{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "328ae690-6f5d-4a44-92a4-43c1baf24286",
          "code": "68123-13-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=68123-13-7",
          "code_system": "CAS",
          "references": [
            "3cd8c09d-295c-44e3-9413-6a0bbb1edb97",
            "af7f9cb6-1cfb-4e5a-9a22-24f09960c540"
          ]
        },
        {
          "uuid": "48d5d196-f53b-44e4-81ad-eda6d032c30b",
          "code": "C065730",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67065730",
          "code_system": "MESH",
          "references": [
            "3cd8c09d-295c-44e3-9413-6a0bbb1edb97"
          ]
        },
        {
          "uuid": "aee3a8a4-1369-47b4-bc1a-c2d63d1525da",
          "code": "268-544-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.062.294",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "3cd8c09d-295c-44e3-9413-6a0bbb1edb97"
          ]
        },
        {
          "uuid": "f2a3421e-afce-4df1-13fb-792b86cc44c9",
          "code": "93377",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/93377",
          "code_system": "PUBCHEM",
          "references": [
            "330eeab3-5368-dce9-8523-01e0c80025d5"
          ]
        },
        {
          "uuid": "896c6e2c-a5ab-4517-8a51-9d9c3e206c9d",
          "code": "P0U7VBC51E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "029dba9d-1802-6a20-3418-93c720f1232d",
          "code": "DTXSID60874042",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60874042",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "88035943-6e35-48ce-bc11-0ae3db65bb45",
          "name": "ARIANOR STEEL BLUE 306004",
          "stdName": "ARIANOR STEEL BLUE 306004",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b8cdac4-45a6-4e2e-9538-a5b0f2214d90",
            "c7d3e086-d8b1-498e-b2e6-20eb007c2b57"
          ],
          "display_name": false
        },
        {
          "uuid": "36b40260-1f82-44f8-bad1-2d3ca2e1ccbc",
          "name": "BASIC BLUE 99",
          "stdName": "BASIC BLUE 99",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b8cdac4-45a6-4e2e-9538-a5b0f2214d90",
            "c7d3e086-d8b1-498e-b2e6-20eb007c2b57",
            "bf0de799-cd18-46b7-8cdb-035518174b5d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "6db62755-f57a-43d3-a3b9-2cfb8dcf958d",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "fb3fd142-2984-49f6-aeb8-3732e8da5304",
          "name": "BENZENAMINIUM, 3-((4-AMINO-6-BROMO-5,8-DIHYDRO-1-HYDROXY-8-IMINO-5-OXO-2-NAPHTHALENYL)AMINO)-N,N,N-TRIMETHYL-, CHLORIDE",
          "stdName": "BENZENAMINIUM, 3-((4-AMINO-6-BROMO-5,8-DIHYDRO-1-HYDROXY-8-IMINO-5-OXO-2-NAPHTHALENYL)AMINO)-N,N,N-TRIMETHYL-, CHLORIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7d3e086-d8b1-498e-b2e6-20eb007c2b57",
            "56ac917f-46b6-4c36-b77c-69d1d080dbfb"
          ],
          "display_name": false
        },
        {
          "uuid": "5ff44fa8-8e29-44fe-893f-a8358c64fe2d",
          "name": "BENZENAMINIUM, 3-((4-AMINO-6-BROMO-5,8-DIHYDRO-1-HYDROXY-8-IMINO-5-OXO-2-NAPHTHALENYL)AMINO)-N,N,N-TRIMETHYL-, CHLORIDE (1:1)",
          "stdName": "BENZENAMINIUM, 3-((4-AMINO-6-BROMO-5,8-DIHYDRO-1-HYDROXY-8-IMINO-5-OXO-2-NAPHTHALENYL)AMINO)-N,N,N-TRIMETHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c7d3e086-d8b1-498e-b2e6-20eb007c2b57",
            "56ac917f-46b6-4c36-b77c-69d1d080dbfb"
          ],
          "display_name": false
        },
        {
          "uuid": "2b198245-0d1a-4898-8627-0c918e17aab2",
          "name": "C.I. BASIC BLUE 99",
          "stdName": "C.I. BASIC BLUE 99",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b18f5fb4-5888-4878-9b0e-92fb2a1f80f9"
          ],
          "display_name": false
        },
        {
          "uuid": "a844d042-530e-44dd-b3a7-e27ff3e1ce6c",
          "name": "CI 56059",
          "stdName": "CI 56059",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b8cdac4-45a6-4e2e-9538-a5b0f2214d90",
            "c7d3e086-d8b1-498e-b2e6-20eb007c2b57"
          ],
          "display_name": false
        },
        {
          "uuid": "710d33f5-7ac9-4837-ac67-689e304b4c9e",
          "name": "JAROCOL STEEL BLUE",
          "stdName": "JAROCOL STEEL BLUE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b8cdac4-45a6-4e2e-9538-a5b0f2214d90",
            "c7d3e086-d8b1-498e-b2e6-20eb007c2b57"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b18f5fb4-5888-4878-9b0e-92fb2a1f80f9",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7b8cdac4-45a6-4e2e-9538-a5b0f2214d90",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7d3e086-d8b1-498e-b2e6-20eb007c2b57",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "56ac917f-46b6-4c36-b77c-69d1d080dbfb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3cd8c09d-295c-44e3-9413-6a0bbb1edb97",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "40564b54-0a82-4ef6-af9e-a76829ee06c1",
          "citation": "SRS import [P0U7VBC51E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=P0U7VBC51E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390994000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b7e41f4-8cbb-455d-bdb5-e729045db6dd",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf0de799-cd18-46b7-8cdb-035518174b5d",
          "citation": "BASIC BLUE 99 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "330eeab3-5368-dce9-8523-01e0c80025d5",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "af7f9cb6-1cfb-4e5a-9a22-24f09960c540",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f195c2b8-fc88-4667-ba2a-17eea04b4c61",
          "id": "f195c2b8-fc88-4667-ba2a-17eea04b4c61",
