{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "5d2461dc-bf0e-4705-bc06-29b183596b89", "code": "6373-07-5", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=6373-07-5", "code_system": "CAS", "references": [ "e4f2c599-d072-4c77-9ea2-668143eec9ad", "0b906d67-ae91-42ef-a99e-6bc78662aacd" ] }, { "uuid": "74c8b0e6-9354-473c-b343-b8fc48be8f35", "code": "228-908-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.026.281", "code_system": "ECHA (EC/EINECS)", "references": [ "e4f2c599-d072-4c77-9ea2-668143eec9ad" ] }, { "uuid": "e623811d-da11-1077-d759-731dfb6dfb51", "code": "61398", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/61398", "code_system": "PUBCHEM", "references": [ "0de38422-3ff4-7629-6011-0d177e894faa" ] }, { "uuid": "860c66b9-cd08-456d-818e-f50ea9722389", "code": "P867J78P1Y", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "69c14229-3555-d43f-9064-4e93d0fcc704", "code": "DTXSID2064284", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2064284", "code_system": "EPA CompTox", "references": [ "6c0e954e-5999-470c-5831-16bb91f8166b" ] }, { "uuid": "5cf0a181-5b02-40c2-e90a-3b9ed55edcd7", "code": "10476", "type": "PRIMARY", "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=10476", "code_system": "NSC", "references": [ "fd2a7d25-520e-3c8a-9a43-a3c15e33fd01" ] } ], "substance_class": "chemical", "names": [ { "uuid": "edcb34a6-218f-4984-a59f-733e2a9187e0", "name": "AKA-215", "stdName": "AKA-215", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "62b4b1c6-0e14-482a-a899-af6d27c7ea60" ], "display_name": false }, { "uuid": "b1d5819d-5d0f-4a9e-aead-6ae2f492876b", "name": "AKA215", "stdName": "AKA215", "type": "of", "languages": [ "en" ], "preferred": true, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "b552d3b9-55e4-4eec-9bde-453938636b25", "fb610b38-281e-4128-8aa8-09008a46718c" ], "display_name": false, "domains": [ "cosmetic" ], "name_orgs": [ { "uuid": "447a77e5-53c8-4bbb-aadb-4d0df4c1afeb", "name_org": "INCI" } ] }, { "uuid": "1e053d67-1067-4f3c-acfc-4b1b5e144ebc", "name": "AMMONIUM, (9-(O-CARBOXYPHENYL)-6(DIETHYLAMINO)-3H-XANTHEN-3-YLIDENE)DIETHYL-, STEARATE", "stdName": "AMMONIUM, (9-(O-CARBOXYPHENYL)-6(DIETHYLAMINO)-3H-XANTHEN-3-YLIDENE)DIETHYL-, STEARATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "fb610b38-281e-4128-8aa8-09008a46718c" ], "display_name": false }, { "uuid": "a814b2c5-aa63-4172-ac26-54b81a8866e1", "name": "C.I. 45170 STEARATE", "stdName": "C.I. 45170 STEARATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "62b4b1c6-0e14-482a-a899-af6d27c7ea60" ], "display_name": false }, { "uuid": "0b9a2366-0432-4f9a-8dc9-91c55b61381f", "name": "CI 45170 STEARATE", "stdName": "CI 45170 STEARATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "62b4b1c6-0e14-482a-a899-af6d27c7ea60" ], "display_name": false }, { "uuid": "ea110734-1f1b-c851-1200-17ef36ca90a5", "name": "D&C RED NO. 37 (DELISTED)", "stdName": "D&C RED NO. 37 (DELISTED)", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "98cd3560-2262-b4e7-dad8-afa236ba2388", "7ea3b572-4f4e-81b7-703b-8e6f78a02a72" ], "display_name": false }, { "uuid": "230a5e4c-0bb3-467c-86b9-9af41ac18290", "name": "ETHANAMINIUM, N-(9-(2-CARBOXYPHENYL)-6-(DIETHYLAMINO)-3H-XANTHEN-3-YLIDENE)-N-ETHYL-, OCTADECANOATE", "stdName": "ETHANAMINIUM, N-(9-(2-CARBOXYPHENYL)-6-(DIETHYLAMINO)-3H-XANTHEN-3-YLIDENE)-N-ETHYL-, OCTADECANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "fb610b38-281e-4128-8aa8-09008a46718c" ], "display_name": false }, { "uuid": "508e3067-2ea5-4ad1-9fa2-565963ae23fb", "name": "N-(9-(2-CARBOXYPHENYL)-6-(DIETHYLAMINO)-3H-XANTHEN-3-YLIDENE)-N-ETHYLETHANAMINIUM OCTADECANOATE", "stdName": "N-(9-(2-CARBOXYPHENYL)-6-(DIETHYLAMINO)-3H-XANTHEN-3-YLIDENE)-N-ETHYLETHANAMINIUM OCTADECANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "fb610b38-281e-4128-8aa8-09008a46718c" ], "display_name": false }, { "uuid": "f4800589-a99b-48c9-8482-9ef2b2961386", "name": "NSC-10476", "stdName": "NSC-10476", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "802f5705-5dc7-49e6-832f-0c5e1eb80be9" ], "display_name": false }, { "uuid": "e83267d9-83a7-4884-a39c-c24d94f1bb44", "name": "RHODAMINE B STEARATE", "stdName": "RHODAMINE B STEARATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "62b4b1c6-0e14-482a-a899-af6d27c7ea60" ], "display_name": true }, { "uuid": "6161be6b-8d12-4034-9be5-041c5ef2c75c", "name": "RHODAMINE B-STEARATE", "stdName": "RHODAMINE