{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3c338523-6fe1-43f2-99cf-90b826dd58b4",
          "code": "2866-43-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2866-43-5",
          "code_system": "CAS",
          "references": [
            "f5b71e91-cdd2-4b52-a841-31e1161a2351",
            "ebdee96d-af63-4885-80f7-0f89873bd7ae"
          ]
        },
        {
          "uuid": "445c913e-6858-4506-90ed-655640de2a0c",
          "code": "220-685-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.018.805",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "f5b71e91-cdd2-4b52-a841-31e1161a2351"
          ]
        },
        {
          "uuid": "38af05ef-b12a-4a09-8f09-8dd598677d8e",
          "code": "17867",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/17867",
          "code_system": "PUBCHEM",
          "references": [
            "f5b71e91-cdd2-4b52-a841-31e1161a2351"
          ]
        },
        {
          "uuid": "58719d97-c8f6-6835-d28b-10bead659591",
          "code": "DTXSID8051966",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8051966",
          "code_system": "EPA CompTox",
          "references": [
            "0ac5a31f-64fd-d1fc-b279-ba593b1501b1"
          ]
        },
        {
          "uuid": "6f8ccf77-8e0f-40c5-b470-6e13ac9dbbe6",
          "code": "P104CN84X2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "50a59d78-5846-4e87-98b0-14a006042dbc",
          "name": "2,2'-(2,5-THIOPHENEDIYL)BIS(BENZOXAZOLE)",
          "stdName": "2,2'-(2,5-THIOPHENEDIYL)BIS(BENZOXAZOLE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "d9fc59a1-be03-4f81-8fa9-bcdf5f66673b",
          "name": "2,2'-THIOPHENE-2,5-DIYLBIS(BENZOXAZOLE)",
          "stdName": "2,2'-THIOPHENE-2,5-DIYLBIS(BENZOXAZOLE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6133997-ae5e-47cd-b07a-1ee9b11bd608"
          ],
          "display_name": false
        },
        {
          "uuid": "9f193755-e0b6-43d6-a891-f86383a130e3",
          "name": "2,5-BIS(2-BENZOXAZOLYL)THIOPHENE",
          "stdName": "2,5-BIS(2-BENZOXAZOLYL)THIOPHENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "75b92209-a4f8-44ec-b5ca-a9d93f712e0f",
          "name": "2,5-DI(BENZOXAZOL-2-YL)THIOPHENE",
          "stdName": "2,5-DI(BENZOXAZOL-2-YL)THIOPHENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "976ac22c-3c82-4166-b299-19c9a25942f5"
          ],
          "display_name": true
        },
        {
          "uuid": "2e175e9a-86a1-415f-99f9-d3aa148658d6",
          "name": "BENZOXAZOLE, 2,2'-(2,5-THIOPHENEDIYL)BIS-",
          "stdName": "BENZOXAZOLE, 2,2'-(2,5-THIOPHENEDIYL)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "528b70ef-6f53-4a86-ab5b-d0e79e30335d",
          "name": "C.I. 515240",
          "stdName": "C.I. 515240",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "372662fb-9da7-4a60-a68c-2be4247d57e5",
          "name": "C.I. FLUORESCENT BRIGHTENER 172",
          "stdName": "C.I. FLUORESCENT BRIGHTENER 172",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "5cf06a0f-98a2-42e1-a88e-d208698ee9c3",
          "name": "C.I. FLUORESCENT BRIGHTENING AGENT 185",
          "stdName": "C.I. FLUORESCENT BRIGHTENING AGENT 185",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "3cc02983-9cd2-4b1e-9163-276e3b9a028d",
          "name": "SOF (FLUORESCENT BRIGHTENER)",
          "stdName": "SOF (FLUORESCENT BRIGHTENER)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "fa560f69-0b48-4e36-8562-531d666ebf48",
          "name": "THIOPHENEBIS(BENZOXAZOLYL)",
          "stdName": "THIOPHENEBIS(BENZOXAZOLYL)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "021f2083-0cab-4ee8-92c6-efeadd39951f",
          "name": "TINOPAL SOP",
          "stdName": "TINOPAL SOP",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        },
        {
          "uuid": "92280ad7-2925-46e6-b361-e341b55fcd73",
          "name": "UVITEX EBF",
          "stdName": "UVITEX EBF",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e88e6431-8a54-49c8-834e-2c1610ca9faf"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "976ac22c-3c82-4166-b299-19c9a25942f5",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e88e6431-8a54-49c8-834e-2c1610ca9faf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6133997-ae5e-47cd-b07a-1ee9b11bd608",
          "citation": "http://echa.europa.eu/substance-information/-/substanceinfo/100.018.805",
          "url": "http://echa.europa.eu/substance-information/-/substanceinfo/100.018.805",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5b71e91-cdd2-4b52-a841-31e1161a2351",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392233000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ac3b1ac-2aa6-4243-a1ff-6164c8f05442",
          "citation": "SRS import [P104CN84X2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P104CN84X2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392233000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0ac5a31f-64fd-d1fc-b279-ba593b1501b1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2866-43-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ebdee96d-af63-4885-80f7-0f89873bd7ae",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "79ea8b55-4f49-4772-996d-63c955b08657",
