{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c723f2e1-718e-4d1a-bb48-551ce8f261b9",
          "code": "10161-33-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10161-33-8",
          "code_system": "CAS",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc",
            "62c9395a-c333-4008-b80c-374e89d99cee"
          ]
        },
        {
          "uuid": "e1fe9026-a5d2-4ffb-9b1c-fd75ef4b863d",
          "code": "C95072",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C95072",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "5ee8734a-10af-4574-b80f-364c0d09945b",
          "code": "TRENBOLONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Trenbolone",
          "code_system": "WIKIPEDIA",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "2f3c2ef3-b311-44b3-ae1e-bfae5b6e8ae6",
          "code": "2916",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=2916",
          "code_system": "INN",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "faca4584-86ae-4c75-b946-3033ad664d22",
          "code": "4000",
          "comments": "PART 1308 -- SCHEDULES OF CONTROLLED SUBSTANCES|Sec. 1308.11 Schedule III.|Anabolic Steroids",
          "type": "PRIMARY",
          "url": "http://www.ecfr.gov/cgi-bin/text-idx?rgn=div5&node=21:9.0.1.1.9#se21.9.1308_111",
          "code_system": "DEA NO.",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "586a272b-5d2b-4a23-993b-dd72369d571b",
          "code": "1484278",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1484278/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "86fda63a-472d-4647-99fc-56ed6372fdb8",
          "code": "m11015",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11015?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "2f77af38-b9c7-4fcf-a41d-0f8ba0f7ea00",
          "code": "SUB11232MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "64f872ee-3a25-4e96-bb2f-abf48366eaf2",
          "code": "21 CFR 556.739",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 556 -- TOLERANCES FOR RESIDUES OF NEW ANIMAL DRUGS IN FOOD|Subpart B--Specific Tolerances for Residues of New Animal Drugs|Sec. 556.739 Trenbolone.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=556.739",
          "code_system": "CFR",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "dbeb07ec-4fab-4b86-a7f2-70099b895853",
          "code": "CHEMBL1698011",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1698011",
          "code_system": "ChEMBL",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "34611569-ae99-40a7-b7e6-e21ba5165b47",
          "code": "25015",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/25015",
          "code_system": "PUBCHEM",
          "references": [
            "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc"
          ]
        },
        {
          "uuid": "9a9243f5-7d6a-e661-f7f8-8d4ac6b79f2e",
          "code": "DTXSID0034192",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0034192",
          "code_system": "EPA CompTox",
          "references": [
            "96bcee28-f2fc-3c20-7159-9eed2ce49e2e"
          ]
        },
        {
          "uuid": "65241c0e-c217-a4ad-3506-3e3feb95fa4d",
          "code": "C2360",
          "comments": "Pharmacologic Substance[C1909]|Hormone Therapy Agent[C147908]|Therapeutic Hormone[C548]|Anabolic Steroid",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C2360",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ff7140da-5428-a933-cdff-2dc18ae266f4"
          ]
        },
        {
          "uuid": "5a52e505-ea66-4a27-952a-24e898c0bcfb",
          "code": "P53R4420TR",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c5d3ba65-7879-135d-9e31-d64ea2c81458",
          "code": "DB11551",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11551",
          "code_system": "DRUG BANK",
          "references": [
            "ff7140da-5428-a933-cdff-2dc18ae266f4"
          ]
        },
        {
          "uuid": "469fe435-4db3-d1f8-932d-eb488f5ad2a4",
          "code": "Designer-drugs-Trenbolone",
          "comments": "Wikipedia|List of designer drugs|Androgens|Estranes",
          "type": "CONCEPT",
          "url": "https://en.wikipedia.org/wiki/List_of_designer_drugs",
          "code_system": "WIKIPEDIA",
          "references": [
            "ff7140da-5428-a933-cdff-2dc18ae266f4"
          ]
        },
        {
          "uuid": "5e208fbc-ba39-a665-2831-7a43722a63a4",
          "code": "P53R4420TR",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=P53R4420TR",
          "code_system": "DAILYMED",
          "references": [
            "1b6b4110-4093-fc04-2589-fc9da236a166"
          ]
        },
        {
          "uuid": "72f52089-06df-6265-8e71-ccd2baab607c",
