{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "73633df8-7f79-449d-a6e6-992d04708a56",
          "code": "A14AA09",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|norethandrolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A14AA09&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "f9ad001f-7f99-4c88-a28a-9bd7fb847ccc",
          "code": "QA14AA09",
          "comments": "VATC|ANABOLIC AGENTS FOR SYSTEMIC USE|ANABOLIC STEROIDS|Androstan derivatives|norethandrolone",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QA14AA09&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "fb07798b-dc1a-431f-bdbb-ed1502754c0a",
          "code": "52-78-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=52-78-8",
          "code_system": "CAS",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785",
            "1a8b4137-2da8-44b2-87e3-6bca8d202cfd"
          ]
        },
        {
          "uuid": "d47525df-c992-4b54-a13b-898a22bac9fb",
          "code": "D009639",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68009639",
          "code_system": "MESH",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "037a52fa-d15c-4552-b63b-e050ce806a51",
          "code": "NORETHANDROLONE",
          "comments": "LiverTox|HDS: Anabolic steroid|Body building|Anabolic steroid",
          "type": "PRIMARY",
          "url": "https://livertox.nlm.nih.gov/AndrogenicSteroids.htm",
          "code_system": "LIVERTOX",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "4671d378-0507-4d7e-b392-6c10e8c51997",
          "code": "664",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=664",
          "code_system": "INN",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "7dcb5df5-2484-4b1b-90d5-f9c23fd5550e",
          "code": "NORETHANDROLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Norethandrolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "2032c508-5842-4791-b7a9-52919c3306c1",
          "code": "200-153-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.140",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "37981a55-81fe-4933-91e8-92a24335dc56",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "0dd60bce-ad44-4c80-94cc-3d0797cf0de0",
          "code": "C80802",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C80802",
          "code_system": "NCI_THESAURUS",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "3595d579-c10b-4888-af4d-c90463832ae3",
          "code": "7513",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/7513/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "2cfdf5ba-1a28-4f6a-b0fe-275557c09654",
          "code": "m8055",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m8055?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "19c7a40d-2ec8-41ca-992a-923d7bfbc6d1",
          "code": "SUB09361MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "964fb77e-793e-452d-8558-fa557a61b6f0",
          "code": "CHEMBL1697845",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1697845",
          "code_system": "ChEMBL",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "f0310e92-3495-42a0-a344-2ba1016b5361",
          "code": "5858",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5858",
          "code_system": "PUBCHEM",
          "references": [
            "29426158-2e52-464f-aa3c-7122d8d61785"
          ]
        },
        {
          "uuid": "17247ad9-f3c5-62b8-de04-b233a4a784f2",
          "code": "DTXSID0023379",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0023379",
          "code_system": "EPA CompTox",
          "references": [
            "189a7d2f-e074-7a75-2d57-f2ebd7772875"
          ]
        },
        {
          "uuid": "a09af823-198e-c885-d207-8ddfe9a3954d",
          "code": "C243",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Therapeutic Steroid Hormone[C1636]|Therapeutic Androgen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C243",
          "code_system": "NCI_THESAURUS",
          "references": [
            "7d8b1a0d-53b7-cac4-7fe0-600a121aecde"
          ]
        },
        {
          "uuid": "a689be09-8a99-4ac6-b273-0611223b7c4f",
          "code": "P7W01638W6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "650aa4a9-70cc-a4ae-9b4b-3e213df288ab",
          "code": "1961",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1961",
          "code_system": "DRUG CENTRAL",
          "references": [
            "7d8b1a0d-53b7-cac4-7fe0-600a121aecde"
          ]
        },
        {
          "uuid": "975275f4-d9a3-08ea-f1a0-62ae3e38d59c",
          "code": "DB12787",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB12787",
          "code_system": "DRUG BANK",
          "references": [
            "7d8b1a0d-53b7-cac4-7fe0-600a121aecde"
          ]
        },
        {
          "uuid": "bfb2549e-714e-2cf9-db92-ce2a2c63827a",
          "code": "70581",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=70581",
          "code_system": "NSC",
          "references": [
            "a891b227-672c-c9ba-a495-1aeff9b04375"
          ]
        },
        {
          "uuid": "c006149c-503f-908d-2504-4191472456c7",
          "code": "100000083614",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1ea9c5b4-c956-9911-4e0a-267e70ede890"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "431095f9-5b20-4041-9ca1-515bbb5dbad8",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "0deec91f-b6ee-4e65-8491-919738052920",
            "refuuid": "e3496b15-5b02-457e-9d8e-b28081dfe31d",
            "name": "NORETHANDROLONE",
            "unii": "P7W01638W6",
            "linking_id": "P7W01638W6",
            "ref_pname": "NORETHANDROLONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6e6b25ba-4075-4465-a73d-83fd66a7de5e",
          "amount": {
            "uuid": "2c90a0fc-4270-48ce-9ede-aa00d611d215"
          },
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "12b8ee85-38fc-46be-b220-4e095fd7989a"
          ],
          "related_substance": {
            "uuid": "db270a1e-c0e9-4d50-ac8c-31ab078b9164",
            "refuuid": "20a19bbf-8c02-4880-8d09-dd9ecb58e188",
