{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ee4519ae-ff01-457a-9ac8-2f27a5f9b45f", "code": "2315-61-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2315-61-9", "code_system": "CAS", "references": [ "9e5b3a9d-d89d-4629-b662-359a9ef732e4", "90d11584-5a3b-41e2-ad50-af2d2c64b94f" ] }, { "uuid": "1ae897a5-8b42-4fb7-87c6-e4ba35e7d387", "code": "24775", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/24775", "code_system": "PUBCHEM", "references": [ "9e5b3a9d-d89d-4629-b662-359a9ef732e4" ] }, { "uuid": "3e7668dc-b5b8-f3b1-e0fe-71fd052bed4a", "code": "DTXSID3075044", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3075044", "code_system": "EPA CompTox", "references": [ "4b40739c-8d3f-c574-bc65-72445e01fa03" ] }, { "uuid": "e920a57e-e49b-4148-ada5-8c4c54de0b23", "code": "P801HF8Z9A", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "1eb917bd-f060-4fd9-b692-7612fe7c75b5", "name": "DIETHYLENE GLYCOL 4-TERT-OCTYLPHENYL ETHER", "stdName": "DIETHYLENE GLYCOL 4-TERT-OCTYLPHENYL ETHER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "2349be27-e580-42bb-920c-9da4ebff314f" ], "display_name": false }, { "uuid": "ecc3235c-a7bb-42c7-adc8-3c4a77e9aac4", "name": "ETHANOL, 2-(2-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)ETHOXY)-", "stdName": "ETHANOL, 2-(2-(4-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)ETHOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "f9c919ee-ed52-4480-98d0-49e351317881" ], "display_name": false }, { "uuid": "1d45fd37-0b40-4442-a59e-4581f1f9cfde", "name": "ETHANOL, 2-(2-(P-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)ETHOXY)-", "stdName": "ETHANOL, 2-(2-(P-(1,1,3,3-TETRAMETHYLBUTYL)PHENOXY)ETHOXY)-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "f9c919ee-ed52-4480-98d0-49e351317881" ], "display_name": false }, { "uuid": "703d7a7f-4f3d-4df7-b070-bee74f0edc99", "name": "OCTOXYNOL-2", "stdName": "OCTOXYNOL-2", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "75e74392-1a12-49b5-8529-ad5e7996c553" ], "display_name": true } ], "references": [ { "uuid": "75e74392-1a12-49b5-8529-ad5e7996c553", "citation": "FDA_SRS", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "2349be27-e580-42bb-920c-9da4ebff314f", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "f9c919ee-ed52-4480-98d0-49e351317881", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "9e5b3a9d-d89d-4629-b662-359a9ef732e4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493390887000, "tags": [ "NOMEN" ] }, { "uuid": "51eaf8dd-7dc0-4429-9fd5-e1533daeb4d2", "citation": "SRS import [P801HF8Z9A]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P801HF8Z9A", "doc_type": "SRS", "public_domain": true, "document_date": 1493390887000, "tags": [ "NOMEN" ] }, { "uuid": "d69a0786-b284-4737-82b7-6e1596a443e0", "citation": "PCPC-DB", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4b40739c-8d3f-c574-bc65-72445e01fa03", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2315-61-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "90d11584-5a3b-41e2-ad50-af2d2c64b94f", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "f43e6305-d753-4085-9a98-cc1ab8cc7da3", "id": "f43e6305-d753-4085-9a98-cc1ab8cc7da3", "molfile": "\n Marvin 01132112402D \n\n 21 21 0 0 0 0 999 V2000\n 12.5822 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8677 -5.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8677 -6.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5822 -5.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1533 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4388 -5.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0264 -6.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8514 -6.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7243 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7244 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0099 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2954 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5810 -3.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8665 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1520 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4375 -4.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7231 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0086 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2941 -3.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2954 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0099 -5.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 2 4 1 0 0 0 0\n 5 2 1 0 0 0 0\n 6 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 8 1 0 0 0 0\n 9 6 1 0 0 0 0\n 9 10 1 0 0 0 0\n 21 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 20 2 0 0 0 0\n 14 13 1 0 0 0 0\n 15 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)OCCOCCO", "formula": "C18H30O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "87ca832a-69bd-4417-bee4-e604ebcdb7ef" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "294.4297", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "89209e68-7802-4611-8d84-cfc30c2728de", "version": "3", "structure": { "id": "fe0c6472-2f69-4e88-9ebc-4ee6d0ba7834", "molfile": "\n Marvin 01132113092D \n\n 21 21 0 0 0 0 999 V2000\n 5.4375 -4.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.1520 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.8665 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.5810 -3.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2954 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0099 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7244 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7243 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.4388 -5.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.1533 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8677 -5.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5822 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.8677 -6.1526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.5822 -5.7401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0264 -6.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8514 -6.0421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0099 -5.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.2954 -4.9151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7231 -3.6776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0086 -4.0901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2941 -3.6776 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 2 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 13 1 0 0 0 0\n 11 14 1 0 0 0 0\n 9 15 1 0 0 0 0\n 9 16 1 0 0 0 0\n 17 8 2 0 0 0 0\n 18 17 1 0 0 0 0\n 5 18 2 0 0 0 0\n 1 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CC(C)(C)CC(C)(C)c1ccc(cc1)OCCOCCO", "formula": "C18H30O3", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "294.4297", "optical_activity": "NONE", "references": [ "51eaf8dd-7dc0-4429-9fd5-e1533daeb4d2", "d69a0786-b284-4737-82b7-6e1596a443e0" ], "stereo_centers": 0 }, "unii": "P801HF8Z9A" } ] }