B-STEARATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "fb610b38-281e-4128-8aa8-09008a46718c" ], "display_name": false }, { "uuid": "6488906e-71e3-4a7b-b3c9-0e159df7e7e5", "name": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3,6-BIS(DIETHYLAMINO)-, OCTADECANOATE", "stdName": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3,6-BIS(DIETHYLAMINO)-, OCTADECANOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "fb610b38-281e-4128-8aa8-09008a46718c" ], "display_name": false }, { "uuid": "a0781fd1-aa6d-459b-acd2-778be2841ec5", "name": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3,6-BIS(DIETHYLAMINO)-, OCTADECANOATE (1:1)", "stdName": "XANTHYLIUM, 9-(2-CARBOXYPHENYL)-3,6-BIS(DIETHYLAMINO)-, OCTADECANOATE (1:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4ad88bed-b0f0-4dab-9249-c014281e926e", "a3cbaab2-092c-441a-8d39-9a63fd541721" ], "display_name": false } ], "references": [ { "uuid": "fb610b38-281e-4128-8aa8-09008a46718c", "citation": "PCPC", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4ad88bed-b0f0-4dab-9249-c014281e926e", "citation": "PERSONAL CARE PRODUCTS COUNCIL", "doc_type": "PERSONAL CARE PRODUCTS COUNCIL", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "62b4b1c6-0e14-482a-a899-af6d27c7ea60", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a3cbaab2-092c-441a-8d39-9a63fd541721", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "802f5705-5dc7-49e6-832f-0c5e1eb80be9", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e4f2c599-d072-4c77-9ea2-668143eec9ad", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391420000, "tags": [ "NOMEN" ] }, { "uuid": "6311e960-8729-438a-81af-8b4a1de01383", "citation": "SRS import [P867J78P1Y]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P867J78P1Y", "doc_type": "SRS", "public_domain": true, "document_date": 1493391420000, "tags": [ "NOMEN" ] }, { "uuid": "b552d3b9-55e4-4eec-9bde-453938636b25", "citation": "AKA215 [INCI]", "doc_type": "SRS_LOCATOR", "public_domain": true }, { "uuid": "0de38422-3ff4-7629-6011-0d177e894faa", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "0b906d67-ae91-42ef-a99e-6bc78662aacd", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "a80655f6-7fee-59c8-a457-f68be587c2fe", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "50e13d16-c6a1-1cbf-d6ed-1314a4d00897", "citation": "21CFR81.10", "doc_type": "CFR", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "98cd3560-2262-b4e7-dad8-afa236ba2388", "citation": "CFR", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7ea3b572-4f4e-81b7-703b-8e6f78a02a72", "citation": "CFR", "doc_type": "CFR", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "57468a45-1420-8cac-da70-2ff28a5d4b1f", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394622000, "tags": [ "NOMEN" ] }, { "uuid": "cbf877b4-1c81-a845-d486-3f0da60b44fe", "citation": "SRS import [[ingredient] 0046322AA]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=[ingredient] 0046322AA", "doc_type": "SRS", "public_domain": true, "document_date": 1493394622000, "tags": [ "NOMEN" ] }, { "uuid": "94fc66de-71ce-933a-cda9-dc220ab7fdc9", "citation": "SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "6c0e954e-5999-470c-5831-16bb91f8166b", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=6373-07-5", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "9fde1601-626f-4a9f-9403-ce09b26081f2", "citation": "SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "fd2a7d25-520e-3c8a-9a43-a3c15e33fd01", "citation": "NCI", "doc_type": "NCI DRUG DICTIONARY", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f02f9373-e68c-4a17-9a20-68f6e453ea21", "id": "f02f9373-e68c-4a17-9a20-68f6e453ea21", "molfile": "\n Marvin 01132112282D \n\n 20 19 0 0 0 0 999 V2000\n -2.4038 -8.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.5788 -8.7662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.1663 -8.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3413 -8.0518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0712 -7.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8962 -7.3373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.3086 -6.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1337 -6.6228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5461 -5.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3711 -5.9084 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7836 -5.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6086 -5.1939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0211 -4.