          "id": "79ea8b55-4f49-4772-996d-63c955b08657",
          "molfile": "\n  Marvin  01132106202D          \n\n 23 27  0  0  0  0            999 V2000\n    4.5287    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7008    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4524   -0.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1230   -1.2501    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7936   -0.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5802   -0.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2425   -0.4637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9213   -0.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7410   -0.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2791   -1.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0226   -2.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2029   -2.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6648   -1.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8368   -1.7470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6824   -1.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9870   -0.5216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3412   -1.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5216   -0.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2732   -2.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0846   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6228   -1.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4507   -1.7883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  5  1  2  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n 15  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 14  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 23  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)nc(-c3ccc(-c4nc5ccccc5o4)s3)o2",
          "formula": "C18H10N2O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "559ade85-c219-48a6-baf8-7f93a42f5ab1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "318.351",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5611c774-0101-4cf9-941e-bad34133d0c3",
      "version": "3",
      "structure": {
        "id": "97e4ed6f-e6c8-41c6-86c2-7c26079431cc",
        "molfile": "\n  Marvin  01132107532D          \n\n 23 27  0  0  0  0            999 V2000\n    2.6824   -1.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5802   -0.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9870   -0.5216    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2425   -0.4637    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4524   -0.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7936   -0.7534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1230   -1.2501    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4507   -1.7883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8368   -1.7470    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5287    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7008    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3412   -1.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9213   -0.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6228   -1.8049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6648   -1.7387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5216   -0.8858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7410   -0.7948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0846   -2.4423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2029   -2.3678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.5151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2732   -2.2933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0226   -2.2022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2791   -1.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  2  0  0  0  0\n  1  5  1  0  0  0  0\n  1  8  1  0  0  0  0\n  2  6  1  0  0  0  0\n  2  4  2  0  0  0  0\n  2  9  1  0  0  0  0\n  3 12  1  0  0  0  0\n  4 13  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6 10  2  0  0  0  0\n  8 14  1  0  0  0  0\n  9 15  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 16  1  0  0  0  0\n 12 14  2  0  0  0  0\n 13 17  1  0  0  0  0\n 13 15  2  0  0  0  0\n 14 18  1  0  0  0  0\n 15 19  1  0  0  0  0\n 16 20  2  0  0  0  0\n 17 23  2  0  0  0  0\n 18 21  2  0  0  0  0\n 19 22  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)nc(-c3ccc(-c4nc5ccccc5o4)s3)o2",
        "formula": "C18H10N2O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "318.351",
        "optical_activity": "NONE",
        "references": [
          "976ac22c-3c82-4166-b299-19c9a25942f5",
          "0ac3b1ac-2aa6-4243-a1ff-6164c8f05442"
        ],
        "stereo_centers": 0
      },
      "unii": "P104CN84X2"
    }
  ]
}