            "name": "3-OXO-5-ALPHA-STEROID 4-DEHYDROGENASE 1",
            "unii": "5RJT9C7KXH",
            "linking_id": "5RJT9C7KXH",
            "ref_pname": "3-OXO-5-ALPHA-STEROID 4-DEHYDROGENASE 1",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5e0ad51a-9a46-4ddc-a254-a9698504cfeb",
          "name": "17.ALPHA.-ETHYL-17.BETA.-HYDROXYESTR-4-EN-3-ONE",
          "stdName": "17.ALPHA.-ETHYL-17.BETA.-HYDROXYESTR-4-EN-3-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c374a4d-f876-4433-8716-18fca874f033"
          ],
          "display_name": false
        },
        {
          "uuid": "7812d055-252e-48c2-a5c0-349523b9180c",
          "name": "NILEVAR",
          "stdName": "NILEVAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b400ffe6-3a7e-4644-94e5-42673372a073"
          ],
          "display_name": false
        },
        {
          "uuid": "893f0c4e-9074-4bd0-b4af-5a90df6efa84",
          "name": "NORETHANDROLONE",
          "stdName": "NORETHANDROLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3799df1b-3c29-43ce-bb64-5cf96415383e",
            "90fea340-94a0-41de-be9c-86a59bf139b3",
            "85404c46-4fda-45d2-b640-4e4b167ea560",
            "03c8cea8-6722-4325-9860-f75285b7d8f3",
            "3dadd268-3848-4338-8f9f-19ffdceeab63",
            "3097fd48-3f20-4525-a9e8-7917d538873c",
            "30a42d16-bdbb-4c29-aac0-62b01f8cc04d",
            "987db336-34d6-4405-80ec-8db284aefc2d",
            "23505cd8-17d8-4b87-9874-900876b00c06"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a11e392a-a717-4851-a467-7e1e8c902e92",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "6d60a054-0402-47c6-af82-66e4bfc25f65",
          "name": "NORETHANDROLONE [MART.]",
          "stdName": "NORETHANDROLONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "987db336-34d6-4405-80ec-8db284aefc2d"
          ],
          "display_name": false
        },
        {
          "uuid": "effa4a66-0dfb-4b7e-8c4e-087e7aae067b",
          "name": "NORETHANDROLONE [MI]",
          "stdName": "NORETHANDROLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "30a42d16-bdbb-4c29-aac0-62b01f8cc04d"
          ],
          "display_name": false
        },
        {
          "uuid": "942b4a32-5734-43c7-ba41-876683bf3f4c",
          "name": "NSC-70581",
          "stdName": "NSC-70581",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "071e0c7b-6b85-45b5-931d-d36c92b01004"
          ],
          "display_name": false
        },
        {
          "uuid": "4d8c7017-5494-fe80-0ad3-0b87fbfdd1b8",
          "name": "Norethandrolone [WHO-DD]",
          "stdName": "NORETHANDROLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fba71b51-d8a2-ba60-fa1e-78591a220082"
          ],
          "display_name": false
        },
        {
          "uuid": "d530b030-3bbe-4832-900b-4cb561cb8bb3",
          "name": "PRONABOL",
          "stdName": "PRONABOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b400ffe6-3a7e-4644-94e5-42673372a073"
          ],
          "display_name": false
        },
        {
          "uuid": "97a36742-c705-4176-b766-efa6b959fa15",
          "name": "SOLEVAR",
          "stdName": "SOLEVAR",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b400ffe6-3a7e-4644-94e5-42673372a073"
          ],
          "display_name": false
        },
        {
          "uuid": "0327aafe-be66-4c60-a8b7-e18ab55e6f40",
          "name": "norethandrolone [INN]",
          "stdName": "NORETHANDROLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "90fea340-94a0-41de-be9c-86a59bf139b3"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "03c8cea8-6722-4325-9860-f75285b7d8f3",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7c374a4d-f876-4433-8716-18fca874f033",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "90fea340-94a0-41de-be9c-86a59bf139b3",
          "citation": "INN Proposed List 6",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL06.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "987db336-34d6-4405-80ec-8db284aefc2d",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "30a42d16-bdbb-4c29-aac0-62b01f8cc04d",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b400ffe6-3a7e-4644-94e5-42673372a073",
          "citation": "DEA LIST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3799df1b-3c29-43ce-bb64-5cf96415383e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "071e0c7b-6b85-45b5-931d-d36c92b01004",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "29426158-2e52-464f-aa3c-7122d8d61785",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389691000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bc6711e-37cd-4544-9f6f-0401b054ca31",
          "citation": "SRS import [P7W01638W6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P7W01638W6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389691000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c3574cb-9b67-44e7-a72f-220aa89185ea",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23505cd8-17d8-4b87-9874-900876b00c06",
          "citation": "NORETHANDROLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3097fd48-3f20-4525-a9e8-7917d538873c",
          "citation": "NORETHANDROLONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "85404c46-4fda-45d2-b640-4e4b167ea560",
          "citation": "NORETHANDROLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3dadd268-3848-4338-8f9f-19ffdceeab63",
          "citation": "NORETHANDROLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "189a7d2f-e074-7a75-2d57-f2ebd7772875",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52-78-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7d8b1a0d-53b7-cac4-7fe0-600a121aecde",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "1a8b4137-2da8-44b2-87e3-6bca8d202cfd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a58aaef6-9944-41e0-b6cc-7c1bd1441f13",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2f781a82-e7ba-4301-a625-6502a53de3fb",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/5%CE%B1-Dihydronorethandrolone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "12b8ee85-38fc-46be-b220-4e095fd7989a",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/5%CE%B1-Dihydronorethandrolone",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "fba71b51-d8a2-ba60-fa1e-78591a220082",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a891b227-672c-c9ba-a495-1aeff9b04375",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1ea9c5b4-c956-9911-4e0a-267e70ede890",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1d0ae37e-195d-4ae4-bdc6-fd815a833571",