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8461 -4.4794 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2586 -3.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.0836 -3.7650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.4961 -3.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3211 -3.0505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7335 -3.7650 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 8.7335 -2.3361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\nM CHG 1 19 -1\nM END", "smiles": "CCCCCCCCCCCCCCCCCC(=O)[O-]", "formula": "C18H35O2", "atropisomerism": "No", "charge": -1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "f3c0e8cc-765d-476a-ad24-dffb322e7ed2" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "283.47", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "4435d0ac-de0a-4bf1-ba21-b908dc3d93ea", "id": "4435d0ac-de0a-4bf1-ba21-b908dc3d93ea", "molfile": "\n Marvin 01132103362D \n\n 33 36 0 0 0 0 999 V2000\n 0.0820 1.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7965 0.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7965 -0.1699 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0820 -0.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6325 -0.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5109 -0.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5109 -1.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2254 -1.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9398 -1.4073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6543 -1.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6543 -3.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9398 -3.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9398 -4.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6543 -4.8311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3688 -4.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3688 -3.5936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -3.1811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -2.3561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7977 -3.5936 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3688 -1.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -1.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7977 -1.4074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7977 -0.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0832 -0.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3688 -0.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6543 -0.1699 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9398 -0.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2253 -0.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5122 -0.1699 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 6.5122 0.6551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2266 1.0676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2266 -0.5824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9411 -0.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 6 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 28 6 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 9 27 2 0 0 0 0\n 10 11 1 0 0 0 0\n 10 20 2 0 0 0 0\n 11 12 1 0 0 0 0\n 11 16 2 0 0 0 0\n 12 13 2 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 17 19 2 0 0 0 0\n 20 21 1 0 0 0 0\n 20 25 1 0 0 0 0\n 21 22 2 0 0 0 0\n 22 23 1 0 0 0 0\n 24 23 1 0 0 0 0\n 23 29 2 0 0 0 0\n 25 24 2 0 0 0 0\n 25 26 1 0 0 0 0\n 27 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 32 1 0 0 0 0\n 30 31 1 0 0 0 0\n 32 33 1 0 0 0 0\nM CHG 1 29 1\nM END", "smiles": "CCN(CC)c1ccc2c(c1)oc-3cc(=[N+](CC)CC)ccc3c2-c4ccccc4C(=O)O", "formula": "C28H31N2O3", "atropisomerism": "No", "charge": 1, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "af0cd295-0f21-4aed-8d3c-c5469e62fa0b" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "443.5584", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "58bc6398-e016-43e3-a54b-e3d2d6663bc9", "version": "9", "structure": { "id": "6f59d33d-e1c9-4602-8e6c-4144a55763c1", "molfile": "\n JSDraw209272113062D\n\n 53 55 0 0 0 0 999 V2000\n 41.6397 -7.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.2887 -6.