{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "8823b9af-412b-4a06-9c31-d003ca45a0be",
          "code": "95962-14-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=95962-14-4",
          "code_system": "CAS",
          "references": [
            "81103a92-9678-40cb-9d8d-36626e87a2e9",
            "ab19ac94-3860-4307-8cb9-9e17462cdb7e"
          ]
        },
        {
          "uuid": "108bfd75-e525-4093-9090-7b45e9de408f",
          "code": "175661",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/175661",
          "code_system": "PUBCHEM",
          "references": [
            "81103a92-9678-40cb-9d8d-36626e87a2e9"
          ]
        },
        {
          "uuid": "27bd9cf1-0f79-b131-8c5c-b730d35d90fa",
          "code": "DTXSID3052646",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3052646",
          "code_system": "EPA CompTox",
          "references": [
            "93c03be9-6597-c340-422a-ac1f81be1721"
          ]
        },
        {
          "uuid": "f10f6641-6265-6896-9706-8e9f122bee24",
          "code": "2395764",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/2395764/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "4ad9bf52-7a7f-65b7-20b4-2bb744429b62"
          ]
        },
        {
          "uuid": "b8c29feb-270b-409d-a777-7b041f01c7e5",
          "code": "P1K3Z8A8HJ",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "9faee82b-2432-f57e-7fac-e3afe69becb0",
          "code": "2-(2-(4-Methyl-3-cyclohexen-1-yl)propyl)cyclopentanone",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/2-(2-(4-Methyl-3-cyclohexen-1-yl)propyl)cyclopentanone",
          "code_system": "WIKIPEDIA",
          "references": [
            "83df7765-ecfb-cae4-94bb-48e8f5ad5aa2"
          ]
        },
        {
          "uuid": "45183fb0-24f0-d242-ab9f-1a4fa77e4b37",
          "code": "P1K3Z8A8HJ",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=P1K3Z8A8HJ",
          "code_system": "DAILYMED",
          "references": [
            "369c64fa-600f-bee6-bed4-c3b562f186bd"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1e0bdbb4-f25e-51a0-6fab-7f75f5d3143a",
          "name": "2-(2-(4-METHYL-3-CYCLOHEXEN-1-YL)PROPYL)CYCLOPENTANONE",
          "stdName": "2-(2-(4-METHYL-3-CYCLOHEXEN-1-YL)PROPYL)CYCLOPENTANONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86ca2847-fe9f-e978-3814-57d609162f88"
          ],
          "display_name": false
        },
        {
          "uuid": "d6b3063f-30d7-0af1-364f-6f7b2371f1f0",
          "name": "2-(2-(4-METHYLCYCLOHEX-3-EN-1-YL)PROPYL)CYCLOPENTAN-1-ONE",
          "stdName": "2-(2-(4-METHYLCYCLOHEX-3-EN-1-YL)PROPYL)CYCLOPENTAN-1-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86ca2847-fe9f-e978-3814-57d609162f88"
          ],
          "display_name": true
        },
        {
          "uuid": "5c05f11a-04e5-4e33-9d94-e4226365c297",
          "name": "CYCLOPENTANONE, 2-(2-(4-METHYL-3-CYCLOHEXEN-1-YL)PROPYL)-",
          "stdName": "CYCLOPENTANONE, 2-(2-(4-METHYL-3-CYCLOHEXEN-1-YL)PROPYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c11ca16a-c2f3-4483-80c6-244e17123fd7"
          ],
          "display_name": false
        },
        {
          "uuid": "9878a7ea-b157-9c21-e80f-534cb86db534",
          "name": "NECTARYL",
          "stdName": "NECTARYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86ca2847-fe9f-e978-3814-57d609162f88"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "c11ca16a-c2f3-4483-80c6-244e17123fd7",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "81103a92-9678-40cb-9d8d-36626e87a2e9",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392227000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "93c03be9-6597-c340-422a-ac1f81be1721",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=95962-14-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "86ca2847-fe9f-e978-3814-57d609162f88",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ab19ac94-3860-4307-8cb9-9e17462cdb7e",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "83df7765-ecfb-cae4-94bb-48e8f5ad5aa2",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "4ad9bf52-7a7f-65b7-20b4-2bb744429b62",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "369c64fa-600f-bee6-bed4-c3b562f186bd",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "be5249aa-2cd7-4c2d-880c-a2a5fcaf49d1",
          "id": "be5249aa-2cd7-4c2d-880c-a2a5fcaf49d1",
          "molfile": "\n  Marvin  01132109502D          \n\n 16 17  0  0  0  0            999 V2000\n    2.8569    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8513   -0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    3.5641   -1.2404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2825   -0.8307    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.9729   -0.3873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6127   -0.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3152   -1.6726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4958   -1.6277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9738   -2.2675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1384   -1.2348    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.1384   -2.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4257   -2.4696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7128   -2.0599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.4752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7128   -1.2348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4257   -0.8194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 10  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  8  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 16  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 15 13  2  0  0  0  0\n 15 16  1  0  0  0  0\nM  END",
          "smiles": "CC1=CCC(CC1)C(C)CC2CCCC2=O",
          "formula": "C15H24O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "050f7528-245c-4efd-89bd-ae50f92768ff"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "220.351",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "INCOMPLETE",
      "uuid": "a93b432c-6878-49e5-b797-2b686c88b789",
      "version": "8",
      "structure": {
        "id": "7871d1ab-83d2-46b2-b595-3c769e1ec6f9",
        "molfile": "\n  Marvin  01132106152D          \n\n 16 17  0  0  0  0            999 V2000\n   16.7531   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.5067   -4.0766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0588   -3.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6463   -2.7490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.8393   -2.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6783   -4.8835    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.0386   -4.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3242   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6096   -4.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.6096   -4.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8952   -5.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1806   -4.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1806   -4.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.8952   -3.7410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4662   -5.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.3242   -2.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  1  5  1  0  0  0  0\n  2  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n  9 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n  8 16  1  0  0  0  0\nM  END",
        "smiles": "CC1=CCC(CC1)C(C)CC2CCCC2=O",
        "formula": "C15H24O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "220.351",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "c11ca16a-c2f3-4483-80c6-244e17123fd7"
        ],
        "stereo_centers": 3
      },
      "unii": "P1K3Z8A8HJ"
    }
  ]
}