{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "e487a788-0e20-494e-a325-df37a0e6b859",
          "code": "3739-67-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3739-67-1",
          "code_system": "CAS",
          "references": [
            "50ad0a85-13f3-440e-8d39-585480296a08",
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ]
        },
        {
          "uuid": "f1dca8bc-8ac1-4e08-af2d-07d6616836bd",
          "code": "223-123-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.021.022",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "50ad0a85-13f3-440e-8d39-585480296a08"
          ]
        },
        {
          "uuid": "0f40eba8-e1fd-4a13-9399-9cf86f75ee2f",
          "code": "77333",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/77333",
          "code_system": "PUBCHEM",
          "references": [
            "50ad0a85-13f3-440e-8d39-585480296a08"
          ]
        },
        {
          "uuid": "10889f5c-00a2-3117-2979-a410106e82da",
          "code": "DTXSID30863266",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30863266",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "796c3125-639a-46f1-8790-063a8342ac76",
          "code": "P47L73LDF8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "7c7c4703-1108-7470-a3e1-fe4a42c5fcc5",
          "code": "404194",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=404194",
          "code_system": "NSC",
          "references": [
            "e6719c8a-8843-d036-f280-cb3634696c2f"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "28a31ce2-6e45-46bd-9fac-7d359e268b98",
          "name": "1,1′-(1-Methylethylidene)bis[4-(2-propen-1-yloxy)benzene]",
          "stdName": "1,1'-(1-METHYLETHYLIDENE)BIS(4-(2-PROPEN-1-YLOXY)BENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "0e0cc285-5ff5-40bd-98e8-749c60e2fcee",
          "name": "1-Prop-2-enoxy-4-[2-(4-prop-2-enoxyphenyl)propan-2-yl]benzene",
          "stdName": "1-PROP-2-ENOXY-4-(2-(4-PROP-2-ENOXYPHENYL)PROPAN-2-YL)BENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "ad8aeaa5-7227-483e-9be2-bd43702d1536",
          "name": "2,2-Bis(4-allyloxyphenyl)propane",
          "stdName": "2,2-BIS(4-ALLYLOXYPHENYL)PROPANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "e80d0f67-7d9d-48f4-91e7-53b7a8df9479",
          "name": "4,4′-Isopropylidenebis[(allyloxy)benzene]",
          "stdName": "4,4'-ISOPROPYLIDENEBIS((ALLYLOXY)BENZENE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "14dc8d4e-2b49-452a-80d7-e958bf9c2197",
          "name": "B-303589",
          "stdName": "B-303589",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "fd84eff6-ed08-4d06-a4b9-2b80e8ecb41e",
          "name": "BENZENE, 1,1'-(1-METHYLETHYLIDENE)BIS(4-(2-PROPEN-1-YLOXY)-",
          "stdName": "BENZENE, 1,1'-(1-METHYLETHYLIDENE)BIS(4-(2-PROPEN-1-YLOXY)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ccb180d9-aa61-4c5f-bcb5-b97aa3ee78f3",
            "5d244001-cc6f-4365-af17-e807abc65077"
          ],
          "display_name": false
        },
        {
          "uuid": "f6aac43b-4a4d-4f94-abbf-d6359431cadb",
          "name": "BPA-AE",
          "stdName": "BPA-AE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "43e02486-6883-4f92-89b6-21591daccaed",
          "name": "Bisphenol A diallyl ether",
          "stdName": "BISPHENOL A DIALLYL ETHER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": true
        },
        {
          "uuid": "766a0c5d-8cc1-4b0e-98e7-f2cf60ed83cf",
          "name": "Homide 126A",
          "stdName": "HOMIDE 126A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "65f6b7a5-ef91-45a3-9371-c7f478e9dcb4",
          "name": "Matrimid 2292",
          "stdName": "MATRIMID 2292",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        },
        {
          "uuid": "f9a4270f-f2c5-4fd7-b1dd-9b030bfa81ca",
          "name": "NSC-404194",
          "stdName": "NSC-404194",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ccb180d9-aa61-4c5f-bcb5-b97aa3ee78f3",
            "5d244001-cc6f-4365-af17-e807abc65077"
          ],
          "display_name": false
        },
        {
          "uuid": "7a11be09-ae46-43b6-83d1-94c67b8a6c28",
          "name": "O,O-Diallylbisphenol A",
          "stdName": "O,O-DIALLYLBISPHENOL A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ccb180d9-aa61-4c5f-bcb5-b97aa3ee78f3",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d244001-cc6f-4365-af17-e807abc65077",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50ad0a85-13f3-440e-8d39-585480296a08",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493394085000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e6719c8a-8843-d036-f280-cb3634696c2f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b646caa8-b025-b2f2-4888-718f39f67639",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a44eae6a-0a6e-4637-9264-746ca8d940b2",
          "id": "a44eae6a-0a6e-4637-9264-746ca8d940b2",
          "molfile": "\n  Marvin  01132108322D          \n\n 23 24  0  0  0  0            999 V2000\n    0.6569    0.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6553   -0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1697   -0.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6537   -1.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0636   -1.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0636   -2.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6497   -2.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6460   -3.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3611   -4.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3565   -4.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0716   -5.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3629   -2.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3670   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8103   -0.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2231    0.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0438    0.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4588   -0.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2838   -0.4645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6974    0.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5181    0.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9312    0.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0461   -1.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2182   -1.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n 14  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n 13  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 14 23  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 22 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "C=CCOc1ccc(cc1)C(C)(C)c2ccc(cc2)OCC=C",
          "formula": "C21H24O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a83dc245-b865-4c9f-9fc7-c14272c2029b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "308.4148",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "69a02ef1-3ae6-4b87-89f7-16fabd4c7104",
      "version": "7",
      "structure": {
        "id": "ea2a46ae-5f19-487e-a75d-066650d35cf5",
        "molfile": "\n  Marvin  01132112072D          \n\n 23 24  0  0  0  0            999 V2000\n    4.2838   -0.4645    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4588   -0.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0438    0.2513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2231    0.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8103   -0.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2182   -1.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0461   -1.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6553   -0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6537   -1.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0636   -1.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0636   -2.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6497   -2.9363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6460   -3.7613    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3611   -4.1784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3565   -4.9991    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0716   -5.4162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3629   -2.5303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3670   -1.7025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6569    0.3622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1697   -0.4613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6974    0.2526    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5181    0.2522    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9312    0.9687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 12 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18  9  2  0  0  0  0\n  8 19  1  0  0  0  0\n  8 20  1  0  0  0  0\n  1 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\nM  END",
        "smiles": "C=CCOc1ccc(cc1)C(C)(C)c2ccc(cc2)OCC=C",
        "formula": "C21H24O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "308.4148",
        "optical_activity": "NONE",
        "references": [
          "ccb180d9-aa61-4c5f-bcb5-b97aa3ee78f3",
          "a949da47-a41d-4aaf-9a6c-c2ffbc5f29d8"
        ],
        "stereo_centers": 0
      },
      "unii": "P47L73LDF8"
    }
  ]
}