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.2887 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9377 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5869 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2360 -3.8999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 36.2360 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8850 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8850 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 33.5340 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.5869 -6.2397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.9379 -7.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.6397 -3.8999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 42.9907 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.9907 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.3415 -7.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 45.6926 -6.2399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 45.6926 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.3415 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 47.0436 -3.8999 0.0000 N 0 3 0 0 0 0 0 0 0 0 0 0\n 47.0436 -2.3400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 48.3944 -1.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 48.3944 -4.6799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 49.7454 -3.8999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.6397 -9.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 42.9907 -10.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.3415 -9.5937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.3415 -8.0337 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 45.6926 -10.3736 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 42.9907 -11.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.6397 -12.7136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.2887 -11.9336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 40.2887 -10.3736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 48.9040 -9.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 50.4639 -9.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 51.2437 -10.6977 0.0000 O 0 5 0 0 0 0 0 0 0 0 0 0\n 51.2437 -7.9959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 48.1240 -10.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 46.5640 -10.6977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 45.7841 -12.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 44.2241 -12.0486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 43.4441 -13.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.8842 -13.3996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 41.1042 -14.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 39.5443 -14.7506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 38.7645 -16.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 37.2043 -16.1014 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 36.4245 -17.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.8646 -17.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 34.0846 -18.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 32.5247 -18.8034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 31.7447 -20.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 30.1847 -20.1543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 19 18 1 0 0 0 0\n 14 19 2 0 0 0 0\n 18 20 2 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 20 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 1 15 2 0 0 0 0\n 1 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 29 2 0 0 0 0\n 26 30 2 0 0 0 0\n 30 31 1 0 0 0 0\n 32 31 2 0 0 0 0\n 33 32 1 0 0 0 0\n 25 33 2 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 6 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 5 1 0 0 0 0\n 12 11 2 0 0 0 0\n 2 12 1 0 0 0 0\n 3 13 1 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 34 35 1 0 0 0 0\n 35 36 1 0 0 0 0\n 35 37 2 0 0 0 0\n 34 38 1 0 0 0 0\n 38 39 1 0 0 0 0\n 39 40 1 0 0 0 0\n 40 41 1 0 0 0 0\n 41 42 1 0 0 0 0\n 42 43 1 0 0 0 0\n 43 44 1 0 0 0 0\n 44 45 1 0 0 0 0\n 45 46 1 0 0 0 0\n 46 47 1 0 0 0 0\n 47 48 1 0 0 0 0\n 48 49 1 0 0 0 0\n 49 50 1 0 0 0 0\n 50 51 1 0 0 0 0\n 51 52 1 0 0 0 0\n 52 53 1 0 0 0 0\nM CHG 2 20 1 36 -1\nM END", "smiles": "CCN(CC)c1ccc2c(c1)oc-3cc(=[N+](CC)CC)ccc3c2-c4ccccc4C(=O)O.CCCCCCCCCCCCCCCCCC(=O)[O-]", "formula": "C28H31N2O3.C18H35O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "727.0284", "optical_activity": "NONE", "references": [ "fb610b38-281e-4128-8aa8-09008a46718c", "6311e960-8729-438a-81af-8b4a1de01383" ], "stereo_centers": 0 }, "unii": "P867J78P1Y" } ] }