          "code": "100000077481",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "edda9200-28c6-32f2-088a-1b290e2d54a3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "6bd85120-94f6-4a9a-886e-cfa116f2505c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ed791796-c910-4d9e-8f08-1676a8e1204d",
            "refuuid": "e15b03ca-5d20-4acd-973e-0aa88a7c49e0",
            "name": "TRENBOLONE",
            "unii": "P53R4420TR",
            "linking_id": "P53R4420TR",
            "ref_pname": "TRENBOLONE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cb4e62b9-330a-4396-9d58-4f3059e8e11a",
          "amount": {
            "uuid": "138fa057-b277-4acf-9d7c-09de622f5436"
          },
          "type": "PRODRUG->METABOLITE ACTIVE",
          "references": [
            "1ec42edb-90d2-48f8-a40b-0e10ac0d78e1"
          ],
          "related_substance": {
            "uuid": "09fc35b5-cc28-435a-aa6c-e95ce5b8c2fc",
            "refuuid": "93a443d7-b47d-439a-80b3-55bcad06e8d4",
            "name": "TRENDIONE",
            "unii": "7M9J4CV848",
            "linking_id": "7M9J4CV848",
            "ref_pname": "TRENDIONE"
          }
        },
        {
          "uuid": "55333200-fdce-4d4f-a757-17ab72c66a96",
          "amount": {
            "uuid": "453fa301-31f7-4b91-b0e5-ea66c110e65f"
          },
          "type": "METABOLITE INACTIVE->PARENT",
          "references": [
            "6af7e644-2c83-4f4a-8110-1a95b25280a6"
          ],
          "related_substance": {
            "uuid": "cc4059e1-35cb-44a3-82a4-11803ee14396",
            "refuuid": "93a443d7-b47d-439a-80b3-55bcad06e8d4",
            "name": "TRENDIONE",
            "unii": "7M9J4CV848",
            "linking_id": "7M9J4CV848",
            "ref_pname": "TRENDIONE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bdb39227-8321-49f3-81db-87788a9e0df2",
          "name": "17BETA-TRENBOLONE",
          "stdName": "17BETA-TRENBOLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "714e74a8-b79f-4c0d-905d-8ab6ecdfb56e",
            "b42efdd8-2531-4456-b09d-3b955c126c70"
          ],
          "display_name": false
        },
        {
          "uuid": "c0085e96-94a1-4ec8-9e01-2005ff1d3d24",
          "name": "ESTRA-4,9,11-TRIEN-3-ONE, 17-HYDROXY-, (17.BETA.)-",
          "stdName": "ESTRA-4,9,11-TRIEN-3-ONE, 17-HYDROXY-, (17.BETA.)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c28c02c-fc90-4029-a8f5-20b81f0a5e46",
            "b42efdd8-2531-4456-b09d-3b955c126c70"
          ],
          "display_name": false
        },
        {
          "uuid": "31602f51-8658-4e0c-8cda-c6ea210c3dc8",
          "name": "RU-2341",
          "stdName": "RU-2341",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c28c02c-fc90-4029-a8f5-20b81f0a5e46",
            "b42efdd8-2531-4456-b09d-3b955c126c70"
          ],
          "display_name": false
        },
        {
          "uuid": "43becebd-3241-4de4-a3ed-f42cae2fd3eb",
          "name": "TRENBOLONE",
          "stdName": "TRENBOLONE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08b3019f-7c7f-45f7-8c6a-ce93dc2c027f",
            "e7f265c0-a48c-4923-bd0a-0230a6491b9d",
            "10e3fdde-a57c-4e18-a75f-5a4831bb71d6",
            "664c50e4-2f1a-4661-bbd6-7b33d94e9b05",
            "645783bd-1c4e-467b-883d-daef9805720e",
            "431db7ac-cd50-4919-85c1-ef4a6b002362",
            "b42efdd8-2531-4456-b09d-3b955c126c70",
            "caab683e-5bc7-488e-8fb6-681a997a1c21"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "85af0e2c-8e0f-42ac-8502-cdbf6e1ea734",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "82b86b4d-e70e-4a37-b6b1-c56354537e96",
          "name": "TRENBOLONE RELATED COMPOUND B",
          "stdName": "TRENBOLONE RELATED COMPOUND B",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2357c53c-dd60-47fb-8497-970abd1d5c18",
            "b42efdd8-2531-4456-b09d-3b955c126c70",
            "76ffe8c6-b4fe-4c7b-b923-44f2606a2702"
          ],
          "display_name": false
        },
        {
          "uuid": "4ac4e4fb-b1f9-c387-6014-f7e52698e317",
          "name": "TRENBOLONE RELATED COMPOUND B [USP IMPURITY]",
          "stdName": "TRENBOLONE RELATED COMPOUND B [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b42efdd8-2531-4456-b09d-3b955c126c70",
            "76ffe8c6-b4fe-4c7b-b923-44f2606a2702"
          ],
          "display_name": false
        },
        {
          "uuid": "1d3d4a94-c79d-493f-8d5b-f696265ba5a2",
          "name": "TRENBOLONE [MI]",
          "stdName": "TRENBOLONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "10e3fdde-a57c-4e18-a75f-5a4831bb71d6",
            "b42efdd8-2531-4456-b09d-3b955c126c70"
          ],
          "display_name": false
        },
        {
          "uuid": "db33a3e9-4f2c-4cff-bca5-abaa0d4b4513",
