{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "be47f972-5f87-4b97-9c36-9d78517043be", "code": "10340-42-8", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=10340-42-8", "code_system": "CAS", "references": [ "e58e3a73-41dd-4bea-919b-ae8c9b1c6c8b", "abfc2a2e-c00b-438e-a838-68203f71e482" ] }, { "uuid": "7c44aa2b-9b43-4295-a95c-69dd6cf59501", "code": "233-736-8", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.657", "code_system": "ECHA (EC/EINECS)", "references": [ "e58e3a73-41dd-4bea-919b-ae8c9b1c6c8b" ] }, { "uuid": "c5637672-3607-4ba0-abd6-12721195e8af", "code": "82557", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82557", "code_system": "PUBCHEM", "references": [ "e58e3a73-41dd-4bea-919b-ae8c9b1c6c8b" ] }, { "uuid": "c1e22872-42bb-a797-e577-ad8fc9583327", "code": "DTXSID90145818", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90145818", "code_system": "EPA CompTox", "references": [ "042eefd4-9c2a-4713-9977-582652de7c08" ] }, { "uuid": "f9fd4762-053c-4829-af79-026221876f8a", "code": "P6L32H24V3", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "abfc2a2e-c00b-438e-a838-68203f71e482" ] } ], "substance_class": "chemical", "names": [ { "uuid": "6220722a-9d96-4d23-a883-5d9e1b599c10", "name": "1,10-Bis(3-methylbutyl) decanedioate", "stdName": "1,10-BIS(3-METHYLBUTYL) DECANEDIOATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "abfc2a2e-c00b-438e-a838-68203f71e482" ], "display_name": false }, { "uuid": "4b461cd2-9d9c-4c59-9d5f-dcd14c59d583", "name": "Bis(3-methylbutyl) sebacate", "stdName": "BIS(3-METHYLBUTYL) SEBACATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "cbe2cd68-393a-4d3b-bfd2-19307ed1b9b7", "89ab9f80-179f-4c91-b77e-9d8a3aad683b" ], "display_name": true }, { "uuid": "62caf2fd-1785-4b48-8408-66b8ebba75cd", "name": "Decanedioic acid, 1,10-bis(3-methylbutyl) ester", "stdName": "DECANEDIOIC ACID, 1,10-BIS(3-METHYLBUTYL) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "abfc2a2e-c00b-438e-a838-68203f71e482" ], "display_name": false } ], "references": [ { "uuid": "cbe2cd68-393a-4d3b-bfd2-19307ed1b9b7", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "89ab9f80-179f-4c91-b77e-9d8a3aad683b", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e58e3a73-41dd-4bea-919b-ae8c9b1c6c8b", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393789000, "tags": [ "NOMEN" ] }, { "uuid": "042eefd4-9c2a-4713-9977-582652de7c08", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10340-42-8", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "abfc2a2e-c00b-438e-a838-68203f71e482", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d68a8cbc-4be5-4cc9-9c08-751663481fe9", "id": "d68a8cbc-4be5-4cc9-9c08-751663481fe9", "molfile": "\n Marvin 01132111072D \n\n 24 23 0 0 0 0 999 V2000\n -0.6338 -3.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6344 -4.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3537 -5.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0828 -5.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8041 -4.6278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5250 -5.0525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2373 -4.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2799 -3.7914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9672 -5.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6761 -4.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4059 -5.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1184 -4.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8483 -5.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5551 -4.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2850 -5.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9974 -4.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7274 -5.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7410 -5.8370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4362 -4.5962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1660 -5.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8785 -4.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6084 -4.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6222 -5.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3152 -4.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 0 0 0 0\n 2 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 8 7 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 18 17 2 0 0 0 0\n 19 17 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 24 22 1 0 0 0 0\nM END", "smiles": "CC(C)CCOC(=O)CCCCCCCCC(=O)OCCC(C)C", "formula": "C20H38O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "c549be3a-cf51-4af8-bebf-46535ff72f0f" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "342.5141", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e1a0db2b-3ecd-4da1-b660-544c0e293351", "version": "5", "structure": { "id": "4413a95a-a73d-4df2-ba95-4be0f548037e", "molfile": "\n Marvin 01132103352D \n\n 24 23 0 0 0 0 999 V2000\n 1.5250 -5.0525 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.8041 -4.6278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0828 -5.0281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6344 -4.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.6338 -3.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.3537 -5.0023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2373 -4.6340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7274 -5.0142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.7410 -5.8370 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2799 -3.7914 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.4362 -4.5962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.1660 -5.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9974 -4.6053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9672 -5.0429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.8785 -4.5891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6084 -4.9980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6761 -4.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2850 -5.0212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5551 -4.6123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8483 -5.0267 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1184 -4.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4059 -5.0338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6222 -5.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3152 -4.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5 4 1 0 0 0 0\n 6 4 1 0 0 0 0\n 1 7 1 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 7 14 1 0 0 0 0\n 9 8 2 0 0 0 0\n 10 7 2 0 0 0 0\n 11 8 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 8 1 0 0 0 0\n 14 17 1 0 0 0 0\n 15 12 1 0 0 0 0\n 16 15 1 0 0 0 0\n 17 22 1 0 0 0 0\n 18 13 1 0 0 0 0\n 19 18 1 0 0 0 0\n 20 19 1 0 0 0 0\n 21 20 1 0 0 0 0\n 22 21 1 0 0 0 0\n 23 16 1 0 0 0 0\n 24 16 1 0 0 0 0\nM END", "smiles": "CC(C)CCOC(=O)CCCCCCCCC(=O)OCCC(C)C", "formula": "C20H38O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "342.5141", "optical_activity": "NONE", "references": [ "cbe2cd68-393a-4d3b-bfd2-19307ed1b9b7" ], "stereo_centers": 0 }, "unii": "P6L32H24V3" } ] }