{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "1385c9e3-930a-49d3-862d-5b4e01d9c750", "code": "51556-30-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=51556-30-0", "code_system": "CAS", "references": [ "17ed8dac-625c-4119-a309-ebfcf06531f4", "c452eef6-9aa3-47ad-be5d-776d25773857" ] }, { "uuid": "e5b54d2a-4ed6-468c-be0f-f9b59689f73a", "code": "257-283-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.058", "code_system": "ECHA (EC/EINECS)", "references": [ "17ed8dac-625c-4119-a309-ebfcf06531f4" ] }, { "uuid": "347e4559-8a6b-4251-a8a0-b43928f42bf9", "code": "103904", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/103904", "code_system": "PUBCHEM", "references": [ "17ed8dac-625c-4119-a309-ebfcf06531f4" ] }, { "uuid": "09fb9386-eb86-862d-3df0-9164302a8281", "code": "DTXSID6068648", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6068648", "code_system": "EPA CompTox", "references": [ "ebb0b1eb-97a3-1ed9-5762-3043bcb01206" ] }, { "uuid": "a2af265d-7a18-4f55-a073-f97da9e0740e", "code": "P3MEU5J4BP", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "af3c9307-a23d-48eb-b33f-a5890e70f64e", "name": "1-BUTANONE, 3-METHYL-2-(1-METHYLETHYL)-1-PHENYL-", "stdName": "1-BUTANONE, 3-METHYL-2-(1-METHYLETHYL)-1-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "3c326a3f-3c2d-47fe-9db4-b9138f1627e7" ], "display_name": false }, { "uuid": "67bea88f-61f3-4c85-b941-74a10cced60f", "name": "2-ISOPROPYL-3-METHYLBUTYROPHENONE", "stdName": "2-ISOPROPYL-3-METHYLBUTYROPHENONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "a4f9ac96-1261-416c-a6c9-40733e354a5b" ], "display_name": true }, { "uuid": "b2418fc7-bb3b-47a5-9bcd-5a8e6363940c", "name": "3-METHYL-1-PHENYL-2-(PROPAN-2-YL)BUTAN-1-ONE", "stdName": "3-METHYL-1-PHENYL-2-(PROPAN-2-YL)BUTAN-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c452eef6-9aa3-47ad-be5d-776d25773857" ], "display_name": false }, { "uuid": "97b82377-dcbf-48d5-8fb8-1b8d569c0c0c", "name": "3-METHYL-2-(1-METHYLETHYL)-1-PHENYL-1-BUTANONE", "stdName": "3-METHYL-2-(1-METHYLETHYL)-1-PHENYL-1-BUTANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "c452eef6-9aa3-47ad-be5d-776d25773857" ], "display_name": false } ], "references": [ { "uuid": "3c326a3f-3c2d-47fe-9db4-b9138f1627e7", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "17ed8dac-625c-4119-a309-ebfcf06531f4", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392360000, "tags": [ "NOMEN" ] }, { "uuid": "ebb0b1eb-97a3-1ed9-5762-3043bcb01206", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=51556-30-0", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "c452eef6-9aa3-47ad-be5d-776d25773857", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "a4f9ac96-1261-416c-a6c9-40733e354a5b", "citation": "CHEMID", "doc_type": "CHEMID", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "ddc8f8e8-1698-47e9-9fee-366b91f0f4a9", "id": "ddc8f8e8-1698-47e9-9fee-366b91f0f4a9", "molfile": "\n Marvin 01132111302D \n\n 15 15 0 0 0 0 999 V2000\n 3.6269 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6314 -1.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4286 -2.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0469 -1.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6314 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6269 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3444 -0.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2231 -1.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2187 -0.5891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4304 -1.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -1.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -1.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -2.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4304 -2.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 4 5 1 0 0 0 0\n 8 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 5 7 1 0 0 0 0\n 8 9 2 0 0 0 0\n 10 8 1 0 0 0 0\n 10 11 1 0 0 0 0\n 15 10 2 0 0 0 0\n 12 11 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 14 15 1 0 0 0 0\nM END", "smiles": "CC(C)C(C(C)C)C(=O)c1ccccc1", "formula": "C14H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "179f82cb-4efd-4e17-8da0-e450502d3ba7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.3085", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "40bac6c6-40a1-4f0d-9715-8ecd64a680a6", "version": "8", "structure": { "id": "08db94c5-6f19-4dc7-8683-6baa03f229a4", "molfile": "\n Marvin 01132100442D \n\n 15 15 0 0 0 0 999 V2000\n 0.0000 -1.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -2.8742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4304 -2.4623 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4304 -1.6297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7129 -1.2223 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2231 -1.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2187 -0.5891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.0469 -1.4127 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6314 -1.9973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6269 -2.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4286 -2.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6314 -0.8237 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6269 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3444 -0.4075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 1 6 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 7 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 9 13 1 0 0 0 0\n 10 11 1 0 0 0 0\n 10 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 1 0 0 0 0\nM END", "smiles": "CC(C)C(C(C)C)C(=O)c1ccccc1", "formula": "C14H20O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.3085", "optical_activity": "NONE", "references": [ "3c326a3f-3c2d-47fe-9db4-b9138f1627e7" ], "stereo_centers": 0 }, "unii": "P3MEU5J4BP" } ] }