          "name": "TRIENBOLONE",
          "stdName": "TRIENBOLONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c28c02c-fc90-4029-a8f5-20b81f0a5e46",
            "b42efdd8-2531-4456-b09d-3b955c126c70"
          ],
          "display_name": false
        },
        {
          "uuid": "6b36df5d-5542-2266-6ba4-f791fc3e0b24",
          "name": "Trenbolone [WHO-DD]",
          "stdName": "TRENBOLONE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1f8b9804-4177-14f2-a2fe-f34d6587ac7e"
          ],
          "display_name": false
        },
        {
          "uuid": "ec35d9bb-deed-47be-bbce-5d9cbdaf9434",
          "name": "trenbolone [INN]",
          "stdName": "TRENBOLONE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e7f265c0-a48c-4923-bd0a-0230a6491b9d",
            "fcb3e210-d5cc-4e4b-92c3-f0c5491af36e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "431db7ac-cd50-4919-85c1-ef4a6b002362",
          "citation": "INN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b42efdd8-2531-4456-b09d-3b955c126c70",
          "citation": "INN",
          "doc_type": "INN",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c28c02c-fc90-4029-a8f5-20b81f0a5e46",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e7f265c0-a48c-4923-bd0a-0230a6491b9d",
          "citation": "INN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10e3fdde-a57c-4e18-a75f-5a4831bb71d6",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "645783bd-1c4e-467b-883d-daef9805720e",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "76ffe8c6-b4fe-4c7b-b923-44f2606a2702",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "714e74a8-b79f-4c0d-905d-8ab6ecdfb56e",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b907738-3c29-4a64-b8e2-5ec2c6b56bfc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390843000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6e5b8ef-a245-4206-b93d-7f90213a9e69",
          "citation": "SRS import [P53R4420TR]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P53R4420TR",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390843000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "caab683e-5bc7-488e-8fb6-681a997a1c21",
          "citation": "TRENBOLONE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "664c50e4-2f1a-4661-bbd6-7b33d94e9b05",
          "citation": "TRENBOLONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08b3019f-7c7f-45f7-8c6a-ce93dc2c027f",
          "citation": "TRENBOLONE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2357c53c-dd60-47fb-8497-970abd1d5c18",
          "citation": "TRENBOLONE RELATED COMPOUND B [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "96bcee28-f2fc-3c20-7159-9eed2ce49e2e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10161-33-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ff7140da-5428-a933-cdff-2dc18ae266f4",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "fcb3e210-d5cc-4e4b-92c3-f0c5491af36e",
          "citation": "INN Proposed List 24",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL24.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "62c9395a-c333-4008-b80c-374e89d99cee",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3c8807c9-7345-4b17-8262-3befabd3034a",
          "citation": "https://muzcle.com/trenavar/",
          "url": "https://muzcle.com/trenavar/",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "31d9d6d3-bc85-4634-aff0-192d036daf0b",
          "citation": "Khan, Bushra, and Linda S. Lee. \"Estrogens and synthetic androgens in manure slurry from trenbolone acetate/estradiol implanted cattle and in waste-receiving lagoons used for irrigation.\" Chemosphere 89.11 (2012): 1443-1449.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0045653512007990",
          "doc_type": "JA",
          "public_domain": true
        },
        {
          "uuid": "1f8b9804-4177-14f2-a2fe-f34d6587ac7e",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1b6b4110-4093-fc04-2589-fc9da236a166",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "edda9200-28c6-32f2-088a-1b290e2d54a3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1ec42edb-90d2-48f8-a40b-0e10ac0d78e1",
          "citation": "https://muzcle.com/trenavar/",
          "url": "https://muzcle.com/trenavar/",
          "doc_type": "WEB PAGE",
          "public_domain": true
        },
        {
          "uuid": "6af7e644-2c83-4f4a-8110-1a95b25280a6",
          "citation": "Khan, Bushra, and Linda S. Lee. \"Estrogens and synthetic androgens in manure slurry from trenbolone acetate/estradiol implanted cattle and in waste-receiving lagoons used for irrigation.\" Chemosphere 89.11 (2012): 1443-1449.",
          "url": "https://www.sciencedirect.com/science/article/pii/S0045653512007990",
