{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "b7397de5-a6b6-4ecd-877b-636954bdf9f5", "code": "860627-90-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=860627-90-3", "code_system": "CAS", "references": [ "e5398afe-e8c9-4b8d-81d9-f0c6b6fb093c", "6b16c27c-7d35-460e-af83-47e75ac3ed65" ] }, { "uuid": "ba0add8d-8659-4e16-8cdd-2f0dd0604795", "code": "1426471", "comments": "RxNorm", "type": "PRIMARY", "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426471/allProperties.xml?prop=all", "code_system": "RXCUI", "references": [ "e5398afe-e8c9-4b8d-81d9-f0c6b6fb093c" ] }, { "uuid": "b52d6b88-abec-4a2d-ba1d-0488f3fd2415", "code": "71587827", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587827", "code_system": "PUBCHEM", "references": [ "e5398afe-e8c9-4b8d-81d9-f0c6b6fb093c" ] }, { "uuid": "e5d1bf15-0eea-53da-5773-a41ed34b66eb", "code": "DTXSID00235370", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00235370", "code_system": "EPA CompTox", "references": [ "361cd570-3ada-20f9-0609-0e5b3c3cfe17" ] }, { "uuid": "b2bdafed-f08c-4e6c-9eb6-a2b60a6cda88", "code": "P8A02Z93M6", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "5d27aab2-3934-ae48-fc87-d0b59ee1f38b", "code": "P8A02Z93M6", "type": "PRIMARY", "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=P8A02Z93M6", "code_system": "DAILYMED", "references": [ "462aa188-755c-4f5e-e0f1-577c553f2e21" ] } ], "relationships": [ { "uuid": "3922913f-61a8-4820-b379-e43146c6e6e2", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "1a826676-bde5-4fee-9f3f-7341176dbed7", "refuuid": "48e11a84-a6c5-44d5-8bc4-1a7c88da8f3a", "name": "HEXANOYL DIPEPTIDE-3 NORLEUCINE", "unii": "0Y97N2242B", "linking_id": "0Y97N2242B", "ref_pname": "HEXANOYL DIPEPTIDE-3 NORLEUCINE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "51391906-1a63-4822-ab73-b4313799f38f", "name": "HEXANOYL DIPEPTIDE-3 NORLEUCINE ACETATE", "stdName": "HEXANOYL DIPEPTIDE-3 NORLEUCINE ACETATE", "type": "of", "languages": [ "en" ], "preferred": false, "references": [ "38627957-14ee-465f-a9bf-dc540e032577", "ec63f36a-b1ba-4e04-bf53-8ec7ee0cb233", "94d7c20f-9265-41c4-8bff-c47f56c9c643", "d22c8a06-d4ee-409e-8f3a-00494b694be9" ], "display_name": true, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "21701ab3-9ef7-4ea2-82a4-f69582ed21d5", "name_org": "INCI" } ] }, { "uuid": "b1674cc6-47e5-4f35-bb64-6a931d314e63", "name": "L-NORLEUCINAMIDE, N2-(1-OXOHEXYL)-L-ARGINYL-L-ALANYL-, ACETATE (1:1)", "stdName": "L-NORLEUCINAMIDE, N2-(1-OXOHEXYL)-L-ARGINYL-L-ALANYL-, ACETATE (1:1)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d42c1b70-4a5c-4f3f-ab0e-38166b4dcee5", "d22c8a06-d4ee-409e-8f3a-00494b694be9" ], "display_name": false }, { "uuid": "4b10c4b1-0658-4871-93f9-b48c07d75688", "name": "L-NORLEUCINAMIDE, N2-(1-OXOHEXYL)-L-ARGINYL-L-ALANYL-, MONOACETATE", "stdName": "L-NORLEUCINAMIDE, N2-(1-OXOHEXYL)-L-ARGINYL-L-ALANYL-, MONOACETATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "d42c1b70-4a5c-4f3f-ab0e-38166b4dcee5", "d22c8a06-d4ee-409e-8f3a-00494b694be9" ], "display_name": false } ], "references": [ { "uuid": "ec63f36a-b1ba-4e04-bf53-8ec7ee0cb233", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "d22c8a06-d4ee-409e-8f3a-00494b694be9", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "d42c1b70-4a5c-4f3f-ab0e-38166b4dcee5", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "38627957-14ee-465f-a9bf-dc540e032577", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e5398afe-e8c9-4b8d-81d9-f0c6b6fb093c", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390962000, "tags": [ "NOMEN" ] }, { "uuid": "70cc0aca-801e-4ed0-945f-88a4c906f51b", "citation": "SRS import [P8A02Z93M6]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P8A02Z93M6", "doc_type": "SRS", "public_domain": true, "document_date": 1493390962000, "tags": [ "NOMEN" ] }, { "uuid": "328a83ce-f59c-47e7-92a8-84eed818ab78", "citation": "PCPC-DB;S?FW-Journal | 132 | 3-2006", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "94d7c20f-9265-41c4-8bff-c47f56c9c643", "citation": "HEXANOYL DIPEPTIDE-3 NORLEUCINE ACETATE [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "361cd570-3ada-20f9-0609-0e5b3c3cfe17", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=860627-90-3", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "6b16c27c-7d35-460e-af83-47e75ac3ed65", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "462aa188-755c-4f5e-e0f1-577c553f2e21", "citation": "DailyMed", "doc_type": "DAILYMED", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0534ea59-6b7e-45b5-926a-26e539c3c919", "id": "0534ea59-6b7e-45b5-926a-26e539c3c919", "molfile": "\n Marvin 01132100342D \n\n 4 3 0 0 1 0 999 V2000\n -1.5011 -0.1581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5011 0.6669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.2156 1.0793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.7867 1.0793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 2 0 0 0 0\nM END", "smiles": "CC(=O)O", "formula": "C2H4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "4742a300-9411-4322-836b-aea4420f53d3" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "60.052", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "851a6d2d-25d9-4d14-a84b-c8e159c87531", "id": "851a6d2d-25d9-4d14-a84b-c8e159c87531", "molfile": "\n Marvin 01132106542D \n\n 32 31 0 0 1 0 999 V2000\n 6.0187 -2.2005 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 6.0187 -1.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3043 -2.6130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5898 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5898 -1.3754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8753 -2.6130 0.0000 C 0 0 2 0 0 0 0 0 0 2 0 0\n 3.8753 -3.