{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bbb2c95c-3ec5-66aa-166a-fe58d0c30ece",
          "code": "11173230",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11173230",
          "code_system": "PUBCHEM",
          "references": [
            "e619537d-e0fb-613d-cdad-7758a98b9323"
          ]
        },
        {
          "uuid": "236df11d-797e-4f1d-97fc-50d48b66ccfe",
          "code": "34499",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=34499",
          "code_system": "NSC",
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ]
        },
        {
          "uuid": "a08b51ae-388a-45ad-8e84-a2ab6a2c23aa",
          "code": "6519-67-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=6519-67-1",
          "code_system": "CAS",
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ]
        },
        {
          "uuid": "d00c9e86-082e-467b-be1f-fd02e3803b2b",
          "code": "P57ZK52SQ9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "d5c26d00-9800-4725-98c2-3fd750791608",
          "amount": {
            "uuid": "e691c608-a5b4-4397-912a-194d0326e07d"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "related_substance": {
            "uuid": "730f245b-6cca-4926-8d46-70ff520249e5",
            "refuuid": "e7b4475d-126d-4c25-9840-45b4595ba244",
            "name": "Ethyl tryptophanate hydrochloride",
            "unii": "Q96A44MQ87",
            "linking_id": "Q96A44MQ87",
            "ref_pname": "Ethyl tryptophanate hydrochloride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "1c251b00-2001-40b9-9a43-d4a7acc33d96",
          "amount": {
            "uuid": "687b4bc7-4da8-4506-9d41-ce41974d4f68"
          },
          "type": "ENANTIOMER->RACEMATE",
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "related_substance": {
            "uuid": "b00acb18-8e6e-411c-b976-1a1d782e6dc5",
            "refuuid": "1df55a4d-3df0-47cd-845e-6bcdbd0135a9",
            "name": "Ethyl D-tryptophanate hydrochloride",
            "unii": "M8J3VM9W79",
            "linking_id": "M8J3VM9W79",
            "ref_pname": "Ethyl D-tryptophanate hydrochloride",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ff96da2a-ed21-42f5-adbe-6a7cd990734e",
          "amount": {
            "uuid": "cbf9b8c9-9ab8-4c20-b9aa-3282758316a0"
          },
          "type": "PARENT->SALT/SOLVATE",
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "related_substance": {
            "uuid": "f3d84ef2-a181-4501-aaf0-4346cc6be3c7",
            "refuuid": "94192d27-393d-427f-915c-0f51f3efa21b",
            "name": "Ethyl DL-tryptophanate",
            "unii": "U4U6385NKL",
            "linking_id": "U4U6385NKL",
            "ref_pname": "Ethyl DL-tryptophanate",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c4db416f-0428-4b12-bac2-c4841f9bccd4",
          "name": "DL-Tryptophan, ethyl ester, hydrochloride (1:1)",
          "stdName": "DL-TRYPTOPHAN, ETHYL ESTER, HYDROCHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "display_name": false
        },
        {
          "uuid": "f36d1ab1-2f15-41a4-921f-48ea97a38e28",
          "name": "DL-Tryptophan, ethyl ester, monohydrochloride",
          "stdName": "DL-TRYPTOPHAN, ETHYL ESTER, MONOHYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "display_name": false
        },
        {
          "uuid": "8bbfd233-908e-4eab-b283-65861b278190",
          "name": "Ethyl DL-tryptophanate hydrochloride",
          "stdName": "ETHYL DL-TRYPTOPHANATE HYDROCHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "display_name": true
        },
        {
          "uuid": "337cdc4a-d842-44d1-ac68-183c48537a00",
          "name": "NSC-34499",
          "stdName": "NSC-34499",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "display_name": false
        },
        {
          "uuid": "548a0b17-5b99-4848-8eda-64b41aea89f0",
          "name": "Tryptophan, ethyl ester, monohydrochloride, DL-",
          "stdName": "TRYPTOPHAN, ETHYL ESTER, MONOHYDROCHLORIDE, DL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "851fea62-628f-4e1d-bd8b-743169467780"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "e619537d-e0fb-613d-cdad-7758a98b9323",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "851fea62-628f-4e1d-bd8b-743169467780",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "5ae3869f-585a-4343-9c09-dd5d0ae4dcf2",
          "id": "5ae3869f-585a-4343-9c09-dd5d0ae4dcf2",
          "molfile": "\n  Marvin  09272304422D          \n\n 17 18  0  0  0  0            999 V2000\n   13.0586   -3.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8826   -3.8111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.3289   -3.1173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.2603   -4.5446    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1529   -3.1569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9513   -2.3838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5993   -2.4631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.4233   -2.5028    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7885   -4.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6122   -4.4653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.5784   -5.3098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.2027   -3.9311    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.9111   -5.2342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2722   -5.7562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7825   -5.5267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4067   -4.1480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1966   -4.9459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 10 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  2  0  0  0  0\n 12 16  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 17  2  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C(Cc1c[nH]c2ccccc12)N",
          "formula": "C13H16N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "c3ce97a1-7332-42a2-9c5d-05de41473e7e"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "232.2788",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        },
        {
          "uuid": "397691d8-1d90-48ec-8119-639251ad5e2a",
          "id": "397691d8-1d90-48ec-8119-639251ad5e2a",
          "molfile": "\n  Marvin  09272304422D          \n\n  1  0  0  0  0  0            999 V2000\n   16.9400   -4.3083    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "65860e4c-b843-40ae-bc41-d12af5d00de3"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e6a9440e-e6c0-4f69-8465-f98b27d7aec9",
      "version": "5",
      "structure": {
        "id": "88b691d2-7469-4aea-8665-a1de63ed3ee7",
        "molfile": "L-Tryptophan, ethyl ester\n   JSDraw209272304422D\n\n 18 18  0  0  0  0              0 V2000\n   24.6926   -7.1315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.2508   -7.2065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.0948   -5.8945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.9650   -8.5935    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6528   -5.9695    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3807   -4.5076    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   29.4969   -4.6575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.0551   -4.7325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   22.2910   -8.5318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.8485   -8.4435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.8938  -10.0403    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.1833   -7.4334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   24.4138   -9.8975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.2057  -10.8844    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   20.3887  -10.4505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.6781   -7.8436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.2809   -9.3523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.0320   -8.1467    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 10  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  3  6  2  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  2  0  0  0  0\n 10 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 11 15  2  0  0  0  0\n 12 16  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 17  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C(Cc1c[nH]c2ccccc12)N.Cl",
        "formula": "C13H16N2O2.ClH",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "268.7397",
        "optical_activity": "( + / - )",
        "references": [
          "851fea62-628f-4e1d-bd8b-743169467780"
        ],
        "stereo_centers": 1
      },
      "unii": "P57ZK52SQ9"
    }
  ]
}