          "molfile": "\n  Marvin  01132112322D          \n\n  1  0  0  0  0  0            999 V2000\n    9.8969   -5.6144    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6ab15097-4797-4f3b-9637-fcc52fa5531b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "975ffec6-077d-48e9-ba4a-3ec558c33bc9",
          "id": "975ffec6-077d-48e9-ba4a-3ec558c33bc9",
          "molfile": "\n  Marvin  01132107522D          \n\n 26 28  0  0  0  0            999 V2000\n    9.3299   -2.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3299   -3.2304    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   10.1478   -3.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3299   -4.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6189   -3.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9078   -3.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -3.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -4.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9078   -4.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9078   -5.7399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -6.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -6.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -7.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -8.2494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7748   -6.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -7.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -8.2494    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.3529   -6.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6464   -7.4129    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    4.3529   -6.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -5.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -4.9034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7748   -6.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -5.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -4.9034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6189   -4.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  2  1  0  0  0  0\n  2  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 26  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 26  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 11 24  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n 13 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 23  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 21  1  0  0  0  0\n 21 23  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\nM  CHG  2   2   1  17  -1\nM  END",
          "smiles": "C[N+](C)(C)c1cccc(c1)NC2=CC(=N)c3c(c(cc(c3[O-])Br)N)C2=O",
          "formula": "C19H19BrN4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a07392fd-b059-441d-8faf-ee821401afae"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "415.284",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6434eea8-089b-41fd-a039-83b14dd29d90",
      "version": "8",
      "structure": {
        "id": "a0446701-9da1-4175-b2e2-2d6ed1d123dc",
        "molfile": "\n  Marvin  01132108192D          \n\n 27 28  0  0  0  0            999 V2000\n    9.8969   -5.6144    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n    5.7748   -6.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7748   -6.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -7.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -8.2494    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3529   -6.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3529   -6.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -5.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0638   -4.9034    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6464   -7.4129    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -7.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -8.2494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -6.9946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -6.1582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -5.7399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4859   -4.9034    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9078   -5.7399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9078   -4.9034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6189   -4.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6189   -3.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3299   -3.2304    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n    9.3299   -2.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1478   -3.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3299   -4.0437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9078   -3.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -3.6487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1968   -4.4851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  8  2  0  0  0  0\n 10  6  1  0  0  0  0\n 11  3  2  0  0  0  0\n 12 11  1  0  0  0  0\n 11 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15  2  2  0  0  0  0\n 16 15  1  0  0  0  0\n 17 14  1  0  0  0  0\n 18 17  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 21  1  0  0  0  0\n 24 21  1  0  0  0  0\n 20 25  1  0  0  0  0\n 25 26  2  0  0  0  0\n 26 27  1  0  0  0  0\n 27 18  2  0  0  0  0\nM  CHG  2   1  -1  21   1\nM  END",
        "smiles": "C[N+](C)(C)c1cccc(c1)Nc2cc(c3c(C(=N)C=C(C3=O)Br)c2O)N.[Cl-]",
        "formula": "C19H20BrN4O2.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "451.7449",
        "optical_activity": "NONE",
        "references": [
          "9b7e41f4-8cbb-455d-bdb5-e729045db6dd",
          "40564b54-0a82-4ef6-af9e-a76829ee06c1"
        ],
        "stereo_centers": 0
      },
      "unii": "P0U7VBC51E"
    }
  ]
}