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -3.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -4.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -5.0880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -5.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -6.3255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7319 -6.3255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -2.2005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -3.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7319 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0174 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3029 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4115 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1260 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7331 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7331 -3.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4477 -2.2005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1621 -2.6130 0.0000 C 0 0 1 0 0 0 0 0 0 2 0 0\n 8.1621 -3.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4477 -3.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4477 -4.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7332 -5.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8766 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5911 -2.6130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8766 -1.3754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 1 0 0 0\n 3 1 1 0 0 0 0\n 1 22 1 0 0 0 0\n 4 3 1 0 0 0 0\n 4 5 2 0 0 0 0\n 6 4 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 14 1 6 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 2 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 22 23 2 0 0 0 0\n 22 24 1 0 0 0 0\n 25 24 1 6 0 0 0\n 25 26 1 0 0 0 0\n 25 30 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 30 2 0 0 0 0\nM END", "smiles": "CCCCCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCC)C(=O)N", "formula": "C21H41N7O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "148d31e8-db7a-40c1-b13c-54d080818d68" }, "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "455.5956", "optical_activity": "UNSPECIFIED", "stereo_centers": 3 } ], "definition_level": "COMPLETE", "uuid": "e589bda5-8272-413f-af79-399810293c3f", "version": "5", "structure": { "id": "12a4949f-5a8d-468d-927f-53f42a539baf", "molfile": "\n Marvin 01132101112D \n\n 36 34 0 0 1 0 999 V2000\n -2.3783 1.1586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6114 0.7159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.8445 1.1586 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6114 -0.1697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -6.3255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -5.9130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7319 -6.3255 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -5.0880 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -4.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -3.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8753 -3.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8753 -2.6130 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 4.5898 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.5898 -1.3754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3043 -2.6130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.0187 -2.2005 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 6.0187 -1.3754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7331 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7331 -3.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4477 -2.2005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.1621 -2.6130 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 8.1621 -3.4379 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4477 -3.8505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4477 -4.6755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7332 -5.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8766 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.8766 -1.3754 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.5911 -2.6130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1608 -2.2005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7319 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0174 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3029 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.4115 -2.6130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1260 -2.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4464 -3.4379 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 2 0 0 0 0\n 8 6 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 6 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 1 0 0 0\n 16 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 18 20 1 0 0 0 0\n 21 20 1 0 0 0 0\n 21 22 1 6 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 26 21 1 0 0 0 0\n 27 26 2 0 0 0 0\n 26 28 1 0 0 0 0\n 29 12 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 33 1 0 0 0 0\n 33 34 1 0 0 0 0\n 34 35 1 0 0 0 0\n 30 36 2 0 0 0 0\nM END", "smiles": "CCCCCC(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](C)C(=O)N[C@@H](CCCC)C(=O)N.CC(=O)O", "formula": "C21H41N7O4.C2H4O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 3, "ez_centers": 0, "molecular_weight": "515.6476", "optical_activity": "UNSPECIFIED", "references": [ "328a83ce-f59c-47e7-92a8-84eed818ab78", "70cc0aca-801e-4ed0-945f-88a4c906f51b" ], "stereo_centers": 3 }, "unii": "P8A02Z93M6" } ] }