{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "203d3190-8395-4a71-acf5-332c1cfcfefc",
          "code": "23526-45-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23526-45-6",
          "code_system": "CAS",
          "references": [
            "8c2fdcb2-bd1e-4557-9681-d7b513c65648",
            "059c5635-e072-4582-bbac-34e5b6ebc81b"
          ]
        },
        {
          "uuid": "88ff0ff8-da7e-43e6-b5d8-9fa115788318",
          "code": "C525026",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67525026",
          "code_system": "MESH",
          "references": [
            "8c2fdcb2-bd1e-4557-9681-d7b513c65648"
          ]
        },
        {
          "uuid": "dc766902-6203-40c8-a8ae-0eeb3336b1f6",
          "code": "5280462",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5280462",
          "code_system": "PUBCHEM",
          "references": [
            "8c2fdcb2-bd1e-4557-9681-d7b513c65648"
          ]
        },
        {
          "uuid": "614dedde-4fe8-400a-9985-ef65a3bba5e2",
          "code": "P86438KC5J",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "95ffcab4-d9ed-405c-8d6c-6b8f325cb147",
          "code": "49164",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:49164",
          "code_system": "CHEBI",
          "references": [
            "2f71a4a7-a2ef-1dda-eb09-a754d325e97a"
          ]
        },
        {
          "uuid": "260278d0-2d20-907b-c772-24e9cd19c8ce",
          "code": "28258",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:28258",
          "code_system": "CHEBI",
          "references": [
            "2f71a4a7-a2ef-1dda-eb09-a754d325e97a"
          ]
        },
        {
          "uuid": "675a6c8e-1a04-b3b4-468f-a5b162bbe5c0",
          "code": "DTXSID601009964",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601009964",
          "code_system": "EPA CompTox",
          "references": [
            "2f71a4a7-a2ef-1dda-eb09-a754d325e97a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "93ebae56-f22b-4faf-9aeb-89e0c35921b2",
          "name": "(+)-BLUMENOL A",
          "stdName": "(+)-BLUMENOL A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "efc4ab19-0592-41f5-b92f-895ae55c859b",
          "name": "(+)-VOMIFOLIOL",
          "stdName": "(+)-VOMIFOLIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "67b4ab02-500d-4f02-9b0f-43bc76149265",
          "name": "(6S,7E,9R)-6,9-DIHYDROXY-4,7-MEGASTIGMADIEN-3-ONE",
          "stdName": "(6S,7E,9R)-6,9-DIHYDROXY-4,7-MEGASTIGMADIEN-3-ONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "97636d5b-381a-4d1c-b5d8-eb5049651f31",
          "name": "(6S,9R)-6-HYDROXY-3-OXO-.ALPHA.-IONOL",
          "stdName": "(6S,9R)-6-HYDROXY-3-OXO-.ALPHA.-IONOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "c7752b5d-7196-412d-aab5-99c6cf1ff7cb",
          "name": "(6S,9R)-VOMIFOLIOL",
          "stdName": "(6S,9R)-VOMIFOLIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "da9949cd-20b9-4e95-8a75-f21c1071f23f",
          "name": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-((1E,3R)-3-HYDROXY-1-BUTEN-1-YL)-3,5,5-TRIMETHYL-, (4S)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-((1E,3R)-3-HYDROXY-1-BUTEN-1-YL)-3,5,5-TRIMETHYL-, (4S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "7d104b86-10f3-4ee1-8028-afe1d2767b9a",
          "name": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-((1E,3R)-3-HYDROXY-1-BUTENYL)-3,5,5-TRIMETHYL-, (4S)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-((1E,3R)-3-HYDROXY-1-BUTENYL)-3,5,5-TRIMETHYL-, (4S)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "1859df6b-79aa-42e8-8fa5-95839684bad2",
          "name": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-(3-HYDROXY-1-BUTENYL)-3,5,5-TRIMETHYL-, (+)-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-(3-HYDROXY-1-BUTENYL)-3,5,5-TRIMETHYL-, (+)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "c10d761a-97c7-482d-9028-34c4f34f34fb",
          "name": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-(3-HYDROXY-1-BUTENYL)-3,5,5-TRIMETHYL-, (S-(R*,S*-(E)))-",
          "stdName": "2-CYCLOHEXEN-1-ONE, 4-HYDROXY-4-(3-HYDROXY-1-BUTENYL)-3,5,5-TRIMETHYL-, (S-(R*,S*-(E)))-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "76e37d63-d310-4f3d-beb9-f0e3524c8260",
          "name": "ROSEOSIDE AGLYCON",
          "stdName": "ROSEOSIDE AGLYCON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "8e246a08-8fa4-4049-a4e0-e7ebd2a5130e",
          "name": "VOMIFOLIOL",
          "stdName": "VOMIFOLIOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49383c8b-6598-4f59-964d-939bd2505b1d",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": false
        },
        {
          "uuid": "1f21f651-a712-4a56-92ed-1498b6f6089e",
          "name": "VOMIFOLIOL, (+)-",
