176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1044 -19.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8185 -19.5134 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5326 -19.9227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2466 -19.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9606 -19.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6747 -19.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3888 -19.9185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1029 -19.5008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0961 -18.6783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3763 -18.2649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8068 -18.2591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5304 -18.6685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2408 -18.2481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5345 -19.4965 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2477 -19.9033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2539 -20.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5391 -21.1446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8233 -20.7343 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8206 -19.9108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 2 0 0 0 0\n 2 12 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 11 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 1 0 0 0 0\n 23 34 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 24 2 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 2 0 0 0 0\n 29 27 1 0 0 0 0\n 30 29 1 0 0 0 0\n 29 34 2 0 0 0 0\n 31 30 2 0 0 0 0\n 32 31 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\nM END", "smiles": "Cc1cc(=N)c2ccccc2n1CCCCCCCCCCn3c(C)cc(=N)c4ccccc43", "formula": "C30H38N4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "03c8a4bc-622f-49d3-bf64-2392da99cd1a" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "454.6506", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "fdbebc94-e922-43cb-a81a-e2bac33df75e", "version": "10", "structure": { "id": "821c78d0-d312-4c86-9287-e98406579921", "molfile": "\n Marvin 01132106452D \n\n 42 43 0 0 0 0 999 V2000\n -2.7515 -19.9329 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n -2.0375 -19.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3235 -19.9287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6096 -19.5154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.1044 -19.9245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8184 -19.5112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5324 -19.9204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2463 -19.5070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9603 -19.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6743 -19.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3883 -19.9162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1023 -19.4986 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 6.5297 -18.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8061 -18.2570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0955 -18.6762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5338 -19.4943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8199 -19.9085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8226 -20.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5384 -21.1422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2531 -20.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2469 -19.9010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1789 -20.7568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4590 -21.1683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.7485 -20.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1795 -19.9309 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4656 -19.5204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.4652 -18.6986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.1779 -18.2865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8926 -18.7021 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8896 -19.5225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3758 -18.2628 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2400 -18.2460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n -2.0375 -21.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.8976 -21.1646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0834 -20.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7973 -19.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5113 -20.1333 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.7931 -18.8933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0834 -20.1374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7973 -19.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.5113 -20.1333 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 10.7931 -18.8933 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 1 0 0 0 0\n 28 29 1 0 0 0 0\n 13 14 1 0 0 0 0\n 29 30 2 0 0 0 0\n 30 25 1 0 0 0 0\n 6 7 1 0 0 0 0\n 15 31 1 0 0 0 0\n 14 15 2 0 0 0 0\n 13 32 1 0 0 0 0\n 15 12 1 0 0 0 0\n 24 33 1 0 0 0 0\n 22 34 1 0 0 0 0\n 7 8 1 0 0 0 0\n 16 17 1 0 0 0 0\n 3 4 1 0 0 0 0\n 17 18 1 0 0 0 0\n 8 9 1 0 0 0 0\n 18 19 2 0 0 0 0\n 1 2 1 0 0 0 0\n 19 20 1 0 0 0 0\n 9 10 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 16 1 0 0 0 0\n 1 26 2 0 0 0 0\n 4 5 1 0 0 0 0\n 25 22 2 0 0 0 0\n 10 11 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 2 0 0 0 0\n 24 1 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 17 2 0 0 0 0\n 25 26 1 0 0 0 0\n 35 36 1 0 0 0 0\n 36 37 1 0 0 0 0\n 36 38 2 0 0 0 0\n 5 6 1 0 0 0 0\n 26 27 1 0 0 0 0\n 16 13 2 0 0 0 0\n 27 28 2 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 40 42 2 0 0 0 0\nM CHG 4 1 1 12 1 37 -1 41 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 8 35 36 37 38 39 40 41 42\nM SPA 1 4 35 36 37 38\nM SDI 1 4 9.6634 -20.5574 9.6634 -18.4733\nM SDI 1 4 11.9313 -18.4733 11.9313 -20.5574\nM SMT 1 2\nM END", "smiles": "Cc1cc(c2ccccc2[n+]1CCCCCCCCCC[n+]3c(C)cc(c4ccccc43)N)N.CC(=O)[O-].CC(=O)[O-]", "formula": "C30H40N4.2C2H3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "574.7547", "optical_activity": "NONE", "references": [ "4291e76e-31f6-42b7-aebc-9e42922da970", "a1384197-32c4-4fa5-9c77-b181e4afd459" ], "stereo_centers": 0 }, "unii": "P8W4UX112S" } ] }