          "doc_type": "JA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "bd819977-8776-4337-b84f-2bea5b5443d3",
          "id": "bd819977-8776-4337-b84f-2bea5b5443d3",
          "molfile": "\n  Marvin  01132109482D          \n\n 20 23  0  0  1  0            999 V2000\n    6.5976   -1.9579    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.8429   -1.1701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0906   -2.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6138   -3.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8261   -3.0472    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.1167   -3.4684    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.1267   -4.2934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4173   -4.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6978   -4.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9884   -4.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2690   -4.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5596   -4.7492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2590   -3.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9684   -3.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6878   -3.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3973   -3.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3873   -2.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0967   -1.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8161   -2.2223    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    5.8923   -1.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 19  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  1  0  0  0\n  6  5  1  0  0  0  0\n  5 19  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 16  1  6  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 15  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  1  1  0  0  0\nM  END",
          "smiles": "C[C@@]12C=CC3=C4CCC(=O)C=C4CC[C@H]3[C@@H]2CC[C@@H]1O",
          "formula": "C18H22O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2c9c5ca6-a8f9-47ad-8d2b-abcfd415032b"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "270.3668",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e15b03ca-5d20-4acd-973e-0aa88a7c49e0",
      "version": "19",
      "structure": {
        "id": "e146b624-ac37-4f5b-a41e-143e2cb1d0ac",
        "molfile": "\n  Marvin  01132111402D          \n\n 22 25  0  0  1  0            999 V2000\n    5.1267   -4.2934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1167   -3.4684    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    4.3973   -3.0646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6878   -3.4858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9684   -3.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2590   -3.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2690   -4.3281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5596   -4.7492    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9884   -4.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6978   -4.3107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4173   -4.7145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3873   -2.2397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0967   -1.8185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8161   -2.2223    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.8261   -3.0472    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.6138   -3.2926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0906   -2.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5976   -1.9579    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8429   -1.1701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9223   -3.8666    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8923   -1.4008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1067   -2.6434    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11  1  1  0  0  0  0\n  4 10  1  0  0  0  0\n  3 12  1  0  0  0  0\n 13 12  2  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n  2 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 14  1  0  0  0  0\n 18 19  1  1  0  0  0\n 15 20  1  6  0  0  0\n 14 21  1  1  0  0  0\n  2 22  1  1  0  0  0\nM  END",
        "smiles": "C[C@@]12C=CC3=C4CCC(=O)C=C4CC[C@@]3([H])[C@]2([H])CC[C@@H]1O",
        "formula": "C18H22O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "270.3668",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "431db7ac-cd50-4919-85c1-ef4a6b002362",
          "f6e5b8ef-a245-4206-b93d-7f90213a9e69",
          "fcb3e210-d5cc-4e4b-92c3-f0c5491af36e"
        ],
        "stereo_centers": 4
      },
      "unii": "P53R4420TR"
    }
  ]
}