          "stdName": "VOMIFOLIOL, (+)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b23f7b18-2560-4e4b-bbd3-0d4535d73dcc",
            "05f9a266-58b8-4a1a-9ea9-5dddb002faa9"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "b23f7b18-2560-4e4b-bbd3-0d4535d73dcc",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "05f9a266-58b8-4a1a-9ea9-5dddb002faa9",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49383c8b-6598-4f59-964d-939bd2505b1d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c2fdcb2-bd1e-4557-9681-d7b513c65648",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391498000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4670116b-cffe-4e76-a1f4-916bf1dad536",
          "citation": "SRS import [P86438KC5J]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P86438KC5J",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391498000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f71a4a7-a2ef-1dda-eb09-a754d325e97a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "059c5635-e072-4582-bbac-34e5b6ebc81b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "11463ae9-4a9a-4b0a-ad87-2864d56fe821",
          "id": "11463ae9-4a9a-4b0a-ad87-2864d56fe821",
          "molfile": "\n  Marvin  01132101072D          \n\n 16 16  0  0  1  0            999 V2000\n    8.2699   -5.2739    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    8.8954   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4230   -6.0845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4913   -5.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8658   -5.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0872   -5.2662    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.4911   -4.5469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9538   -6.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5921   -6.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1820   -6.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5437   -5.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7719   -6.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6771   -5.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4488   -4.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0744   -4.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0277   -4.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  1  0  0  0\n  4  1  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  8  6  1  0  0  0  0\n  6 14  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\nM  END",
          "smiles": "CC1=CC(=O)CC(C)(C)[C@]1(/C=C/[C@@H](C)O)O",
          "formula": "C13H20O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "31863042-72fc-4b7a-8ebc-c41dabe839d6"
          },
          "defined_stereo": 2,
          "ez_centers": 1,
          "molecular_weight": "224.2966",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "df2e9e1e-3392-4090-bcf2-75ea8a933f7e",
      "version": "5",
      "structure": {
        "id": "df85a2a1-fdff-4140-89d5-0cf91cd05016",
        "molfile": "\n  Marvin  01132111352D          \n\n 16 16  0  0  1  0            999 V2000\n    4.6771   -5.0352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4488   -4.7436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0744   -4.2057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0277   -4.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0872   -5.2662    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.4911   -4.5469    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8658   -5.5390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4913   -5.0011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2699   -5.2739    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.8954   -4.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4230   -6.0845    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9538   -6.0803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5921   -6.6030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1820   -6.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5437   -5.8493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7719   -6.1408    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  6  0  0  0\n  5  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  1  0  0  0\n 12  5  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 12  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n  1 15  1  0  0  0  0\nM  END",
        "smiles": "CC1=CC(=O)CC(C)(C)[C@]1(/C=C/[C@@H](C)O)O",
        "formula": "C13H20O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 1,
        "molecular_weight": "224.2966",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4670116b-cffe-4e76-a1f4-916bf1dad536",
          "49383c8b-6598-4f59-964d-939bd2505b1d"
        ],
        "stereo_centers": 2
      },
      "unii": "P86438KC5J"
    }
  ]
}