          "id": "1d0ae37e-195d-4ae4-bdc6-fd815a833571",
          "molfile": "\n  Marvin  01132101412D          \n\n 22 25  0  0  1  0            999 V2000\n    1.8062   -0.1624    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    2.5900   -0.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0771    0.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5900    0.8980    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    2.5900    1.7275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3739    1.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9675    0.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8062    0.6595    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.7910    1.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0908    1.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3755    0.6595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3755   -0.1624    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   -0.3425   -0.5733    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -1.0578   -0.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7782   -0.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7782   -1.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4936   -1.8138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0578   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3425   -1.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3755   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0908   -1.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0908   -0.5733    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n  1  2  1  1  0  0  0\n  1  8  1  0  0  0  0\n 22  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  1  0  0  0\n  4  6  1  0  0  0  0\n  8  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  1  0  0  0\n  8 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  1  0  0  0\n 12 13  1  0  0  0  0\n 22 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 19  1  6  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 21  1  6  0  0  0\nM  END",
          "smiles": "CC[C@@]1(CC[C@H]2[C@@H]3CCC4=CC(=O)CC[C@@H]4[C@H]3CC[C@@]21C)O",
          "formula": "C20H30O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6c58faa0-11d9-4f90-bda3-d521d3c3039d"
          },
          "defined_stereo": 6,
          "ez_centers": 0,
          "molecular_weight": "302.4518",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 6
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e3496b15-5b02-457e-9d8e-b28081dfe31d",
      "version": "16",
      "structure": {
        "id": "ab2beb8d-c869-41fb-8a03-d048d7d58882",
        "molfile": "\n  Marvin  01132108532D          \n\n 26 29  0  0  1  0            999 V2000\n    1.8062    0.6595    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.8062   -0.1624    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.3425   -1.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0908   -0.5733    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.3755   -0.1624    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -0.3425   -0.5733    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   -1.0578   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5900    0.8980    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    1.0908    1.0781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3755    0.6595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0908   -1.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5900   -0.4186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0578   -0.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3755   -1.8138    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7782   -1.4028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0771    0.2562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4936   -1.8138    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7782   -0.5733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5900    1.7275    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7910    1.4231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3739    1.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9675    0.8955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7986   -1.0223    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3475    0.2562    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0883    0.2511    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3755   -0.8143    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  6  1  0  0  0  0\n  4  2  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  3  2  0  0  0  0\n  8  1  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  2  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 18  1  0  0  0  0\n 16  8  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 13  1  0  0  0  0\n  8 19  1  1  0  0  0\n  1 20  1  1  0  0  0\n  8 21  1  6  0  0  0\n 22 21  1  0  0  0  0\n  2 23  1  6  0  0  0\n  6 24  1  1  0  0  0\n  4 25  1  1  0  0  0\n  5 26  1  6  0  0  0\n 16 12  1  0  0  0  0\n  4  5  1  0  0  0  0\n 14  3  1  0  0  0  0\n 15  7  1  0  0  0  0\nM  END",
        "smiles": "CC[C@@]1(CC[C@@]2([H])[C@]3([H])CCC4=CC(=O)CC[C@]4([H])[C@@]3([H])CC[C@@]21C)O",
        "formula": "C20H30O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 6,
        "ez_centers": 0,
        "molecular_weight": "302.4518",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "0c3574cb-9b67-44e7-a72f-220aa89185ea",
          "5bc6711e-37cd-4544-9f6f-0401b054ca31",
          "90fea340-94a0-41de-be9c-86a59bf139b3"
        ],
        "stereo_centers": 6
      },
      "unii": "P7W01638W6"
    }
  ]
}